{ "glytoucan_ac": "G08520NM", "number_monosaccharides": 8, "number_monosaccharides_suffix": "", "mass": 1437.51, "mass_pme": 1801.92, "tool_support": { "gnome_glygen_oglycans": "no", "sandbox": "yes", "gnome_glygen": "yes", "gnome": "yes", "gnome_glycotree_oglycans": "no", "pdb": "yes", "gnome_glygen_nglycans": "yes", "gnome_glycotree_nglycans": "yes" }, "fully_determined": "yes", "missing_score": 0, "glycan_type": "Saccharide", "iupac": "\u03b2-D-GlcpNAc-(1\u21922)-\u03b1-D-Manp-(1\u21923)[\u03b1-D-Manp-(1\u21923)[\u03b1-D-Manp-(1\u21926)]-\u03b1-D-Manp-(1\u21926)]-\u03b2-D-Manp-(1\u21924)-\u03b2-D-GlcpNAc-(1\u21924)-\u03b2-D-GlcpNAc-(1\u2192", "wurcs": "WURCS=2.0/3,8,7/[a2122h-1b_1-5_2*NCC/3=O][a1122h-1b_1-5][a1122h-1a_1-5]/1-1-2-3-1-3-3-3/a4-b1_b4-c1_c3-d1_c6-f1_d2-e1_f3-g1_f6-h1", "glycoct": "RES 1b:b-dglc-HEX-1:5 2s:n-acetyl 3b:b-dglc-HEX-1:5 4s:n-acetyl 5b:b-dman-HEX-1:5 6b:a-dman-HEX-1:5 7b:b-dglc-HEX-1:5 8s:n-acetyl 9b:a-dman-HEX-1:5 10b:a-dman-HEX-1:5 11b:a-dman-HEX-1:5 LIN 1:1d(2+1)2n 2:1o(4+1)3d 3:3d(2+1)4n 4:3o(4+1)5d 5:5o(3+1)6d 6:6o(2+1)7d 7:7d(2+1)8n 8:5o(6+1)9d 9:9o(3+1)10d 10:9o(6+1)11d", "inchi": "InChI=1S/C54H91N3O41/c1-12(64)55-23-33(74)42(19(8-62)86-47(23)83)94-49-25(57-14(3)66)34(75)43(20(9-63)91-49)95-53-41(82)45(97-54-46(37(78)29(70)18(7-61)90-54)98-48-24(56-13(2)65)32(73)26(67)15(4-58)87-48)31(72)22(93-53)11-85-51-40(81)44(96-52-39(80)36(77)28(69)17(6-60)89-52)30(71)21(92-51)10-84-50-38(79)35(76)27(68)16(5-59)88-50/h15-54,58-63,67-83H,4-11H2,1-3H3,(H,55,64)(H,56,65)(H,57,66)/t15-,16-,17-,18-,19-,20-,21-,22-,23-,24-,25-,26-,27-,28-,29-,30-,31-,32-,33-,34-,35+,36+,37+,38+,39+,40+,41+,42-,43-,44+,45+,46+,47-,48+,49+,50+,51+,52-,53+,54-/m1/s1", "glycam": "DManpa1-3[DManpa1-6]DManpa1-6[DGlcpNAcb1-2DManpa1-3]DManpb1-4DGlcpNAcb1-4DGlcpNAcb1-OH", "smiles_isomeric": "CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1O)CO)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O[C@H]3[C@H]([C@H]([C@@H]([C@H](O3)CO[C@@H]4[C@H]([C@H]([C@@H]([C@H](O4)CO[C@@H]5[C@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)O)O[C@@H]6[C@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)O)O)O[C@@H]7[C@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)NC(=O)C)O)O)NC(=O)C)O", "inchi_key": { "key": "MRIXKRYHOZQBAW-ABMGQQJYSA-N", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/MRIXKRYHOZQBAW-ABMGQQJYSA-N" }, "byonic": "HexNAc(3)Hex(5) % 1437.51280002", "gwb": "freeEnd--1b1D-GlcNAc,p--4b1D-GlcNAc,p--4b1D-Man,p(--3a1D-Man,p--2b1D-GlcNAc,p)--6a1D-Man,p(--3a1D-Man,p)--6a1D-Man,p$MONO,Und,0,0,freeEnd", "species": [ { "taxid": 9913, "name": "Bos taurus", "annotation_category": "direct", "evidence": [ { "database": "GlyConnect", "id": "3141", "url": "https://glyconnect.expasy.org/browser/structures/3141" }, { "database": "GlyCosmos", "id": "G08520NM", "url": "https://glycosmos.org/glycans/show/G08520NM" }, { "database": "PubMed", "id": "447724", "url": "https://glygen.org/publication/PubMed/447724" } ], "common_name": "Bovine", "glygen_name": "Bovine", "reference_species": "Bos taurus [9913]" }, { "taxid": 9031, "name": "Gallus gallus", "annotation_category": "direct", "evidence": [ { "database": "GlyConnect", "id": "3141", "url": "https://glyconnect.expasy.org/browser/structures/3141" }, { "database": "GlyCosmos", "id": "G08520NM", "url": "https://glycosmos.org/glycans/show/G08520NM" }, { "database": "PubMed", "id": "10833030", "url": "https://glygen.org/publication/PubMed/10833030" } ], "common_name": "Chicken", "glygen_name": "Chicken", "reference_species": "Gallus gallus [9031]" }, { "taxid": 9606, "name": "Homo sapiens", "annotation_category": "direct", "evidence": [ { "database": "GlyConnect", "id": "11708", "url": "https://glyconnect.expasy.org/browser/structures/11708" }, { "database": "GlyConnect", "id": "3141", "url": "https://glyconnect.expasy.org/browser/structures/3141" }, { "database": "GlyCosmos", "id": "G08520NM", "url": "https://glycosmos.org/glycans/show/G08520NM" }, { "database": "PubMed", "id": "10207177", "url": "https://glygen.org/publication/PubMed/10207177" }, { "database": "PubMed", "id": "11469797", "url": "https://glygen.org/publication/PubMed/11469797" }, { "database": "PubMed", "id": "24706782", "url": "https://glygen.org/publication/PubMed/24706782" }, { "database": "PubMed", "id": "25802287", "url": "https://glygen.org/publication/PubMed/25802287" }, { "database": "PubMed", "id": "26510530", "url": "https://glygen.org/publication/PubMed/26510530" }, { "database": "PubMed", "id": "32643525", "url": "https://glygen.org/publication/PubMed/32643525" }, { "database": "PubMed", "id": "33139572", "url": "https://glygen.org/publication/PubMed/33139572" }, { "database": "PubMed", "id": "7514386", "url": "https://glygen.org/publication/PubMed/7514386" }, { "database": "PubMed", "id": "7881178", "url": "https://glygen.org/publication/PubMed/7881178" }, { "database": "UniCarbKB", "id": "GLY_000341", "url": "http://data.glygen.org/GLY_000341" } ], "common_name": "Human", "glygen_name": "Human", "reference_species": "Homo sapiens [9606]" }, { "taxid": 10116, "name": "Rattus norvegicus", "annotation_category": "direct", "evidence": [ { "database": "GlyConnect", "id": "3141", "url": "https://glyconnect.expasy.org/browser/structures/3141" }, { "database": "GlyCosmos", "id": "G08520NM", "url": "https://glycosmos.org/glycans/show/G08520NM" }, { "database": "PubMed", "id": "10207177", "url": "https://glygen.org/publication/PubMed/10207177" }, { "database": "PubMed", "id": "24090084", "url": "https://glygen.org/publication/PubMed/24090084" }, { "database": "UniCarbKB", "id": "GLY_000341", "url": "http://data.glygen.org/GLY_000341" } ], "common_name": "Rat", "glygen_name": "Rat", "reference_species": "Rattus norvegicus [10116]" } ], "classification": [ { "type": { "name": "N-linked", "url": "" }, "subtype": { "name": "Hybrid", "url": "" } } ], "enzyme": [ { "uniprot_canonical_ac": "Q8BML3-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G08520NM", "protein_name": "UDP-N-acetylglucosamine transferase subunit ALG13", "gene": "Glt28d2", "gene_link": "https://www.uniprot.org/uniprot/Q8BML3", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G08520NM", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G08520NM" } ] }, { "uniprot_canonical_ac": "Q96F25-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G08520NM", "protein_name": "UDP-N-acetylglucosamine transferase subunit ALG14", "gene": "ALG14", "gene_link": "https://www.uniprot.org/uniprot/Q96F25", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G08520NM", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G08520NM" } ] }, { "uniprot_canonical_ac": "Q9D081-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G08520NM", "protein_name": "UDP-N-acetylglucosamine transferase subunit ALG14", "gene": "Alg14", "gene_link": "https://www.uniprot.org/uniprot/Q9D081", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G08520NM", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G08520NM" } ] }, { "uniprot_canonical_ac": "Q9D8C3-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G08520NM", "protein_name": "UDP-N-acetylglucosamine transferase subunit ALG13", "gene": "Alg13", "gene_link": "https://www.uniprot.org/uniprot/Q9D8C3", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G08520NM", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G08520NM" } ] }, { "uniprot_canonical_ac": "Q9NP73-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G08520NM", "protein_name": "UDP-N-acetylglucosamine transferase subunit ALG13", "gene": "ALG13", "gene_link": "https://www.uniprot.org/uniprot/Q9NP73", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G08520NM", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G08520NM" } ] }, { "uniprot_canonical_ac": "P42867-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G08520NM", "protein_name": "UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase", "gene": "Dpagt1", "gene_link": "https://www.uniprot.org/uniprot/P42867", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G08520NM", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G08520NM" } ] }, { "uniprot_canonical_ac": "Q9H3H5-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G08520NM", "protein_name": "UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase", "gene": "DPAGT1", "gene_link": "https://www.uniprot.org/uniprot/Q9H3H5", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G08520NM", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G08520NM" } ] }, { "uniprot_canonical_ac": "Q921Q3-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G08520NM", "protein_name": "Chitobiosyldiphosphodolichol beta-mannosyltransferase", "gene": "Alg1", "gene_link": "https://www.uniprot.org/uniprot/Q921Q3", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G08520NM", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G08520NM" } ] }, { "uniprot_canonical_ac": "Q9BT22-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G08520NM", "protein_name": "Chitobiosyldiphosphodolichol beta-mannosyltransferase", "gene": "ALG1", "gene_link": "https://www.uniprot.org/uniprot/Q9BT22", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G08520NM", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G08520NM" } ] }, { "uniprot_canonical_ac": "Q9DBE8-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G08520NM", "protein_name": "Alpha-1,3/1,6-mannosyltransferase ALG2", "gene": "Alg2", "gene_link": "https://www.uniprot.org/uniprot/Q9DBE8", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G08520NM", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G08520NM" } ] }, { "uniprot_canonical_ac": "Q9H553-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G08520NM", "protein_name": "Alpha-1,3/1,6-mannosyltransferase ALG2", "gene": "ALG2", "gene_link": "https://www.uniprot.org/uniprot/Q9H553", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G08520NM", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G08520NM" } ] }, { "uniprot_canonical_ac": "P26572-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G08520NM", "protein_name": "Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase", "gene": "MGAT1", "gene_link": "https://www.uniprot.org/uniprot/P26572", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G08520NM", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G08520NM" } ] }, { "uniprot_canonical_ac": "P27808-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G08520NM", "protein_name": "Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase", "gene": "Mgat1", "gene_link": "https://www.uniprot.org/uniprot/P27808", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G08520NM", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G08520NM" } ] }, { "uniprot_canonical_ac": "Q8K2A8-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G08520NM", "protein_name": "Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase", "gene": "Alg3", "gene_link": "https://www.uniprot.org/uniprot/Q8K2A8", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G08520NM", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G08520NM" } ] }, { "uniprot_canonical_ac": "Q92685-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G08520NM", "protein_name": "Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase", "gene": "ALG3", "gene_link": "https://www.uniprot.org/uniprot/Q92685", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G08520NM", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G08520NM" } ] } ], "crossref": [ { "id": "91858075", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91858075", "database": "PubChem Compound", "categories": [ "Chemical" ] }, { "id": "252291399", "url": "https://pubchem.ncbi.nlm.nih.gov/substance/252291399", "database": "PubChem Substance", "categories": [ "Chemical" ] }, { "id": "2545", "url": "", "database": "UniCarbKB", "categories": [ "Glycoproteomics" ] }, { "id": "G00013", "url": "https://www.genome.jp/dbget-bin/www_bget?gl:G00013", "database": "KEGG Glycan", "categories": [ "Enzyme and Pathway" ] }, { "id": "23657", "url": "", "database": "Glycosciences.de", "categories": [ "Glycomics" ] }, { "id": "2384", "url": "", "database": "Glycosciences.de", "categories": [ "Glycomics" ] }, { "id": "11708", "url": "https://glyconnect.expasy.org/browser/structures/11708", "database": "GlyConnect", "categories": [ "Glycoproteomics", "Glycomics" ] }, { "id": "3141", "url": "https://glyconnect.expasy.org/browser/structures/3141", "database": "GlyConnect", "categories": [ "Glycoproteomics", "Glycomics" ] }, { "id": "11938", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+11938", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "29587", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+29587", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "31282", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+31282", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "33013", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+33013", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "35726", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+35726", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "38414", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+38414", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "38483", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+38483", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "43561", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+43561", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "45814", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+45814", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "46713", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+46713", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "7008", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+7008", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "7009", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+7009", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "7625", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+7625", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "7626", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+7626", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "7627", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+7627", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "7628", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+7628", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "7630", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+7630", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "146850", "url": "https://www.ebi.ac.uk/chebi/searchId.do?chebiId=146850", "database": "ChEBI", "categories": [] }, { "id": "G08520NM", "url": "https://glytoucan.org/Structures/Glycans/G08520NM", "database": "GlyTouCan", "categories": [ "Glycomics" ] }, { "id": "G08520NM", "url": "https://sandbox.glyomics.org/explore.html?G08520NM", "database": "SandBox", "categories": [ "Enzyme and Pathway" ] }, { "id": "G08520NM", "url": "https://gnome.glyomics.org/restrictions/GlyGen.StructureBrowser.html?focus=G08520NM", "database": "GNOme", "categories": [ "Ontology and Dictionary", "Glycomics" ] }, { "id": "G08520NM", "url": "https://glycosmos.org/glycans/show/G08520NM", "database": "GlyCosmos", "categories": [ "Glycoproteomics", "Glycomics" ] } ], "glycoprotein": [ { "uniprot_canonical_ac": "P13987-1", "start_pos": 43, "end_pos": 43, "residue": "Asn", "evidence": [ { "database": "PubMed", "id": "7514386", "url": "https://glygen.org/publication/PubMed/7514386" }, { "database": "UniCarbKB", "id": "GLY_000040", "url": "http://data.glygen.org/GLY_000040" }, { "database": "PubMed", "id": "10207177", "url": "https://glygen.org/publication/PubMed/10207177" } ], "protein_name": "CD59 glycoprotein", "gene_name": "CD59", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P01871-2", "start_pos": 