{ "glytoucan_ac": "G06580KR", "number_monosaccharides": 3, "number_monosaccharides_suffix": "", "mass": 545.2, "mass_pme": 699.37, "tool_support": { "gnome_glygen_oglycans": "no", "sandbox": "no", "gnome_glygen": "yes", "gnome": "yes", "gnome_glycotree_oglycans": "no", "pdb": "yes", "gnome_glygen_nglycans": "no", "gnome_glycotree_nglycans": "no" }, "fully_determined": "yes", "missing_score": 0, "glycan_type": "Saccharide", "iupac": "beta-D-Galp-(1->4)-beta-D-GlcpNAc-(1->3)-beta-D-Galp-(1->", "wurcs": "WURCS=2.0/2,3,2/[a2112h-1b_1-5][a2122h-1b_1-5_2*NCC/3=O]/1-2-1/a3-b1_b4-c1", "glycoct": "RES 1b:b-dgal-HEX-1:5 2b:b-dglc-HEX-1:5 3s:n-acetyl 4b:b-dgal-HEX-1:5 LIN 1:1o(3+1)2d 2:2d(2+1)3n 3:2o(4+1)4d", "inchi": "InChI=1S/C20H35NO16/c1-5(25)21-9-12(28)16(36-20-14(30)13(29)10(26)6(2-22)34-20)8(4-24)35-19(9)37-17-11(27)7(3-23)33-18(32)15(17)31/h6-20,22-24,26-32H,2-4H2,1H3,(H,21,25)/t6-,7-,8-,9-,10+,11+,12-,13+,14-,15-,16-,17+,18-,19+,20+/m1/s1", "glycam": "DGalpb1-4DGlcpNAcb1-3DGalpb1-OH", "smiles_isomeric": "CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1O[C@H]2[C@H]([C@H](O[C@H]([C@@H]2O)O)CO)O)CO)O[C@H]3[C@@H]([C@H]([C@H]([C@H](O3)CO)O)O)O)O", "inchi_key": { "key": "VGVHVNDLCYSGNE-OGBLMHIUSA-N", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/VGVHVNDLCYSGNE-OGBLMHIUSA-N" }, "byonic": "Hex(2)HexNAc(1) % 545.195584305", "gwb": "freeEnd--1b1D-Gal,p--3b1D-GlcNAc,p--4b1D-Gal,p$MONO,Und,0,0,freeEnd", "species": [ { "taxid": 9606, "name": "Homo sapiens", "annotation_category": "Direct", "evidence": [ { "database": "GlyCosmos", "id": "G06580KR", "url": "https://glycosmos.org/glycans/show/G06580KR" } ], "common_name": "Human" } ], "classification": [ { "type": { "name": "Other", "url": "" }, "subtype": { "name": "Other", "url": "" } } ], "enzyme": [], "crossref": [ { "id": "24826242", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/24826242", "database": "PubChem Compound" }, { "id": "252276636", "url": "https://pubchem.ncbi.nlm.nih.gov/substance/252276636", "database": "PubChem Substance" }, { "id": "2xrs", "url": "https://www.rcsb.org/structure/2xrs", "database": "PDB" }, { "id": "15435", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=15435", "database": "Glycosciences.de" }, { "id": "2571", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=2571", "database": "Glycosciences.de" }, { "id": "2855", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=2855", "database": "Glycosciences.de" }, { "id": "4184", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=4184", "database": "Glycosciences.de" }, { "id": "6500", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=6500", "database": "Glycosciences.de" }, { "id": "9118", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=9118", "database": "Glycosciences.de" }, { "id": "10447", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+10447", "database": "CarbBank" }, { "id": "11025", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+11025", "database": "CarbBank" }, { "id": "12613", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+12613", "database": "CarbBank" }, { "id": "18759", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+18759", "database": "CarbBank" }, { "id": "19270", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+19270", "database": "CarbBank" }, { "id": "19690", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+19690", "database": "CarbBank" }, { "id": "23977", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+23977", "database": "CarbBank" }, { "id": "26895", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+26895", "database": "CarbBank" }, { "id": "33129", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+33129", "database": "CarbBank" }, { "id": "35907", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+35907", "database": "CarbBank" }, { "id": "36186", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+36186", "database": "CarbBank" }, { "id": "38642", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+38642", "database": "CarbBank" }, { "id": "4488", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+4488", "database": "CarbBank" }