{ "glytoucan_ac": "G00033MO", "number_monosaccharides": 3, "number_monosaccharides_suffix": "", "mass": 586.22, "mass_pme": 740.39, "tool_support": { "gnome_glygen_oglycans": "yes", "sandbox": "yes", "gnome_glygen": "yes", "gnome": "yes", "gnome_glycotree_oglycans": "yes", "pdb": "yes", "gnome_glygen_nglycans": "no", "gnome_glycotree_nglycans": "no" }, "fully_determined": "yes", "missing_score": 0, "glycan_type": "Saccharide", "iupac": "\u03b2-D-Galp-(1\u21923)[\u03b2-D-GlcpNAc-(1\u21926)]-\u03b1-D-GalpNAc-(1\u2192", "wurcs": "WURCS=2.0/3,3,2/[a2112h-1a_1-5_2*NCC/3=O][a2112h-1b_1-5][a2122h-1b_1-5_2*NCC/3=O]/1-2-3/a3-b1_a6-c1", "glycoct": "RES 1b:a-dgal-HEX-1:5 2s:n-acetyl 3b:b-dgal-HEX-1:5 4b:b-dglc-HEX-1:5 5s:n-acetyl LIN 1:1d(2+1)2n 2:1o(3+1)3d 3:1o(6+1)4d 4:4d(2+1)5n", "inchi": "InChI=1S/C22H38N2O16/c1-6(27)23-11-16(32)13(29)8(3-25)38-21(11)36-5-10-15(31)19(12(20(35)37-10)24-7(2)28)40-22-18(34)17(33)14(30)9(4-26)39-22/h8-22,25-26,29-35H,3-5H2,1-2H3,(H,23,27)(H,24,28)/t8-,9-,10-,11-,12-,13-,14+,15+,16-,17+,18-,19-,20+,21-,22+/m1/s1", "glycam": "DGalpb1-3[DGlcpNAcb1-6]DGalpNAca1-OH", "smiles_isomeric": "CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1OC[C@@H]2[C@@H]([C@@H]([C@H]([C@H](O2)O)NC(=O)C)O[C@H]3[C@@H]([C@H]([C@H]([C@H](O3)CO)O)O)O)O)CO)O)O", "inchi_key": { "key": "AULDNGHDBFNGGC-XYVIJKTMSA-N", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/AULDNGHDBFNGGC-XYVIJKTMSA-N" }, "byonic": "HexNAc(2)Hex(1) % 586.22213341", "gwb": "freeEnd--1a1D-GalNAc,p(--3b1D-Gal,p)--6b1D-GlcNAc,p$MONO,Und,0,0,freeEnd", "species": [ { "taxid": 9913, "name": "Bos taurus", "annotation_category": "direct", "evidence": [ { "database": "GlyConnect", "id": "3318", "url": "https://glyconnect.expasy.org/browser/structures/3318" }, { "database": "PubMed", "id": "1718265", "url": "https://glygen.org/publication/PubMed/1718265" }, { "database": "PubMed", "id": "1730232", "url": "https://glygen.org/publication/PubMed/1730232" }, { "database": "PubMed", "id": "3768900", "url": "https://glygen.org/publication/PubMed/3768900" }, { "database": "PubMed", "id": "9874229", "url": "https://glygen.org/publication/PubMed/9874229" } ], "common_name": "Bovine", "glygen_name": "Bovine", "reference_species": "Bos taurus [9913]" }, { "taxid": 7227, "name": "Drosophila melanogaster", "annotation_category": "direct", "evidence": [ { "database": "GlyConnect", "id": "3318", "url": "https://glyconnect.expasy.org/browser/structures/3318" }, { "database": "GlyCosmos", "id": "G00033MO", "url": "https://glycosmos.org/glycans/show/G00033MO" }, { "database": "PubMed", "id": "18725413", "url": "https://glygen.org/publication/PubMed/18725413" } ], "common_name": "Fruit fly", "glygen_name": "Fruit fly", "reference_species": "Drosophila melanogaster [7227]" }, { "taxid": 9606, "name": "Homo sapiens", "annotation_category": "direct", "evidence": [ { "database": "GlyConnect", "id": "3318", "url": "https://glyconnect.expasy.org/browser/structures/3318" }, { "database": "GlyCosmos", "id": "G00033MO", "url": "https://glycosmos.org/glycans/show/G00033MO" }, { "database": "PubMed", "id": "14673092", "url": "https://glygen.org/publication/PubMed/14673092" }, { "database": "PubMed", "id": "1488058", "url": "https://glygen.org/publication/PubMed/1488058" }, { "database": "PubMed", "id": "1627559", "url": "https://glygen.org/publication/PubMed/1627559" }, { "database": "PubMed", "id": "25187573", "url": "https://glygen.org/publication/PubMed/25187573" }, { "database": "PubMed", "id": "2580706", "url": "https://glygen.org/publication/PubMed/2580706" }, { "database": "PubMed", "id": "3003076", "url": "https://glygen.org/publication/PubMed/3003076" }, { "database": "PubMed", "id": "32310329", "url": "https://glygen.org/publication/PubMed/32310329" }, { "database": "PubMed", "id": "32841605", "url": "https://glygen.org/publication/PubMed/32841605" }, { "database": "PubMed", "id": "3345749", "url": "https://glygen.org/publication/PubMed/3345749" }, { "database": "PubMed", "id": "34191522", "url": "https://glygen.org/publication/PubMed/34191522" }, { "database": "PubMed", "id": "3956483", "url": "https://glygen.org/publication/PubMed/3956483" }, { "database": "PubMed", "id": "4357339", "url": "https://glygen.org/publication/PubMed/4357339" }, { "database": "PubMed", "id": "6539332", "url": "https://glygen.org/publication/PubMed/6539332" }, { "database": "PubMed", "id": "7080930", "url": "https://glygen.org/publication/PubMed/7080930" }, { "database": "PubMed", "id": "7140761", "url": "https://glygen.org/publication/PubMed/7140761" }, { "database": "PubMed", "id": "7215351", "url": "https://glygen.org/publication/PubMed/7215351" }, { "database": "PubMed", "id": "952526", "url": "https://glygen.org/publication/PubMed/952526" }, { "database": "PubMed", "id": "9530955", "url": "https://glygen.org/publication/PubMed/9530955" } ], "common_name": "Human", "glygen_name": "Human", "reference_species": "Homo sapiens [9606]" }, { "taxid": 10090, "name": "Mus musculus", "annotation_category": "direct", "evidence": [ { "database": "GlyConnect", "id": "3318", "url": "https://glyconnect.expasy.org/browser/structures/3318" }, { "database": "GlyCosmos", "id": "G00033MO", "url": "https://glycosmos.org/glycans/show/G00033MO" }, { "database": "PubMed", "id": "14673092", "url": "https://glygen.org/publication/PubMed/14673092" }, { "database": "PubMed", "id": "35022400", "url": "https://glygen.org/publication/PubMed/35022400" } ], "common_name": "Mouse", "glygen_name": "Mouse", "reference_species": "Mus musculus [10090]" }, { "taxid": 9823, "name": "Sus scrofa", "annotation_category": "direct", "evidence": [ { "database": "GlyConnect", "id": "3318", "url": "https://glyconnect.expasy.org/browser/structures/3318" }, { "database": "PubMed", "id": "6436240", "url": "https://glygen.org/publication/PubMed/6436240" } ], "common_name": "Pig", "glygen_name": "Pig", "reference_species": "Sus scrofa [9823]" }, { "taxid": 10116, "name": "Rattus norvegicus", "annotation_category": "direct", "evidence": [ { "database": "GlyConnect", "id": "3318", "url": "https://glyconnect.expasy.org/browser/structures/3318" }, { "database": "GlyCosmos", "id": "G00033MO", "url": "https://glycosmos.org/glycans/show/G00033MO" }, { "database": "PubMed", "id": "6882773", "url": "https://glygen.org/publication/PubMed/6882773" }, { "database": "PubMed", "id": "7061510", "url": "https://glygen.org/publication/PubMed/7061510" } ], "common_name": "Rat", "glygen_name": "Rat", "reference_species": "Rattus norvegicus [10116]" }, { "taxid": 2697049, "name": "Severe acute respiratory syndrome coronavirus 2", "annotation_category": "direct", "evidence": [ { "database": "GlyConnect", "id": "3318", "url": "https://glyconnect.expasy.org/browser/structures/3318" }, { "database": "GlyCosmos", "id": "G00033MO", "url": "https://glycosmos.org/glycans/show/G00033MO" }, { "database": "PubMed", "id": "33871970", "url": "https://glygen.org/publication/PubMed/33871970" } ], "common_name": "2019-nCoV", "glygen_name": "SARS-CoV-2", "reference_species": "Severe acute respiratory syndrome coronavirus 2 [2697049]" } ], "classification": [ { "type": { "name": "O-linked", "url": "" }, "subtype": { "name": "Core 2", "url": "" } } ], "enzyme": [ { "uniprot_canonical_ac": "E5D8G1-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase", "gene": "Galntl6", "gene_link": "https://www.uniprot.org/uniprot/E5D8G1", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "G3X942-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase", "gene": "Galnt9", "gene_link": "https://www.uniprot.org/uniprot/G3X942", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "O08832-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 4", "gene": "Galnt4", "gene_link": "https://www.uniprot.org/uniprot/O08832", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "O08912-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 1", "gene": "Galnt1", "gene_link": "https://www.uniprot.org/uniprot/O08912", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "P70419-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 3", "gene": "Galnt3", "gene_link": "https://www.uniprot.org/uniprot/P70419", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q10471-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 