{ "glytoucan_ac": "G00054MO", "number_monosaccharides": 4, "number_monosaccharides_suffix": "", "mass": 820.3, "mass_pme": 1030.53, "tool_support": { "gnome_glygen_oglycans": "no", "sandbox": "no", "gnome_glygen": "yes", "gnome": "yes", "gnome_glycotree_oglycans": "no", "pdb": "yes", "gnome_glygen_nglycans": "no", "gnome_glycotree_nglycans": "no" }, "fully_determined": "yes", "missing_score": 0, "glycan_type": "Saccharide", "iupac": "alpha-D-Neup5Ac-(2->3)-beta-D-Galp-(1->4)[alpha-L-Fucp-(1->3)]-beta-D-GlcpNAc-(1->", "wurcs": "WURCS=2.0/4,4,3/[a2122h-1b_1-5_2*NCC/3=O][a1221m-1a_1-5][a2112h-1b_1-5][Aad21122h-2a_2-6_5*NCC/3=O]/1-2-3-4/a3-b1_a4-c1_c3-d2", "glycoct": "RES 1b:b-dglc-HEX-1:5 2s:n-acetyl 3b:a-lgal-HEX-1:5|6:d 4b:b-dgal-HEX-1:5 5b:a-dgro-dgal-NON-2:6|1:a|2:keto|3:d 6s:n-acetyl LIN 1:1d(2+1)2n 2:1o(3+1)3d 3:1o(4+1)4d 4:4o(3+2)5d 5:5d(5+1)6n", "inchi": "InChI=1S/C31H52N2O23/c1-8-17(41)20(44)21(45)28(50-8)54-25-16(33-10(3)38)27(47)51-14(7-36)23(25)53-29-22(46)26(19(43)13(6-35)52-29)56-31(30(48)49)4-11(39)15(32-9(2)37)24(55-31)18(42)12(40)5-34/h8,11-29,34-36,39-47H,4-7H2,1-3H3,(H,32,37)(H,33,38)(H,48,49)/t8-,11-,12+,13+,14+,15+,16+,17+,18+,19-,20+,21-,22+,23+,24+,25+,26-,27+,28-,29-,31-/m0/s1", "glycam": "DNeup5Aca2-3DGalpb1-4[LFucpa1-3]DGlcpNAcb1-OH", "smiles_isomeric": "C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H](O[C@@H]([C@H]2O[C@H]3[C@@H]([C@H]([C@H]([C@H](O3)CO)O)O[C@@]4(C[C@@H]([C@H]([C@@H](O4)[C@@H]([C@@H](CO)O)O)NC(=O)C)O)C(=O)O)O)CO)O)NC(=O)C)O)O)O", "inchi_key": { "key": "NIGUVXFURDGQKZ-UQTBNESHSA-N", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/NIGUVXFURDGQKZ-UQTBNESHSA-N" }, "byonic": "Hex(1)HexNAc(1)dHex(1)NeuAc(1) % 820.29608631", "gwb": "freeEnd--1b1D-GlcNAc,p(--3a1L-Fuc,p)--4b1D-Gal,p--3a2D-NeuAc,p$MONO,Und,0,0,freeEnd", "species": [ { "taxid": 9606, "name": "Homo sapiens", "annotation_category": "Direct", "evidence": [ { "database": "GlyCosmos", "id": "G00054MO", "url": "https://glycosmos.org/glycans/show/G00054MO" }, { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "common_name": "Human" }, { "taxid": 10090, "name": "Mus musculus", "annotation_category": "Direct", "evidence": [ { "database": "GlyCosmos", "id": "G00054MO", "url": "https://glycosmos.org/glycans/show/G00054MO" }, { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "common_name": "Mouse" }, { "taxid": 10114, "name": "Rattus", "annotation_category": "Direct", "evidence": [ { "database": "GlyCosmos", "id": "G00054MO", "url": "https://glycosmos.org/glycans/show/G00054MO" } ], "common_name": "rats" } ], "classification": [ { "type": { "name": "Other", "url": "" }, "subtype": { "name": "Other", "url": "" } } ], "enzyme": [], "crossref": [ { "id": "44456859", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/44456859", "database": "PubChem Compound" }, { "id": "252277227", "url": "https://pubchem.ncbi.nlm.nih.gov/substance/252277227", "database": "PubChem Substance" }, { "id": "1g1r", "url": "https://www.rcsb.org/structure/1g1r", "database": "PDB" }, { "id": "1g1t", "url": "https://www.rcsb.org/structure/1g1t", "database": "PDB" }, { "id": "2kmb", "url": "https://www.rcsb.org/structure/2kmb", "database": "PDB" }, { "id": "2r61", "url": "https://www.rcsb.org/structure/2r61", "database": "PDB" }, { "id": "2z8l", "url": "https://www.rcsb.org/structure/2z8l", "database": "PDB" }, { "id": "13411", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=13411", "database": "Glycosciences.de" }, { "id": "149", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=149", "database": "Glycosciences.de" }, { "id": "1713", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=1713", "database": "Glycosciences.de" }, { "id": "19144", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=19144", "database": "Glycosciences.de" }, { "id": "19852", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=19852", "database": "Glycosciences.de" }, { "id": "2173", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=2173", "database": "Glycosciences.de" }, { "id": "2218", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=2218", "database": "Glycosciences.de" }, { "id": "22427", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=22427", "database": "Glycosciences.de" }, { "id": "2293", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=2293", "database": "Glycosciences.de" }, { "id": "4519", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=4519", "database": "Glycosciences.de" }, { "id": "6010", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=6010", "database": "Glycosciences.de" }, { "id": "9301", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=9301", "database": "Glycosciences.de" }, { "id": "carbPDB_00002_D000", "url": "http://www.functionalglycomics.org/glycomics/CarbohydrateServlet?pageType=view&view=view&operationType=view&carbId=carbPDB_00002_D000", "database": "CFG" }, { "id": "carbSynthe_0107_D000", "url": "http://www.functionalglycomics.org/glycomics/CarbohydrateServlet?pageType=view&view=view&operationType=view&carbId=carbSynthe_0107_D000", "database": "CFG" }, { "id": "carbSynthe_0559_D000", "url": "http://www.functionalglycomics.org/glycomics/CarbohydrateServlet?pageType=view&view=view&operationType=view&carbId=carbSynthe_0559_D000", "database": "CFG" }, { "id": "carbSynthe_0560_D000", "url": "http://www.functionalglycomics.org/glycomics/CarbohydrateServlet?pageType=view&view=view&operationType=view&carbId=carbSynthe_0560_D000", "database": "CFG" }, { "id": "carbSynthe_0733_D000", "url": "http://www.functionalglycomics.org/glycomics/CarbohydrateServlet?pageType=view&view=view&operationType=view&carbId=carbSynthe_0733_D000", "database": "CFG" }, { "id": "carbSynthe_0734_D000", "url": "http://www.functionalglycomics.org/glycomics/CarbohydrateServlet?pageType=view&view=view&operationType=view&carbId=carbSynthe_0734_D000", "database": "CFG" }, { "id": "carbSynthe_487_D000", "url": "http://www.functionalglycomics.org/glycomics/CarbohydrateServlet?pageType=view&view=view&operationType=view&carbId=carbSynthe_487_D000", "database": "CFG" }, { "id": "11191", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+11191", "database": "CarbBank" }, { "id": "14568", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+14568", "database": "CarbBank" }, { "id": "1806", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+1806", "database": "CarbBank" }, { "id": "20130", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+20130", "database": "CarbBank" }, { "id": "21241", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+21241", "database": "CarbBank" }, { "id": "25839", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+25839", "database": "CarbBank" }, { "id": "27704", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+27704", "database": "CarbBank" }, { "id": "28240", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+28240", "database": "CarbBank" }, { "id": "28520", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+28520", "database": "CarbBank" }, { "id": "28523", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+28523", "database": "CarbBank" }, { "id": "28533", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+28533", "database": "CarbBank" }, { "id": "29467", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+29467", "database": "CarbBank" }, { "id": "30049", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+30049", "database": "CarbBank" }, { "id": "30267", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+30267", "database": "CarbBank" }, { "id": "30795", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+30795", "database": "CarbBank" }, { "id": "31039", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+31039", "database": "CarbBank" }, { "id": "31048", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+31048", "database": "CarbBank" }, { "id": "31336", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+31336", "database": "CarbBank" }, { "id": "31587", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+31587", "database": "CarbBank" }, { "id": "31588", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+31588", "database": "CarbBank" }, { "id": "31589", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+31589", "database": "CarbBank" }, { "id": "31613", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+31613", "database": "CarbBank" }, { "id": "31635", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+31635", "database": "CarbBank" }, { "id": "31649", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+31649", "database": "CarbBank" }, { "id": "31666", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+31666", "database": "CarbBank" }, { "id": "32072", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+32072", "database": "CarbBank" }, { "id": "32081", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+32081", "database": "CarbBank" }, { "id": "32265", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+32265", "database": "CarbBank" }, { "id": "32548", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+32548", "database": "CarbBank" }, { "id": "32817", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+32817", "database": "CarbBank" }, { "id": "33146", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+33146", "database": "CarbBank" }, { "id": "33195", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+33195", "database": "CarbBank" }, { "id": "33197", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+33197", "database": "CarbBank" }, { "id": "33552", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+33552", "database": "CarbBank" }, { "id": "33886", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+33886", "database": "CarbBank" }, { "id": "33917", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+33917", "database": "CarbBank" }, { "id": "34678", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+34678", "database": "CarbBank" }, { "id": "34685", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+34685", "database": "CarbBank" }, { "id": "34710", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+34710", "database": "CarbBank" }, { "id": "34850", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+34850", "database": "CarbBank" }, { "id": "34852", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+34852", "database": "CarbBank" }, { "id": "34853", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+34853", "database": "CarbBank" }, { "id": "34855", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+34855", "database": "CarbBank" }, { "id": "34912", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+34912", "database": "CarbBank" }, { "id": "34946", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+34946", "database": "CarbBank" }, { "id": "34983", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+34983", "database": "CarbBank" }, { "id": "35279", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+35279", "database": "CarbBank" }, { "id": "35613", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+35613", "database": "CarbBank" }, { "id": "35664", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+35664", "database": "CarbBank" }, { "id": "35700", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+35700", "database": "CarbBank" }, { "id": "35736", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+35736", "database": "CarbBank" }, { "id": "36201", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+36201", "database": "CarbBank" }, { "id": "36253", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+36253", "database": "CarbBank" }, { "id": "36554", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+36554", "database": "CarbBank" }, { "id": "36908", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+36908", "database": "CarbBank" }, { "id": "36925", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+36925", "database": "CarbBank" }, { "id": "36944", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+36944", "database": "CarbBank" }, { "id": "36960", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+36960", "database": "CarbBank" }, { "id": "37027", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+37027", "database": "CarbBank" }, { "id": "37261", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+37261", "database": "CarbBank" }, { "id": "37597", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+37597", "database": "CarbBank" }, { "id": "37599", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+37599", "database": "CarbBank" }, { "id": "38131", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+38131", "database": "CarbBank" }, { "id": "38300", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+38300", "database": "CarbBank" }, { "id": "38317", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+38317", "database": "CarbBank" }, { "id": "38377", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+38377", "database": "CarbBank" }, { "id": "38646", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+38646", "database": "CarbBank" }, { "id": "38702", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+38702", "database": "CarbBank" }, { "id": "39618", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+39618", "database": "CarbBank" }, { "id": "40371", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+40371", "database": "CarbBank" }, { "id": "41404", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+41404", "database": "CarbBank" }, { "id": "41555", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+41555", "database": "CarbBank" }, { "id": "41589", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+41589", "database": "CarbBank" }, { "id": "41878", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+41878", "database": "CarbBank" }, { "id": "42329", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+42329", "database": "CarbBank" }, { "id": "42388", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+42388", "database": "CarbBank" }, { "id": "42391", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+42391", "database": "CarbBank" }, { "id": "42393", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+42393", "database": "CarbBank" }, { "id": "42394", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+42394", "database": "CarbBank" }, { "id": "42412", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+42412", "database": "CarbBank" }, { "id