{ "glytoucan_ac": "G07483YN", "number_monosaccharides": 7, "number_monosaccharides_suffix": "", "mass": 1259.47, "mass_pme": 1567.81, "tool_support": { "gnome_glygen_oglycans": "no", "sandbox": "yes", "gnome_glygen": "yes", "gnome": "yes", "gnome_glycotree_oglycans": "no", "pdb": "yes", "gnome_glygen_nglycans": "yes", "gnome_glycotree_nglycans": "yes" }, "fully_determined": "yes", "missing_score": 0, "glycan_type": "Saccharide", "iupac": "\u03b2-D-GlcpNAc-(1\u21922)-\u03b1-D-Manp-(1\u21923)[\u03b1-D-Manp-(1\u21926)]-\u03b2-D-Manp-(1\u21924)-\u03b2-D-GlcpNAc-(1\u21924)[\u03b1-L-Fucp-(1\u21926)]-\u03b2-D-GlcpNAc-(1\u2192", "wurcs": "WURCS=2.0/4,7,6/[a2122h-1b_1-5_2*NCC/3=O][a1122h-1b_1-5][a1122h-1a_1-5][a1221m-1a_1-5]/1-1-2-3-1-3-4/a4-b1_a6-g1_b4-c1_c3-d1_c6-f1_d2-e1", "glycoct": "RES 1b:b-dglc-HEX-1:5 2s:n-acetyl 3b:b-dglc-HEX-1:5 4s:n-acetyl 5b:b-dman-HEX-1:5 6b:a-dman-HEX-1:5 7b:b-dglc-HEX-1:5 8s:n-acetyl 9b:a-dman-HEX-1:5 10b:a-lgal-HEX-1:5|6:d LIN 1:1d(2+1)2n 2:1o(4+1)3d 3:3d(2+1)4n 4:3o(4+1)5d 5:5o(3+1)6d 6:6o(2+1)7d 7:7d(2+1)8n 8:5o(6+1)9d 9:1o(6+1)10d", "inchi": "InChI=1S/C48H81N3O35/c1-11-24(59)32(67)35(70)45(76-11)75-10-20-39(30(65)21(42(73)77-20)49-12(2)56)83-44-23(51-14(4)58)31(66)38(18(8-55)81-44)84-47-37(72)40(28(63)19(82-47)9-74-46-36(71)33(68)26(61)16(6-53)79-46)85-48-41(34(69)27(62)17(7-54)80-48)86-43-22(50-13(3)57)29(64)25(60)15(5-52)78-43/h11,15-48,52-55,59-73H,5-10H2,1-4H3,(H,49,56)(H,50,57)(H,51,58)/t11-,15+,16+,17+,18+,19+,20+,21+,22+,23+,24+,25+,26+,27+,28+,29+,30+,31+,32+,33-,34-,35-,36-,37-,38+,39+,40-,41-,42+,43-,44-,45+,46-,47-,48+/m0/s1", "glycam": "DGlcpNAcb1-2DManpa1-3[DManpa1-6]DManpb1-4DGlcpNAcb1-4[LFucpa1-6]DGlcpNAcb1-OH", "smiles_isomeric": "C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)O)NC(=O)C)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O[C@H]4[C@H]([C@H]([C@@H]([C@H](O4)CO[C@@H]5[C@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)O)O[C@@H]6[C@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)NC(=O)C)O)O)NC(=O)C)O)O)O", "inchi_key": { "key": "JFEMCTLUNMFSPE-XMHUBXGFSA-N", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/JFEMCTLUNMFSPE-XMHUBXGFSA-N" }, "byonic": "HexNAc(3)Hex(3)dHex(1) % 1259.46506189", "gwb": "freeEnd--1b1D-GlcNAc,p(--4b1D-GlcNAc,p--4b1D-Man,p(--3a1D-Man,p--2b1D-GlcNAc,p)--6a1D-Man,p)--6a1L-Fuc,p$MONO,Und,0,0,freeEnd", "species": [ { "taxid": 7227, "name": "Drosophila melanogaster", "annotation_category": "direct", "evidence": [ { "database": "GlyConnect", "id": "678", "url": "https://glyconnect.expasy.org/browser/structures/678" }, { "database": "GlyCosmos", "id": "G07483YN", "url": "https://glycosmos.org/glycans/show/G07483YN" }, { "database": "PubMed", "id": "16339150", "url": "https://glygen.org/publication/PubMed/16339150" } ], "common_name": "Fruit fly", "glygen_name": "Fruit fly", "reference_species": "Drosophila melanogaster [7227]" }, { "taxid": 9606, "name": "Homo sapiens", "annotation_category": "direct", "evidence": [ { "database": "GlyConnect", "id": "678", "url": "https://glyconnect.expasy.org/browser/structures/678" }, { "database": "GlyCosmos", "id": "G07483YN", "url": "https://glycosmos.org/glycans/show/G07483YN" }, { "database": "PubMed", "id": "10207177", "url": "https://glygen.org/publication/PubMed/10207177" }, { "database": "PubMed", "id": "10929010", "url": "https://glygen.org/publication/PubMed/10929010" }, { "database": "PubMed", "id": "2363690", "url": "https://glygen.org/publication/PubMed/2363690" }, { "database": "PubMed", "id": "32841605", "url": "https://glygen.org/publication/PubMed/32841605" }, { "database": "PubMed", "id": "33383989", "url": "https://glygen.org/publication/PubMed/33383989" }, { "database": "PubMed", "id": "34207636", "url": "https://glygen.org/publication/PubMed/34207636" }, { "database": "PubMed", "id": "7514386", "url": "https://glygen.org/publication/PubMed/7514386" }, { "database": "PubMed", "id": "7881178", "url": "https://glygen.org/publication/PubMed/7881178" }, { "database": "PubMed", "id": "8142896", "url": "https://glygen.org/publication/PubMed/8142896" }, { "database": "UniCarbKB", "id": "GLY_000341", "url": "http://data.glygen.org/GLY_000341" } ], "common_name": "Human", "glygen_name": "Human", "reference_species": "Homo sapiens [9606]" }, { "taxid": 10090, "name": "Mus musculus", "annotation_category": "direct", "evidence": [ { "database": "GlyConnect", "id": "678", "url": "https://glyconnect.expasy.org/browser/structures/678" }, { "database": "GlyCosmos", "id": "G07483YN", "url": "https://glycosmos.org/glycans/show/G07483YN" }, { "database": "PubMed", "id": "7906504", "url": "https://glygen.org/publication/PubMed/7906504" }, { "database": "PubMed", "id": "9083032", "url": "https://glygen.org/publication/PubMed/9083032" } ], "common_name": "Mouse", "glygen_name": "Mouse", "reference_species": "Mus musculus [10090]" }, { "taxid": 10116, "name": "Rattus norvegicus", "annotation_category": "direct", "evidence": [ { "database": "GlyConnect", "id": "678", "url": "https://glyconnect.expasy.org/browser/structures/678" }, { "database": "GlyCosmos", "id": "G07483YN", "url": "https://glycosmos.org/glycans/show/G07483YN" }, { "database": "PubMed", "id": "10207177", "url": "https://glygen.org/publication/PubMed/10207177" }, { "database": "PubMed", "id": "33242084", "url": "https://glygen.org/publication/PubMed/33242084" } ], "common_name": "Rat", "glygen_name": "Rat", "reference_species": "Rattus norvegicus [10116]" } ], "classification": [ { "type": { "name": "N-linked", "url": "" }, "subtype": { "name": "Core-fucosylated" } } ], "enzyme": [ { "uniprot_canonical_ac": "P42867-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07483YN", "protein_name": "UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase", "gene": "Dpagt1", "gene_link": "https://www.uniprot.org/uniprot/P42867", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G07483YN", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07483YN" } ] }, { "uniprot_canonical_ac": "Q9H3H5-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07483YN", "protein_name": "UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase", "gene": "DPAGT1", "gene_link": "https://www.uniprot.org/uniprot/Q9H3H5", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G07483YN", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07483YN" } ] }, { "uniprot_canonical_ac": "Q8BML3-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07483YN", "protein_name": "UDP-N-acetylglucosamine transferase subunit ALG13", "gene": "Glt28d2", "gene_link": "https://www.uniprot.org/uniprot/Q8BML3", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G07483YN", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07483YN" } ] }, { "uniprot_canonical_ac": "Q96F25-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07483YN", "protein_name": "UDP-N-acetylglucosamine transferase subunit ALG14", "gene": "ALG14", "gene_link": "https://www.uniprot.org/uniprot/Q96F25", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G07483YN", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07483YN" } ] }, { "uniprot_canonical_ac": "Q9D081-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07483YN", "protein_name": "UDP-N-acetylglucosamine transferase subunit ALG14", "gene": "Alg14", "gene_link": "https://www.uniprot.org/uniprot/Q9D081", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G07483YN", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07483YN" } ] }, { "uniprot_canonical_ac": "Q9D8C3-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07483YN", "protein_name": "UDP-N-acetylglucosamine transferase subunit ALG13", "gene": "Alg13", "gene_link": "https://www.uniprot.org/uniprot/Q9D8C3", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G07483YN", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07483YN" } ] }, { "uniprot_canonical_ac": "Q9NP73-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07483YN", "protein_name": "UDP-N-acetylglucosamine transferase subunit ALG13", "gene": "ALG13", "gene_link": "https://www.uniprot.org/uniprot/Q9NP73", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G07483YN", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07483YN" } ] }, { "uniprot_canonical_ac": "Q921Q3-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07483YN", "protein_name": "Chitobiosyldiphosphodolichol beta-mannosyltransferase", "gene": "Alg1", "gene_link": "https://www.uniprot.org/uniprot/Q921Q3", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G07483YN", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07483YN" } ] }, { "uniprot_canonical_ac": "Q9BT22-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07483YN", "protein_name": "Chitobiosyldiphosphodolichol beta-mannosyltransferase", "gene": "ALG1", "gene_link": "https://www.uniprot.org/uniprot/Q9BT22", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G07483YN", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07483YN" } ] }, { "uniprot_canonical_ac": "Q9DBE8-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07483YN", "protein_name": "Alpha-1,3/1,6-mannosyltransferase ALG2", "gene": "Alg2", "gene_link": "https://www.uniprot.org/uniprot/Q9DBE8", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G07483YN", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07483YN" } ] }, { "uniprot_canonical_ac": "Q9H553-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07483YN", "protein_name": "Alpha-1,3/1,6-mannosyltransferase ALG2", "gene": "ALG2", "gene_link": "https://www.uniprot.org/uniprot/Q9H553", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G07483YN", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07483YN" } ] }, { "uniprot_canonical_ac": "P26572-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07483YN", "protein_name": "Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase", "gene": "MGAT1", "gene_link": "https://www.uniprot.org/uniprot/P26572", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G07483YN", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07483YN" } ] }, { "uniprot_canonical_ac": "P27808-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07483YN", "protein_name": "Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase", "gene": "Mgat1", "gene_link": "https://www.uniprot.org/uniprot/P27808", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G07483YN", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07483YN" } ] }, { "uniprot_canonical_ac": "Q9BYC5-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07483YN", "protein_name": "Alpha-(1,6)-fucosyltransferase", "gene": "FUT8", "gene_link": "https://www.uniprot.org/uniprot/Q9BYC5", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G07483YN", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07483YN" } ] }, { "uniprot_canonical_ac": "Q9WTS2-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07483YN", "protein_name": "Alpha-(1,6)-fucosyltransferase", "gene": "Fut8", "gene_link": "https://www.uniprot.org/uniprot/Q9WTS2", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G07483YN", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07483YN" } ] } ], "crossref": [ { "id": "91857605", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91857605", "database": "PubChem Compound", "categories": [ "Chemical" ] }, { "id": "252290840", "url": "https://pubchem.ncbi.nlm.nih.gov/substance/252290840", "database": "PubChem Substance", "categories": [ "Chemical" ] }, { "id": "1487", "url": "", "database": "UniCarbKB", "categories": [ "Glycoproteomics" ] }, { "id": "7800", "url": "", "database": "UniCarbKB", "categories": [ "Glycoproteomics" ] }, { "id": "G10770", "url": "https://www.genome.jp/dbget-bin/www_bget?gl:G10770", "database": "KEGG Glycan", "categories": [ "Enzyme and Pathway" ] }, { "id": "23316", "url": "", "database": "Glycosciences.de", "categories": [ "Glycomics" ] }, { "id": "24706", "url": "", "database": "Glycosciences.de", "categories": [ "Glycomics" ] }, { "id": "24709", "url": "", "database": "Glycosciences.de", "categories": [ "Glycomics" ] }, { "id": "3415", "url": "", "database": "Glycosciences.de", "categories": [ "Glycomics" ] }, { "id": "6439", "url": "", "database": "Glycosciences.de", "categories": [ "Glycomics" ] }, { "id": "678", "url": "https://glyconnect.expasy.org/browser/structures/678", "database": "GlyConnect", "categories": [ "Glycoproteomics", "Glycomics" ] }, { "id": "11715", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+11715", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "45809", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+45809", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "5087", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+5087", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "7080", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+7080", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "7756", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+7756", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "7757", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+7757", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "7758", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+7758", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "147161", "url": "https://www.ebi.ac.uk/chebi/searchId.do?chebiId=147161", "database": "ChEBI", "categories": [] }, { "id": "G07483YN", "url": "https://glytoucan.org/Structures/Glycans/G07483YN", "database": "GlyTouCan", "categories": [ "Glycomics" ] }, { "id": "G07483YN", "url": "https://sandbox.glyomics.org/explore.html?G07483YN", "database": "SandBox", "categories": [ "Enzyme and Pathway" ] }, { "id": "G07483YN", "url": "https://gnome.glyomics.org/restrictions/GlyGen.StructureBrowser.html?focus=G07483YN", "database": "GNOme", "categories": [ "Ontology and Dictionary", "Glycomics" ] }, { "id": "G07483YN", "url": "https://glycosmos.org/glycans/show/G07483YN", "database": "GlyCosmos", "categories": [ "Glycoproteomics", "Glycomics" ] } ], "glycoprotein": [ { "uniprot_canonical_ac": "P15260-1", "start_pos": 179, "end_pos": 179, "residue": "Asn", "evidence": [ { "database": "PubMed", "id": "8142896", "url": "https://glygen.org/publication/PubMed/8142896" }, { "database": "UniCarbKB", "id": "GLY_000040", "url": "http://data.glygen.org/GLY_000040" } ], "protein_name": "Interferon gamma receptor 1", "gene_name": "IFNGR1", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P13987-1", "start_pos": 43, "end_pos": 43, "residue": "Asn", "evidence": [ { "database": "PubMed", "id": "7514386", "url": "https://glygen.org/publication/PubMed/7514386" }, { "database": "UniCarbKB", "id": "GLY_000040", "url": "http://data.glygen.org/GLY_000040" }, { "database": "PubMed", "id": "10207177", "url": "https://glygen.org/publication/PubMed/10207177" } ], "protein_name": "CD59 glycoprotein", "gene_name": "CD59", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P15260-1", "start_pos": 86, "end_pos": 86, "residue": "Asn", "evidence": [ { "database": "PubMed", "id": "8142896", "url": "https://glygen.org/publication/PubMed/8142896" }, { "database": "UniCarbKB", "id": "GLY_000040", "url": "http://data.glygen.org/GLY_000040" } ], "protein_name": "Interferon gamma receptor 1", "gene_name": "IFNGR1", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P15260-1", "start_pos": 79, "end_pos": 79, "residue": "Asn", "evidence": [ { "database": "PubMed", "id": "8142896", "url": "https://glygen.org/publication/PubMed/8142896" }, { "database": "UniCarbKB", "id": "GLY_000040", "url": "http://data.glygen.org/GLY_000040" } ], "protein_name": "Interferon gamma receptor 1", "gene_name": "IFNGR1", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P15260-1", "start_pos": 34, "end_pos": 34, "residue": "Asn", "evidence": [ { "database": "PubMed", "id": "8142896", "url": "https://glygen.org/publication/PubMed/8142896" }, { "database": "UniCarbKB", "id": "GLY_000040", "url": "http://data.glygen.org/GLY_000040" } ], "protein_name": "Interferon gamma receptor 1", "gene_name": "IFNGR1", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P01860-2", "evidence": [ { "database": "PubMed", "id": "2363690", "url": "https://glygen.org/publication/PubMed/2363690" }, { "database": "GlyConnect", "id": "1385", "url": "https://glyconnect.expasy.org/browser/proteins/1385" }, { "database": "GlyConnect", "id": "233", "url": "https://glyconnect.expasy.org/browser/proteins/233" } ], "protein_name": "Immunoglobulin heavy constant gamma 3", "gene_name": "IGHG3", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P01861-2", "evidence": [ { "database": "PubMed", "id": "2363690", "url": "https://glygen.org/publication/PubMed/2363690" }, { "database": "GlyConnect", "id": "233", "url": "https://glyconnect.expasy.org/browser/proteins/233" } ], "protein_name": "Immunoglobulin heavy constant gamma 4", "gene_name": "IGHG4", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P01859-2", "evidence": [ { "database": "PubMed", "id": "2363690", "url": "https://glygen.org/publication/PubMed/2363690" }, { "database": "GlyConnect", "id": "233", "url": "https://glyconnect.expasy.org/browser/proteins/233" } ], "protein_name": "Immunoglobulin heavy constant gamma 2", "gene_name": "IGHG2", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P01857-2", "evidence": [ { "database": "PubMed", "id": "2363690", "url": "https://glygen.org/publication/PubMed/2363690" }, { "database": "GlyConnect", "id": "233", "url": "https://glyconnect.expasy.org/browser/proteins/233" } ], "protein_name": "Immunoglobulin heavy constant gamma 1", "gene_name": "IGHG1", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P01859-2", "start_pos": 176, "end_pos": 176, "residue": "Asn", "evidence": [ { "database": "PubMed", "id": "2363690", "url": "https://glygen.org/publication/PubMed/2363690" }, { "database": "GlyConnect", "id": "688", "url": "https://glyconnect.expasy.org/browser/proteins/688" } ], "protein_name": "Immunoglobulin heavy constant gamma 2", "gene_name": "IGHG2", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P08100-1", "evidence": [ { "database": "PubMed", "id": "7881178", "url": "https://glygen.org/publication/PubMed/7881178" }, { "database": "GlyConnect", "id": "525", "url": "https://glyconnect.expasy.org/browser/proteins/525" } ], "protein_name": "Rhodopsin", "gene_name": "RHO", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P15260-1", "evidence": [ { "database": "PubMed", "id": "8142896", "url": "https://glygen.org/publication/PubMed/8142896" }, { "database": "GlyConnect", "id": "294", "url": "https://glyconnect.expasy.org/browser/proteins/294" } ], "protein_name": "Interferon gamma receptor 1", "gene_name": "IFNGR1", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P02787-1", "evidence": [ { "database": "PubMed", "id": "10929010", "url": "https://glygen.org/publication/PubMed/10929010" }, { "database": "GlyConnect", "id": "558", "url": "https://glyconnect.expasy.org/browser/proteins/558" } ], "protein_name": "Serotransferrin", "gene_name": "TF", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "Q9BYF1-1", "evidence": [ { "database": "PubMed", "id": "32841605", "url": "https://glygen.org/publication/PubMed/32841605" }, { "database": "GlyConnect", "id": "1012", "url": "https://glyconnect.expasy.org/browser/proteins/1012" } ], "protein_name": "Angiotensin-converting enzyme 2", "gene_name": "ACE2", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P10252-1", "evidence": [ { "database": "PubMed", "id": "10207177", "url": "https://glygen.org/publication/PubMed/10207177" }, { "database": "GlyConnect", "id": "371", "url": "https://glyconnect.expasy.org/browser/proteins/371" } ], "protein_name": "CD48 antigen", "gene_name": "Cd48", "tax_id": 10116, "tax_name": "Rattus norvegicus", "tax_common_name": "Rat" } ], "publication": [ { "title": "Structural analysis and localization of the carbohydrate moieties of a soluble human interferon gamma receptor produced in baculovirus-infected insect cells.", "journal": "Protein science : a publication of the Protein Society", "date": "1994", "authors": "Manneberg M, Friedlein A, Kurth H, Lahm HW, Fountoulakis M", "evidence": [ { "database": "UniCarbKB", "id": "GLY_000040", "url": "http://data.glygen.org/GLY_000040" }, { "database": "GlyTouCan", "id": "G07483YN", "url": "https://glytoucan.org/Structures/Glycans/G07483YN" }, { "database": "GlyConnect", "id": "294", "url": "https://glyconnect.expasy.org/browser/proteins/294" } ], "reference": [ { "type": "PubMed", "id": "8142896", "url": "https://glygen.org/publication/PubMed/8142896" } ] }, { "title": "Structural study on the glycosyl-phosphatidylinositol anchor and the asparagine-linked sugar chain of a soluble form of CD59 in human urine.", "journal": "Archives of biochemistry and biophysics", "date": "1994", "authors": "Nakano Y, Noda K, Endo T, Kobata A, Tomita M", "evidence": [ { "database": "UniCarbKB", "id": "GLY_000040", "url": "http://data.glygen.org/GLY_000040" }, { "database": "GlyTouCan", "id": "G07483YN", "url": "https://glytoucan.org/Structures/Glycans/G07483YN" } ], "reference": [ { "type": "PubMed", "id": "7514386", "url": "https://glygen.org/publication/PubMed/7514386" } ] }, { "title": "Oligosaccharide analysis and molecular modeling of soluble forms of glycoproteins belonging to the Ly-6, scavenger receptor, and immunoglobulin superfamilies expressed in Chinese hamster ovary cells.", "journal": "Glycobiology", "date": "1999", "authors": "Rudd PM, Wormald MR, Harvey DJ, Devasahayam M, McAlister MS, Brown MH, Davis SJ, Barclay AN, Dwek RA", "evidence": [ { "database": "UniCarbKB", "id": "GLY_000040", "url": "http://data.glygen.org/GLY_000040" }, { "database": "GlyTouCan", "id": "G07483YN", "url": "https://glytoucan.org/Structures/Glycans/G07483YN" }, { "database": "GlyConnect", "id": "371", "url": "https://glyconnect.expasy.org/browser/proteins/371" } ], "reference": [ { "type": "PubMed", "id": "10207177", "url": "https://glygen.org/publication/PubMed/10207177" } ] }, { "title": "What Can N-glycomics and N-glycoproteomics of Cerebrospinal Fluid Tell Us about Alzheimer Disease?", "journal": "Biomolecules", "date": "2021", "authors": "Gaunitz S, Tjernberg LO, Schedin-Weiss S", "evidence": [ { "database": "UniCarbKB", "id": "GLY_000611", "url": "http://data.glygen.org/GLY_000611" }, { "database": "GlyTouCan", "id": "G07483YN", "url": "https://glytoucan.org/Structures/Glycans/G07483YN" } ], "reference": [ { "type": "PubMed", "id": "34207636", "url": "https://glygen.org/publication/PubMed/34207636" } ] }, { "title": "The Drosophila fused lobes gene encodes an N-acetylglucosaminidase involved in N-glycan processing.", "journal": "The Journal of biological chemistry", "date": "2006", "authors": "Leonard R, Rendic D, Rabouille C, Wilson IB, Preat T, Altmann F", "evidence": [ { "database": "GlyTouCan", "id": "G07483YN", "url": "https://glytoucan.org/Structures/Glycans/G07483YN" }, { "database": "GlyConnect", "id": "678", "url": "https://glyconnect.expasy.org/browser/structures/678" } ], "reference": [ { "type": "PubMed", "id": "16339150", "url": "https://glygen.org/publication/PubMed/16339150" } ] }, { "title": "N-glycan