{ "glytoucan_ac": "G08371CD", "number_monosaccharides": 2, "number_monosaccharides_suffix": "", "mass": 512.19, "mass_pme": 652.34, "tool_support": { "gnome_glygen_oglycans": "no", "sandbox": "no", "gnome_glygen": "yes", "gnome": "yes", "gnome_glycotree_oglycans": "no", "pdb": "no", "gnome_glygen_nglycans": "no", "gnome_glycotree_nglycans": "no" }, "fully_determined": "", "missing_score": 492, "glycan_type": "Saccharide", "iupac": "alpha-D-Neup5Ac-(2->6)-?-D-GalpNAc-(1->", "wurcs": "WURCS=2.0/2,2,1/[a2112h-1x_1-5_2*NCC/3=O][Aad21122h-2a_2-6_5*NCC/3=O]/1-2/a6-b2", "glycoct": "RES 1b:x-dgal-HEX-1:5 2s:n-acetyl 3b:a-dgro-dgal-NON-2:6|1:a|2:keto|3:d 4s:n-acetyl LIN 1:1d(2+1)2n 2:1o(6+2)3d 3:3d(5+1)4n", "inchi": "InChI=1S/C19H32N2O14/c1-6(23)20-11-8(25)3-19(18(31)32,35-16(11)13(27)9(26)4-22)33-5-10-14(28)15(29)12(17(30)34-10)21-7(2)24/h8-17,22,25-30H,3-5H2,1-2H3,(H,20,23)(H,21,24)(H,31,32)/t8-,9+,10+,11+,12+,13+,14-,15+,16+,17?,19+/m0/s1", "glycam": "", "smiles_isomeric": "CC(=O)N[C@@H]1[C@H](C[C@@](O[C@H]1[C@@H]([C@@H](CO)O)O)(C(=O)O)OC[C@@H]2[C@@H]([C@@H]([C@H](C(O2)O)NC(=O)C)O)O)O", "inchi_key": { "key": "CZOGCRVBCLRHQJ-YIDOBNJDSA-N", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/CZOGCRVBCLRHQJ-YIDOBNJDSA-N" }, "byonic": "HexNAc(1)NeuAc(1) % 512.18535394", "gwb": "freeEnd--1?1D-GalNAc,p--6a2D-NeuAc,p$MONO,Und,0,0,freeEnd", "species": [ { "taxid": 9606, "name": "Homo sapiens", "annotation_category": "Direct", "evidence": [ { "database": "GlyCosmos", "id": "G08371CD", "url": "https://glycosmos.org/glycans/show/G08371CD" }, { "database": "UniCarbKB", "id": "G08371CD", "url": "http://www.unicarbkb.org/structure/G08371CD" } ], "common_name": "Human" }, { "taxid": 10090, "name": "Mus musculus", "annotation_category": "Direct", "evidence": [ { "database": "GlyCosmos", "id": "G08371CD", "url": "https://glycosmos.org/glycans/show/G08371CD" } ], "common_name": "Mouse" }, { "taxid": 10116, "name": "Rattus norvegicus", "annotation_category": "Direct", "evidence": [ { "database": "GlyCosmos", "id": "G08371CD", "url": "https://glycosmos.org/glycans/show/G08371CD" } ], "common_name": "Rat" } ], "classification": [ { "type": { "name": "Other", "url": "" }, "subtype": { "name": "Other", "url": "" } } ], "enzyme": [], "crossref": [ { "id": "11409652", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11409652", "database": "PubChem Compound" }, { "id": "252285889", "url": "https://pubchem.ncbi.nlm.nih.gov/substance/252285889", "database": "PubChem Substance" }, { "id": "G00455", "url": "https://www.genome.jp/dbget-bin/www_bget?gl:G00455", "database": "KEGG Glycan" }, { "id": "G10625", "url": "https://www.genome.jp/dbget-bin/www_bget?gl:G10625", "database": "KEGG Glycan" }, { "id": "22034", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=22034", "database": "Glycosciences.de" }, { "id": "6269", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=6269", "database": "Glycosciences.de" }, { "id": "carbOlink_20663_D000", "url": "http://www.functionalglycomics.org/glycomics/CarbohydrateServlet?pageType=view&view=view&operationType=view&carbId=carbOlink_20663_D000", "database": "CFG" }, { "id": "carbOlink_21109_D000", "url": "http://www.functionalglycomics.org/glycomics/CarbohydrateServlet?pageType=view&view=view&operationType=view&carbId=carbOlink_21109_D000", "database": "CFG" }, { "id": "29553", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+29553", "database": "CarbBank" }, { "id": "32226", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+32226", "database": "CarbBank" }, { "id": "42379", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+42379", "database": "CarbBank" }, { "id": "45713", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+45713", "database": "CarbBank" }, { "id": "45744", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+45744", "database": "CarbBank" }, { "id": "146820", "url": "https://www.ebi.ac.uk/chebi/searchId.do?chebiId=146820", "database": "ChEBI" }, { "id": "EP0352", "url": "https://www.glycoepitope.jp/epitopes/EP0352", "database": "GlycoEpitope" }, { "id": "G08371CD", "url": "https://glytoucan.org/Structures/Glycans/G08371CD", "database": "GlyTouCan" }, { "id": "G08371CD", "url": "https://gnome.glyomics.org/restrictions/GlyGen.StructureBrowser.html?focus=G08371CD", "database": "GNOme" }, { "id": "G08371CD", "url": "https://glycosmos.org/glycans/show/G08371CD", "database": "GlyCosmos" }, { "id": "GSD000009", "url": "https://wiki.glygen.org/Glycan_structure_dictionary#GSD000009", "database": "Glycan