": "42429", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+42429", "database": "CarbBank" }, { "id": "42494", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+42494", "database": "CarbBank" }, { "id": "42583", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+42583", "database": "CarbBank" }, { "id": "42772", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+42772", "database": "CarbBank" }, { "id": "42790", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+42790", "database": "CarbBank" }, { "id": "43028", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+43028", "database": "CarbBank" }, { "id": "43213", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+43213", "database": "CarbBank" }, { "id": "43343", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+43343", "database": "CarbBank" }, { "id": "43474", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+43474", "database": "CarbBank" }, { "id": "43477", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+43477", "database": "CarbBank" }, { "id": "43601", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+43601", "database": "CarbBank" }, { "id": "43811", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+43811", "database": "CarbBank" }, { "id": "43838", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+43838", "database": "CarbBank" }, { "id": "44018", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+44018", "database": "CarbBank" }, { "id": "44030", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+44030", "database": "CarbBank" }, { "id": "44229", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+44229", "database": "CarbBank" }, { "id": "44249", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+44249", "database": "CarbBank" }, { "id": "44250", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+44250", "database": "CarbBank" }, { "id": "44256", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+44256", "database": "CarbBank" }, { "id": "44276", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+44276", "database": "CarbBank" }, { "id": "44362", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+44362", "database": "CarbBank" }, { "id": "44464", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+44464", "database": "CarbBank" }, { "id": "44476", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+44476", "database": "CarbBank" }, { "id": "44509", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+44509", "database": "CarbBank" }, { "id": "44522", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+44522", "database": "CarbBank" }, { "id": "44541", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+44541", "database": "CarbBank" }, { "id": "44793", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+44793", "database": "CarbBank" }, { "id": "44877", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+44877", "database": "CarbBank" }, { "id": "44879", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+44879", "database": "CarbBank" }, { "id": "45616", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+45616", "database": "CarbBank" }, { "id": "45711", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+45711", "database": "CarbBank" }, { "id": "45860", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+45860", "database": "CarbBank" }, { "id": "45870", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+45870", "database": "CarbBank" }, { "id": "45878", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+45878", "database": "CarbBank" }, { "id": "45884", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+45884", "database": "CarbBank" }, { "id": "45892", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+45892", "database": "CarbBank" }, { "id": "45902", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+45902", "database": "CarbBank" }, { "id": "46006", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+46006", "database": "CarbBank" }, { "id": "46010", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+46010", "database": "CarbBank" }, { "id": "46168", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+46168", "database": "CarbBank" }, { "id": "46233", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+46233", "database": "CarbBank" }, { "id": "46238", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+46238", "database": "CarbBank" }, { "id": "46239", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+46239", "database": "CarbBank" }, { "id": "46276", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+46276", "database": "CarbBank" }, { "id": "46367", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+46367", "database": "CarbBank" }, { "id": "46447", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+46447", "database": "CarbBank" }, { "id": "46469", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+46469", "database": "CarbBank" }, { "id": "46492", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+46492", "database": "CarbBank" }, { "id": "46548", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+46548", "database": "CarbBank" }, { "id": "46796", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+46796", "database": "CarbBank" }, { "id": "46810", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+46810", "database": "CarbBank" }, { "id": "46897", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+46897", "database": "CarbBank" }, { "id": "47401", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+47401", "database": "CarbBank" }, { "id": "47458", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+47458", "database": "CarbBank" }, { "id": "47794", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+47794", "database": "CarbBank" }, { "id": "47822", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+47822", "database": "CarbBank" }, { "id": "48043", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+48043", "database": "CarbBank" }, { "id": "48366", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+48366", "database": "CarbBank" }, { "id": "48369", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+48369", "database": "CarbBank" }, { "id": "48370", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+48370", "database": "CarbBank" }, { "id": "48488", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+48488", "database": "CarbBank" }, { "id": "48544", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+48544", "database": "CarbBank" }, { "id": "48560", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+48560", "database": "CarbBank" }, { "id": "48914", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+48914", "database": "CarbBank" }, { "id": "49000", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+49000", "database": "CarbBank" }, { "id": "49045", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+49045", "database": "CarbBank" }, { "id": "49051", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+49051", "database": "CarbBank" }, { "id": "49148", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+49148", "database": "CarbBank" }, { "id": "49343", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+49343", "database": "CarbBank" }, { "id": "49496", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+49496", "database": "CarbBank" }, { "id": "49514", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+49514", "database": "CarbBank" }, { "id": "50145", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+50145", "database": "CarbBank" }, { "id": "50148", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+50148", "database": "CarbBank" }, { "id": "50789", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+50789", "database": "CarbBank" }, { "id": "6615", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+6615", "database": "CarbBank" }, { "id": "7792", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+7792", "database": "CarbBank" }, { "id": "8075", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+8075", "database": "CarbBank" }, { "id": "26818", "url": "http://csdb.glycoscience.ru/bacterial/core/search_id.php?mode=record&id_list=26818", "database": "BCSDB" }, { "id": "6922", "url": "http://csdb.glycoscience.ru/bacterial/core/search_id.php?mode=record&id_list=6922", "database": "BCSDB" }, { "id": "71622", "url": "https://www.ebi.ac.uk/chebi/searchId.do?chebiId=71622", "database": "ChEBI" }, { "id": "EP0012", "url": "https://www.glycoepitope.jp/epitopes/EP0012", "database": "GlycoEpitope" }, { "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO", "database": "GlyTouCan" }, { "id": "G00054MO", "url": "https://gnome.glyomics.org/restrictions/GlyGen.StructureBrowser.html?focus=G00054MO", "database": "GNOme" }, { "id": "G00054MO", "url": "https://glycosmos.org/glycans/show/G00054MO", "database": "GlyCosmos" }, { "id": "GSD000151", "url": "https://wiki.glygen.org/Glycan_structure_dictionary#GSD000151", "database": "Glycan Structure Dictionary" } ], "glycoprotein": [], "publication": [ { "title": "Reconstitution of functional L-selectin ligands on a cultured human endothelial cell line by cotransfection of alpha1-->3 fucosyltransferase VII and newly cloned GlcNAcbeta:6-sulfotransferase cDNA.", "journal": "Proceedings of the National Academy of Sciences of the United States of America", "date": "1999", "authors": "Kimura N, Mitsuoka C, Kanamori A, Hiraiwa N, Uchimura K, Muramatsu T, Tamatani T, Kansas GS, Kannagi R", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "10200296", "url": "https://glygen.org/publication/PubMed/10200296" } ] }, { "title": "L-selectin ligands expressed by human leukocytes are HECA-452 antibody-defined carbohydrate epitopes preferentially displayed by P-selectin glycoprotein ligand-1.", "journal": "Journal of immunology (Baltimore, Md. : 1950)", "date": "1999", "authors": "Tu L, Murphy PG, Li X, Tedder TF", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "10528213", "url": "https://glygen.org/publication/PubMed/10528213" } ] }, { "title": "Mucin core protein expression in extrahepatic bile duct carcinoma is associated with metastases to the liver and poor prognosis.", "journal": "Cancer", "date": "1999", "authors": "Takao S, Uchikura K, Yonezawa S, Shinchi H, Aikou T", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "10570420", "url": "https://glygen.org/publication/PubMed/10570420" } ] }, { "title": "Expression of sialyl 6-sulfo Lewis X is inversely correlated with conventional sialyl Lewis X expression in human colorectal cancer.", "journal": "Cancer research", "date": "2000", "authors": "Izawa M, Kumamoto K, Mitsuoka C, Kanamori C, Kanamori A, Ohmori K, Ishida H, Nakamura S, Kurata-Miura K, Sasaki K, Nishi T, Kannagi R", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "10728707", "url": "https://glygen.org/publication/PubMed/10728707" } ] }, { "title": "Expression of SIALYL-Le(x) antigen defined by MAb AM-3 is an independent prognostic marker in colorectal carcinoma patients.", "journal": "International journal of cancer", "date": "2000", "authors": "Grabowski P, Mann B, Mansmann U, Lovin N, Foss HD, Berger G, Scherubl H, Riecken EO, Buhr HJ, Hanski C", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "11004681", "url": "https://glygen.org/publication/PubMed/11004681" } ] }, { "title": "High endothelial venule-like vessels in the interstitial lesions of human glomerulonephritis.", "journal": "American journal of nephrology", "date": "2002", "authors": "Takaeda M, Yokoyama H, Segawa-Takaeda C, Wada T, Kobayashi K", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "11919403", "url": "https://glygen.org/publication/PubMed/11919403" } ] }, { "title": "Glycosylation might provide endothelial zip codes for organ-specific leukocyte traffic into inflammatory sites.", "journal": "The American journal of pathology", "date": "2002", "authors": "Renkonen J, Tynninen O, Hayry P, Paavonen T, Renkonen R", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "12163379", "url": "https://glygen.org/publication/PubMed/12163379" } ] }, { "title": "Increased expression of sialyl Lewis(x) antigen in penetrating growth type A early gastric cancer.", "journal": "Journal of experimental & clinical cancer research : CR", "date": "2002", "authors": "Nakagoe T, Fukushima K, Sawai T, Tsuji T, Jibiki M, Nanashima A, Tanaka K, Yamaguchi H, Yasutake T, Ayabe H, Ishikawa H", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "12385579", "url": "https://glygen.org/publication/PubMed/12385579" } ] }, { "title": "Tumor cell MUC1 and CD43 are glycosylated differently with sialyl-Lewis a and x epitopes and show variable interactions with E-selectin under physiological flow conditions.", "journal": "Glycoconjugate journal", "date": "2001", "authors": "Fernandez-Rodriguez J, Dwir O, Alon R, Hansson GC", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "12820726", "url": "https://glygen.org/publication/PubMed/12820726" } ] }, { "title": "Human epidermal keratinocyte expression of sialyl-Lewis X.", "journal": "The Journal of investigative dermatology", "date": "1992", "authors": "Symington FW, Holmes EH, Symington BE", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "1358980", "url": "https://glygen.org/publication/PubMed/1358980" } ] }, { "title": "Reactivity profiles of leukemic myeloblasts with monoclonal antibodies directed to sialosyl-Le(x) and other lacto-series type 2 chain antigens:absence of reactivity with normal hematopoietic progenitor cells.", "journal": "Blood", "date": "1992", "authors": "Muroi K, Suda T, Nojiri H, Ema H, Amemiya Y, Miura Y, Nakauchi H, Singhal A, Hakomori S", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "1370643", "url": "https://glygen.org/publication/PubMed/1370643" } ] }, { "title": "Complement regulatory protein C1 inhibitor binds to selectins and interferes with endothelial-leukocyte adhesion.", "journal": "Journal of immunology (Baltimore, Md. : 1950)", "date": "2003", "authors": "Cai S, Davis AE 3rd", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "14568956", "url": "https://glygen.org/publication/PubMed/14568956" } ] }, { "title": "Antigenic differences between metastatic cells in bone marrow and primary tumours and the anti-MUC1 humoral immune response induced in breast cancer patients.", "journal": "Clinical & experimental metastasis", "date": "2004", "authors": "Croce MV, Isla-Larrain M, Tur R, Rabassa ME, Segal-Eiras A", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "15168731", "url": "https://glygen.org/publication/PubMed/15168731" } ] }, { "title": "Differences in prognosis of colorectal cancer patients based on the expression of sialyl Lewisa, sialyl Lewisx and sialyl Tn antigens in serum and tumor tissue.", "journal": "Anticancer research", "date": "2004", "authors": "Akamine S, Nakagoe T, Sawai T, Tsuji T, Tanaka K, Hidaka S, Shibasaki S, Nanashima A, Yamaguchi H, Nagayasu T, Yasutake T", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "15330211", "url": "https://glygen.org/publication/PubMed/15330211" } ] }, { "title": "ELAM-1--dependent cell adhesion to vascular endothelium determined by a transfected human fucosyltransferase cDNA.", "journal": "Cell", "date": "1990", "authors": "Lowe JB, Stoolman LM, Nair RP, Larsen RD, Berhend TL, Marks RM", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "1699667", "url": "https://glygen.org/publication/PubMed/1699667" } ] }, { "title": "ELAM-1 mediates cell adhesion by recognition of a carbohydrate ligand, sialyl-Lex.", "journal": "Science (New York, N.Y.)", "date": "1990", "authors": "Phillips ML, Nudelman E, Gaeta FC, Perez M, Singhal AK, Hakomori S, Paulson JC", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "1701274", "url": "https://glygen.org/publication/PubMed/1701274" } ] }, { "title": "Recognition by ELAM-1 of the sialyl-Lex determinant on myeloid and tumor cells.", "journal": "Science (New York, N.Y.)", "date": "1990", "authors": "Walz G, Aruffo A, Kolanus W, Bevilacqua M, Seed B", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "1701275", "url": "https://glygen.org/publication/PubMed/1701275" } ] }, { "title": "Lewis x is highly expressed in normal tissues: a comparative immunohistochemical study and literature revision.", "journal": "Pathology oncology research : POR", "date": "2007", "authors": "Croce MV, Isla-Larrain M, Rabassa ME, Demichelis S, Colussi AG, Crespo M, Lacunza E, Segal-Eiras A", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "17607374", "url": "https://glygen.org/publication/PubMed/17607374" } ] }, { "title": "Northern hybridization analysis of VH gene expression in murine monoclonal antibodies directed to cancer-associated ganglioside antigens having various sialic acid linkages.", "journal": "Journal of immunology (Baltimore, Md. : 1950)", "date": "1990", "authors": "Zenita K, Hirashima K, Shigeta K, Hiraiwa N, Takada A, Hashimoto K, Fujimoto E, Yago K, Kannagi R", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "2111348", "url": "https://glygen.org/publication/PubMed/2111348" } ] }, { "title": "Immunohistological and biochemical detection of fucosylated polylactosamine antigen with monoclonal antibody ACFH18 in gastric cancer and normal gastric mucosa.", "journal": "Japanese journal of cancer research : Gann", "date": "1990", "authors": "Dohi T, Abe K, Ohshiba S, Yamaguchi K, Oshima M", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "2119368", "url": "https://glygen.org/publication/PubMed/2119368" } ] }, { "title": "[An immunohistochemical evaluation of Warthin's tumor using the monoclonal anti-human lung adenocarcinoma antibody KM-93 and the anti-human gastric carcinoma antibody KM-231].", "journal": "Gan no rinsho. Japan journal of cancer clinics", "date": "1990", "authors": "Tsuji T, Kimura Y, Murakami T, Sasaki K, Shinozaki F", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "2355463", "url": "https://glygen.org/publication/PubMed/2355463" } ] }, { "title": "Sialyl SSEA-1 antigen as a carbohydrate marker of human natural killer cells and immature lymphoid cells.", "journal": "Blood", "date": "1989", "authors": "Ohmori K, Yoneda T, Ishihara G, Shigeta K, Hirashima K, Kanai M, Itai S, Sasaoki T, Arii S, Arita H, et al.", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "2568858", "url": "https://glygen.org/publication/PubMed/2568858" } ] }, { "title": "Immunohistochemical detection of human lung and gastric cancer antigen in human salivary gland tumors.", "journal": "Anticancer research", "date": "1989", "authors": "Tsuzi T, Shinozaki F, Yamada K, Mori M", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "2665633", "url": "https://glygen.org/publication/PubMed/2665633" } ] }, { "title": "[Monoclonal antibody NCC-ST-439 in gastric cancer tissue].", "journal": "Nihon Geka Gakkai zasshi", "date": "1989", "authors": "Kamata T, Yoneumura Y, Sugiyama K, Yamaguchi A, Miwa K, Miyazaki I", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "2747606", "url": "https://glygen.org/publication/PubMed/2747606" } ] }, { "title": "Quantitative and qualitative characterization of human cancer-associated serum glycoprotein antigens expressing fucosyl or sialyl-fucosyl type 2 chain polylactosamine.", "journal": "Cancer research", "date": "1986", "authors": "Kannagi R, Fukushi Y, Tachikawa T, Noda A, Shin S, Shigeta K, Hiraiwa N, Fukuda Y, Inamoto T, Hakomori S, et al.", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "3008996", "url": "https://glygen.org/publication/PubMed/3008996" } ] }, { "title": "Distribution of lung adenocarcinoma-associated antigens in human tissues and sera defined by monoclonal antibodies KM-52 and KM-93.", "journal": "Cancer research", "date": "1987", "authors": "Shitara K, Hanai N, Yoshida H", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "3545444", "url": "https://glygen.org/publication/PubMed/3545444" } ] }, { "title": "Generation of monoclonal antibodies against human lung squamous cell carcinoma and adenocarcinoma using mice rendered tolerant to normal human lung.", "journal": "Cancer research", "date": "1986", "authors": "Hanai N, Shitara K, Yoshida H", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "3731100", "url": "https://glygen.org/publication/PubMed/3731100" } ] }, { "title": "Location and distribution of difucoganglioside (VI3NeuAcV3III3Fuc2nLc6) in normal and tumor tissues defined by its monoclonal antibody FH6.", "journal": "Cancer research", "date": "1985", "authors": "Fukushi Y, Kannagi R, Hakomori S, Shepard T, Kulander BG, Singer JW", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "4016748", "url": "https://glygen.org/publication/PubMed/4016748" } ] }, { "title": "Characterization of sialosylated Lewisx as a new tumor-associated antigen.", "journal": "Cancer research", "date": "1984", "authors": "Fukushima K, Hirota M, Terasaki PI, Wakisaka A, Togashi H, Chia D, Suyama N, Fukushi Y, Nudelman E, Hakomori S", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" }, { "database": "Glycan Motif", "id": "GGM.000022", "url": "https://glycomotif.glyomics.org/glycomotif/GGM.000022" } ], "reference": [ { "type": [ "PubMed" ], "id": "6386148", "url": "https://glygen.org/publication/PubMed/6386148" } ] }, { "title": "Novel fucolipids accumulating in human adenocarcinoma. III. A hybridoma antibody (FH6) defining a human cancer-associated difucoganglioside (VI3NeuAcV3III3Fuc2nLc6).", "journal": "The Journal of biological chemistry", "date": "1984", "authors": "Fukushi Y, Nudelman E, Levery SB, Hakomori S, Rauvala H", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "6469974", "url": "https://glygen.org/publication/PubMed/6469974" } ] }, { "title": "Recognition