, { "id": "45364", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+45364", "database": "CarbBank" }, { "id": "47479", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+47479", "database": "CarbBank" }, { "id": "7810", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+7810", "database": "CarbBank" }, { "id": "8673", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+8673", "database": "CarbBank" }, { "id": "9410", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+9410", "database": "CarbBank" }, { "id": "9996", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+9996", "database": "CarbBank" }, { "id": "8737", "url": "http://csdb.glycoscience.ru/bacterial/core/search_id.php?mode=record&id_list=8737", "database": "BCSDB" }, { "id": "59487", "url": "https://www.ebi.ac.uk/chebi/searchId.do?chebiId=59487", "database": "ChEBI" }, { "id": "EP0140", "url": "https://www.glycoepitope.jp/epitopes/EP0140", "database": "GlycoEpitope" }, { "id": "G06580KR", "url": "https://glytoucan.org/Structures/Glycans/G06580KR", "database": "GlyTouCan" }, { "id": "G06580KR", "url": "https://gnome.glyomics.org/restrictions/GlyGen.StructureBrowser.html?focus=G06580KR", "database": "GNOme" }, { "id": "G06580KR", "url": "https://glycosmos.org/glycans/show/G06580KR", "database": "GlyCosmos" } ], "glycoprotein": [], "publication": [ { "title": "Construction of multivalent sialyl Le(x) from the type Ia group B Streptococcus capsular polysaccharide.", "journal": "Carbohydrate research", "date": "2001", "authors": "Zou W, Li J, Larocque S, Jennings HJ", "evidence": [ { "database": "GlyTouCan", "id": "G06580KR", "url": "https://glytoucan.org/Structures/Glycans/G06580KR" } ], "reference": [ { "type": [ "PubMed" ], "id": "11376605", "url": "https://glygen.org/publication/PubMed/11376605" } ] }, { "title": "Immunohistochemical demonstration of glycoconjugates bearing the type 2 chain-backbone structure in human fetal, normal and neoplastic gastrointestinal tract.", "journal": "Histochemistry", "date": "1992", "authors": "Nakayama J, Ota H, Katsuyama T, Kanai M, Taki T, Hirabayashi Y, Suzuki Y", "evidence": [ { "database": "GlyTouCan", "id": "G06580KR", "url": "https://glytoucan.org/Structures/Glycans/G06580KR" } ], "reference": [ { "type": [ "PubMed" ], "id": "1618643", "url": "https://glygen.org/publication/PubMed/1618643" } ] }, { "title": "Subsets of olfactory and vomeronasal sensory epithelial cells and axons revealed by monoclonal antibodies to carbohydrate antigens.", "journal": "Brain research", "date": "1991", "authors": "Schwarting GA, Crandall JE", "evidence": [ { "database": "GlyTouCan", "id": "G06580KR", "url": "https://glytoucan.org/Structures/Glycans/G06580KR" } ], "reference": [ { "type": [ "PubMed" ], "id": "1884198", "url": "https://glygen.org/publication/PubMed/1884198" } ] }, { "title": "A human monoclonal antibody directed to blood group i antigen: heterohybridoma between human lymphocytes from regional lymph nodes of a lung cancer patient and mouse myeloma.", "journal": "Journal of immunology (Baltimore, Md. : 1950)", "date": "1986", "authors": "Hirohashi S, Clausen H, Nudelman E, Inoue H, Shimosato Y, Hakomori S", "evidence": [ { "database": "GlyTouCan", "id": "G06580KR", "url": "https://glytoucan.org/Structures/Glycans/G06580KR" } ], "reference": [ { "type": [ "PubMed" ], "id": "2422274", "url": "https://glygen.org/publication/PubMed/2422274" } ] }, { "title": "Expression of lacto series type 2 antigens in human renal cell carcinoma and its clinical significance.", "journal": "Journal of the National Cancer Institute", "date": "1989", "authors": "Fukushi Y, Ohtani H, Orikasa S", "evidence": [ { "database": "GlyTouCan", "id": "G06580KR", "url": "https://glytoucan.org/Structures/Glycans/G06580KR" } ], "reference": [ { "type": [ "PubMed" ], "id": "2563403", "url": "https://glygen.org/publication/PubMed/2563403" } ] }, { "title": "Differentiation antigens defined by mouse monoclonal antibodies against human germ cell tumors.", "journal": "Laboratory investigation; a journal of technical methods and pathology", "date": "1987", "authors": "Fujimoto J, Hata