279, "end_pos": 279, "residue": "Asn", "evidence": [ { "database": "PubMed", "id": "25802287", "url": "https://glygen.org/publication/PubMed/25802287" }, { "database": "UniCarbKB", "id": "GLY_000040", "url": "http://data.glygen.org/GLY_000040" }, { "database": "PubMed", "id": "26510530", "url": "https://glygen.org/publication/PubMed/26510530" }, { "database": "PubMed", "id": "24706782", "url": "https://glygen.org/publication/PubMed/24706782" } ], "protein_name": "Immunoglobulin heavy constant mu", "gene_name": "IGHM", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "F1LNP8-1", "start_pos": 202, "end_pos": 202, "residue": "Asn", "evidence": [ { "database": "PubMed", "id": "24090084", "url": "https://glygen.org/publication/PubMed/24090084" }, { "database": "UniCarbKB", "id": "GLY_000221", "url": "http://data.glygen.org/GLY_000221" } ], "protein_name": "Nectin cell adhesion molecule 1", "gene_name": "Nectin1", "tax_id": 10116, "tax_name": "Rattus norvegicus", "tax_common_name": "Rat" }, { "uniprot_canonical_ac": "Q63198-1", "start_pos": 457, "end_pos": 457, "residue": "Asn", "evidence": [ { "database": "PubMed", "id": "24090084", "url": "https://glygen.org/publication/PubMed/24090084" }, { "database": "UniCarbKB", "id": "GLY_000221", "url": "http://data.glygen.org/GLY_000221" } ], "protein_name": "Contactin-1", "gene_name": "Cntn1", "tax_id": 10116, "tax_name": "Rattus norvegicus", "tax_common_name": "Rat" }, { "uniprot_canonical_ac": "P02699-1", "evidence": [ { "database": "PubMed", "id": "447724", "url": "https://glygen.org/publication/PubMed/447724" }, { "database": "GlyConnect", "id": "523", "url": "https://glyconnect.expasy.org/browser/proteins/523" } ], "protein_name": "Rhodopsin", "gene_name": "RHO", "tax_id": 9913, "tax_name": "Bos taurus", "tax_common_name": "Bovine" }, { "uniprot_canonical_ac": "P01012-1", "evidence": [ { "database": "PubMed", "id": "10833030", "url": "https://glygen.org/publication/PubMed/10833030" }, { "database": "GlyConnect", "id": "475", "url": "https://glyconnect.expasy.org/browser/proteins/475" } ], "protein_name": "Ovalbumin", "gene_name": "SERPINB14", "tax_id": 9031, "tax_name": "Gallus gallus", "tax_common_name": "Chicken" }, { "uniprot_canonical_ac": "P01005-1", "evidence": [ { "database": "PubMed", "id": "10833030", "url": "https://glygen.org/publication/PubMed/10833030" }, { "database": "GlyConnect", "id": "479", "url": "https://glyconnect.expasy.org/browser/proteins/479" } ], "protein_name": "Ovomucoid", "gene_name": "", "tax_id": 9031, "tax_name": "Gallus gallus", "tax_common_name": "Chicken" }, { "uniprot_canonical_ac": "P02752-1", "evidence": [ { "database": "PubMed", "id": "10833030", "url": "https://glygen.org/publication/PubMed/10833030" }, { "database": "GlyConnect", "id": "527", "url": "https://glyconnect.expasy.org/browser/proteins/527" } ], "protein_name": "Riboflavin-binding protein", "gene_name": "", "tax_id": 9031, "tax_name": "Gallus gallus", "tax_common_name": "Chicken" }, { "uniprot_canonical_ac": "P08100-1", "evidence": [ { "database": "PubMed", "id": "7881178", "url": "https://glygen.org/publication/PubMed/7881178" }, { "database": "GlyConnect", "id": "525", "url": "https://glyconnect.expasy.org/browser/proteins/525" } ], "protein_name": "Rhodopsin", "gene_name": "RHO", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P01579-1", "evidence": [ { "database": "PubMed", "id": "11469797", "url": "https://glygen.org/publication/PubMed/11469797" }, { "database": "GlyConnect", "id": "287", "url": "https://glyconnect.expasy.org/browser/proteins/287" } ], "protein_name": "Interferon gamma", "gene_name": "IFNG", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P05540-1", "evidence": [ { "database": "PubMed", "id": "10207177", "url": "https://glygen.org/publication/PubMed/10207177" }, { "database": "GlyConnect", "id": "588", "url": "https://glyconnect.expasy.org/browser/proteins/588" } ], "protein_name": "T-cell surface glycoprotein CD4", "gene_name": "Cd4", "tax_id": 10116, "tax_name": "Rattus norvegicus", "tax_common_name": "Rat" } ], "publication": [ { "title": "Structural study on the glycosyl-phosphatidylinositol anchor and the asparagine-linked sugar chain of a soluble form of CD59 in human urine.", "journal": "Archives of biochemistry and biophysics", "date": "1994", "authors": "Nakano Y, Noda K, Endo T, Kobata A, Tomita M", "evidence": [ { "database": "UniCarbKB", "id": "GLY_000040", "url": "http://data.glygen.org/GLY_000040" }, { "database": "GlyTouCan", "id": "G08520NM", "url": "https://glytoucan.org/Structures/Glycans/G08520NM" } ], "reference": [ { "type": "PubMed", "id": "7514386", "url": "https://glygen.org/publication/PubMed/7514386" } ] }, { "title": "Oligosaccharide analysis and molecular modeling of soluble forms of glycoproteins belonging to the Ly-6, scavenger receptor, and immunoglobulin superfamilies expressed in Chinese hamster ovary cells.", "journal": "Glycobiology", "date": "1999", "authors": "Rudd PM, Wormald MR, Harvey DJ, Devasahayam M, McAlister MS, Brown MH, Davis SJ, Barclay AN, Dwek RA", "evidence": [ { "database": "UniCarbKB", "id": "GLY_000040", "url": "http://data.glygen.org/GLY_000040" }, { "database": "GlyTouCan", "id": "G08520NM", "url": "https://glytoucan.org/Structures/Glycans/G08520NM" }, { "database": "GlyConnect", "id": "588", "url": "https://glyconnect.expasy.org/browser/proteins/588" } ], "reference": [ { "type": "PubMed", "id": "10207177", "url": "https://glygen.org/publication/PubMed/10207177" } ] }, { "title": "A Microarray-Matrix-assisted Laser Desorption/Ionization-Mass Spectrometry Approach for Site-specific Protein N-glycosylation Analysis, as Demonstrated for Human Serum Immunoglobulin M (IgM).", "journal": "Molecular & cellular proteomics : MCP", "date": "2015", "authors": "Pabst M, Kuster SK, Wahl F, Krismer J, Dittrich PS, Zenobi R", "evidence": [ { "database": "UniCarbKB", "id": "GLY_000040", "url": "http://data.glygen.org/GLY_000040" }, { "database": "GlyTouCan", "id": "G08520NM", "url": "https://glytoucan.org/Structures/Glycans/G08520NM" } ], "reference": [ { "type": "PubMed", "id": "25802287", "url": "https://glygen.org/publication/PubMed/25802287" } ] }, { "title": "A Method for Comprehensive Glycosite-Mapping and Direct Quantitation of Serum Glycoproteins.", "journal": "Journal of proteome research", "date": "2015", "authors": "Hong Q, Ruhaak LR, Stroble C, Parker E, Huang J, Maverakis E, Lebrilla CB", "evidence": [ { "database": "UniCarbKB", "id": "GLY_000040", "url": "http://data.glygen.org/GLY_000040" }, { "database": "GlyTouCan", "id": "G08520NM", "url": "https://glytoucan.org/Structures/Glycans/G08520NM" } ], "reference": [ { "type": "PubMed", "id": "26510530", "url": "https://glygen.org/publication/PubMed/26510530" } ] }, { "title": "Expression and glycoengineering of functionally active heteromultimeric IgM in plants.", "journal": "Proceedings of the National Academy of Sciences of the United States of America", "date": "2014", "authors": "Loos A, Gruber C, Altmann F, Mehofer U, Hensel F, Grandits M, Oostenbrink C, Stadlmayr G, Furtmuller PG, Steinkellner H", "evidence": [ { "database": "UniCarbKB", "id": "GLY_000040", "url": "http://data.glygen.org/GLY_000040" }, { "database": "GlyTouCan", "id": "G08520NM", "url": "https://glytoucan.org/Structures/Glycans/G08520NM" } ], "reference": [ { "type": "PubMed", "id": "24706782", "url": "https://glygen.org/publication/PubMed/24706782" } ] }, { "title": "Site-specific glycan-peptide analysis for determination of N-glycoproteome heterogeneity.", "journal": "Journal of proteome research", "date": "2013", "authors": "Parker BL, Thaysen-Andersen M, Solis N, Scott NE, Larsen MR, Graham ME, Packer NH, Cordwell SJ", "evidence": [ { "database": "UniCarbKB", "id": "GLY_000221", "url": "http://data.glygen.org/GLY_000221" }, { "database": "GlyTouCan", "id": "G08520NM", "url": "https://glytoucan.org/Structures/Glycans/G08520NM" } ], "reference": [ { "type": "PubMed", "id": "24090084", "url": "https://glygen.org/publication/PubMed/24090084" } ] }, { "title": "Structure of the carbohydrate moieties of bovine rhodopsin.", "journal": "The Journal of biological chemistry", "date": "1979-07-25", "authors": "Liang C J, Yamashita K, Muellenberg C G, Shichi H, Kobata A", "evidence": [ { "database": "GlyTouCan", "id": "G08520NM", "url": "https://glytoucan.org/Structures/Glycans/G08520NM" }, { "database": "GlyConnect", "id": "523", "url": "https://glyconnect.expasy.org/browser/proteins/523" } ], "reference": [ { "type": "PubMed", "id": "447724", "url": "https://glygen.org/publication/PubMed/447724" } ] }, { "title": "Composition of N-linked carbohydrates from ovalbumin and co-purified glycoproteins.", "journal": "Journal of the American Society for Mass Spectrometry", "date": "2000", "authors": "Harvey DJ, Wing DR, Kuster B, Wilson IB", "evidence": [ { "database": "GlyTouCan", "id": "G08520NM", "url": "https://glytoucan.org/Structures/Glycans/G08520NM" }, { "database": "GlyConnect", "id": "475", "url": "https://glyconnect.expasy.org/browser/proteins/475" }, { "database": "GlyConnect", "id": "479", "url": "https://glyconnect.expasy.org/browser/proteins/479" }, { "database": "GlyConnect", "id": "527", "url": "https://glyconnect.expasy.org/browser/proteins/527" } ], "reference": [ { "type": "PubMed", "id": "10833030", "url": "https://glygen.org/publication/PubMed/10833030" } ] }, { "title": "The widespread effect of beta 1,4-galactosyltransferase on N-glycan processing.", "journal": "Archives of biochemistry and biophysics", "date": "2001", "authors": "Fukuta K, Abe R, Yokomatsu T, Minowa MT, Takeuchi M, Asanagi M, Makino T", "evidence": [ { "database": "GlyTouCan", "id": "G08520NM", "url": "https://glytoucan.org/Structures/Glycans/G08520NM" }, { "database": "GlyConnect", "id": "287", "url": "https://glyconnect.expasy.org/browser/proteins/287" } ], "reference": [ { "type": "PubMed", "id": "11469797", "url": "https://glygen.org/publication/PubMed/11469797" } ] }, { "title": "Malignant tissues produce divergent antibody glycosylation of relevance for cancer gene therapy effectiveness.", "journal": "mAbs", "date": "2020", "authors": "Br\u00fccher Dominik, Franc Vojtech, Smith Sheena N, Heck Albert J R, Pl\u00fcckthun Andreas", "evidence": [ { "database": "GlyTouCan", "id": "G08520NM", "url": "https://glytoucan.org/Structures/Glycans/G08520NM" } ], "reference": [ { "type": "PubMed", "id": "32643525", "url": "https://glygen.org/publication/PubMed/32643525" } ] }, { "title": "Spatial and temporal diversity of glycome expression in mammalian