of consensus CHO structure in ligands for selectins by novel antibody against sialyl Lewis X.", "journal": "The American journal of physiology", "date": "1995", "authors": "Tamatani T, Suematsu M, Tezuka K, Hanzawa N, Tsuji T, Ishimura Y, Kannagi R, Toyoshima S, Homma M", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "7485559", "url": "https://glygen.org/publication/PubMed/7485559" } ] }, { "title": "The P-selectin glycoprotein ligand from human neutrophils displays sialylated, fucosylated, O-linked poly-N-acetyllactosamine.", "journal": "The Journal of biological chemistry", "date": "1994", "authors": "Moore KL, Eaton SF, Lyons DE, Lichenstein HS, Cummings RD, McEver RP", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "7521878", "url": "https://glygen.org/publication/PubMed/7521878" } ] }, { "title": "The E-selectin-ligand ESL-1 is a variant of a receptor for fibroblast growth factor.", "journal": "Nature", "date": "1995", "authors": "Steegmaier M, Levinovitz A, Isenmann S, Borges E, Lenter M, Kocher HP, Kleuser B, Vestweber D", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "7531823", "url": "https://glygen.org/publication/PubMed/7531823" } ] }, { "title": "Impairment of selectin-mediated leukocyte adhesion to venular endothelium in spontaneously hypertensive rats.", "journal": "The Journal of clinical investigation", "date": "1995", "authors": "Suematsu M, Suzuki H, Tamatani T, Iigou Y, DeLano FA, Miyasaka M, Forrest MJ, Kannagi R, Zweifach BW, Ishimura Y, et al.", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "7560094", "url": "https://glygen.org/publication/PubMed/7560094" } ] }, { "title": "Specific expression of a complex sialyl Lewis X antigen on high endothelial venules of human lymph nodes: possible candidate for L-selectin ligand.", "journal": "Biochemical and biophysical research communications", "date": "1993", "authors": "Sawada M, Takada A, Ohwaki I, Takahashi N, Tateno H, Sakamoto J, Kannagi R", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "7684905", "url": "https://glygen.org/publication/PubMed/7684905" } ] }, { "title": "A distinct type of sialyl Lewis X antigen defined by a novel monoclonal antibody is selectively expressed on helper memory T cells.", "journal": "Blood", "date": "1993", "authors": "Ohmori K, Takada A, Ohwaki I, Takahashi N, Furukawa Y, Maeda M, Kiso M, Hasegawa A, Kannagi M, Kannagi R", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "7693048", "url": "https://glygen.org/publication/PubMed/7693048" } ] }, { "title": "Characterization of the major sialyl-Lex-positive mucins present in colon, colon carcinoma, and sera of patients with colorectal cancer.", "journal": "Cancer research", "date": "1995", "authors": "Hanski C, Hanski ML, Zimmer T, Ogorek D, Devine P, Riecken EO", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "7850810", "url": "https://glygen.org/publication/PubMed/7850810" } ] }, { "title": "Different binding properties of three monoclonal antibodies to sialyl Le(x) glycolipids in a gastric cancer cell line and normal stomach tissue.", "journal": "Anticancer research", "date": "1993", "authors": "Dohi T, Nemoto T, Ohta S, Shitara K, Hanai N, Nudelman E, Hakomori S, Oshima M", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "8239497", "url": "https://glygen.org/publication/PubMed/8239497" } ] }, { "title": "Association of expression of blood group-related carbohydrate antigens with prognosis in breast cancer.", "journal": "Cancer", "date": "1993", "authors": "Narita T, Funahashi H, Satoh Y, Watanabe T, Sakamoto J, Takagi H", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "8490832", "url": "https://glygen.org/publication/PubMed/8490832" } ] }, { "title": "Expression of alpha-1,3-fucosyltransferase type IV and VII genes is related to poor prognosis in lung cancer.", "journal": "Cancer research", "date": "1996", "authors": "Ogawa J, Inoue H, Koide S", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "8542587", "url": "https://glygen.org/publication/PubMed/8542587" } ] }, { "title": "The alpha(1,3)fucosyltransferase Fuc-TVII controls leukocyte trafficking through an essential role in L-, E-, and P-selectin ligand biosynthesis.", "journal": "Cell", "date": "1996", "authors": "Maly P, Thall A, Petryniak B, Rogers CE, Smith PL, Marks RM, Kelly RJ, Gersten KM, Cheng G, Saunders TL, Camper SA, Camphausen RT, Sullivan FX, Isogai Y, Hindsgaul O, von Andrian UH, Lowe JB", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "8752218", "url": "https://glygen.org/publication/PubMed/8752218" } ] }, { "title": "Expression of sialyl Lewis(X) in rat heart with ischaemia/reperfusion and reduction of myocardial reperfusion injury by a monoclonal antibody against sialyl Lewis(X)", "journal": "The Journal of pathology", "date": "1996", "authors": "Seko Y, Enokawa Y, Tamatani T, Kannagi R, Yagita H, Okumura K, Yazaki Y", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "8958810", "url": "https://glygen.org/publication/PubMed/8958810" } ] }, { "title": "Sulfated sialyl Lewis X, the putative L-selectin ligand, detected on endothelial cells of high endothelial venules by a distinct set of anti-sialyl Lewis X antibodies.", "journal": "Biochemical and biophysical research communications", "date": "1997", "authors": "Mitsuoka C, Kawakami-Kimura N, Kasugai-Sawada M, Hiraiwa N, Toda K, Ishida H, Kiso M, Hasegawa A, Kannagi R", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "9015359", "url": "https://glygen.org/publication/PubMed/9015359" } ] }, { "title": "Role of a sialyl Lewis(x)-like epitope selectively expressed on vascular endothelial cells in local skin inflammation of the rat.", "journal": "Journal of immunology (Baltimore, Md. : 1950)", "date": "1997", "authors": "Akahori T, Yuzawa Y, Nishikawa K, Tamatani T, Kannagi R, Miyasaka M, Okada H, Hotta N, Matsuo S", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "9164959", "url": "https://glygen.org/publication/PubMed/9164959" } ] }, { "title": "Expression of leukocyte fucosyltransferases regulates binding to E-selectin: relationship to previously implicated carbohydrate epitopes.", "journal": "Journal of immunology (Baltimore, Md. : 1950)", "date": "1997", "authors": "Wagers AJ, Stoolman LM, Kannagi R, Craig R, Kansas GS", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "9257857", "url": "https://glygen.org/publication/PubMed/9257857" } ] }, { "title": "Cloning and heterologous expression of an alpha1,3-fucosyltransferase gene from the gastric pathogen Helicobacter pylori.", "journal": "The Journal of biological chemistry", "date": "1997", "authors": "Ge Z, Chan NW, Palcic MM, Taylor DE", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "9261149", "url": "https://glygen.org/publication/PubMed/9261149" } ] }, { "title": "Carbohydrate-mediated cell adhesion involved in hematogenous metastasis of cancer.", "journal": "Glycoconjugate journal", "date": "1997", "authors": "Kannagi R", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "9298690", "url": "https://glygen.org/publication/PubMed/9298690" } ] }, { "title": "L-Selectin ligands that are O-glycoprotease resistant and