{ "glytoucan_ac": "G01650PH", "number_monosaccharides": 5, "number_monosaccharides_suffix": "", "mass": 853.31, "mass_pme": 1077.56, "tool_support": { "gnome_glygen_oglycans": "no", "sandbox": "yes", "gnome_glygen": "yes", "gnome": "yes", "gnome_glycotree_oglycans": "no", "pdb": "no", "gnome_glygen_nglycans": "no", "gnome_glycotree_nglycans": "no" }, "fully_determined": "", "missing_score": 196, "glycan_type": "Saccharide", "iupac": "\u03b1-L-Fucp-(1\u21922)-\u03b2-D-Galp-(1\u21923)-\u03b2-D-GlcpNAc-(1\u21923)-\u03b2-D-Galp-(1\u21924)-?-D-Glcp-(1\u2192", "wurcs": "WURCS=2.0/4,5,4/[a2122h-1x_1-5][a2112h-1b_1-5][a2122h-1b_1-5_2*NCC/3=O][a1221m-1a_1-5]/1-2-3-2-4/a4-b1_b3-c1_c3-d1_d2-e1", "glycoct": "RES 1b:x-dglc-HEX-1:5 2b:b-dgal-HEX-1:5 3b:b-dglc-HEX-1:5 4s:n-acetyl 5b:b-dgal-HEX-1:5 6b:a-lgal-HEX-1:5|6:d LIN 1:1o(4+1)2d 2:2o(3+1)3d 3:3d(2+1)4n 4:3o(3+1)5d 5:5o(2+1)6d", "inchi": "InChI=1S/C32H55NO25/c1-7-14(39)18(43)22(47)30(50-7)58-27-19(44)15(40)9(3-34)54-32(27)56-25-13(33-8(2)38)29(52-10(4-35)16(25)41)57-26-17(42)11(5-36)53-31(23(26)48)55-24-12(6-37)51-28(49)21(46)20(24)45/h7,9-32,34-37,39-49H,3-6H2,1-2H3,(H,33,38)/t7-,9+,10+,11+,12+,13+,14+,15-,16+,17-,18+,19-,20+,21+,22-,23+,24+,25+,26-,27+,28?,29-,30-,31-,32-/m0/s1", "glycam": "", "smiles_isomeric": "C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)O[C@@H]2[C@H]([C@H]([C@H](O[C@H]2O[C@@H]3[C@H]([C@@H](O[C@@H]([C@H]3O)CO)O[C@H]4[C@H]([C@H](O[C@H]([C@@H]4O)O[C@@H]5[C@H](OC([C@@H]([C@H]5O)O)O)CO)CO)O)NC(=O)C)CO)O)O)O)O)O", "inchi_key": { "key": "FZIVHOUANIQOMU-YIHIYSSUSA-N", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/FZIVHOUANIQOMU-YIHIYSSUSA-N" }, "byonic": "HexNAc(1)Hex(3)dHex(1) % 853.306316675", "gwb": "freeEnd--1?1D-Glc,p--4b1D-Gal,p--3b1D-GlcNAc,p--3b1D-Gal,p--2a1L-Fuc,p$MONO,Und,0,0,freeEnd", "species": [ { "taxid": 9606, "name": "Homo sapiens", "annotation_category": "both", "evidence": [ { "database": "GlyConnect", "id": "3099", "url": "https://glyconnect.expasy.org/browser/structures/3099" }, { "database": "GlyCosmos", "id": "G01650PH", "url": "https://glycosmos.org/glycans/show/G01650PH" }, { "database": "PubMed", "id": "11425797", "url": "https://glygen.org/publication/PubMed/11425797" }, { "database": "PubMed", "id": "11787698", "url": "https://glygen.org/publication/PubMed/11787698" }, { "database": "PubMed", "id": "20578730", "url": "https://glygen.org/publication/PubMed/20578730" }, { "database": "PubMed", "id": "26613816", "url": "https://glygen.org/publication/PubMed/26613816" }, { "database": "PubMed", "id": "29053807", "url": "https://glygen.org/publication/PubMed/29053807" }, { "database": "PubMed", "id": "29969231", "url": "https://glygen.org/publication/PubMed/29969231" }, { "database": "PubMed", "id": "31409852", "url": "https://glygen.org/publication/PubMed/31409852" }, { "database": "Subsumption", "id": "G00050MO", "url": "https://www.glygen.org/glycan/G00050MO" } ], "common_name": "Human", "glygen_name": "Human", "reference_species": "Homo sapiens [9606]" }, { "taxid": 10090, "name": "Mus musculus", "annotation_category": "subsumption", "evidence": [ { "database": "Subsumption", "id": "G00050MO", "url": "https://www.glygen.org/glycan/G00050MO" } ], "common_name": "Mouse", "glygen_name": "Mouse", "reference_species": "Mus musculus [10090]" }, { "taxid": 9823, "name": "Sus scrofa", "annotation_category": "subsumption", "evidence": [ { "database": "Subsumption", "id": "G00050MO", "url": "https://www.glygen.org/glycan/G00050MO" } ], "common_name": "Pig", "glygen_name": "Pig", "reference_species": "Sus scrofa [9823]" }, { "taxid": 10114, "name": "Rattus", "annotation_category": "subsumption", "evidence": [ { "database": "Subsumption", "id": "G00050MO", "url": "https://www.glygen.org/glycan/G00050MO" } ], "common_name": "Rattus", "glygen_name": "Rattus", "reference_species": "Rattus [10114]" } ], "classification": [ { "type": { "name": "Glycosphingolipid" }, "subtype": { "name": "Lacto series" } } ], "enzyme": [ { "uniprot_canonical_ac": "G5E897-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G01650PH", "protein_name": "Protein O-glucosyltransferase 3", "gene": "Poglut3", "gene_link": "https://www.uniprot.org/uniprot/G5E897", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G01650PH", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G01650PH" } ] }, { "uniprot_canonical_ac": "Q6UW63-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G01650PH", "protein_name": "Protein O-glucosyltransferase 2", "gene": "POGLUT2", "gene_link": "https://www.uniprot.org/uniprot/Q6UW63", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G01650PH", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G01650PH" } ] }, { "uniprot_canonical_ac": "Q7Z4H8-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G01650PH", "protein_name": "Protein O-glucosyltransferase 3", "gene": "POGLUT3", "gene_link": "https://www.uniprot.org/uniprot/Q7Z4H8", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G01650PH", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G01650PH" } ] }, { "uniprot_canonical_ac": "Q8BYB9-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G01650PH", "protein_name": "Protein O-glucosyltransferase 1", "gene": "Poglut1", "gene_link": "https://www.uniprot.org/uniprot/Q8BYB9", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G01650PH", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G01650PH" } ] }, { "uniprot_canonical_ac": "Q8NBL1-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G01650PH", "protein_name": "Protein O-glucosyltransferase 1", "gene": "POGLUT1", "gene_link": "https://www.uniprot.org/uniprot/Q8NBL1", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G01650PH", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G01650PH" } ] }, { "uniprot_canonical_ac": "Q9JHP7-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G01650PH", "protein_name": "Protein O-glucosyltransferase 2", "gene": "Poglut2", "gene_link": "https://www.uniprot.org/uniprot/Q9JHP7", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G01650PH", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G01650PH" } ] } ], "crossref": [ { "id": "50909802", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/50909802", "database": "PubChem Compound", "categories": [ "Chemical" ] }, { "id": "252278640", "url": "https://pubchem.ncbi.nlm.nih.gov/substance/252278640", "database": "PubChem Substance", "categories": [ "Chemical" ] }, { "id": "G00535", "url": "https://www.genome.jp/dbget-bin/www_bget?gl:G00535", "database": "KEGG Glycan", "categories": [ "Enzyme and Pathway" ] }, { "id": "3099", "url": "https://glyconnect.expasy.org/browser/structures/3099", "database": "GlyConnect", "categories": [ "Glycoproteomics", "Glycan" ] }, { "id": "6368", "url": "http://csdb.glycoscience.ru/database/core/search_id.php?mode=record&id_list=6368", "database": "BCSDB", "categories": [ "Glycomics" ] }, { "id": "61357", "url": "https://www.ebi.ac.uk/chebi/searchId.do?chebiId=61357", "database": "ChEBI", "categories": [ "Chemical" ] }, { "id": "G01650PH", "url": "https://glytoucan.org/Structures/Glycans/G01650PH", "database": "GlyTouCan", "categories": [ "Glycan" ] }, { "id": "G01650PH", "url": "https://sandbox.glyomics.org/explore.html?G01650PH", "database": "SandBox", "categories": [ "Enzyme and Pathway" ] }, { "id": "G01650PH", "url": "https://gnome.glyomics.org/restrictions/GlyGen.StructureBrowser.html?focus=G01650PH", "database": "GNOme", "categories": [ "Glycan", "Ontology and Dictionary" ] }, { "id": "G01650PH", "url": "https://glycosmos.org/glycans/show/G01650PH", "database": "GlyCosmos", "categories": [ "Glycoproteomics", "Glycan" ] }, { "id": "6133223GAR", "url": "https://glygen.ccrc.uga.edu/ggarray/glycanDetail/6133223GAR", "database": "Glycan