J, Ishii E, Tanaka S, Kannagi R, Ueyama Y, Tamaoki N", "evidence": [ { "database": "GlyTouCan", "id": "G06580KR", "url": "https://glytoucan.org/Structures/Glycans/G06580KR" } ], "reference": [ { "type": [ "PubMed" ], "id": "2823004", "url": "https://glygen.org/publication/PubMed/2823004" } ] }, { "title": "Oncofetal expression of Lex carbohydrate antigens in human colonic adenocarcinomas. Regulation through type 2 core chain synthesis rather than fucosylation.", "journal": "The Journal of biological chemistry", "date": "1987", "authors": "Holmes EH, Ostrander GK, Clausen H, Graem N", "evidence": [ { "database": "GlyTouCan", "id": "G06580KR", "url": "https://glytoucan.org/Structures/Glycans/G06580KR" } ], "reference": [ { "type": [ "PubMed" ], "id": "3112156", "url": "https://glygen.org/publication/PubMed/3112156" } ] }, { "title": "Human sperm carbohydrate antigens defined by an antisperm human monoclonal antibody derived from an infertile woman bearing antisperm antibodies in her serum.", "journal": "The Journal of experimental medicine", "date": "1988", "authors": "Tsuji Y, Clausen H, Nudelman E, Kaizu T, Hakomori S, Isojima S", "evidence": [ { "database": "GlyTouCan", "id": "G06580KR", "url": "https://glytoucan.org/Structures/Glycans/G06580KR" } ], "reference": [ { "type": [ "PubMed" ], "id": "3294333", "url": "https://glygen.org/publication/PubMed/3294333" } ] }, { "title": "Detection of patients with cancer by monoclonal antibody directed to lactoneotetraosylceramide (paragloboside).", "journal": "Cancer research", "date": "1988", "authors": "Myoga A, Taki T, Arai K, Sekiguchi K, Ikeda I, Kurata K, Matsumoto M", "evidence": [ { "database": "GlyTouCan", "id": "G06580KR", "url": "https://glytoucan.org/Structures/Glycans/G06580KR" } ], "reference": [ { "type": [ "PubMed" ], "id": "3345524", "url": "https://glygen.org/publication/PubMed/3345524" } ] }, { "title": "Two monoclonal anticarbohydrate antibodies directed to glycosphingolipids with a lacto-N-glycosyl type II chain.", "journal": "The Journal of biological chemistry", "date": "1981", "authors": "Young WW Jr, Portoukalian J, Hakomori S", "evidence": [ { "database": "GlyTouCan", "id": "G06580KR", "url": "https://glytoucan.org/Structures/Glycans/G06580KR" } ], "reference": [ { "type": [ "PubMed" ], "id": "7287743", "url": "https://glygen.org/publication/PubMed/7287743" } ] }, { "title": "Production of human monoclonal antibodies to i blood group by EBV-induced transformation: possible presence of a new glycolipid in cord red cell membranes and human hematopoietic cell lines.", "journal": "Immunology letters", "date": "1995", "authors": "Nagatsuka Y, Watarai S, Yasuda T, Higashi H, Yamagata T, Ono Y", "evidence": [ { "database": "GlyTouCan", "id": "G06580KR", "url": "https://glytoucan.org/Structures/Glycans/G06580KR" } ], "reference": [ { "type": [ "PubMed" ], "id": "7590936", "url": "https://glygen.org/publication/PubMed/7590936" } ] }, { "title": "Neolactoglycosphingolipids, potential mediators of corneal epithelial cell migration.", "journal": "The Journal of biological chemistry", "date": "1995", "authors": "Panjwani N, Zhao Z, Ahmad S, Yang Z, Jungalwala F, Baum J", "evidence": [ { "database": "GlyTouCan", "id": "G06580KR", "url": "https://glytoucan.org/Structures/Glycans/G06580KR" } ], "reference": [ { "type": [ "PubMed" ], "id": "7775461", "url": "https://glygen.org/publication/PubMed/7775461" } ] }, { "title": "Detection in human blood platelets of sialyl Lewis X gangliosides, potential ligands for CD62 and other selectins.", "journal": "Glycobiology", "date": "1995", "authors": "Cooling LL, Zhang DS, Walker KE, Koerner TA", "evidence": [ { "database": "GlyTouCan", "id": "G06580KR", "url": "https://glytoucan.org/Structures/Glycans/G06580KR" } ], "reference": [ { "type": [ "PubMed" ], "id": "8563144", "url": "https://glygen.org/publication/PubMed/8563144" } ] }, { "title": "Preparation of peptides which mimic glycosphingolipids by using phage peptide library and their modulation on beta-galactosidase activity.", "journal": "FEBS letters", "date": "1997", "authors": "Taki T, Ishikawa