Structure Dictionary" } ], "glycoprotein": [], "publication": [ { "title": "Immunohistochemical demonstration of glycoconjugates bearing the type 2 chain-backbone structure in human fetal, normal and neoplastic gastrointestinal tract.", "journal": "Histochemistry", "date": "1992", "authors": "Nakayama J, Ota H, Katsuyama T, Kanai M, Taki T, Hirabayashi Y, Suzuki Y", "evidence": [ { "database": "GlyTouCan", "id": "G08371CD", "url": "https://glytoucan.org/Structures/Glycans/G08371CD" } ], "reference": [ { "type": [ "PubMed" ], "id": "1618643", "url": "https://glygen.org/publication/PubMed/1618643" } ] }, { "title": "The O-Glycome of Human Nigrostriatal Tissue and Its Alteration in Parkinson's Disease.", "journal": "Journal of proteome research", "date": "2021", "authors": "Wilkinson H, Thomsson KA, Rebelo AL, Hilliard M, Pandit A, Rudd PM, Karlsson NG, Saldova R", "evidence": [ { "database": "UniCarbKB", "id": "G08371CD", "url": "http://www.unicarbkb.org/structure/G08371CD" } ], "reference": [ { "type": [ "PubMed" ], "id": "34191522", "url": "https://glygen.org/publication/PubMed/34191522" } ] }, { "title": "A monoclonal antibody directed to N-acetylneuraminosyl-alpha 2 leads to 6-galactosyl residue in gangliosides and glycoproteins.", "journal": "The Journal of biological chemistry", "date": "1983", "authors": "Hakomori S, Patterson CM, Nudelman E, Sekiguchi K", "evidence": [ { "database": "GlyTouCan", "id": "G08371CD", "url": "https://glytoucan.org/Structures/Glycans/G08371CD" } ], "reference": [ { "type": [ "PubMed" ], "id": "6194157", "url": "https://glygen.org/publication/PubMed/6194157" } ] } ], "residues": [], "composition": [ { "name": "6-Deoxy-Hexose", "residue": "dhex", "count": 0, "cid": "840", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840" }, { "name": "Hexose", "residue": "hex", "count": 0, "cid": "206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206" }, { "name": "N-Acetylhexosamine", "residue": "hexnac", "count": 1, "cid": "899", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899" }, { "name": "Hexuronic Acid", "residue": "hexa", "count": 0, "cid": "610", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610" }, { "name": "2-Amino-2-Deoxy-Hexose", "residue": "hexn", "count": 0, "cid": "739", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739" }, { "name": "N-Acetyl-Neuraminic Acid", "residue": "neuac", "count": 1, "cid": "439197", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197" }, { "name": "N-Glycolyl-Neuraminic Acid", "residue": "neugc", "count": 0, "cid": "440001", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001" }, { "name": "Phosphate", "residue": "p", "count": 0, "cid": "1061", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061" }, { "name": "Pentose", "residue": "pent", "count": 0, "cid": "229", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229" }, { "name": "Sulfate", "residue": "s", "count": 0, "cid": "1117", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117" }, { "name": "Other", "residue": "other", "count": 0 } ], "composition_expanded": [ { "name": "Alditol", "residue": "aldi", "count": 0 }, { "name": "6-Deoxy-Hexose", "residue": "dhex", "count": 0, "cid": "840", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840" }, { "name": "6-Deoxy-Hexitol", "residue": "dhex+aldi", "count": 0 }, { "name": "L-Fucose", "residue": "fuc", "count": 