brain.", "journal": "Proceedings of the National Academy of Sciences of the United States of America", "date": "2020-11-17", "authors": "Lee Jua, Ha Seungshin, Kim Minsoo, Kim Seong-Wook, Yun Jaekyung, Ozcan Sureyya, Hwang Heeyoun, Ji In Jung, Yin Dongtan, Webster Maree J, Shannon Weickert Cynthia, Kim Jae-Han, Yoo Jong Shin, Grimm Rudolf, Bahn Sabine, Shin Hee-Sup, An Hyun Joo", "evidence": [ { "database": "GlyTouCan", "id": "G08520NM", "url": "https://glytoucan.org/Structures/Glycans/G08520NM" } ], "reference": [ { "type": "PubMed", "id": "33139572", "url": "https://glygen.org/publication/PubMed/33139572" } ] }, { "title": "Structural studies of the N-linked sugar chains of human rhodopsin.", "journal": "Glycobiology", "date": "1994", "authors": "Fujita S, Endo T, Ju J, Kean EL, Kobata A", "evidence": [ { "database": "GlyTouCan", "id": "G08520NM", "url": "https://glytoucan.org/Structures/Glycans/G08520NM" }, { "database": "GlyConnect", "id": "525", "url": "https://glyconnect.expasy.org/browser/proteins/525" } ], "reference": [ { "type": "PubMed", "id": "7881178", "url": "https://glygen.org/publication/PubMed/7881178" } ] }, { "title": "Identification of N-glycans from Ebola virus glycoproteins by matrix-assisted laser desorption/ionisation time-of-flight and negative ion electrospray tandem mass spectrometry.", "journal": "Rapid communications in mass spectrometry : RCM", "date": "2010-03-15", "authors": "Ritchie Gayle, Harvey David J, Stroeher Ute, Feldmann Friederike, Feldmann Heinz, Wahl-Jensen Victoria, Royle Louise, Dwek Raymond A, Rudd Pauline M", "evidence": [ { "database": "UniCarbKB", "id": "GLY_000285", "url": "http://data.glygen.org/GLY_000285" } ], "reference": [ { "type": "PubMed", "id": "20131323", "url": "https://glygen.org/publication/PubMed/20131323" } ] } ], "residues": [ { "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "attachedby": "rxn.Q8BML3-1", "detachedby": "", "parentid": "NA" }, { "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "attachedby": "rxn.Q96F25-1", "detachedby": "", "parentid": "NA" }, { "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "attachedby": "rxn.Q9D081-1", "detachedby": "", "parentid": "NA" }, { "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "attachedby": "rxn.Q9D8C3-1", "detachedby": "", "parentid": "NA" }, { "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "attachedby": "rxn.Q9NP73-1", "detachedby": "", "parentid": "NA" }, { "id": "NA", "name": "N-glycan_core_D-GlcNAc_A", "attachedby": "rxn.P42867-1", "detachedby": "", "parentid": "0" }, { "id": "NA", "name": "N-glycan_core_D-GlcNAc_A", "attachedby": "rxn.Q9H3H5-1", "detachedby": "", "parentid": "0" }, { "id": "NC", "name": "N-glycan_core_b-D-Manp_C", "attachedby": "rxn.Q921Q3-1", "detachedby": "", "parentid": "NB" }, { "id": "NC", "name": "N-glycan_core_b-D-Manp_C", "attachedby": "rxn.Q9BT22-1", "detachedby": "", "parentid": "NB" }, { "id": "N1", "name": "N-glycan_a-D-Manp_1", "attachedby": "rxn.Q9DBE8-1", "detachedby": "", "parentid": "NC" }, { "id": "N1", "name": "N-glycan_a-D-Manp_1", "attachedby": "rxn.Q9H553-1", "detachedby": "", "parentid": "NC" }, { "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "attachedby": "rxn.P26572-1", "detachedby": "", "parentid": "N1" }, { "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "attachedby": "rxn.P27808-1", "detachedby": "", "parentid": "N1" }, { "id": "N4", "name": "N-glycan_a-D-Manp_4", "attachedby": "rxn.Q9DBE8-1", "detachedby": "", "parentid": "NC" }, { "id": "N4", "name": "N-glycan_a-D-Manp_4", "attachedby": "rxn.Q9H553-1", "detachedby": "", "parentid": "NC" }, { "id": "N19", "name": "N-glycan_a-D-Manp_19", "attachedby": "rxn.Q8K2A8-1", "detachedby": "", "parentid": "N4" }, { "id": "N19", "name": "N-glycan_a-D-Manp_19", "attachedby": "rxn.Q92685-1", "detachedby": "", "parentid": "N4" }, { "id": "N20", "name": "N-glycan_a-D-Manp_20", "attachedby": "rxn.Q8K2A8-1", "detachedby": "", "parentid": "N4" }, { "id": "N20", "name": "N-glycan_a-D-Manp_20", "attachedby": "rxn.Q92685-1", "detachedby": "", "parentid": "N4" } ], "composition": [ { "name": "6-Deoxy-Hexose", "residue": "dhex", "count": 0, "cid": "840", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840" }, { "name": "Hexose", "residue": "hex", "count": 5, "cid": "206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206" }, { "name": "N-Acetylhexosamine", "residue": "hexnac", "count": 3, "cid": "899", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899" }, { "name": "Hexuronic Acid", "residue": "hexa", "count": 0, "cid": "610", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610" }, { "name": "2-Amino-2-Deoxy-Hexose", "residue": "hexn", "count": 0, "cid": "739", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739" }, { "name": "N-Acetyl-Neuraminic Acid", "residue": "neuac", "count": 0, "cid": "439197", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197" }, { "name": "N-Glycolyl-Neuraminic Acid", "residue": "neugc", "count": 0, "cid": "440001", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001" }, { "name": "Phosphate", "residue": "p", "count": 0, "cid": "1061", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061" }, { "name": "Pentose", "residue": "pent", "count": 0, "cid": "229", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229" }, { "name": "Sulfate", "residue": "s", "count": 