Array Data Repository", "categories": [] } ], "glycoprotein": [], "publication": [ { "title": "Fucosylated human milk oligosaccharides vary between individuals and over the course of lactation.", "journal": "Glycobiology", "date": "2001", "authors": "Chaturvedi P, Warren CD, Altaye M, Morrow AL, Ruiz-Palacios G, Pickering LK, Newburg DS", "evidence": [ { "database": "GlyTouCan", "id": "G01650PH", "url": "https://glytoucan.org/Structures/Glycans/G01650PH" }, { "database": "GlyConnect", "id": "3099", "url": "https://glyconnect.expasy.org/browser/structures/3099" } ], "reference": [ { "type": "PubMed", "id": "11425797", "url": "https://glygen.org/publication/PubMed/11425797" } ] }, { "title": "Comparison of oligosaccharides in milk specimens from humans and twelve other species.", "journal": "Advances in experimental medicine and biology", "date": "2001", "authors": "Warren CD, Chaturvedi P, Newburg AR, Oftedal OT, Tilden CD, Newburg DS", "evidence": [ { "database": "GlyTouCan", "id": "G01650PH", "url": "https://glytoucan.org/Structures/Glycans/G01650PH" }, { "database": "GlyConnect", "id": "3099", "url": "https://glyconnect.expasy.org/browser/structures/3099" } ], "reference": [ { "type": "PubMed", "id": "11787698", "url": "https://glygen.org/publication/PubMed/11787698" } ] }, { "title": "Development of an annotated library of neutral human milk oligosaccharides.", "journal": "Journal of proteome research", "date": "2010", "authors": "Wu S, Tao N, German JB, Grimm R, Lebrilla CB", "evidence": [ { "database": "GlyTouCan", "id": "G01650PH", "url": "https://glytoucan.org/Structures/Glycans/G01650PH" }, { "database": "GlyConnect", "id": "3099", "url": "https://glyconnect.expasy.org/browser/structures/3099" } ], "reference": [ { "type": "PubMed", "id": "20578730", "url": "https://glygen.org/publication/PubMed/20578730" } ] }, { "title": "Human Milk Oligosaccharides (HMOS): Structure, Function, and Enzyme-Catalyzed Synthesis.", "journal": "Advances in carbohydrate chemistry and biochemistry", "date": "2015", "authors": "Chen X", "evidence": [ { "database": "GlyTouCan", "id": "G01650PH", "url": "https://glytoucan.org/Structures/Glycans/G01650PH" }, { "database": "GlyConnect", "id": "3099", "url": "https://glyconnect.expasy.org/browser/structures/3099" } ], "reference": [ { "type": "PubMed", "id": "26613816", "url": "https://glygen.org/publication/PubMed/26613816" } ] }, { "title": "Systematic review of the concentrations of oligosaccharides in human milk.", "journal": "Nutrition reviews", "date": "2017", "authors": "Thurl S, Munzert M, Boehm G, Matthews C, Stahl B", "evidence": [ { "database": "GlyTouCan", "id": "G01650PH", "url": "https://glytoucan.org/Structures/Glycans/G01650PH" }, { "database": "GlyConnect", "id": "3099", "url": "https://glyconnect.expasy.org/browser/structures/3099" } ], "reference": [ { "type": "PubMed", "id": "29053807", "url": "https://glygen.org/publication/PubMed/29053807" } ] }, { "title": "Creating a Mass Spectral Reference Library for Oligosaccharides in Human Milk.", "journal": "Analytical chemistry", "date": "2018", "authors": "Remoroza CA, Mak TD, De Leoz MLA, Mirokhin YA, Stein SE", "evidence": [ { "database": "GlyTouCan", "id": "G01650PH", "url": "https://glytoucan.org/Structures/Glycans/G01650PH" }, { "database": "GlyConnect", "id": "3099", "url": "https://glyconnect.expasy.org/browser/structures/3099" } ], "reference": [ { "type": "PubMed", "id": "29969231", "url": "https://glygen.org/publication/PubMed/29969231" } ] }, { "title": "Impact of maternal characteristics on human milk oligosaccharide composition over the first 4 months of lactation in a cohort of healthy European mothers.", "journal": "Scientific reports", "date": "2019", "authors": "Samuel TM, Binia A, de Castro CA, Thakkar SK, Billeaud C, Agosti M, Al-Jashi I, Costeira MJ, Marchini