distinct from MECA-79 antigen are sufficient for tethering and rolling of lymphocytes on human high endothelial venules.", "journal": "The Journal of cell biology", "date": "1998", "authors": "Clark RA, Fuhlbrigge RC, Springer TA", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "9456330", "url": "https://glygen.org/publication/PubMed/9456330" } ] }, { "title": "Identification of a major carbohydrate capping group of the L-selectin ligand on high endothelial venules in human lymph nodes as 6-sulfo sialyl Lewis X.", "journal": "The Journal of biological chemistry", "date": "1998", "authors": "Mitsuoka C, Sawada-Kasugai M, Ando-Furui K, Izawa M, Nakanishi H, Nakamura S, Ishida H, Kiso M, Kannagi R", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "9556613", "url": "https://glygen.org/publication/PubMed/9556613" } ] }, { "title": "Characterization of E-selectin-binding epitopes expressed by skin-homing T cells.", "journal": "Immunology", "date": "1998", "authors": "Priest R, Bird MI, Malhotra R", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "9767440", "url": "https://glygen.org/publication/PubMed/9767440" } ] }, { "title": "Identification of sialyl Lewis-x in squamous cell carcinoma of the head and neck.", "journal": "Head & neck", "date": "1998", "authors": "Farmer RW, Richtsmeier WJ, Scher RL", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "9790295", "url": "https://glygen.org/publication/PubMed/9790295" } ] }, { "title": "Novel monoclonal antibodies to putative selectin carbohydrate ligands that inhibit selectin binding to myeloid cells.", "journal": "Hybridoma", "date": "1998", "authors": "Zhang K, Chuluyan HE, Hardie D, Shen DC, Larsen R, Issekutz A", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "9873990", "url": "https://glygen.org/publication/PubMed/9873990" } ] }, { "title": "Immunohistopathological characterizatin of spontaneous metastases in a human lung mucoepidermoid adenocarcinoma (HLMC) xenograft.", "journal": "Pathology oncology research : POR", "date": "1998", "authors": "Croce MV, Colussi AG, De Bravo MG, Price MR, Segal-Eiras A", "evidence": [ { "database": "GlyTouCan", "id": "G00054MO", "url": "https://glytoucan.org/Structures/Glycans/G00054MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "9887355", "url": "https://glygen.org/publication/PubMed/9887355" } ] }, { "title": "The repertoire of glycan determinants in the human glycome.", "journal": "Molecular bioSystems", "date": "2009", "authors": "Cummings RD", "evidence": [ { "database": "Glycan Motif", "id": "GGM.000022", "url": "https://glycomotif.glyomics.org/glycomotif/GGM.000022" } ], "reference": [ { "type": [ "PubMed" ], "id": "19756298", "url": "https://glygen.org/publication/PubMed/19756298" } ] } ], "residues": [], "composition": [ { "name": "6-Deoxy-Hexose", "residue": "dhex", "count": 1, "cid": "840", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840" }, { "name": "Hexose", "residue": "hex", "count": 1, "cid": "206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206" }, { "name": "N-Acetylhexosamine", "residue": "hexnac", "count": 1, "cid": "899", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899" }, { "name": "Hexuronic Acid", "residue": "hexa", "count": 0, "cid": "610", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610" }, { "name": "2-Amino-2-Deoxy-Hexose", "residue": "hexn", "count": 0, "cid": "739", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739" }, { "name": "N-Acetyl-Neuraminic Acid", "residue": "neuac", "count": 1, "cid": "439197", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197" }, { "name": "N-Glycolyl-Neuraminic Acid", "residue": "neugc", "count": 0, "cid": "440001", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001" }, { "name": "Phosphate", "residue": "p", "count": 0, "cid": "1061", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061" }, { "name": "Pentose", "residue": "pent", "count": 0, "cid": "229", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229" }, { "name": "Sulfate", "residue": "s", "count": 0, "cid": "1117", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117" }, { "name": "Other", "residue": "other", "count": 0 } ], "composition_expanded": [ { "name": "Alditol", "residue": "aldi", "count": 0 }, { "name": "6-Deoxy-Hexose", "residue": "dhex", "count": 1, "cid": "840", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840" }, { "name": "6-Deoxy-Hexitol", "residue": "dhex+aldi", "count": 0 }, { "name": "L-Fucose", "residue": "fuc", "count": 1, "cid": "17106", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/17106" }, { "name": "L-Fucitol", "residue": "fuc+aldi", "count": 0, "cid": "445724", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/445724" }, { "name": "D-Galactose", "residue": "gal", "count": 1, "cid": "6036", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6036" }, { "name": "D-Galacitol", "residue": "gal+aldi", "count": 0, "cid": "11850", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11850" }, { "name": "D-Galactosamine", "residue": "galn", "count": 0, "cid": "24154", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/24154" }, { "name": "N-Acetyl-D-galactosamine", "residue": "galnac", "count": 0, "cid": "35717", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/35717" }, { "name": "N-Acetylgalactosaminitol", "residue": "galnac+aldi", "count": 0, "cid": "165880", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165880" }, { "name": "D-Glucose", "residue": "glc", "count": 0, "cid": "5793", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5793" }, { "name": "D-Glucitol", "residue": "glc+aldi", "count": 0, "cid": "5780", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5780" }, { "name": "D-Glucuronic acid", "residue": "glca", "count": 0, "cid": "94715", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/94715" }, { "name": "D-Glucosamine", "residue": "glcn", "count": 0, "cid": "439213", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439213" }, { "name": "N-Acetyl-D-Glucosamine", "residue": "glcnac", "count": 1, "cid": "439174", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439174" }, { "name": "N-Acetyl-D-glucosaminitol", "residue": "glcnac+aldi", "count": 0, "cid": "165206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165206" }, { "name": "Hexose", "residue": "hex", "count": 1, "cid": "206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206" }, { "name": "N-Acetylhexosamine", "residue": "hexnac", "count": 1, "cid": "899", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899" }, { "name": "Hexuronic Acid", "residue": "hexa", "count": 0, "cid": "610", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610" }, { "name": "2-Amino-2-Deoxy-Hexose", "residue": "hexn", "count": 0, "cid": "739", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739" }, { "name": "Hexitol", "residue": "hex+aldi", "count": 0, "cid": "453", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/453" }, { "name": "N-Acetylhexosaminitol", "residue": "hexnac+aldi", "count": 0 }, { "name": "L-Iduronic acid", "residue": "idoa", "count": 0, "cid": "441039", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/441039" }, { "name": "D-Mannose", "residue": "man", "count": 