2", "gene": "GALNT2", "gene_link": "https://www.uniprot.org/uniprot/Q10471", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q10472-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 1", "gene": "GALNT1", "gene_link": "https://www.uniprot.org/uniprot/Q10472", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q14435-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 3", "gene": "GALNT3", "gene_link": "https://www.uniprot.org/uniprot/Q14435", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q49A17-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase-like 6", "gene": "GALNTL6", "gene_link": "https://www.uniprot.org/uniprot/Q49A17", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q6IS24-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 17", "gene": "GALNT17", "gene_link": "https://www.uniprot.org/uniprot/Q6IS24", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q6P9A2-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 18", "gene": "GALNT18", "gene_link": "https://www.uniprot.org/uniprot/Q6P9A2", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q6P9S7-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 10", "gene": "Galnt10", "gene_link": "https://www.uniprot.org/uniprot/Q6P9S7", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q6PB93-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 2", "gene": "Galnt2", "gene_link": "https://www.uniprot.org/uniprot/Q6PB93", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q7TT15-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 17", "gene": "Galnt17", "gene_link": "https://www.uniprot.org/uniprot/Q7TT15", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q7Z4T8-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Inactive polypeptide N-acetylgalactosaminyltransferase-like protein 5", "gene": "GALNTL5", "gene_link": "https://www.uniprot.org/uniprot/Q7Z4T8", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q7Z7M9-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 5", "gene": "GALNT5", "gene_link": "https://www.uniprot.org/uniprot/Q7Z7M9", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q80VA0-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "N-acetylgalactosaminyltransferase 7", "gene": "Galnt7", "gene_link": "https://www.uniprot.org/uniprot/Q80VA0", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q86SF2-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "N-acetylgalactosaminyltransferase 7", "gene": "GALNT7", "gene_link": "https://www.uniprot.org/uniprot/Q86SF2", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q86SR1-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 10", "gene": "GALNT10", "gene_link": "https://www.uniprot.org/uniprot/Q86SR1", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q8BGT9-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 12", "gene": "Galnt12", "gene_link": "https://www.uniprot.org/uniprot/Q8BGT9", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q8BVG5-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 14", "gene": "Galnt14", "gene_link": "https://www.uniprot.org/uniprot/Q8BVG5", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q8C102-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 5", "gene": "Galnt5", "gene_link": "https://www.uniprot.org/uniprot/Q8C102", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q8C7U7-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 6", "gene": "Galnt6", "gene_link": "https://www.uniprot.org/uniprot/Q8C7U7", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q8CF93-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 13", "gene": "Galnt13", "gene_link": "https://www.uniprot.org/uniprot/Q8CF93", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q8IUC8-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 13", "gene": "GALNT13", "gene_link": "https://www.uniprot.org/uniprot/Q8IUC8", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q8IXK2-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 12", "gene": "GALNT12", "gene_link": "https://www.uniprot.org/uniprot/Q8IXK2", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q8K1B9-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 18", "gene": "Galnt18", "gene_link": "https://www.uniprot.org/uniprot/Q8K1B9", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q8N3T1-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 15", "gene": "GALNT15", "gene_link": "https://www.uniprot.org/uniprot/Q8N3T1", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q8N428-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 16", "gene": "GALNT16", "gene_link": "https://www.uniprot.org/uniprot/Q8N428", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q8N4A0-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 4", "gene": "GALNT4", "gene_link": "https://www.uniprot.org/uniprot/Q8N4A0", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q8NCL4-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 6", "gene": "GALNT6", "gene_link": "https://www.uniprot.org/uniprot/Q8NCL4", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q8NCW6-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 11", "gene": "GALNT11", "gene_link": "https://www.uniprot.org/uniprot/Q8NCW6", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q921L8-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 11", "gene": "Galnt11", "gene_link": "https://www.uniprot.org/uniprot/Q921L8", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q96FL9-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 14", "gene": "GALNT14", "gene_link": "https://www.uniprot.org/uniprot/Q96FL9", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q9D2N8-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 15", "gene": "Galnt15", "gene_link": "https://www.uniprot.org/uniprot/Q9D2N8", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q9D4M9-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Inactive polypeptide N-acetylgalactosaminyltransferase-like protein 5", "gene": "Galntl5", "gene_link": "https://www.uniprot.org/uniprot/Q9D4M9", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q9HCQ5-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 9", "gene": "GALNT9", "gene_link": "https://www.uniprot.org/uniprot/Q9HCQ5", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q9JJ61-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Polypeptide N-acetylgalactosaminyltransferase 16", "gene": "Galnt16", "gene_link": "https://www.uniprot.org/uniprot/Q9JJ61", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q96EU7-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "C1GALT1-specific chaperone 1", "gene": "C1GALT1C1", "gene_link": "https://www.uniprot.org/uniprot/Q96EU7", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q9JJ06-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1", "gene": "C1galt1", "gene_link": "https://www.uniprot.org/uniprot/Q9JJ06", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q9JMG2-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "C1GALT1-specific chaperone 1", "gene": "C1galt1c1", "gene_link": "https://www.uniprot.org/uniprot/Q9JMG2", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q9NS00-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1", "gene": "C1GALT1", "gene_link": "https://www.uniprot.org/uniprot/Q9NS00", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "O95395-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3", "gene": "GCNT3", "gene_link": "https://www.uniprot.org/uniprot/O95395", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "P97402-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "N-acetyllactosaminide beta-1,6-N-acetylglucosaminyl-transferase", "gene": "Gcnt2", "gene_link": "https://www.uniprot.org/uniprot/P97402", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q02742-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase", "gene": "GCNT1", "gene_link": "https://www.uniprot.org/uniprot/Q02742", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q09324-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase", "gene": "Gcnt1", "gene_link": "https://www.uniprot.org/uniprot/Q09324", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q5JCT0-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3", "gene": "Gcnt3", "gene_link": "https://www.uniprot.org/uniprot/Q5JCT0", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] }, { "uniprot_canonical_ac": "Q8N0V5-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G00033MO", "protein_name": "N-acetyllactosaminide