D, Hamasaki H, Handa S", "evidence": [ { "database": "GlyTouCan", "id": "G06580KR", "url": "https://glytoucan.org/Structures/Glycans/G06580KR" } ], "reference": [ { "type": [ "PubMed" ], "id": "9414130", "url": "https://glygen.org/publication/PubMed/9414130" } ] } ], "residues": [], "composition": [ { "name": "6-Deoxy-Hexose", "residue": "dhex", "count": 0, "cid": "840", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840" }, { "name": "Hexose", "residue": "hex", "count": 2, "cid": "206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206" }, { "name": "N-Acetylhexosamine", "residue": "hexnac", "count": 1, "cid": "899", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899" }, { "name": "Hexuronic Acid", "residue": "hexa", "count": 0, "cid": "610", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610" }, { "name": "2-Amino-2-Deoxy-Hexose", "residue": "hexn", "count": 0, "cid": "739", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739" }, { "name": "N-Acetyl-Neuraminic Acid", "residue": "neuac", "count": 0, "cid": "439197", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197" }, { "name": "N-Glycolyl-Neuraminic Acid", "residue": "neugc", "count": 0, "cid": "440001", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001" }, { "name": "Phosphate", "residue": "p", "count": 0, "cid": "1061", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061" }, { "name": "Pentose", "residue": "pent", "count": 0, "cid": "229", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229" }, { "name": "Sulfate", "residue": "s", "count": 0, "cid": "1117", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117" }, { "name": "Other", "residue": "other", "count": 0 } ], "composition_expanded": [ { "name": "Alditol", "residue": "aldi", "count": 0 }, { "name": "6-Deoxy-Hexose", "residue": "dhex", "count": 0, "cid": "840", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840" }, { "name": "6-Deoxy-Hexitol", "residue": "dhex+aldi", "count": 0 }, { "name": "L-Fucose", "residue": "fuc", "count": 0, "cid": "17106", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/17106" }, { "name": "L-Fucitol", "residue": "fuc+aldi", "count": 0, "cid": "445724", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/445724" }, { "name": "D-Galactose", "residue": "gal", "count": 2, "cid": "6036", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6036" }, { "name": "D-Galacitol", "residue": "gal+aldi", "count": 0, "cid": "11850", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11850" }, { "name": "D-Galactosamine", "residue": "galn", "count": 0, "cid": "24154", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/24154" }, { "name": "N-Acetyl-D-galactosamine", "residue": "galnac", "count": 0, "cid": "35717", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/35717" }, { "name": "N-Acetylgalactosaminitol", "residue": "galnac+aldi", "count": 0, "cid": "165880", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165880" }, { "name": "D-Glucose", "residue": "glc", "count": 0, "cid": "5793", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5793" }, { "name": "D-Glucitol", "residue": "glc+aldi", "count": 0, "cid": "5780", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5780" }, { "name": "D-Glucuronic acid", "residue": "glca", "count": 0, "cid": "94715", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/94715" }, { "name": "D-Glucosamine", "residue": "glcn", "count": 0, "cid": "439213", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439213" }, { "name": "N-Acetyl-D-Glucosamine", "residue": "glcnac", "count": 1, "cid": "439174", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439174" }, { "name": "N-Acetyl-D-glucosaminitol", "residue": "glcnac+aldi", "count": 0, "cid": "165206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165206" }, { "name": "Hexose", "residue": "hex", "count": 2, "cid": "206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206" }, { "name": "N-Acetylhexosamine", "residue": "hexnac", "count": 1, "cid": "899", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899" }, { "name": "Hexuronic Acid", "residue": "hexa", "count": 