G, Martinez-Costa C, Picaud JC, Stiris T, Stoicescu SM, Vanpee M, Domellof M, Austin S, Sprenger N", "evidence": [ { "database": "GlyTouCan", "id": "G01650PH", "url": "https://glytoucan.org/Structures/Glycans/G01650PH" }, { "database": "GlyConnect", "id": "3099", "url": "https://glyconnect.expasy.org/browser/structures/3099" } ], "reference": [ { "type": "PubMed", "id": "31409852", "url": "https://glygen.org/publication/PubMed/31409852" } ] } ], "residues": [ { "id": "OC3", "name": "O-glycan_core_x-D-Glcx_C3", "attachedby": "rxn.G5E897-1", "detachedby": "", "parentid": "0" }, { "id": "OC3", "name": "O-glycan_core_x-D-Glcx_C3", "attachedby": "rxn.Q6UW63-1", "detachedby": "", "parentid": "0" }, { "id": "OC3", "name": "O-glycan_core_x-D-Glcx_C3", "attachedby": "rxn.Q7Z4H8-1", "detachedby": "", "parentid": "0" }, { "id": "OC3", "name": "O-glycan_core_x-D-Glcx_C3", "attachedby": "rxn.Q8BYB9-1", "detachedby": "", "parentid": "0" }, { "id": "OC3", "name": "O-glycan_core_x-D-Glcx_C3", "attachedby": "rxn.Q8NBL1-1", "detachedby": "", "parentid": "0" }, { "id": "OC3", "name": "O-glycan_core_x-D-Glcx_C3", "attachedby": "rxn.Q9JHP7-1", "detachedby": "", "parentid": "0" } ], "composition": [ { "name": "6-Deoxy-Hexose", "residue": "dhex", "count": 1, "cid": "840", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840" }, { "name": "Hexose", "residue": "hex", "count": 3, "cid": "206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206" }, { "name": "N-Acetylhexosamine", "residue": "hexnac", "count": 1, "cid": "899", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899" }, { "name": "Hexuronic Acid", "residue": "hexa", "count": 0, "cid": "610", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610" }, { "name": "2-Amino-2-Deoxy-Hexose", "residue": "hexn", "count": 0, "cid": "739", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739" }, { "name": "N-Acetyl-Neuraminic Acid", "residue": "neuac", "count": 0, "cid": "439197", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197" }, { "name": "N-Glycolyl-Neuraminic Acid", "residue": "neugc", "count": 0, "cid": "440001", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001" }, { "name": "Phosphate", "residue": "p", "count": 0, "cid": "1061", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061" }, { "name": "Pentose", "residue": "pent", "count": 0, "cid": "229", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229" }, { "name": "Sulfate", "residue": "s", "count": 0, "cid": "1117", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117" }, { "name": "Other", "residue": "other", "count": 0 } ], "composition_expanded": [ { "name": "Alditol", "residue": "aldi", "count": 0 }, { "name": "6-Deoxy-Hexose", "residue": "dhex", "count": 1, "cid": "840", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840" }, { "name": "6-Deoxy-Hexitol", "residue": "dhex+aldi", "count": 0 }, { "name": "L-Fucose", "residue": "fuc", "count": 1, "cid": "17106", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/17106" }, { "name": "L-Fucitol", "residue": "fuc+aldi", "count": 0, "cid": "445724", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/445724" }, { "name": "D-Galactose", "residue": "gal", "count": 2, "cid": "6036", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6036" }, { "name": "D-Galactitol", "residue": "gal+aldi", "count": 0, "cid": "11850", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11850" }, { "name": "N-Acetyl-D-galactosamine", "residue": "galnac", "count": 0, "cid": "35717", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/35717" }, { "name": "N-Acetylgalactosaminitol", "residue": "galnac+aldi", "count": 0, "cid": "165880", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165880" }, { "name": "D-Galacturonic Acid", "residue": "gala", "count": 0, "cid": "439215", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439215" }, { "name": "D-Glucose", "residue": "glc", "count": 