beta-1,6-N-acetylglucosaminyl-transferase", "gene": "GCNT2", "gene_link": "https://www.uniprot.org/uniprot/Q8N0V5", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G00033MO", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G00033MO" } ] } ], "crossref": [ { "id": "52921656", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/52921656", "database": "PubChem Compound", "categories": [ "Chemical" ] }, { "id": "252289141", "url": "https://pubchem.ncbi.nlm.nih.gov/substance/252289141", "database": "PubChem Substance", "categories": [ "Chemical" ] }, { "id": "G00025", "url": "https://www.genome.jp/dbget-bin/www_bget?gl:G00025", "database": "KEGG Glycan", "categories": [ "Enzyme and Pathway" ] }, { "id": "1009", "url": "", "database": "Glycosciences.de", "categories": [ "Glycomics" ] }, { "id": "1010", "url": "", "database": "Glycosciences.de", "categories": [ "Glycomics" ] }, { "id": "14228", "url": "", "database": "Glycosciences.de", "categories": [ "Glycomics" ] }, { "id": "16761", "url": "", "database": "Glycosciences.de", "categories": [ "Glycomics" ] }, { "id": "17155", "url": "", "database": "Glycosciences.de", "categories": [ "Glycomics" ] }, { "id": "17223", "url": "", "database": "Glycosciences.de", "categories": [ "Glycomics" ] }, { "id": "3237", "url": "", "database": "Glycosciences.de", "categories": [ "Glycomics" ] }, { "id": "9125", "url": "", "database": "Glycosciences.de", "categories": [ "Glycomics" ] }, { "id": "3318", "url": "https://glyconnect.expasy.org/browser/structures/3318", "database": "GlyConnect", "categories": [ "Glycoproteomics", "Glycomics" ] }, { "id": "carbSynthe_0124_D000", "url": "", "database": "CFG", "categories": [ "Glycomics" ] }, { "id": "carbSynthe_0624_D000", "url": "", "database": "CFG", "categories": [ "Glycomics" ] }, { "id": "carbSynthe_0901_D000", "url": "", "database": "CFG", "categories": [ "Glycomics" ] }, { "id": "13751", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+13751", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "16601", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+16601", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "23753", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+23753", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "2452", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+2452", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "2453", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+2453", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "30426", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+30426", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "30851", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+30851", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "33633", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+33633", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "34767", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+34767", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "3486", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+3486", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "3487", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+3487", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "35109", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+35109", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "35110", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+35110", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "36265", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+36265", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "38265", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+38265", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "38269", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+38269", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "38650", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+38650", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "42743", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+42743", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "46429", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+46429", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "47878", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+47878", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "62158", "url": "https://www.ebi.ac.uk/chebi/searchId.do?chebiId=62158", "database": "ChEBI", "categories": [] }, { "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO", "database": "GlyTouCan", "categories": [ "Glycomics" ] }, { "id": "G00033MO", "url": "https://sandbox.glyomics.org/explore.html?G00033MO", "database": "SandBox", "categories": [ "Enzyme and Pathway" ] }, { "id": "G00033MO", "url": "https://gnome.glyomics.org/restrictions/GlyGen.StructureBrowser.html?focus=G00033MO", "database": "GNOme", "categories": [ "Ontology and Dictionary", "Glycomics" ] }, { "id": "G00033MO", "url": "https://glycosmos.org/glycans/show/G00033MO", "database": "GlyCosmos", "categories": [ "Glycoproteomics", "Glycomics" ] }, { "id": "GSD000046", "url": "https://wiki.glygen.org/Glycan_structure_dictionary#GSD000046", "database": "Glycan Structure Dictionary", "categories": [ "Ontology and Dictionary" ] }, { "id": "10770800GAR", "url": "https://glygen.ccrc.uga.edu/ggarray/glycanDetail/10770800GAR", "database": "Glycan Array Data Repository", "categories": [] } ], "glycoprotein": [ { "uniprot_canonical_ac": "P15941-1", "evidence": [ { "database": "PubMed", "id": "9530955", "url": "https://glygen.org/publication/PubMed/9530955" }, { "database": "GlyConnect", "id": "413", "url": "https://glyconnect.expasy.org/browser/proteins/413" } ], "protein_name": "Mucin-1", "gene_name": "MUC1", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P01876-2", "evidence": [ { "database": "PubMed", "id": "7215351", "url": "https://glygen.org/publication/PubMed/7215351" }, { "database": "GlyConnect", "id": "230", "url": "https://glyconnect.expasy.org/browser/proteins/230" } ], "protein_name": "Immunoglobulin heavy constant alpha 1", "gene_name": "IGHA1", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P21754-1", "evidence": [ { "database": "PubMed", "id": "14673092", "url": "https://glygen.org/publication/PubMed/14673092" }, { "database": "GlyConnect", "id": "634", "url": "https://glyconnect.expasy.org/browser/proteins/634" } ], "protein_name": "Zona pellucida sperm-binding protein 3", "gene_name": "ZP3", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "Q92954-1", "start_pos": 485, "end_pos": 485, "residue": "Thr", "evidence": [ { "database": "PubMed", "id": "25187573", "url": "https://glygen.org/publication/PubMed/25187573" }, { "database": "GlyConnect", "id": "762", "url": "https://glyconnect.expasy.org/browser/proteins/762" } ], "protein_name": "Proteoglycan 4", "gene_name": "PRG4", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "Q92954-1", "start_pos": 676, "end_pos": 676, "residue": "Thr", "evidence": [ { "database": "PubMed", "id": "25187573", "url": "https://glygen.org/publication/PubMed/25187573" }, { "database": "GlyConnect", "id": "762", "url": "https://glyconnect.expasy.org/browser/proteins/762" } ], "protein_name": "Proteoglycan 4", "gene_name": "PRG4", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "Q9BYF1-1", "evidence": [ { "database": "PubMed", "id": "32841605", "url": "https://glygen.org/publication/PubMed/32841605" }, { "database": "GlyConnect", "id": "1012", "url": "https://glyconnect.expasy.org/browser/proteins/1012" } ], "protein_name": "Angiotensin-converting enzyme 2", "gene_name": "ACE2", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P12259-1", "start_pos": 310, "end_pos": 310, "residue": "Ser", "evidence": [ { "database": "PubMed", "id": "32310329", "url": "https://glygen.org/publication/PubMed/32310329" }, { "database": "GlyConnect", "id": "1120", "url": "https://glyconnect.expasy.org/browser/proteins/1120" } ], "protein_name": "Coagulation factor