0, "cid": "610", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610" }, { "name": "2-Amino-2-Deoxy-Hexose", "residue": "hexn", "count": 0, "cid": "739", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739" }, { "name": "Hexitol", "residue": "hex+aldi", "count": 0, "cid": "453", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/453" }, { "name": "N-Acetylhexosaminitol", "residue": "hexnac+aldi", "count": 0 }, { "name": "L-Iduronic acid", "residue": "idoa", "count": 0, "cid": "441039", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/441039" }, { "name": "D-Mannose", "residue": "man", "count": 0, "cid": "18950", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18950" }, { "name": "D-Mannitol", "residue": "man+aldi", "count": 0, "cid": "6251", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6251" }, { "name": "D-Mannosamine", "residue": "mann", "count": 0, "cid": "440049", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440049" }, { "name": "N-Acetyl-D-mannosamine", "residue": "mannac", "count": 0, "cid": "439281", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439281" }, { "name": "Methyl", "residue": "me", "count": 0 }, { "name": "N-Acetyl-Neuraminic Acid", "residue": "neuac", "count": 0, "cid": "439197", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197" }, { "name": "N-Glycolyl-Neuraminic Acid", "residue": "neugc", "count": 0, "cid": "440001", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001" }, { "name": "Phosphate", "residue": "p", "count": 0, "cid": "1061", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061" }, { "name": "Pentose", "residue": "pent", "count": 0, "cid": "229", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229" }, { "name": "Sulfate", "residue": "s", "count": 0, "cid": "1117", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117" }, { "name": "Sialic acid", "residue": "sia", "count": 0, "cid": "906", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/906" }, { "name": "Other", "residue": "other", "count": 0 }, { "name": "Floating substituent", "residue": "x", "count": 0 }, { "name": "D-Xylose", "residue": "xyl", "count": 0, "cid": "135191", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135191" }, { "name": "Ketodeoxynononic acid", "residue": "kdn", "count": 0, "cid": "13991616", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13991616" } ], "motifs": [ { "id": "GGM.000001", "name": "Type 2 LN", "synonym": "N-acetyllactosamine", "keywords": "LacNAc; N-acetyllactosamine; N-acetyllactosamine type 2" } ], "interactions": [], "expression": [], "subsumption": [ { "related_accession": "G05394UY", "relationship": "ancestor" }, { "related_accession": "G10663NS", "relationship": "ancestor" }, { "related_accession": "G13024ER", "relationship": "ancestor" }, { "related_accession": "G15825TO", "relationship": "ancestor" }, { "related_accession": "G22331NZ", "relationship": "ancestor" }, { "related_accession": "G23448MV", "relationship": "ancestor" }, { "related_accession": "G26424YB", "relationship": "ancestor" }, { "related_accession": "G43788SW", "relationship": "ancestor" }, { "related_accession": "G46831QF", "relationship": "ancestor" }, { "related_accession": "G56872WZ", "relationship": "ancestor" }, { "related_accession": "G60125SW", "relationship": "ancestor" }, { "related_accession": "G61193JO", "relationship": "ancestor" }, { "related_accession": "G87838NG", "relationship": "ancestor" }, { "related_accession": "G91975UP", "relationship": "ancestor" }, { "related_accession": "G92536LD", "relationship": "ancestor" }, { "related_accession": "G98898BT", "relationship": "ancestor" }, { "related_accession": "G05394UY", "relationship": "basecomposition" }, { "related_accession": "G22331NZ", "relationship": "composition" }, { "related_accession": "G23448MV", "relationship": "subsumedby" }, { "related_accession": "G87838NG", "relationship": "subsumedby" }, { "related_accession": "G92536LD", "relationship": "subsumedby" }, { "related_accession": "G15825TO", "relationship": "topology" } ], "names": [], "keywords": [ "fully_determined" ], "glycotree_pathways": [], "dictionary": {} }