{ "glytoucan_ac": "G00052MO", "number_monosaccharides": 4, "number_monosaccharides_suffix": "", "mass": 675.26, "mass_pme": 843.45, "tool_support": { "gnome_glygen_oglycans": "no", "sandbox": "no", "gnome_glygen": "yes", "gnome": "yes", "gnome_glycotree_oglycans": "no", "pdb": "yes", "gnome_glygen_nglycans": "no", "gnome_glycotree_nglycans": "no" }, "fully_determined": "yes", "missing_score": 0, "glycan_type": "Saccharide", "iupac": "alpha-L-Fucp-(1->2)-beta-D-Galp-(1->4)[alpha-L-Fucp-(1->3)]-beta-D-GlcpNAc-(1->", "wurcs": "WURCS=2.0/3,4,3/[a2122h-1b_1-5_2*NCC/3=O][a1221m-1a_1-5][a2112h-1b_1-5]/1-2-3-2/a3-b1_a4-c1_c2-d1", "glycoct": "RES 1b:b-dglc-HEX-1:5 2s:n-acetyl 3b:a-lgal-HEX-1:5|6:d 4b:b-dgal-HEX-1:5 5b:a-lgal-HEX-1:5|6:d LIN 1:1d(2+1)2n 2:1o(3+1)3d 3:1o(4+1)4d 4:4o(2+1)5d", "inchi": "InChI=1S/C26H45NO19/c1-6-12(31)15(34)18(37)24(40-6)45-21-11(27-8(3)30)23(39)42-10(5-29)20(21)44-26-22(17(36)14(33)9(4-28)43-26)46-25-19(38)16(35)13(32)7(2)41-25/h6-7,9-26,28-29,31-39H,4-5H2,1-3H3,(H,27,30)/t6-,7-,9+,10+,11+,12+,13+,14-,15+,16+,17-,18-,19-,20+,21+,22+,23+,24-,25-,26-/m0/s1", "glycam": "LFucpa1-2DGalpb1-4[LFucpa1-3]DGlcpNAcb1-OH", "smiles_isomeric": "C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H](O[C@@H]([C@H]2O[C@H]3[C@@H]([C@H]([C@H]([C@H](O3)CO)O)O)O[C@H]4[C@H]([C@@H]([C@@H]([C@@H](O4)C)O)O)O)CO)O)NC(=O)C)O)O)O", "inchi_key": { "key": "SRHNADOZAAWYLV-XLMUYGLTSA-N", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/SRHNADOZAAWYLV-XLMUYGLTSA-N" }, "byonic": "Hex(1)HexNAc(1)dHex(2) % 675.258578545", "gwb": "freeEnd--1b1D-GlcNAc,p(--3a1L-Fuc,p)--4b1D-Gal,p--2a1L-Fuc,p$MONO,Und,0,0,freeEnd", "species": [ { "taxid": 9606, "name": "Homo sapiens", "annotation_category": "Direct", "evidence": [ { "database": "GlyCosmos", "id": "G00052MO", "url": "https://glycosmos.org/glycans/show/G00052MO" }, { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "common_name": "Human" }, { "taxid": 10090, "name": "Mus musculus", "annotation_category": "Direct", "evidence": [ { "database": "GlyCosmos", "id": "G00052MO", "url": "https://glycosmos.org/glycans/show/G00052MO" } ], "common_name": "Mouse" }, { "taxid": 10114, "name": "Rattus", "annotation_category": "Direct", "evidence": [ { "database": "GlyCosmos", "id": "G00052MO", "url": "https://glycosmos.org/glycans/show/G00052MO" } ], "common_name": "rats" } ], "classification": [ { "type": { "name": "Other", "url": "" }, "subtype": { "name": "Other", "url": "" } } ], "enzyme": [], "crossref": [ { "id": "45266908", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/45266908", "database": "PubChem Compound" }, { "id": "252284113", "url": "https://pubchem.ncbi.nlm.nih.gov/substance/252284113", "database": "PubChem Substance" }, { "id": "366", "url": "https://unicarb-db.expasy.org/searchStructures/366", "database": "UniCarbDB" }, { "id": "1gsl", "url": "https://www.rcsb.org/structure/1gsl", "database": "PDB" }, { "id": "2j1t", "url": "https://www.rcsb.org/structure/2j1t", "database": "PDB" }, { "id": "2wmg", "url": "https://www.rcsb.org/structure/2wmg", "database": "PDB" }, { "id": "3leg", "url": "https://www.rcsb.org/structure/3leg", "database": "PDB" }, { "id": "3pa2", "url": "https://www.rcsb.org/structure/3pa2", "database": "PDB" }, { "id": "4gwi", "url": "https://www.rcsb.org/structure/4gwi", "database": "PDB" }, { "id": "1132", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=1132", "database": "Glycosciences.de" }, { "id": "14249", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=14249", "database": "Glycosciences.de" }, { "id": "19255", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=19255", "database": "Glycosciences.de" }, { "id": "19256", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=19256", "database": "Glycosciences.de" }, { "id": "19257", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=19257", "database": "Glycosciences.de" }, { "id": "19258", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=19258", "database": "Glycosciences.de" }, { "id": "2037", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=2037", "database": "Glycosciences.de" }, { "id": "2172", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=2172", "database": "Glycosciences.de" }, { "id": "373", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=373", "database": "Glycosciences.de" }, { "id": "4562", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=4562", "database": "Glycosciences.de" }, { "id": "8051", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=8051", "database": "Glycosciences.de" }, { "id": "9152", "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=9152", "database": "Glycosciences.de" }, { "id": "carbSynthe_0087_D000", "url": "http://www.functionalglycomics.org/glycomics/CarbohydrateServlet?pageType=view&view=view&operationType=view&carbId=carbSynthe_0087_D000", "database": "CFG" }, { "id": "carbSynthe_0523_D000", "url": "http://www.functionalglycomics.org/glycomics/CarbohydrateServlet?pageType=view&view=view&operationType=view&carbId=carbSynthe_0523_D000", "database": "CFG" }, { "id": "carbSynthe_0524_D000", "url": "http://www.functionalglycomics.org/glycomics/CarbohydrateServlet?pageType=view&view=view&operationType=view&carbId=carbSynthe_0524_D000", "database": "CFG" }, { "id": "carbSynthe_0671_D000", "url": "http://www.functionalglycomics.org/glycomics/CarbohydrateServlet?pageType=view&view=view&operationType=view&carbId=carbSynthe_0671_D000", "database": "CFG" }, { "id": "carbSynthe_0672_D000", "url": "http://www.functionalglycomics.org/glycomics/CarbohydrateServlet?pageType=view&view=view&operationType=view&carbId=carbSynthe_0672_D000", "database": "CFG" }, { "id": "10751", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+10751", "database": "CarbBank" }, { "id": "14878", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+14878", "database": "CarbBank" }, { "id": "15221", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+15221", "database": "CarbBank" }, { "id": "16398", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+16398", "database": "CarbBank" }, { "id": "20238", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+20238", "database": "CarbBank" }, { "id": "22552", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+22552", "database": "CarbBank" }, { "id": "22553", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+22553", "database": "CarbBank" }, { "id": "22554", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+22554", "database": "CarbBank" }, { "id": "22555", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+22555", "database": "CarbBank" }, { "id": "23607", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+23607", "database": "CarbBank" }, { "id": "2537", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+2537", "database": "CarbBank" }, { "id": "2538", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+2538", "database": "CarbBank" }, { "id": "2539", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+2539", "database": "CarbBank" }, { "id": "25838", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+25838", "database": "CarbBank" }, { "id": "27637", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+27637", "database": "CarbBank" }, { "id": "28542", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+28542", "database": "CarbBank" }, { "id": "28578", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+28578", "database": "CarbBank" }, { "id": "28581", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+28581", "database": "CarbBank" }, { "id": "28594", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+28594", "database": "CarbBank" }, { "id": "29591", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+29591", "database": "CarbBank" }, { "id": "329", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+329", "database": "CarbBank" }, { "id": "34222", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+34222", "database": "CarbBank" }, { "id": "34676", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+34676", "database": "CarbBank" }, { "id": "34848", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+34848", "database": "CarbBank" }, { "id": "34944", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+34944", "database": "CarbBank" }, { "id": "34976", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+34976", "database": "CarbBank" }, { "id": "34984", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+34984", "database": "CarbBank" }, { "id": "35241", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+35241", "database": "CarbBank" }, { "id": "35825", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+35825", "database": "CarbBank" }, { "id": "35841", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+35841", "database": "CarbBank" }, { "id": "3605", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+3605", "database": "CarbBank" }, { "id": "36884", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