V", "gene_name": "F5", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P20239-1", "evidence": [ { "database": "PubMed", "id": "14673092", "url": "https://glygen.org/publication/PubMed/14673092" }, { "database": "GlyConnect", "id": "630", "url": "https://glyconnect.expasy.org/browser/proteins/630" } ], "protein_name": "Zona pellucida sperm-binding protein 2", "gene_name": "Zp2", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse" }, { "uniprot_canonical_ac": "P10761-1", "evidence": [ { "database": "PubMed", "id": "14673092", "url": "https://glygen.org/publication/PubMed/14673092" }, { "database": "GlyConnect", "id": "633", "url": "https://glyconnect.expasy.org/browser/proteins/633" } ], "protein_name": "Zona pellucida sperm-binding protein 3", "gene_name": "Zp3", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse" }, { "uniprot_canonical_ac": "P0DTC2-1", "start_pos": 323, "end_pos": 323, "residue": "Thr", "evidence": [ { "database": "PubMed", "id": "33871970", "url": "https://glygen.org/publication/PubMed/33871970" }, { "database": "GlyConnect", "id": "2956", "url": "https://glyconnect.expasy.org/browser/proteins/2956" } ], "protein_name": "Spike glycoprotein", "gene_name": "S", "tax_id": 2697049, "tax_name": "Severe acute respiratory syndrome coronavirus 2", "tax_common_name": "2019-nCoV" } ], "publication": [ { "title": "Structural characterization of neutral oligosaccharides with blood-group A and H activity isolated from bovine submaxillary mucin.", "journal": "The Biochemical journal", "date": "1991-10-01", "authors": "Savage A V, D'Arcy S M, Donoghue C M", "evidence": [ { "database": "GlyTouCan", "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO" }, { "database": "GlyConnect", "id": "397", "url": "https://glyconnect.expasy.org/browser/proteins/397" } ], "reference": [ { "type": "PubMed", "id": "1718265", "url": "https://glygen.org/publication/PubMed/1718265" } ] }, { "title": "Neutral oligosaccharides of bovine submaxillary mucin. A combined mass spectrometry and 1H-NMR study.", "journal": "European journal of biochemistry", "date": "1992-01-15", "authors": "Chai W G, Hounsell E F, Cashmore G C, Rosankiewicz J R, Bauer C J, Feeney J, Feizi T, Lawson A M", "evidence": [ { "database": "GlyTouCan", "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO" }, { "database": "GlyConnect", "id": "397", "url": "https://glyconnect.expasy.org/browser/proteins/397" } ], "reference": [ { "type": "PubMed", "id": "1730232", "url": "https://glygen.org/publication/PubMed/1730232" } ] }, { "title": "Carbohydrate structures of bovine submaxillary mucin.", "journal": "Carbohydrate research", "date": "1986-08-15", "authors": "Tsuji T, Osawa T", "evidence": [ { "database": "GlyTouCan", "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO" }, { "database": "GlyConnect", "id": "397", "url": "https://glyconnect.expasy.org/browser/proteins/397" } ], "reference": [ { "type": "PubMed", "id": "3768900", "url": "https://glygen.org/publication/PubMed/3768900" } ] }, { "title": "Neutral core oligosaccharides of bovine submaxillary mucin--use of lead tetraacetate in the cold for establishing branch positions.", "journal": "European journal of biochemistry", "date": "1998-12-01", "authors": "M\u00e5rtensson S, Levery S B, Fang T T, Bendiak B", "evidence": [ { "database": "GlyTouCan", "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO" }, { "database": "GlyConnect", "id": "397", "url": "https://glyconnect.expasy.org/browser/proteins/397" } ], "reference": [ { "type": "PubMed", "id": "9874229", "url": "https://glygen.org/publication/PubMed/9874229" } ] }, { "title": "The diversity of O-linked glycans expressed during Drosophila melanogaster development reflects stage- and tissue-specific requirements for cell signaling.", "journal": "The Journal of biological chemistry", "date": "2008", "authors": "Aoki K, Porterfield M, Lee SS, Dong B, Nguyen K, McGlamry KH, Tiemeyer M", "evidence": [ { "database": "GlyTouCan", "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO" }, { "database": "GlyConnect", "id": "3318", "url": "https://glyconnect.expasy.org/browser/structures/3318" } ], "reference": [ { "type": "PubMed", "id": "18725413", "url": "https://glygen.org/publication/PubMed/18725413" } ] }, { "title": "Murine and human zona pellucida 3 derived from mouse eggs express identical O-glycans.", "journal": "Proceedings of the National Academy of Sciences of the United States of America", "date": "2003", "authors": "Dell A, Chalabi S, Easton RL, Haslam SM, Sutton-Smith M, Patankar MS, Lattanzio F, Panico M, Morris HR, Clark GF", "evidence": [ { "database": "GlyTouCan", "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO" }, { "database": "GlyConnect", "id": "634", "url": "https://glyconnect.expasy.org/browser/proteins/634" }, { "database": "GlyConnect", "id": "630", "url": "https://glyconnect.expasy.org/browser/proteins/630" }, { "database": "GlyConnect", "id": "633", "url": "https://glyconnect.expasy.org/browser/proteins/633" } ], "reference": [ { "type": "PubMed", "id": "14673092", "url": "https://glygen.org/publication/PubMed/14673092" } ] }, { "title": "Quantitation and structures of oligosaccharide chains in human trachea mucin glycoproteins.", "journal": "Molecular and cellular biochemistry", "date": "1992", "authors": "Sangadala S, Bhat UR, Mendicino J", "evidence": [ { "database": "GlyTouCan", "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO" }, { "database": "GlyConnect", "id": "401", "url": "https://glyconnect.expasy.org/browser/proteins/401" } ], "reference": [ { "type": "PubMed", "id": "1488058", "url": "https://glygen.org/publication/PubMed/1488058" } ] }, { "title": "The broad diversity of neutral and sialylated oligosaccharides derived from human salivary mucins.", "journal": "Biochemistry", "date": "1992", "authors": "Klein A, Carnoy C, Wieruszeski JM, Strecker G, Strang AM, van Halbeek H, Roussel P, Lamblin G", "evidence": [ { "database": "GlyTouCan", "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO" }, { "database": "GlyConnect", "id": "401", "url": "https://glyconnect.expasy.org/browser/proteins/401" } ], "reference": [ { "type": "PubMed", "id": "1627559", "url": "https://glygen.org/publication/PubMed/1627559" } ] }, { "title": "The O-glycomap of lubricin, a novel mucin responsible for joint lubrication, identified by site-specific glycopeptide analysis.", "journal": "Molecular & cellular proteomics : MCP", "date": "2014", "authors": "Ali L, Flowers SA, Jin C, Bennet EP, Ekwall AK, Karlsson NG", "evidence": [ { "database": "GlyTouCan", "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO" }, { "database": "GlyConnect", "id": "762", "url": "https://glyconnect.expasy.org/browser/proteins/762" } ], "reference": [ { "type": "PubMed", "id": "25187573", "url": "https://glygen.org/publication/PubMed/25187573" } ] }, { "title": "Structural analysis of the O-glycosidically linked core-region oligosaccharides of human meconium glycoproteins which express oncofoetal antigens.", "journal": "European journal of biochemistry", "date": "1985", "authors": "Hounsell EF, Lawson AM, Feeney J, Gooi HC, Pickering NJ, Stoll MS, Lui SC, Feizi T", "evidence": [ { "database": "GlyTouCan", "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO" }, { "database": "GlyConnect", "id": "889", "url": "https://glyconnect.expasy.org/browser/proteins/889" } ], "reference": [ { "type": "PubMed", "id": "2580706", "url": "https://glygen.org/publication/PubMed/2580706" } ] }, { "title": "Characterization of the oligosaccharide alditols from ovarian cyst mucin glycoproteins of blood group A using high pressure liquid chromatography (HPLC) and high field 1H NMR spectroscopy.", "journal": "The Journal of biological chemistry", "date": "1986", "authors": "Dua VK, Rao BN, Wu SS, Dube VE, Bush CA", "evidence": [ { "database": "GlyTouCan", "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO" }, { "database": "GlyConnect", "id": "201", "url": "https://glyconnect.expasy.org/browser/proteins/201" } ], "reference": [ { "type": "PubMed", "id": "3003076", "url": "https://glygen.org/publication/PubMed/3003076" } ] }, { "title": "Comprehensive N- and O-glycosylation mapping of human coagulation factor V.", "journal": "Journal