0, "cid": "1117", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117" }, { "name": "Other", "residue": "other", "count": 0 } ], "composition_expanded": [ { "name": "Alditol", "residue": "aldi", "count": 0 }, { "name": "6-Deoxy-Hexose", "residue": "dhex", "count": 0, "cid": "840", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840" }, { "name": "6-Deoxy-Hexitol", "residue": "dhex+aldi", "count": 0 }, { "name": "L-Fucose", "residue": "fuc", "count": 0, "cid": "17106", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/17106" }, { "name": "L-Fucitol", "residue": "fuc+aldi", "count": 0, "cid": "445724", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/445724" }, { "name": "D-Galactose", "residue": "gal", "count": 0, "cid": "6036", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6036" }, { "name": "D-Galactitol", "residue": "gal+aldi", "count": 0, "cid": "11850", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11850" }, { "name": "N-Acetyl-D-galactosamine", "residue": "galnac", "count": 0, "cid": "35717", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/35717" }, { "name": "N-Acetylgalactosaminitol", "residue": "galnac+aldi", "count": 0, "cid": "165880", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165880" }, { "name": "D-Galacturonic Acid", "residue": "gala", "count": 0, "cid": "439215", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439215" }, { "name": "D-Glucose", "residue": "glc", "count": 0, "cid": "5793", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5793" }, { "name": "D-Glucitol", "residue": "glc+aldi", "count": 0, "cid": "5780", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5780" }, { "name": "D-Glucuronic acid", "residue": "glca", "count": 0, "cid": "94715", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/94715" }, { "name": "D-Glucosamine", "residue": "glcn", "count": 0, "cid": "439213", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439213" }, { "name": "N-Acetyl-D-Glucosamine", "residue": "glcnac", "count": 3, "cid": "439174", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439174" }, { "name": "N-Acetyl-D-glucosaminitol", "residue": "glcnac+aldi", "count": 0, "cid": "165206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165206" }, { "name": "Hexose", "residue": "hex", "count": 5, "cid": "206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206" }, { "name": "N-Acetylhexosamine", "residue": "hexnac", "count": 3, "cid": "899", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899" }, { "name": "Hexuronic Acid", "residue": "hexa", "count": 0, "cid": "610", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610" }, { "name": "2-Amino-2-Deoxy-Hexose", "residue": "hexn", "count": 0, "cid": "739", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739" }, { "name": "Hexitol", "residue": "hex+aldi", "count": 0, "cid": "453", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/453" }, { "name": "N-Acetylhexosaminitol", "residue": "hexnac+aldi", "count": 0 }, { "name": "L-Iduronic acid", "residue": "idoa", "count": 0, "cid": "441039", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/441039" }, { "name": "D-Mannose", "residue": "man", "count": 5, "cid": "18950", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18950" }, { "name": "D-Mannitol", "residue": "man+aldi", "count": 0, "cid": "6251", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6251" }, { "name": "N-Acetyl-D-mannosamine", "residue": "mannac", "count": 0, "cid": "439281", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439281" }, { "name": "Methyl", "residue": "me", "count": 0 }, { "name": "N-Acetyl-Neuraminic Acid", "residue": "neuac", "count": 0, "cid": "439197", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197" }, { "name": "N-Glycolyl-Neuraminic Acid", "residue": "neugc", "count": 0, "cid": "440001", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001" }, { "name": "Phosphate", "residue": "p", "count": 0, "cid": "1061", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061" }, { "name": "Pentose", "residue": "pent", "count": 0, "cid": "229", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229" }, { "name": "Sulfate", "residue": "s", "count": 0, "cid": "1117", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117" }, { "name": "Sialic acid", "residue": "sia", "count": 0 }, { "name": "Other", "residue": "other", "count": 0 }, { "name": "Floating substituent", "residue": "x", "count": 0 }, { "name": "D-Xylose", "residue": "xyl", "count": 0, "cid": "135191", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135191" }, { "name": "Ketodeoxynononic acid", "residue": "kdn", "count": 0, "cid": "13991616", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13991616" } ], "motifs": [], "interactions": [], "expression": [ { "category": "tissue", "tissue": { "name": "retina", "namespace": "UBERON", "id": "0000966", "url": "http://purl.obolibrary.org/obo/UBERON_0000966" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "3141", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/3141" }, { "id": "447724", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/447724" } ], "uniprot_canonical_ac": "P02699-1" }, { "category": "tissue", "tissue": { "name": "retina", "namespace": "UBERON", "id": "0000966", "url": "http://purl.obolibrary.org/obo/UBERON_0000966" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "3141", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/3141" }, { "id": "7881178", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/7881178" } ], "uniprot_canonical_ac": "P08100-1" }, { "category": "tissue", "tissue": { "name": "ovary", "namespace": "UBERON", "id": "0000992", "url": "http://purl.obolibrary.org/obo/UBERON_0000992" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "3141", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/3141" }, { "id": "11469797", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/11469797" } ], "uniprot_canonical_ac": "P01579-1" }, { "category": "tissue", "tissue": { "name": "ovary", "namespace": "UBERON", "id": "0000992", "url": "http://purl.obolibrary.org/obo/UBERON_0000992" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "3141", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/3141" }, { "id": "10207177", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/10207177" } ], "uniprot_canonical_ac": "P05540-1" } ], "subsumption": [ { "related_accession": "G14220UT", "relationship": "ancestor" }, { "related_accession": "G17905SU", "relationship": "ancestor" }, { "related_accession": "G23432OI", "relationship": "ancestor" }, { "related_accession": "G27828BN", "relationship": "ancestor" }, { "related_accession": "G30754MT", "relationship": "ancestor" }, { "related_accession": "G31474PL", "relationship": "ancestor" }, { "related_accession": "G32909UL", "relationship": "ancestor" }, { "related_accession": "G33581QC", "relationship": "ancestor" }, { "related_accession": "G33609NS", "relationship": "ancestor" }, { "related_accession": "G34810SS", "relationship": "ancestor" }, { "related_accession": "G35916SR", "relationship": "ancestor" }, { "related_accession": "G37369XO", "relationship": "ancestor" }, { "related_accession": "G38297TU", "relationship": "ancestor" }, { "related_accession": "G38826DG", "relationship": "ancestor" }, { "related_accession": "G39446WN", "relationship": "ancestor" }, { "related_accession": "G43463XA", "relationship": "ancestor" }, { "related_accession": "G56225WL", "relationship": "ancestor" }, { "related_accession": "G58056LQ", "relationship": "ancestor" }, { "related_accession": "G65866YC", "relationship": "ancestor" }, { "related_accession": "G66106KZ", "relationship": "ancestor" }, { "related_accession": "G68552WJ", "relationship": "ancestor" }, { "related_accession": "G78341DP", "relationship": "ancestor" }, { "related_accession": "G85302QR", "relationship": "ancestor" }, { "related_accession": "G87811DH", "relationship": "ancestor" }, { "related_accession": "G89319AW", "relationship": "ancestor" }, { "related_accession": "G89756YF", "relationship": "ancestor" }, { "related_accession": "G91174DR", "relationship": "ancestor" }, { "related_accession": "G94101SO", "relationship": "ancestor" }, { "related_accession": "G95925JP", "relationship": "ancestor" }, { "related_accession": "G98398AI", "relationship": "ancestor" }, { "related_accession": "G39446WN", "relationship": "basecomposition" }, { "related_accession": "G32909UL", "relationship": "composition" }, { "related_accession": "G17905SU", "relationship": "subsumedby" }, { "related_accession": "G38297TU", "relationship": "subsumedby" }, { "related_accession": "G65866YC", "relationship": "subsumedby" }, { "related_accession": "G43463XA", "relationship": "topology" } ], "names": [], "keywords": [ "fully_determined" ], "glycotree_pathways": [ { "source": "G53168IY", "target": "G08520NM", "residue_affected": { "id": "N20", "full_name": "α-D-Manp" }, "enzymes": [ { "uniprotkb_ac": "Q8K2A8", "tax_name": "Mus musculus" } ] }, { "source": "G09724ZC", "target": "G53168IY", "residue_affected": { "id": "N2", "full_name": "β-D-GlcpNAc" }, "enzymes": [ { "uniprotkb_ac": "P27808", "tax_name": "Mus musculus" } ] }, { "source": "G22768VO", "target": "G09724ZC", "residue_affected": { "id": "N19", "full_name": "α-D-Manp" }, "enzymes": [ { "uniprotkb_ac": "Q8K2A8", "tax_name": "Mus musculus" } ] } ], "dictionary": {}, "biomarkers": [], "section_stats": [ { "table_id": "glycoprotein", "table_stats": [ { "field": "total", "count": 11 }, { "field": "total_sites", "count": 4 } ], "sort_fields": [ "uniprot_canonical_ac", "start_pos", "end_pos", "residue", "protein_name", "gene_name", "tax_id", "tax_name", "tax_common_name" ] }, { "table_id": "expression", "table_stats": [ { "field": "total", "count": 4 }, { "field": "total_sites", "count": 0 } ], "sort_fields": [ "category", "tissue.name", "tissue.namespace", "tissue.id", "tissue.url", "abundance", "uniprot_canonical_ac" ] }, { "table_id": "expression_tissue", "table_stats": [ { "field": "total", "count": 4 }, { "field": "total_sites", "count": 0 } ], "sort_fields": [ "category", "tissue.name", "tissue.namespace", "tissue.id", "tissue.url", "abundance", "uniprot_canonical_ac" ] }, { "table_id": "expression_cell_line", "table_stats": [ { "field": "total", "count": 0 }, { "field": "total_sites", "count": 0 } ], "sort_fields": [ "category", "abundance", "uniprot_canonical_ac" ] }, { "table_id": "publication", "table_stats": [ { "field": "total", "count": 13 } ], "sort_fields": [ "title", "journal", "date", "authors" ] } ] }