patterns of human transferrin produced in Trichoplusia ni insect cells: effects of mammalian galactosyltransferase.", "journal": "Glycobiology", "date": "2000", "authors": "Ailor E, Takahashi N, Tsukamoto Y, Masuda K, Rahman BA, Jarvis DL, Lee YC, Betenbaugh MJ", "evidence": [ { "database": "GlyTouCan", "id": "G07483YN", "url": "https://glytoucan.org/Structures/Glycans/G07483YN" }, { "database": "GlyConnect", "id": "558", "url": "https://glyconnect.expasy.org/browser/proteins/558" } ], "reference": [ { "type": "PubMed", "id": "10929010", "url": "https://glygen.org/publication/PubMed/10929010" } ] }, { "title": "A comparative study of the N-linked oligosaccharide structures of human IgG subclass proteins.", "journal": "The Biochemical journal", "date": "1990", "authors": "Jefferis R, Lund J, Mizutani H, Nakagawa H, Kawazoe Y, Arata Y, Takahashi N", "evidence": [ { "database": "GlyTouCan", "id": "G07483YN", "url": "https://glytoucan.org/Structures/Glycans/G07483YN" }, { "database": "GlyConnect", "id": "1385", "url": "https://glyconnect.expasy.org/browser/proteins/1385" }, { "database": "GlyConnect", "id": "233", "url": "https://glyconnect.expasy.org/browser/proteins/233" } ], "reference": [ { "type": "PubMed", "id": "2363690", "url": "https://glygen.org/publication/PubMed/2363690" } ] }, { "title": "Virus-Receptor Interactions of Glycosylated SARS-CoV-2 Spike and Human ACE2 Receptor.", "journal": "Cell host & microbe", "date": "2020", "authors": "Zhao P, Praissman JL, Grant OC, Cai Y, Xiao T, Rosenbalm KE, Aoki K, Kellman BP, Bridger R, Barouch DH, Brindley MA, Lewis NE, Tiemeyer M, Chen B, Woods RJ, Wells L", "evidence": [ { "database": "GlyTouCan", "id": "G07483YN", "url": "https://glytoucan.org/Structures/Glycans/G07483YN" }, { "database": "GlyConnect", "id": "1012", "url": "https://glyconnect.expasy.org/browser/proteins/1012" } ], "reference": [ { "type": "PubMed", "id": "32841605", "url": "https://glygen.org/publication/PubMed/32841605" } ] }, { "title": "Bisecting GlcNAc Protein N-Glycosylation Is Characteristic of Human Adipogenesis.", "journal": "Journal of proteome research", "date": "2021", "authors": "Wongtrakul-Kish K, Herbert BR, Packer NH", "evidence": [ { "database": "GlyTouCan", "id": "G07483YN", "url": "https://glytoucan.org/Structures/Glycans/G07483YN" }, { "database": "GlyConnect", "id": "678", "url": "https://glyconnect.expasy.org/browser/structures/678" } ], "reference": [ { "type": "PubMed", "id": "33383989", "url": "https://glygen.org/publication/PubMed/33383989" } ] }, { "title": "Structural studies of the N-linked sugar chains of human rhodopsin.", "journal": "Glycobiology", "date": "1994", "authors": "Fujita S, Endo T, Ju J, Kean EL, Kobata A", "evidence": [ { "database": "GlyTouCan", "id": "G07483YN", "url": "https://glytoucan.org/Structures/Glycans/G07483YN" }, { "database": "GlyConnect", "id": "525", "url": "https://glyconnect.expasy.org/browser/proteins/525" } ], "reference": [ { "type": "PubMed", "id": "7881178", "url": "https://glygen.org/publication/PubMed/7881178" } ] }, { "title": "Structural characterization of the N-glycans of a humanized anti-CD18 murine immunoglobulin G.", "journal": "Archives of biochemistry and biophysics", "date": "1994", "authors": "Ip CC, Miller WJ, Silberklang M, Mark GE, Ellis RW, Huang L, Glushka J, Van Halbeek H, Zhu J, Alhadeff JA", "evidence": [ { "database": "GlyTouCan", "id": "G07483YN", "url": "https://glytoucan.org/Structures/Glycans/G07483YN" }, { "database": "GlyConnect", "id": "223", "url": "https://glyconnect.expasy.org/browser/proteins/223" } ], "reference": [ { "type": "PubMed", "id": "7906504", "url": "https://glygen.org/publication/PubMed/7906504" } ] }, { "title": "Differential N-glycan patterns of secreted and intracellular IgG produced in Trichoplusia ni cells.", "journal": "The Journal of biological chemistry", "date": "1997", "authors": "Hsu TA, Takahashi N, Tsukamoto Y, Kato K, Shimada I, Masuda K, Whiteley EM, Fan JQ, Lee YC, Betenbaugh MJ", "evidence": [ { "database": "GlyTouCan", "id": "G07483YN", "url": "https://glytoucan.org/Structures/Glycans/G07483YN" }, { "database": "GlyConnect", "id": "256", "url": "https://glyconnect.expasy.org/browser/proteins/256" } ], "reference": [ { "type": "PubMed", "id": "9083032", "url": "https://glygen.org/publication/PubMed/9083032" } ] }, { "title": "Post-natal developmental changes in the composition of the rat neocortical N-glycome.", "journal": "Glycobiology", "date": "2021-06-03", "authors": "Klari\u0107 Thomas S, Salopek Matija, Micek Vedran, Gornik Kljai\u0107 Olga, Lauc Gordan", "evidence": [ { "database": "GlyTouCan", "id": "G07483YN", "url": "https://glytoucan.org/Structures/Glycans/G07483YN" } ], "reference": [ { "type": "PubMed", "id": "33242084", "url": "https://glygen.org/publication/PubMed/33242084" } ] }, { "title": "Identification of N-glycans from Ebola virus glycoproteins by matrix-assisted laser desorption/ionisation time-of-flight and negative ion electrospray tandem mass spectrometry.", "journal": "Rapid communications in mass spectrometry : RCM", "date": "2010-03-15", "authors": "Ritchie Gayle, Harvey David J, Stroeher Ute, Feldmann Friederike, Feldmann Heinz, Wahl-Jensen Victoria, Royle Louise, Dwek Raymond A, Rudd Pauline M", "evidence": [ { "database": "UniCarbKB", "id": "GLY_000285", "url": "http://data.glygen.org/GLY_000285" } ], "reference": [ { "type": "PubMed", "id": "20131323", "url": "https://glygen.org/publication/PubMed/20131323" } ] } ], "residues": [ { "id": "NA", "name": "N-glycan_core_D-GlcNAc_A", "attachedby": "rxn.P42867-1", "detachedby": "", "parentid": "0" }, { "id": "NA", "name": "N-glycan_core_D-GlcNAc_A", "attachedby": "rxn.Q9H3H5-1", "detachedby": "", "parentid": "0" }, { "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "attachedby": "rxn.Q8BML3-1", "detachedby": "", "parentid": "NA" }, { "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "attachedby": "rxn.Q96F25-1", "detachedby": "", "parentid": "NA" }, { "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "attachedby": "rxn.Q9D081-1", "detachedby": "", "parentid": "NA" }, { "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "attachedby": "rxn.Q9D8C3-1", "detachedby": "", "parentid": "NA" }, { "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "attachedby": "rxn.Q9NP73-1", "detachedby": "", "parentid": "NA" }, { "id": "NC", "name": "N-glycan_core_b-D-Manp_C", "attachedby": "rxn.Q921Q3-1", "detachedby": "", "parentid": "NB" }, { "id": "NC", "name": "N-glycan_core_b-D-Manp_C", "attachedby": "rxn.Q9BT22-1", "detachedby": "", "parentid": "NB" }, { "id": "N1", "name": "N-glycan_a-D-Manp_1", "attachedby": "rxn.Q9DBE8-1", "detachedby": "", "parentid": "NC" }, { "id": "N1", "name": "N-glycan_a-D-Manp_1", "attachedby": "rxn.Q9H553-1", "detachedby": "", "parentid": "NC" }, { "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "attachedby": "rxn.P26572-1", "detachedby": "", "parentid": "N1" }, { "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "attachedby": "rxn.P27808-1", "detachedby": "", "parentid": "N1" }, { "id": "N4", "name": "N-glycan_a-D-Manp_4", "attachedby": "rxn.Q9DBE8-1", "detachedby": "", "parentid": "NC" }, { "id": "N4", "name": "N-glycan_a-D-Manp_4", "attachedby": "rxn.Q9H553-1", "detachedby": "", "parentid": "NC" }, { "id": "N15", "name": "N-glycan_a-L-Fucp_15", "attachedby": "rxn.Q9BYC5-1", "detachedby": "", "parentid": "NA" }, { "id": "N15", "name": "N-glycan_a-L-Fucp_15", "attachedby": "rxn.Q9WTS2-1", "detachedby": "", "parentid": "NA" } ], "composition": [ { "name": "6-Deoxy-Hexose", "residue": "dhex", "count": 1, "cid": "840", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840" }, { "name": "Hexose", "residue": "hex", "count": 3, "cid": "206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206" }, { "name": "N-Acetylhexosamine", "residue": "hexnac", "count": 3, "cid": "899", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899" }, { "name": "Hexuronic Acid", "residue": "hexa", "count": 0, "cid": "610", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610" }, { "name": "2-Amino-2-Deoxy-Hexose", "residue": "hexn", "count": 0, "cid": "739", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739" }, { "name": "N-Acetyl-Neuraminic Acid", "residue": "neuac", "count": 0, "cid": "439197", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197" }, { "name": "N-Glycolyl-Neuraminic Acid", "residue": "neugc", "count": 0, "cid": "440001", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001" }, { "name": "Phosphate", "residue": "p", "count": 0, "cid": "1061", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061" }, { "name": "Pentose", "residue": "pent", "count": 0, "cid": "229", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229" }, { "name": "Sulfate", "residue": "s", "count": 0, "cid": "1117", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117" }, { "name": "Other", "residue": "other", "count": 0 } ], "composition_expanded": [ { "name": "Alditol", "residue": "aldi", "count": 0 }, { "name": "6-Deoxy-Hexose", "residue": "dhex", "count": 1, "cid": "840", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840" }, { "name": "6-Deoxy-Hexitol", "residue": "dhex+aldi", "count": 0 }, { "name": "L-Fucose", "residue": "fuc", "count": 1, "cid": "17106", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/17106" }, { "name": "L-Fucitol", "residue": "fuc+aldi", "count": 0, "cid": "445724", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/445724" }, { "name": "D-Galactose", "residue": "gal", "count": 0, "cid": "6036", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6036" }, { "name": "D-Galactitol", "residue": "gal+aldi", "count": 0, "cid": "11850", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11850" }, { "name": "N-Acetyl-D-galactosamine", "residue": "galnac", "count": 0, "cid": "35717", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/35717" }, { "name": "N-Acetylgalactosaminitol", "residue": "galnac+aldi", "count": 0, "cid": "165880", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165880" }, { "name": "D-Galacturonic Acid", "residue": "gala", "count": 0, "cid": "439215", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439215" }, { "name": "D-Glucose", "residue": "glc", "count": 0, "cid": "5793", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5793" }, { "name": "D-Glucitol", "residue": "glc+aldi", "count": 0, "cid": "5780", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5780" }, { "name": "D-Glucuronic acid", "residue": "glca", "count": 0, "cid": "94715", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/94715" }, { "name": "D-Glucosamine", "residue": "glcn", "count": 0, "cid": "439213", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439213" }, { "name": "N-Acetyl-D-Glucosamine", "residue": "glcnac", "count": 3, "cid": "439174", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439174" }, { "name": "N-Acetyl-D-glucosaminitol", "residue": "glcnac+aldi", "count": 0, "cid": "165206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165206" }, { "name": "Hexose", "residue": "hex", "count": 3, "cid": "206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206" }, { "name": "N-Acetylhexosamine", "residue": "hexnac", "count": 3, "cid": "899", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899" }, { "name": "Hexuronic Acid", "residue": "hexa", "count": 0, "cid": "610", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610" }, { "name": "2-Amino-2-Deoxy-Hexose", "residue": "hexn", "count": 