of thrombosis and haemostasis : JTH", "date": "2020-08", "authors": "Ma Cheng, Liu Ding, Li Dong, Zhang Junping, Xu Xiao-Qian, Zhu He, Wan Xiu-Feng, Miao Carol H, Konkle Barbara A, Onigman Philip, Xiao Weidong, Li Lei", "evidence": [ { "database": "GlyTouCan", "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO" }, { "database": "GlyConnect", "id": "1120", "url": "https://glyconnect.expasy.org/browser/proteins/1120" } ], "reference": [ { "type": "PubMed", "id": "32310329", "url": "https://glygen.org/publication/PubMed/32310329" } ] }, { "title": "Virus-Receptor Interactions of Glycosylated SARS-CoV-2 Spike and Human ACE2 Receptor.", "journal": "Cell host & microbe", "date": "2020", "authors": "Zhao P, Praissman JL, Grant OC, Cai Y, Xiao T, Rosenbalm KE, Aoki K, Kellman BP, Bridger R, Barouch DH, Brindley MA, Lewis NE, Tiemeyer M, Chen B, Woods RJ, Wells L", "evidence": [ { "database": "GlyTouCan", "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO" }, { "database": "GlyConnect", "id": "1012", "url": "https://glyconnect.expasy.org/browser/proteins/1012" } ], "reference": [ { "type": "PubMed", "id": "32841605", "url": "https://glygen.org/publication/PubMed/32841605" } ] }, { "title": "Primary structure of neutral oligosaccharides derived from respiratory-mucus glycoproteins of a patient suffering from bronchiectasis, determined by combination of 500-MHz 1H-NMR spectroscopy and quantitative sugar analysis. 1. Structure of 16 oligosaccharides having the Gal beta(1----3)GalNAc-ol core (type 1) or the Gal beta(1----3)[GlcNAc beta(1----6)]GalNac-ol core (type 2).", "journal": "European journal of biochemistry", "date": "1988", "authors": "Klein A, Lamblin G, Lhermitte M, Roussel P, Breg J, Van Halbeek H, Vliegenthart JF", "evidence": [ { "database": "GlyTouCan", "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO" }, { "database": "GlyConnect", "id": "401", "url": "https://glyconnect.expasy.org/browser/proteins/401" } ], "reference": [ { "type": "PubMed", "id": "3345749", "url": "https://glygen.org/publication/PubMed/3345749" } ] }, { "title": "The O-Glycome of Human Nigrostriatal Tissue and Its Alteration in Parkinson's Disease.", "journal": "Journal of proteome research", "date": "2021", "authors": "Wilkinson H, Thomsson KA, Rebelo AL, Hilliard M, Pandit A, Rudd PM, Karlsson NG, Saldova R", "evidence": [ { "database": "GlyTouCan", "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO" }, { "database": "GlyConnect", "id": "3318", "url": "https://glyconnect.expasy.org/browser/structures/3318" } ], "reference": [ { "type": "PubMed", "id": "34191522", "url": "https://glygen.org/publication/PubMed/34191522" } ] }, { "title": "Structure of neutral oligosaccharides derived from mucus glycoproteins of human seminal plasma.", "journal": "European journal of biochemistry", "date": "1986", "authors": "Hanisch FG, Egge H, Peter-Katalinic J, Uhlenbruck G", "evidence": [ { "database": "GlyTouCan", "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO" }, { "database": "GlyConnect", "id": "973", "url": "https://glyconnect.expasy.org/browser/proteins/973" } ], "reference": [ { "type": "PubMed", "id": "3956483", "url": "https://glygen.org/publication/PubMed/3956483" } ] }, { "title": "Structures of oligosaccharides produced by base--borohydride degradation of human ovarian cyst blood group H, Le-b and Le-a active glycoproteins.", "journal": "Biochemistry", "date": "1973", "authors": "Rovis L, Anderson B, Kabat EA, Gruenzo F, Liao J", "evidence": [ { "database": "GlyTouCan", "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO" }, { "database": "GlyConnect", "id": "828", "url": "https://glyconnect.expasy.org/browser/proteins/828" } ], "reference": [ { "type": "PubMed", "id": "4357339", "url": "https://glygen.org/publication/PubMed/4357339" } ] }, { "title": "Immunochemical studies on blood groups. Purification and characterization of radioactive 3H-reduced di- to hexasaccharides produced by alkaline beta-elimination-borohydride 3H reduction of Smith degraded blood group A active glycoproteins.", "journal": "The Journal of biological chemistry", "date": "1984", "authors": "Wu AM, Kabat EA, Nilsson B, Zopf DA, Gruezo FG, Liao J", "evidence": [ { "database": "GlyTouCan", "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO" }, { "database": "GlyConnect", "id": "201", "url": "https://glyconnect.expasy.org/browser/proteins/201" } ], "reference": [ { "type": "PubMed", "id": "6539332", "url": "https://glygen.org/publication/PubMed/6539332" } ] }, { "title": "Isolation and characterisation of neutral oligosaccharides from human bronchial glycoproteins.", "journal": "Advances in experimental medicine and biology", "date": "1982", "authors": "Lamblin G, Lhermitte M, Boersma A, Roussel P, Van Halbeek H, Dorland L, Vliegenthart JF", "evidence": [ { "database": "GlyTouCan", "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO" }, { "database": "GlyConnect", "id": "401", "url": "https://glyconnect.expasy.org/browser/proteins/401" } ], "reference": [ { "type": "PubMed", "id": "7080930", "url": "https://glygen.org/publication/PubMed/7080930" } ] }, { "title": "Primary-structure determination of fourteen neutral oligosaccharides derived from bronchial-mucus glycoproteins of patients suffering from cystic fibrosis, employing 500-MHz 1H-NMR spectroscopy.", "journal": "European journal of biochemistry", "date": "1982", "authors": "Van Halbeek H, Dorland L, Vliegenthart JF, Hull WE, Lamblin G, Lhermitte M, Boersma A, Roussel P", "evidence": [ { "database": "GlyTouCan", "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO" }, { "database": "GlyConnect", "id": "401", "url": "https://glyconnect.expasy.org/browser/proteins/401" } ], "reference": [ { "type": "PubMed", "id": "7140761", "url": "https://glygen.org/publication/PubMed/7140761" } ] }, { "title": "Heterogeneity of the glycans O-glycosidically linked to the hinge region of secretory immunoglobulins from human milk.", "journal": "European journal of biochemistry", "date": "1981", "authors": "Pierce-Cretel A, Pamblanco M, Strecker G, Montreuil J, Spik G", "evidence": [ { "database": "GlyTouCan", "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO" }, { "database": "GlyConnect", "id": "230", "url": "https://glyconnect.expasy.org/browser/proteins/230" } ], "reference": [ { "type": "PubMed", "id": "7215351", "url": "https://glygen.org/publication/PubMed/7215351" } ] }, { "title": "Immunochemical studies on blood groups. Structures and immunochemical properties of oligosaccharides from two fractions of blood group substance from human ovarian cyst fluid differing in B, I, and i activities and reactivity toward concanavalin A.", "journal": "Archives of biochemistry and biophysics", "date": "1976", "authors": "McAuliffe FM, Kabat EA", "evidence": [ { "database": "GlyTouCan", "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO" }, { "database": "GlyConnect", "id": "828", "url": "https://glyconnect.expasy.org/browser/proteins/828" } ], "reference": [ { "type": "PubMed", "id": "952526", "url": "https://glygen.org/publication/PubMed/952526" } ] }, { "title": "Purification and characterization of the MUC1 mucin-type glycoprotein, epitectin, from human urine: structures of the major oligosaccharide alditols.", "journal": "Glycoconjugate journal", "date": "1998", "authors": "Bhavanandan VP, Zhu Q, Yamakami K, Dilulio NA, Nair S, Capon C, Lemoine J, Fournet B", "evidence": [ { "database": "GlyTouCan", "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO" }, { "database": "GlyConnect", "id": "413", "url": "https://glyconnect.expasy.org/browser/proteins/413" } ], "reference": [ { "type": "PubMed", "id": "9530955", "url": "https://glygen.org/publication/PubMed/9530955" } ] }, { "title": "Mammalian brain glycoproteins exhibit diminished glycan complexity compared to other tissues.", "journal": "Nature communications", "date": "2022-01-12", "authors": "Williams Sarah E, Noel Maxence, Lehoux Sylvain, Cetinbas Murat, Xavier Ramnik J, Sadreyev Ruslan I, Scolnick Edward M, Smoller Jordan W, Cummings Richard D, Mealer Robert G", "evidence": [ { "database": "GlyTouCan", "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO" }, { "database": "GlyConnect", "id": "3318", "url": "https://glyconnect.expasy.org/browser/structures/3318" } ], "reference": [ { "type": "PubMed", "id": "35022400", "url": "https://glygen.org/publication/PubMed/35022400" } ] }, { "title": "Purification and structures of oligosaccharide chains in swine trachea and Cowper's gland mucin glycoproteins.", "journal": "The Journal of biological chemistry", "date": "1984-10-25", "authors": "Rana S S, Chandrasekaran E V, Kennedy J, Mendicino J", "evidence": [ { "database": "GlyTouCan", "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO" } ], "reference": [ { "type": "PubMed", "id": "6436240", "url": "https://glygen.org/publication/PubMed/6436240" } ] }, { "title": "Terminal alpha (1 leads to 4)-linked N-acetylglucosamine: a characteristic constituent of duodenal-gland mucous glycoproteins in rat and pig. A high-resolution 1H-NMR study.", "journal": "Biochimica et biophysica acta", "date": "1983", "authors": "Van Halbeek H, Gerwig GJ, Vliegenthart JF, Smits HL, Van Kerkhof PJ, Kramer MF", "evidence": [ { "database": "GlyTouCan", "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO" }, { "database": "GlyConnect", "id": "385", "url": "https://glyconnect.expasy.org/browser/proteins/385" } ], "reference": [ { "type": "PubMed", "id": "6882773", "url": "https://glygen.org/publication/PubMed/6882773" } ] }, { "title": "Structure of O-glycosidically linked sugar units from plasma membranes of an ascites hepatoma, AH 66.", "journal": "The Journal of biological chemistry", "date": "1982", "authors": "Funakoshi I, Yamashina I", "evidence": [ { "database": "GlyTouCan", "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO" }, { "database": "GlyConnect", "id": "924", "url": "https://glyconnect.expasy.org/browser/proteins/924" } ], "reference": [ { "type": "PubMed", "id": "7061510", "url": "https://glygen.org/publication/PubMed/7061510" } ] }, { "title": "Structural and Functional Characterization of SARS-CoV-2 RBD Domains Produced in Mammalian Cells.", "journal": "Analytical chemistry", "date": "2021", "authors": "Gstottner C, Zhang T, Resemann A, Ruben S, Pengelley S, Suckau D, Welsink T, Wuhrer M, Dominguez-Vega E", "evidence": [ { "database": "GlyTouCan", "id": "G00033MO", "url": "https://glytoucan.org/Structures/Glycans/G00033MO" }, { "database": "GlyConnect", "id": "2956", "url": "https://glyconnect.expasy.org/browser/proteins/2956" } ], "reference": [ { "type": "PubMed", "id": "33871970", "url": "https://glygen.org/publication/PubMed/33871970" } ] } ], "residues": [ { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.E5D8G1-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.G3X942-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.O08832-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.O08912-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.P70419-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q10471-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q10472-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q14435-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q49A17-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q6IS24-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q6P9A2-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q6P9S7-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q6PB93-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q7TT15-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q7Z4T8-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q7Z7M9-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q80VA0-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q86SF2-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q86SR1-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8BGT9-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8BVG5-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8C102-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8C7U7-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8CF93-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8IUC8-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8IXK2-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8K1B9-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8N3T1-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8N428-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8N4A0-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8NCL4-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8NCW6-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q921L8-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q96FL9-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q9D2N8-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q9D4M9-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q9HCQ5-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q9JJ61-1", "detachedby": "", "parentid": "0" }, { "id": "O152", "name": "O-glycan_b-D-Galp_152", "attachedby": "rxn.Q96EU7-1", "detachedby": "", "parentid": "OC" }, { "id": "O152", "name": "O-glycan_b-D-Galp_152", "attachedby": "rxn.Q9JJ06-1", "detachedby": "", "parentid": "OC" }, { "id": "O152", "name": "O-glycan_b-D-Galp_152", "attachedby": "rxn.Q9JMG2-1", "detachedby": "", "parentid": "OC" }, { "id": "O152", "name": "O-glycan_b-D-Galp_152", "attachedby": "rxn.Q9NS00-1", "detachedby": "", "parentid": "OC" }, { "id": "O157", "name": "O-glycan_b-D-GlcpNAc_157", "attachedby": "rxn.O95395-1", "detachedby": "", "parentid": "OC" }, { "id": "O157", "name": "O-glycan_b-D-GlcpNAc_157", "attachedby": "rxn.P97402-1", "detachedby": "", "parentid": "OC" }, { "id": "O157", "name": "O-glycan_b-D-GlcpNAc_157", "attachedby": "rxn.Q02742-1", "detachedby": "", "parentid": "OC" }, { "id": "O157", "name": "O-glycan_b-D-GlcpNAc_157", "attachedby": "rxn.Q09324-1", "detachedby": "", "parentid": "OC" }, { "id": "O157", "name": "O-glycan_b-D-GlcpNAc_157", "attachedby": "rxn.Q5JCT0-1", "detachedby": "", "parentid": "OC" }, { "id": "O157", "name": "O-glycan_b-D-GlcpNAc_157", "attachedby": "rxn.Q8N0V5-1", "detachedby": "", "parentid": "OC" } ], "composition": [ { "name": "6-Deoxy-Hexose", "residue": "dhex", "count": 0, "cid": "840", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840" }, { "name": "Hexose", "residue": "hex", "count": 1, "cid": "206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206" }, { "name": "N-Acetylhexosamine", "residue": "hexnac", "count": 2, "cid": "899", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899" }, { "name": "Hexuronic Acid", "residue": "hexa", "count": 0, "cid": "610", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610" }, { "name": "2-Amino-2-Deoxy-Hexose", "residue": "hexn", "count": 0, "cid": "739", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739" }, { "name": "N-Acetyl-Neuraminic Acid", "residue": "neuac", "count": 0, "cid": "439197", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197" }, { "name": "N-Glycolyl-Neuraminic Acid", "residue": "neugc", "count": 0, "cid": "440001", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001" }, { "name": "Phosphate", "residue": "p", "count": 0, "cid": "1061", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061" }, { "name": "Pentose", "residue": "pent", "count": 0, "cid": "229", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229" }, { "name": "Sulfate", "residue": "s", "count": 0, "cid": "1117", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117" }, { "name": "Other", "residue": "other", "count": 0 } ], "composition_expanded": [ { "name": "Alditol", "residue": "aldi", "count": 0 }, { "name": "6-Deoxy-Hexose", "residue": "dhex", "count": 0, "cid": "840", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840" }, { "name": "6-Deoxy-Hexitol", "residue": "dhex+aldi", "count": 0 }, { "name": "L-Fucose", "residue": "fuc", "count": 0, "cid": "17106", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/17106" }, { "name": "L-Fucitol", "residue": "fuc+aldi", "count": 0, "cid": "445724", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/445724" }, { "name": "D-Galactose", "residue": "gal", "count": 1, "cid": "6036", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6036" }, { "name": "D-Galactitol", "residue": "gal+aldi", "count": 