0, "cid": "18950", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18950" }, { "name": "D-Mannitol", "residue": "man+aldi", "count": 0, "cid": "6251", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6251" }, { "name": "D-Mannosamine", "residue": "mann", "count": 0, "cid": "440049", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440049" }, { "name": "N-Acetyl-D-mannosamine", "residue": "mannac", "count": 0, "cid": "439281", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439281" }, { "name": "Methyl", "residue": "me", "count": 0 }, { "name": "N-Acetyl-Neuraminic Acid", "residue": "neuac", "count": 1, "cid": "439197", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197" }, { "name": "N-Glycolyl-Neuraminic Acid", "residue": "neugc", "count": 0, "cid": "440001", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001" }, { "name": "Phosphate", "residue": "p", "count": 0, "cid": "1061", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061" }, { "name": "Pentose", "residue": "pent", "count": 0, "cid": "229", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229" }, { "name": "Sulfate", "residue": "s", "count": 0, "cid": "1117", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117" }, { "name": "Sialic acid", "residue": "sia", "count": 1, "cid": "906", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/906" }, { "name": "Other", "residue": "other", "count": 0 }, { "name": "Floating substituent", "residue": "x", "count": 0 }, { "name": "D-Xylose", "residue": "xyl", "count": 0, "cid": "135191", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135191" }, { "name": "Ketodeoxynononic acid", "residue": "kdn", "count": 0, "cid": "13991616", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13991616" } ], "motifs": [ { "id": "GGM.000001", "name": "Type 2 LN", "synonym": "N-acetyllactosamine", "keywords": "LacNAc; N-acetyllactosamine; N-acetyllactosamine type 2" }, { "id": "GGM.000018", "name": "Lewis x", "synonym": "Le^x; Lex; SSEA-1", "keywords": "Lewis x" }, { "id": "GGM.000022", "name": "Sialyl Lewis x", "synonym": "SLe^x; SLex; Slex", "keywords": "Lewis x" }, { "id": "GGM.000034", "name": "3-Sialyl-LN (type 2)", "synonym": "", "keywords": "LacNAc; N-acetyllactosamine; N-acetyllactosamine type 2" } ], "interactions": [], "expression": [], "subsumption": [ { "related_accession": "G01010HI", "relationship": "ancestor" }, { "related_accession": "G04943NQ", "relationship": "ancestor" }, { "related_accession": "G05917SW", "relationship": "ancestor" }, { "related_accession": "G11499FP", "relationship": "ancestor" }, { "related_accession": "G12460CJ", "relationship": "ancestor" }, { "related_accession": "G12750SG", "relationship": "ancestor" }, { "related_accession": "G12942ZN", "relationship": "ancestor" }, { "related_accession": "G13065CP", "relationship": "ancestor" }, { "related_accession": "G15602PX", "relationship": "ancestor" }, { "related_accession": "G16260FV", "relationship": "ancestor" }, { "related_accession": "G16340GB", "relationship": "ancestor" }, { "related_accession": "G16746MI", "relationship": "ancestor" }, { "related_accession": "G17394RC", "relationship": "ancestor" }, { "related_accession": "G18300TG", "relationship": "ancestor" }, { "related_accession": "G22933CR", "relationship": "ancestor" }, { "related_accession": "G23965FE", "relationship": "ancestor" }, { "related_accession": "G25705KO", "relationship": "ancestor" }, { "related_accession": "G25727YQ", "relationship": "ancestor" }, { "related_accession": "G26020CN", "relationship": "ancestor" }, { "related_accession": "G27365DO", "relationship": "ancestor" }, { "related_accession": "G40490MZ", "relationship": "ancestor" }, { "related_accession": "G42932DS", "relationship": "ancestor" }, { "related_accession": "G43415ON", "relationship": "ancestor" }, { "related_accession": "G50230LC", "relationship": "ancestor" }, { "related_accession": "G58879PQ", "relationship": "ancestor" }, { "related_accession": "G66768WN", "relationship": "ancestor" }, { "related_accession": "G70926BB", "relationship": "ancestor" }, { "related_accession": "G80289YI", "relationship": "ancestor" }, { "related_accession": "G82999RZ", "relationship": "ancestor" }, { "related_accession": "G87205VF", "relationship": "ancestor" }, { "related_accession": "G88197GR", "relationship": "ancestor" }, { "related_accession": "G88888LR", "relationship": "ancestor" }, { "related_accession": "G89752BK", "relationship": "ancestor" }, { "related_accession": "G90387AM", "relationship": "ancestor" }, { "related_accession": "G92992DL", "relationship": "ancestor" }, { "related_accession": "G94360ZY", "relationship": "ancestor" }, { "related_accession": "G94845AQ", "relationship": "ancestor" }, { "related_accession": "G95160NQ", "relationship": "ancestor" }, { "related_accession": "G98896IU", "relationship": "ancestor" }, { "related_accession": "G42932DS", "relationship": "basecomposition" }, { "related_accession": "G58879PQ", "relationship": "composition" }, { "related_accession": "G16746MI", "relationship": "subsumedby" }, { "related_accession": "G26020CN", "relationship": "subsumedby" }, { "related_accession": "G90387AM", "relationship": "subsumedby" }, { "related_accession": "G92992DL", "relationship": "subsumedby" }, { "related_accession": "G12750SG", "relationship": "topology" } ], "names": [], "keywords": [ "fully_determined" ], "glycotree_pathways": [], "dictionary": { "term": "Sialyl Lewis x", "term_in_sentence": "As sialyl Lewis X is a lignad of the selectin family, it has been proposed that sialyl Lewis X-rich colon cancer cells metastasize to the liver by adhesion to selectins on hepatic endothelial cells.[PMID:12828079]", "publication": "12828079|8940172|10075923|19054801|9642161|31054033|15229399|29061785|16033070|10728707|9556613|8940172|9298692|18607721|22593503|25944902|9642161|15780091|20401888", "definition": "A sialylated version of Lewis X antigen expressed on cell surfaces with structure alpha-Neup5Ac-(2->3)-beta-D-Galp-(1->4)-[alpha-L-Fucp-(1->3)]-beta-D-GlcpNAcis \u03b1-Neup5Ac-(2\u21923)-\u03b2-D-Galp-(1\u21924)-[\u03b1-L-Fucp-(1\u21923)]-D-GlcpNAc in which the anomeric configuration of the reducing-end N-acetyl-beta-D-glucosamine residue is beta. It is a ligand for selectins. [MESH:2030970,CHEI:71622]", "term_xref": "GTC:G00054MO |GlycoEpitope:EP0012|CID:44456859|CHEBI:71622|MESH:2030970|GlycoMotif:GGM.000022", "synonymns": [ "SLe(x)", "SLe^x", "SLex", "Slex" ], "function": "Sialyl Lex was shown to be a specific ligand on human leukocytes for vascular E- and P-selectins,and was shown to mediate leukocyte recruitment.[GlycoEpitope:EP0012]|The determinant is also frequently expressed on human cancer cells,and is involved in the adhesion of cancer cells to vascular endothelium and thus contribute to hematogenous metastasis of cancer.[GlycoEpitope:EP0012]", "disease_associations": "colon cancer[GlycoEpitope:EP0012]|colorectal cancer[GlycoEpitope:EP0012]", "wikipedia": "", "essentials_of_glycobiology": "", "evidence": [ { "id": "GSD000151", "url": "https://wiki.glygen.org/Glycan_structure_dictionary#GSD000151", "database": "Glycan Structure Dictionary" } ] } }