0, "cid": "739", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739" }, { "name": "Hexitol", "residue": "hex+aldi", "count": 0, "cid": "453", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/453" }, { "name": "N-Acetylhexosaminitol", "residue": "hexnac+aldi", "count": 0 }, { "name": "L-Iduronic acid", "residue": "idoa", "count": 0, "cid": "441039", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/441039" }, { "name": "D-Mannose", "residue": "man", "count": 3, "cid": "18950", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18950" }, { "name": "D-Mannitol", "residue": "man+aldi", "count": 0, "cid": "6251", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6251" }, { "name": "N-Acetyl-D-mannosamine", "residue": "mannac", "count": 0, "cid": "439281", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439281" }, { "name": "Methyl", "residue": "me", "count": 0 }, { "name": "N-Acetyl-Neuraminic Acid", "residue": "neuac", "count": 0, "cid": "439197", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197" }, { "name": "N-Glycolyl-Neuraminic Acid", "residue": "neugc", "count": 0, "cid": "440001", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001" }, { "name": "Phosphate", "residue": "p", "count": 0, "cid": "1061", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061" }, { "name": "Pentose", "residue": "pent", "count": 0, "cid": "229", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229" }, { "name": "Sulfate", "residue": "s", "count": 0, "cid": "1117", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117" }, { "name": "Sialic acid", "residue": "sia", "count": 0 }, { "name": "Other", "residue": "other", "count": 0 }, { "name": "Floating substituent", "residue": "x", "count": 0 }, { "name": "D-Xylose", "residue": "xyl", "count": 0, "cid": "135191", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135191" }, { "name": "Ketodeoxynononic acid", "residue": "kdn", "count": 0, "cid": "13991616", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13991616" } ], "motifs": [], "interactions": [], "expression": [ { "category": "tissue", "tissue": { "name": "cerebrospinal fluid", "namespace": "UBERON", "id": "0001359", "url": "http://purl.obolibrary.org/obo/UBERON_0001359" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "GLY_000611", "database": "UniCarbKB", "url": "http://data.glygen.org/GLY_000611" }, { "id": "34207636", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/34207636" } ] }, { "category": "tissue", "tissue": { "name": "blood serum", "namespace": "UBERON", "id": "0001977", "url": "http://purl.obolibrary.org/obo/UBERON_0001977" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "678", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/678" }, { "id": "2363690", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/2363690" } ], "uniprot_canonical_ac": "P01860-2" }, { "category": "tissue", "tissue": { "name": "blood serum", "namespace": "UBERON", "id": "0001977", "url": "http://purl.obolibrary.org/obo/UBERON_0001977" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "678", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/678" }, { "id": "2363690", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/2363690" } ], "uniprot_canonical_ac": "P01861-2" }, { "category": "tissue", "tissue": { "name": "blood serum", "namespace": "UBERON", "id": "0001977", "url": "http://purl.obolibrary.org/obo/UBERON_0001977" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "678", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/678" }, { "id": "2363690", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/2363690" } ], "uniprot_canonical_ac": "P01859-2" }, { "category": "tissue", "tissue": { "name": "blood serum", "namespace": "UBERON", "id": "0001977", "url": "http://purl.obolibrary.org/obo/UBERON_0001977" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "678", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/678" }, { "id": "2363690", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/2363690" } ], "uniprot_canonical_ac": "P01857-2" }, { "category": "tissue", "tissue": { "name": "blood serum", "namespace": "UBERON", "id": "0001977", "url": "http://purl.obolibrary.org/obo/UBERON_0001977" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "678", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/678" }, { "id": "2363690", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/2363690" } ], "start_pos": 176, "end_pos": 176, "residue": "Asn", "uniprot_canonical_ac": "P01859-2" }, { "category": "tissue", "tissue": { "name": "retina", "namespace": "UBERON", "id": "0000966", "url": "http://purl.obolibrary.org/obo/UBERON_0000966" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "678", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/678" }, { "id": "7881178", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/7881178" } ], "uniprot_canonical_ac": "P08100-1" }, { "category": "tissue", "tissue": { "name": "ovary", "namespace": "UBERON", "id": "0000992", "url": "http://purl.obolibrary.org/obo/UBERON_0000992" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "678", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/678" }, { "id": "8142896", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/8142896" } ], "uniprot_canonical_ac": "P15260-1" }, { "category": "tissue", "tissue": { "name": "ovary", "namespace": "UBERON", "id": "0000992", "url": "http://purl.obolibrary.org/obo/UBERON_0000992" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "678", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/678" }, { "id": "10207177", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/10207177" } ], "uniprot_canonical_ac": "P10252-1" } ], "subsumption": [ { "related_accession": "G01600VV", "relationship": "ancestor" }, { "related_accession": "G02054AQ", "relationship": "ancestor" }, { "related_accession": "G02056RY", "relationship": "ancestor" }, { "related_accession": "G02923VP", "relationship": "ancestor" }, { "related_accession": "G03069WI", "relationship": "ancestor" }, { "related_accession": "G03127AL", "relationship": "ancestor" }, { "related_accession": "G07870ST", "relationship": "ancestor" }, { "related_accession": "G09140IH", "relationship": "ancestor" }, { "related_accession": "G10967LF", "relationship": "ancestor" }, { "related_accession": "G11499BM", "relationship": "ancestor" }, { "related_accession": "G11908FF", "relationship": "ancestor" }, { "related_accession": "G12338DQ", "relationship": "ancestor" }, { "related_accession": "G12593TX", "relationship": "ancestor" }, { "related_accession": "G14023ZV", "relationship": "ancestor" }, { "related_accession": "G14576KZ", "relationship": "ancestor" }, { "related_accession": "G15653JZ", "relationship": "ancestor" }, { "related_accession": "G16136YI", "relationship": "ancestor" }, { "related_accession": "G16411DN", "relationship": "ancestor" }, { "related_accession": "G23593WY", "relationship": "ancestor" }, { "related_accession": "G27517DL", "relationship": "ancestor" }, { "related_accession": "G30225PF", "relationship": "ancestor" }, { "related_accession": "G34540VL", "relationship": "ancestor" }, { "related_accession": "G34597QJ", "relationship": "ancestor" }, { "related_accession": "G35364KM", "relationship": "ancestor" }, { "related_accession": "G35874ON", "relationship": "ancestor" }, { "related_accession": "G36379GD", "relationship": "ancestor" }, { "related_accession": "G40086WC", "relationship": "ancestor" }, { "related_accession": "G40932HD", "relationship": "ancestor" }, { "related_accession": "G46720ZO", "relationship": "ancestor" }, { "related_accession": "G48539GH", "relationship": "ancestor" }, { "related_accession": "G51393QH", "relationship": "ancestor" }, { "related_accession": "G53292OJ", "relationship": "ancestor" }, { "related_accession": "G54620TY", "relationship": "ancestor" }, { "related_accession": "G55519GO", "relationship": "ancestor" }, { "related_accession": "G55682EQ", "relationship": "ancestor" }, { "related_accession": "G61437IT", "relationship": "ancestor" }, { "related_accession": "G61559YJ", "relationship": "ancestor" }, { "related_accession": "G61884GF", "relationship": "ancestor" }, { "related_accession": "G63420HM", "relationship": "ancestor" }, { "related_accession": "G64126SM", "relationship": "ancestor" }, { "related_accession": "G64276SW", "relationship": "ancestor" }, { "related_accession": "G64510MT", "relationship": "ancestor" }, { "related_accession": "G65819KP", "relationship": "ancestor" }, { "related_accession": "G67604VF", "relationship": "ancestor" }, { "related_accession": "G78257QQ", "relationship": "ancestor" }, { "related_accession": "G78951XL", "relationship": "ancestor" }, { "related_accession": "G80276UF", "relationship": "ancestor" }, { "related_accession": "G80475RE", "relationship": "ancestor" }, { "related_accession": "G82605IU", "relationship": "ancestor" }, { "related_accession": "G84140GI", "relationship": "ancestor" }, { "related_accession": "G84548ZG", "relationship": "ancestor" }, { "related_accession": "G84936PF", "relationship": "ancestor" }, { "related_accession": "G86576TM", "relationship": "ancestor" }, { "related_accession": "G89049LM", "relationship": "ancestor" }, { "related_accession": "G94854LT", "relationship": "ancestor" }, { "related_accession": "G95184RD", "relationship": "ancestor" }, { "related_accession": "G96847QV", "relationship": "ancestor" }, { "related_accession": "G98493PV", "relationship": "ancestor" }, { "related_accession": "G98983WU", "relationship": "ancestor" }, { "related_accession": "G99164LO", "relationship": "ancestor" }, { "related_accession": "G80475RE", "relationship": "basecomposition" }, { "related_accession": "G09140IH", "relationship": "composition" }, { "related_accession": "G14576KZ", "relationship": "subsumedby" }, { "related_accession": "G30225PF", "relationship": "subsumedby" }, { "related_accession": "G34597QJ", "relationship": "subsumedby" }, { "related_accession": "G61559YJ", "relationship": "subsumedby" }, { "related_accession": "G98493PV", "relationship": "subsumedby" }, { "related_accession": "G40932HD", "relationship": "topology" } ], "names": [], "keywords": [ "fully_determined" ], "glycotree_pathways": [], "dictionary": {}, "biomarkers": [], "section_stats": [ { "table_id": "glycoprotein", "table_stats": [ { "field": "total", "count": 15 }, { "field": "total_sites", "count": 6 } ], "sort_fields": [ "uniprot_canonical_ac", "start_pos", "end_pos", "residue", "protein_name", "gene_name", "tax_id", "tax_name", "tax_common_name" ] }, { "table_id": "expression", "table_stats": [ { "field": "total", "count": 9 }, { "field": "total_sites", "count": 1 } ], "sort_fields": [ "category", "tissue.name", "tissue.namespace", "tissue.id", "tissue.url", "abundance", "uniprot_canonical_ac", "start_pos", "end_pos", "residue" ] }, { "table_id": "expression_tissue", "table_stats": [ { "field": "total", "count": 9 }, { "field": "total_sites", "count": 1 } ], "sort_fields": [ "category", "tissue.name", "tissue.namespace", "tissue.id", "tissue.url", "abundance", "uniprot_canonical_ac", "start_pos", "end_pos", "residue" ] }, { "table_id": "expression_cell_line", "table_stats": [ { "field": "total", "count": 0 }, { "field": "total_sites", "count": 0 } ], "sort_fields": [ "category", "abundance", "uniprot_canonical_ac", "start_pos", "end_pos", "residue" ] }, { "table_id": "publication", "table_stats": [ { "field": "total", "count": 14 } ], "sort_fields": [ "title", "journal", "date", "authors" ] } ] }