0, "cid": "11850", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11850" }, { "name": "N-Acetyl-D-galactosamine", "residue": "galnac", "count": 1, "cid": "35717", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/35717" }, { "name": "N-Acetylgalactosaminitol", "residue": "galnac+aldi", "count": 0, "cid": "165880", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165880" }, { "name": "D-Galacturonic Acid", "residue": "gala", "count": 0, "cid": "439215", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439215" }, { "name": "D-Glucose", "residue": "glc", "count": 0, "cid": "5793", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5793" }, { "name": "D-Glucitol", "residue": "glc+aldi", "count": 0, "cid": "5780", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5780" }, { "name": "D-Glucuronic acid", "residue": "glca", "count": 0, "cid": "94715", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/94715" }, { "name": "D-Glucosamine", "residue": "glcn", "count": 0, "cid": "439213", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439213" }, { "name": "N-Acetyl-D-Glucosamine", "residue": "glcnac", "count": 1, "cid": "439174", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439174" }, { "name": "N-Acetyl-D-glucosaminitol", "residue": "glcnac+aldi", "count": 0, "cid": "165206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165206" }, { "name": "Hexose", "residue": "hex", "count": 1, "cid": "206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206" }, { "name": "N-Acetylhexosamine", "residue": "hexnac", "count": 2, "cid": "899", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899" }, { "name": "Hexuronic Acid", "residue": "hexa", "count": 0, "cid": "610", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610" }, { "name": "2-Amino-2-Deoxy-Hexose", "residue": "hexn", "count": 0, "cid": "739", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739" }, { "name": "Hexitol", "residue": "hex+aldi", "count": 0, "cid": "453", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/453" }, { "name": "N-Acetylhexosaminitol", "residue": "hexnac+aldi", "count": 0 }, { "name": "L-Iduronic acid", "residue": "idoa", "count": 0, "cid": "441039", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/441039" }, { "name": "D-Mannose", "residue": "man", "count": 0, "cid": "18950", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18950" }, { "name": "D-Mannitol", "residue": "man+aldi", "count": 0, "cid": "6251", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6251" }, { "name": "N-Acetyl-D-mannosamine", "residue": "mannac", "count": 0, "cid": "439281", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439281" }, { "name": "Methyl", "residue": "me", "count": 0 }, { "name": "N-Acetyl-Neuraminic Acid", "residue": "neuac", "count": 0, "cid": "439197", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197" }, { "name": "N-Glycolyl-Neuraminic Acid", "residue": "neugc", "count": 0, "cid": "440001", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001" }, { "name": "Phosphate", "residue": "p", "count": 0, "cid": "1061", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061" }, { "name": "Pentose", "residue": "pent", "count": 0, "cid": "229", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229" }, { "name": "Sulfate", "residue": "s", "count": 0, "cid": "1117", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117" }, { "name": "Sialic acid", "residue": "sia", "count": 0 }, { "name": "Other", "residue": "other", "count": 0 }, { "name": "Floating substituent", "residue": "x", "count": 0 }, { "name": "D-Xylose", "residue": "xyl", "count": 0, "cid": "135191", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135191" }, { "name": "Ketodeoxynononic acid", "residue": "kdn", "count": 0, "cid": "13991616", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13991616" } ], "motifs": [], "interactions": [], "expression": [ { "category": "tissue", "tissue": { "name": "submandibular gland", "namespace": "UBERON", "id": "0001736", "url": "http://purl.obolibrary.org/obo/UBERON_0001736" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "3318", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/3318" }, { "id": "1730232", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/1730232" }, { "id": "3768900", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/3768900" }, { "id": "1718265", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/1718265" }, { "id": "9874229", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/9874229" } ] }, { "category": "tissue", "tissue": { "name": "embryo", "namespace": "UBERON", "id": "0000922", "url": "http://purl.obolibrary.org/obo/UBERON_0000922" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "3318", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/3318" }, { "id": "18725413", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/18725413" } ] }, { "category": "tissue", "tissue": { "name": "urine", "namespace": "UBERON", "id": "0001088", "url": "http://purl.obolibrary.org/obo/UBERON_0001088" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "3318", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/3318" }, { "id": "9530955", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/9530955" } ], "uniprot_canonical_ac": "P15941-1" }, { "category": "tissue", "tissue": { "name": "uterine cervix", "namespace": "UBERON", "id": "0000002", "url": "http://purl.obolibrary.org/obo/UBERON_0000002" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "3318", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/3318" }, { "id": "9530955", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/9530955" } ], "uniprot_canonical_ac": "P15941-1" }, { "category": "tissue", "tissue": { "name": "saliva", "namespace": "UBERON", "id": "0001836", "url": "http://purl.obolibrary.org/obo/UBERON_0001836" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "3318", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/3318" }, { "id": "1627559", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/1627559" } ] }, { "category": "tissue", "tissue": { "name": "ovary", "namespace": "UBERON", "id": "0000992", "url": "http://purl.obolibrary.org/obo/UBERON_0000992" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "3318", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/3318" }, { "id": "6539332", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/6539332" }, { "id": "3003076", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/3003076" }, { "id": "4357339", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/4357339" }, { "id": "952526", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/952526" } ] }, { "category": "tissue", "tissue": { "name": "milk", "namespace": "UBERON", "id": "0001913", "url": "http://purl.obolibrary.org/obo/UBERON_0001913" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "3318", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/3318" }, { "id": "7215351", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/7215351" } ], "uniprot_canonical_ac": "P01876-2" }, { "category": "tissue", "tissue": { "name": "meconium", "namespace": "UBERON", "id": "0007109", "url": "http://purl.obolibrary.org/obo/UBERON_0007109" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "3318", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/3318" }, { "id": "2580706", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/2580706" } ] }, { "category": "tissue", "tissue": { "name": "seminal fluid", "namespace": "UBERON", "id": "0006530", "url": "http://purl.obolibrary.org/obo/UBERON_0006530" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "3318", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/3318" }, { "id": "3956483", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/3956483" } ] }, { "category": "tissue", "tissue": { "name": "zona pellucida", "namespace": "UBERON", "id": "0000086", "url": "http://purl.obolibrary.org/obo/UBERON_0000086" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "3318", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/3318" }, { "id": "14673092", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/14673092" } ], "uniprot_canonical_ac": "P21754-1" }, { "category": "tissue", "tissue": { "name": "synovial