1, "cid": "5793", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5793" }, { "name": "D-Glucitol", "residue": "glc+aldi", "count": 0, "cid": "5780", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5780" }, { "name": "D-Glucuronic acid", "residue": "glca", "count": 0, "cid": "94715", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/94715" }, { "name": "D-Glucosamine", "residue": "glcn", "count": 0, "cid": "439213", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439213" }, { "name": "N-Acetyl-D-Glucosamine", "residue": "glcnac", "count": 1, "cid": "439174", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439174" }, { "name": "N-Acetyl-D-glucosaminitol", "residue": "glcnac+aldi", "count": 0, "cid": "165206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165206" }, { "name": "Hexose", "residue": "hex", "count": 3, "cid": "206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206" }, { "name": "N-Acetylhexosamine", "residue": "hexnac", "count": 1, "cid": "899", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899" }, { "name": "Hexuronic Acid", "residue": "hexa", "count": 0, "cid": "610", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610" }, { "name": "2-Amino-2-Deoxy-Hexose", "residue": "hexn", "count": 0, "cid": "739", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739" }, { "name": "Hexitol", "residue": "hex+aldi", "count": 0, "cid": "453", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/453" }, { "name": "N-Acetylhexosaminitol", "residue": "hexnac+aldi", "count": 0 }, { "name": "L-Iduronic acid", "residue": "idoa", "count": 0, "cid": "441039", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/441039" }, { "name": "D-Mannose", "residue": "man", "count": 0, "cid": "18950", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18950" }, { "name": "D-Mannitol", "residue": "man+aldi", "count": 0, "cid": "6251", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6251" }, { "name": "N-Acetyl-D-mannosamine", "residue": "mannac", "count": 0, "cid": "439281", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439281" }, { "name": "Methyl", "residue": "me", "count": 0 }, { "name": "N-Acetyl-Neuraminic Acid", "residue": "neuac", "count": 0, "cid": "439197", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197" }, { "name": "N-Glycolyl-Neuraminic Acid", "residue": "neugc", "count": 0, "cid": "440001", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001" }, { "name": "Phosphate", "residue": "p", "count": 0, "cid": "1061", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061" }, { "name": "Pentose", "residue": "pent", "count": 0, "cid": "229", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229" }, { "name": "Sulfate", "residue": "s", "count": 0, "cid": "1117", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117" }, { "name": "Sialic acid", "residue": "sia", "count": 0 }, { "name": "Other", "residue": "other", "count": 0 }, { "name": "Floating substituent", "residue": "x", "count": 0 }, { "name": "D-Xylose", "residue": "xyl", "count": 0, "cid": "135191", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135191" }, { "name": "Ketodeoxynononic acid", "residue": "kdn", "count": 0, "cid": "13991616", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13991616" } ], "motifs": [ { "id": "GGM.000005", "name": "Type 1 LN", "synonym": "", "keywords": "LacNAc; N-acetyllactosamine; N-acetyllactosamine type 1" }, { "id": "GGM.000042", "name": "Blood group H (type 1)", "synonym": "", "keywords": "Blood group H; Blood group type 1" } ], "interactions": [], "expression": [ { "category": "tissue", "tissue": { "name": "milk", "namespace": "UBERON", "id": "0001913", "url": "http://purl.obolibrary.org/obo/UBERON_0001913" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "3099", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/3099" }, { "id": "11425797", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/11425797" }, { "id": "11787698", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/11787698" }, { "id": "29969231", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/29969231" }, { "id": "29053807", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/29053807" }, { "id": "20578730", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/20578730" }, { "id": "26613816", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/26613816" }, { "id": "31409852", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/31409852" } ] } ], "subsumption": [ { "related_accession": "G05897GU", "relationship": "ancestor" }, { "related_accession": "G07322TJ", "relationship": "ancestor" }, { "related_accession": "G14307WQ", "relationship": "ancestor" }, { "related_accession": "G19490AF", "relationship": "ancestor" }, { "related_accession": "G21375XC", "relationship": "ancestor" }, { "related_accession": "G29900GO", "relationship": "ancestor" }, { "related_accession": "G33355QW", "relationship": "ancestor" }, { "related_accession": "G34397SP", "relationship": "ancestor" }, { "related_accession": "G35406BC", "relationship": "ancestor" }, { "related_accession": "G45590SL", "relationship": "ancestor" }, { "related_accession": "G54630CD", "relationship": "ancestor" }, { "related_accession": "G57243PM", "relationship": "ancestor" }, { "related_accession": "G57349AQ", "relationship": "ancestor" }, { "related_accession": "G59929MX", "relationship": "ancestor" }, { "related_accession": "G66921SR", "relationship": "ancestor" }, { "related_accession": "G82935CH", "relationship": "ancestor" }, { "related_accession": "G84985UI", "relationship": "ancestor" }, { "related_accession": "G88572NY", "relationship": "ancestor" }, { "related_accession": "G99260NP", "relationship": "ancestor" }, { "related_accession": "G54630CD", "relationship": "basecomposition" }, { "related_accession": "G82935CH", "relationship": "composition" }, { "related_accession": "G00050MO", "relationship": "descendant" }, { "related_accession": "G57039PS", "relationship": "descendant" }, { "related_accession": "G00050MO", "relationship": "fullydetermined" }, { "related_accession": "G57039PS", "relationship": "fullydetermined" }, { "related_accession": "G00050MO", "relationship": "leaf" }, { "related_accession": "G57039PS", "relationship": "leaf" }, { "related_accession": "G57349AQ", "relationship": "subsumedby" }, { "related_accession": "G59929MX", "relationship": "subsumedby" }, { "related_accession": "G66921SR", "relationship": "subsumedby" }, { "related_accession": "G00050MO", "relationship": "subsumes" }, { "related_accession": "G57039PS", "relationship": "subsumes" }, { "related_accession": "G29900GO", "relationship": "topology" } ], "names": [], "keywords": [], "glycotree_pathways": [], "dictionary": {}, "biomarkers": [], "section_stats": [ { "table_id": "glycoprotein", "table_stats": [ { "field": "total", "count": 0 }, { "field": "total_sites", "count": 0 } ], "sort_fields": [] }, { "table_id": "expression", "table_stats": [ { "field": "total", "count": 1 }, { "field": "total_sites", "count": 0 } ], "sort_fields": [ "category", "tissue.name", "tissue.namespace", "tissue.id", "tissue.url", "abundance" ] }, { "table_id": "expression_tissue", "table_stats": [ { "field": "total", "count": 1 }, { "field": "total_sites", "count": 0 } ], "sort_fields": [ "category", "tissue.name", "tissue.namespace", "tissue.id", "tissue.url", "abundance" ] }, { "table_id": "expression_cell_line", "table_stats": [ { "field": "total", "count": 0 }, { "field": "total_sites", "count": 0 } ], "sort_fields": [ "category", "abundance" ] }, { "table_id": "publication", "table_stats": [ { "field": "total", "count": 7 } ], "sort_fields": [ "title", "journal", "date", "authors" ] } ] }