0, "cid": "17106", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/17106" }, { "name": "L-Fucitol", "residue": "fuc+aldi", "count": 0, "cid": "445724", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/445724" }, { "name": "D-Galactose", "residue": "gal", "count": 0, "cid": "6036", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6036" }, { "name": "D-Galacitol", "residue": "gal+aldi", "count": 0, "cid": "11850", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11850" }, { "name": "D-Galactosamine", "residue": "galn", "count": 0, "cid": "24154", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/24154" }, { "name": "N-Acetyl-D-galactosamine", "residue": "galnac", "count": 1, "cid": "35717", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/35717" }, { "name": "N-Acetylgalactosaminitol", "residue": "galnac+aldi", "count": 0, "cid": "165880", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165880" }, { "name": "D-Glucose", "residue": "glc", "count": 0, "cid": "5793", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5793" }, { "name": "D-Glucitol", "residue": "glc+aldi", "count": 0, "cid": "5780", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5780" }, { "name": "D-Glucuronic acid", "residue": "glca", "count": 0, "cid": "94715", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/94715" }, { "name": "D-Glucosamine", "residue": "glcn", "count": 0, "cid": "439213", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439213" }, { "name": "N-Acetyl-D-Glucosamine", "residue": "glcnac", "count": 0, "cid": "439174", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439174" }, { "name": "N-Acetyl-D-glucosaminitol", "residue": "glcnac+aldi", "count": 0, "cid": "165206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165206" }, { "name": "Hexose", "residue": "hex", "count": 0, "cid": "206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206" }, { "name": "N-Acetylhexosamine", "residue": "hexnac", "count": 1, "cid": "899", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899" }, { "name": "Hexuronic Acid", "residue": "hexa", "count": 0, "cid": "610", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610" }, { "name": "2-Amino-2-Deoxy-Hexose", "residue": "hexn", "count": 0, "cid": "739", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739" }, { "name": "Hexitol", "residue": "hex+aldi", "count": 0, "cid": "453", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/453" }, { "name": "N-Acetylhexosaminitol", "residue": "hexnac+aldi", "count": 0 }, { "name": "L-Iduronic acid", "residue": "idoa", "count": 0, "cid": "441039", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/441039" }, { "name": "D-Mannose", "residue": "man", "count": 0, "cid": "18950", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18950" }, { "name": "D-Mannitol", "residue": "man+aldi", "count": 0, "cid": "6251", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6251" }, { "name": "D-Mannosamine", "residue": "mann", "count": 0, "cid": "440049", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440049" }, { "name": "N-Acetyl-D-mannosamine", "residue": "mannac", "count": 0, "cid": "439281", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439281" }, { "name": "Methyl", "residue": "me", "count": 0 }, { "name": "N-Acetyl-Neuraminic Acid", "residue": "neuac", "count": 1, "cid": "439197", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197" }, { "name": "N-Glycolyl-Neuraminic Acid", "residue": "neugc", "count": 0, "cid": "440001", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001" }, { "name": "Phosphate", "residue": "p", "count": 0, "cid": "1061", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061" }, { "name": "Pentose", "residue": "pent", "count": 0, "cid": "229", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229" }, { "name": "Sulfate", "residue": "s", "count": 0, "cid": "1117", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117" }, { "name": "Sialic