fluid", "namespace": "UBERON", "id": "0001090", "url": "http://purl.obolibrary.org/obo/UBERON_0001090" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "3318", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/3318" }, { "id": "25187573", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/25187573" } ], "start_pos": 485, "end_pos": 485, "residue": "Thr", "uniprot_canonical_ac": "Q92954-1" }, { "category": "tissue", "tissue": { "name": "synovial fluid", "namespace": "UBERON", "id": "0001090", "url": "http://purl.obolibrary.org/obo/UBERON_0001090" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "3318", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/3318" }, { "id": "25187573", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/25187573" } ], "start_pos": 676, "end_pos": 676, "residue": "Thr", "uniprot_canonical_ac": "Q92954-1" }, { "category": "tissue", "tissue": { "name": "blood plasma", "namespace": "UBERON", "id": "0001969", "url": "http://purl.obolibrary.org/obo/UBERON_0001969" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "3318", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/3318" }, { "id": "32310329", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/32310329" } ], "start_pos": 310, "end_pos": 310, "residue": "Ser", "uniprot_canonical_ac": "P12259-1" }, { "category": "tissue", "tissue": { "name": "substantia nigra", "namespace": "UBERON", "id": "0002038", "url": "http://purl.obolibrary.org/obo/UBERON_0002038" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "3318", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/3318" }, { "id": "34191522", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/34191522" } ] }, { "category": "tissue", "tissue": { "name": "cerebellum", "namespace": "UBERON", "id": "0002037", "url": "http://purl.obolibrary.org/obo/UBERON_0002037" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "3318", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/3318" }, { "id": "35022400", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/35022400" } ] }, { "category": "tissue", "tissue": { "name": "zona pellucida", "namespace": "UBERON", "id": "0000086", "url": "http://purl.obolibrary.org/obo/UBERON_0000086" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "3318", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/3318" }, { "id": "14673092", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/14673092" } ], "uniprot_canonical_ac": "P20239-1" }, { "category": "tissue", "tissue": { "name": "zona pellucida", "namespace": "UBERON", "id": "0000086", "url": "http://purl.obolibrary.org/obo/UBERON_0000086" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "3318", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/3318" }, { "id": "14673092", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/14673092" } ], "uniprot_canonical_ac": "P10761-1" }, { "category": "tissue", "tissue": { "name": "duodenal gland", "namespace": "UBERON", "id": "0001212", "url": "http://purl.obolibrary.org/obo/UBERON_0001212" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "3318", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/3318" }, { "id": "6882773", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/6882773" } ] }, { "category": "tissue", "tissue": { "name": "liver", "namespace": "UBERON", "id": "0002107", "url": "http://purl.obolibrary.org/obo/UBERON_0002107" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "3318", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/3318" }, { "id": "7061510", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/7061510" } ] } ], "subsumption": [ { "related_accession": "G00034MO", "relationship": "ancestor" }, { "related_accession": "G10679DE", "relationship": "ancestor" }, { "related_accession": "G10698NC", "relationship": "ancestor" }, { "related_accession": "G26493RP", "relationship": "ancestor" }, { "related_accession": "G27304YE", "relationship": "ancestor" }, { "related_accession": "G29237TW", "relationship": "ancestor" }, { "related_accession": "G30502CS", "relationship": "ancestor" }, { "related_accession": "G31881UK", "relationship": "ancestor" }, { "related_accession": "G32550BI", "relationship": "ancestor" }, { "related_accession": "G32698TB", "relationship": "ancestor" }, { "related_accession": "G34609SH", "relationship": "ancestor" }, { "related_accession": "G39463KK", "relationship": "ancestor" }, { "related_accession": "G40765JD", "relationship": "ancestor" }, { "related_accession": "G41991SU", "relationship": "ancestor" }, { "related_accession": "G43592PN", "relationship": "ancestor" }, { "related_accession": "G49045KA", "relationship": "ancestor" }, { "related_accession": "G53297ZN", "relationship": "ancestor" }, { "related_accession": "G58001LT", "relationship": "ancestor" }, { "related_accession": "G59848RU", "relationship": "ancestor" }, { "related_accession": "G65091TK", "relationship": "ancestor" }, { "related_accession": "G68529CM", "relationship": "ancestor" }, { "related_accession": "G70058BA", "relationship": "ancestor" }, { "related_accession": "G78369LH", "relationship": "ancestor" }, { "related_accession": "G82950HY", "relationship": "ancestor" }, { "related_accession": "G84919ZX", "relationship": "ancestor" }, { "related_accession": "G89721BJ", "relationship": "ancestor" }, { "related_accession": "G58001LT", "relationship": "basecomposition" }, { "related_accession": "G59848RU", "relationship": "composition" }, { "related_accession": "G26493RP", "relationship": "subsumedby" }, { "related_accession": "G40765JD", "relationship": "subsumedby" }, { "related_accession": "G82950HY", "relationship": "subsumedby" }, { "related_accession": "G31881UK", "relationship": "topology" } ], "names": [], "keywords": [ "fully_determined" ], "glycotree_pathways": [ { "source": "G00031MO", "target": "G00033MO", "residue_affected": { "id": "O157", "full_name": "β-D-GlcpNAc" }, "enzymes": [ { "uniprotkb_ac": "Q5JCT0", "tax_name": "Mus musculus" } ] }, { "source": "G57321FI", "target": "G00031MO", "residue_affected": { "id": "O152", "full_name": "β-D-Galp" }, "enzymes": [ { "uniprotkb_ac": "Q9JMG2", "tax_name": "Mus musculus" } ] } ], "dictionary": { "term": "Core 2", "term_in_sentence": "To investigate the biological roles of core 2 O-glycans, we produced and characterized mice deficient in one or more of the three known glycosyltransferases that generate core 2 O-glycans (C2GnT1, C2GnT2, and C2GnT3).[PMID: 19349303]", "publication": "19349303|30315106|23640779|26677400", "definition": "The trisaccharide \u03b2-D-Gal-(1\u21923)-[\u03b2-D-GlcNAc-(1\u21926)]-D-GalNAc with \u03b1 configuration at the anomeric centre of the N-acetylglucosamine residue at the reducing end.[CHEBI:62158]", "term_xref": "GTC:G00033MO|CID:52921656|CHEBI:62158", "synonymns": [ "" ], "function": "", "disease_associations": "", "wikipedia": "", "essentials_of_glycobiology": "", "evidence": [ { "id": "GSD000046", "url": "https://wiki.glygen.org/Glycan_structure_dictionary#GSD000046", "database": "Glycan Structure Dictionary" } ] }, "biomarkers": [], "section_stats": [ { "table_id": "glycoprotein", "table_stats": [ { "field": "total", "count": 10 }, { "field": "total_sites", "count": 4 } ], "sort_fields": [ "uniprot_canonical_ac", "protein_name", "gene_name", "tax_id", "tax_name", "tax_common_name", "start_pos", "end_pos", "residue" ] }, { "table_id": "expression", "table_stats": [ { "field": "total", "count": 19 }, { "field": "total_sites", "count": 3 } ], "sort_fields": [ "category", "tissue.name", "tissue.namespace", "tissue.id", "tissue.url", "abundance", "uniprot_canonical_ac", "start_pos", "end_pos", "residue" ] }, { "table_id": "expression_tissue", "table_stats": [ { "field": "total", "count": 19 }, { "field": "total_sites", "count": 3 } ], "sort_fields": [ "category", "tissue.name", "tissue.namespace", "tissue.id", "tissue.url", "abundance", "uniprot_canonical_ac", "start_pos", "end_pos", "residue" ] }, { "table_id": "expression_cell_line", "table_stats": [ { "field": "total", "count": 0 }, { "field": "total_sites", "count": 0 } ], "sort_fields": [ "category", "abundance", "uniprot_canonical_ac", "start_pos", "end_pos", "residue" ] }, { "table_id": "publication", "table_stats": [ { "field": "total", "count": 28 } ], "sort_fields": [ "title", "journal", "date", "authors" ] } ] }