acid", "residue": "sia", "count": 1, "cid": "906", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/906" }, { "name": "Other", "residue": "other", "count": 0 }, { "name": "Floating substituent", "residue": "x", "count": 0 }, { "name": "D-Xylose", "residue": "xyl", "count": 0, "cid": "135191", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135191" }, { "name": "Ketodeoxynononic acid", "residue": "kdn", "count": 0, "cid": "13991616", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13991616" } ], "motifs": [], "interactions": [], "expression": [], "subsumption": [ { "related_accession": "G08178PQ", "relationship": "ancestor" }, { "related_accession": "G11378EW", "relationship": "ancestor" }, { "related_accession": "G15807NZ", "relationship": "ancestor" }, { "related_accession": "G19399OS", "relationship": "ancestor" }, { "related_accession": "G35255WG", "relationship": "ancestor" }, { "related_accession": "G37193ED", "relationship": "ancestor" }, { "related_accession": "G37584UP", "relationship": "ancestor" }, { "related_accession": "G53789TU", "relationship": "ancestor" }, { "related_accession": "G54624RV", "relationship": "ancestor" }, { "related_accession": "G69099KE", "relationship": "ancestor" }, { "related_accession": "G77854OM", "relationship": "ancestor" }, { "related_accession": "G77900OU", "relationship": "ancestor" }, { "related_accession": "G87636JF", "relationship": "ancestor" }, { "related_accession": "G90085MT", "relationship": "ancestor" }, { "related_accession": "G92345KY", "relationship": "ancestor" }, { "related_accession": "G93542QZ", "relationship": "ancestor" }, { "related_accession": "G87636JF", "relationship": "basecomposition" }, { "related_accession": "G77854OM", "relationship": "composition" }, { "related_accession": "G36123IU", "relationship": "descendant" }, { "related_accession": "G73708UL", "relationship": "descendant" }, { "related_accession": "G36123IU", "relationship": "fullydetermined" }, { "related_accession": "G73708UL", "relationship": "fullydetermined" }, { "related_accession": "G36123IU", "relationship": "leaf" }, { "related_accession": "G73708UL", "relationship": "leaf" }, { "related_accession": "G37584UP", "relationship": "subsumedby" }, { "related_accession": "G77900OU", "relationship": "subsumedby" }, { "related_accession": "G92345KY", "relationship": "subsumedby" }, { "related_accession": "G36123IU", "relationship": "subsumes" }, { "related_accession": "G73708UL", "relationship": "subsumes" }, { "related_accession": "G08178PQ", "relationship": "topology" } ], "names": [], "keywords": [], "glycotree_pathways": [], "dictionary": { "term": "6-Sialyl-GalNAc", "term_in_sentence": "mmunohistochemical distributions of carbohydrate antigens based on the type 2 chain in normal as well as fetal and neoplastic tissues of human gastrointestinal tract were investigated with a monoclonal antibody (MAb) H11 (specific for type 2 chain) alone and in combination with the two MAbs MSG15 (for alpha 2----6 sialylated type 2 chain) and IB9 (for the alpha 2----6 sialylated type 2 chain and glycoproteins having NeuAc alpha 2----6Gal-NAc), and 188C1 (for short- and long-chain Lex antigens) and FH2 (for the long-chain Lex antigen). [PMID: 1618643]", "publication": "1618643|6194157", "definition": "An amino disaccharide composed of N-acetylneuraminic acid and 2-(acetylamino)-2-deoxy-D-galactopyranose residues joined by an (\u03b1-2\u21926) glycosidic bond.[CHEBI:146820]", "term_xref": "GlycoEpitope:EP0352|KEGG:G00455|KEGG:G10625|CHEBI:146820|CID:11409652|GlycoMotif:GGM.000035|GTC:G08371CD", "synonymns": [ "Sialyl Tn antigen", "6-Sialyl-GalNAc", "6-Sialyl LN", "6-Sialyl LN (type 1)", "6-Sialyl LN (type 2)" ], "function": "", "disease_associations": "", "wikipedia": "", "essentials_of_glycobiology": "", "evidence": [ { "id": "GSD000009", "url": "https://wiki.glygen.org/Glycan_structure_dictionary#GSD000009", "database": "Glycan Structure Dictionary" } ] } }