+36884", "database": "CarbBank" }, { "id": "36921", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+36921", "database": "CarbBank" }, { "id": "36945", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+36945", "database": "CarbBank" }, { "id": "37036", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+37036", "database": "CarbBank" }, { "id": "37265", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+37265", "database": "CarbBank" }, { "id": "38055", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+38055", "database": "CarbBank" }, { "id": "41388", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+41388", "database": "CarbBank" }, { "id": "42058", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+42058", "database": "CarbBank" }, { "id": "42330", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+42330", "database": "CarbBank" }, { "id": "42425", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+42425", "database": "CarbBank" }, { "id": "42873", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+42873", "database": "CarbBank" }, { "id": "42934", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+42934", "database": "CarbBank" }, { "id": "43451", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+43451", "database": "CarbBank" }, { "id": "43710", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+43710", "database": "CarbBank" }, { "id": "44221", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+44221", "database": "CarbBank" }, { "id": "44361", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+44361", "database": "CarbBank" }, { "id": "44371", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+44371", "database": "CarbBank" }, { "id": "44543", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+44543", "database": "CarbBank" }, { "id": "45121", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+45121", "database": "CarbBank" }, { "id": "45320", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+45320", "database": "CarbBank" }, { "id": "45465", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+45465", "database": "CarbBank" }, { "id": "45861", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+45861", "database": "CarbBank" }, { "id": "45867", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+45867", "database": "CarbBank" }, { "id": "45900", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+45900", "database": "CarbBank" }, { "id": "45905", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+45905", "database": "CarbBank" }, { "id": "4591", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+4591", "database": "CarbBank" }, { "id": "46554", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+46554", "database": "CarbBank" }, { "id": "46775", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+46775", "database": "CarbBank" }, { "id": "47008", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+47008", "database": "CarbBank" }, { "id": "47073", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+47073", "database": "CarbBank" }, { "id": "47183", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+47183", "database": "CarbBank" }, { "id": "47330", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+47330", "database": "CarbBank" }, { "id": "47457", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+47457", "database": "CarbBank" }, { "id": "48385", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+48385", "database": "CarbBank" }, { "id": "48510", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+48510", "database": "CarbBank" }, { "id": "48721", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+48721", "database": "CarbBank" }, { "id": "49120", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+49120", "database": "CarbBank" }, { "id": "49149", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+49149", "database": "CarbBank" }, { "id": "49439", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+49439", "database": "CarbBank" }, { "id": "50275", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+50275", "database": "CarbBank" }, { "id": "50533", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+50533", "database": "CarbBank" }, { "id": "642", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+642", "database": "CarbBank" }, { "id": "7421", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+7421", "database": "CarbBank" }, { "id": "7648", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+7648", "database": "CarbBank" }, { "id": "7781", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+7781", "database": "CarbBank" }, { "id": "7847", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+7847", "database": "CarbBank" }, { "id": "10243", "url": "http://csdb.glycoscience.ru/bacterial/core/search_id.php?mode=record&id_list=10243", "database": "BCSDB" }, { "id": "10704", "url": "http://csdb.glycoscience.ru/bacterial/core/search_id.php?mode=record&id_list=10704", "database": "BCSDB" }, { "id": "285", "url": "http://csdb.glycoscience.ru/bacterial/core/search_id.php?mode=record&id_list=285", "database": "BCSDB" }, { "id": "3526", "url": "http://csdb.glycoscience.ru/bacterial/core/search_id.php?mode=record&id_list=3526", "database": "BCSDB" }, { "id": "6361", "url": "http://csdb.glycoscience.ru/bacterial/core/search_id.php?mode=record&id_list=6361", "database": "BCSDB" }, { "id": "6366", "url": "http://csdb.glycoscience.ru/bacterial/core/search_id.php?mode=record&id_list=6366", "database": "BCSDB" }, { "id": "7539", "url": "http://csdb.glycoscience.ru/bacterial/core/search_id.php?mode=record&id_list=7539", "database": "BCSDB" }, { "id": "7822", "url": "http://csdb.glycoscience.ru/bacterial/core/search_id.php?mode=record&id_list=7822", "database": "BCSDB" }, { "id": "8803", "url": "http://csdb.glycoscience.ru/bacterial/core/search_id.php?mode=record&id_list=8803", "database": "BCSDB" }, { "id": "59045", "url": "https://www.ebi.ac.uk/chebi/searchId.do?chebiId=59045", "database": "ChEBI" }, { "id": "EP0018", "url": "https://www.glycoepitope.jp/epitopes/EP0018", "database": "GlycoEpitope" }, { "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO", "database": "GlyTouCan" }, { "id": "G00052MO", "url": "https://gnome.glyomics.org/restrictions/GlyGen.StructureBrowser.html?focus=G00052MO", "database": "GNOme" }, { "id": "G00052MO", "url": "https://glycosmos.org/glycans/show/G00052MO", "database": "GlyCosmos" }, { "id": "GSD000038", "url": "https://wiki.glygen.org/Glycan_structure_dictionary#GSD000038", "database": "Glycan Structure Dictionary" }, { "id": "GSD000122", "url": "https://wiki.glygen.org/Glycan_structure_dictionary#GSD000122", "database": "Glycan Structure Dictionary" } ], "glycoprotein": [], "publication": [ { "title": "Molecular genetic basis for the variable expression of Lewis Y antigen in Helicobacter pylori: analysis of the alpha (1,2) fucosyltransferase gene.", "journal": "Molecular microbiology", "date": "1999", "authors": "Wang G, Rasko DA, Sherburne R, Taylor DE", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "10096092", "url": "https://glygen.org/publication/PubMed/10096092" } ] }, { "title": "Functional genomics of Helicobacter pylori: identification of a beta-1,4 galactosyltransferase and generation of mutants with altered lipopolysaccharide.", "journal": "Molecular microbiology", "date": "2000", "authors": "Logan SM, Conlan JW, Monteiro MA, Wakarchuk WW, Altman E", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "10712696", "url": "https://glygen.org/publication/PubMed/10712696" } ] }, { "title": "Phase variation in H type I and Lewis a epitopes of Helicobacter pylori lipopolysaccharide.", "journal": "Infection and immunity", "date": "2000", "authors": "Appelmelk BJ, Martino MC, Veenhof E, Monteiro MA, Maaskant JJ, Negrini R, Lindh F, Perry M, Del Giudice G, Vandenbroucke-Grauls CM", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "10992504", "url": "https://glygen.org/publication/PubMed/10992504" } ] }, { "title": "The fucosylated histo-blood group antigens H type 2 (blood group O, CD173) and Lewis Y (CD174) are expressed on CD34+ hematopoietic progenitors but absent on mature lymphocytes.", "journal": "Glycobiology", "date": "2001", "authors": "Cao Y, Merling A, Karsten U, Schwartz-Albiez R", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "11479278", "url": "https://glygen.org/publication/PubMed/11479278" } ] }, { "title": "SA-Lea and tumor metastasis: the old prediction and recent findings.", "journal": "Hybridoma and hybridomics", "date": "2002", "authors": "Thurin M, Kieber-Emmons T", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "12031100", "url": "https://glygen.org/publication/PubMed/12031100" } ] }, { "title": "Tumor-related expression of alpha1,2fucosylated antigens on colorectal carcinoma cells and its suppression by cell-mediated priming using sugar acceptors for alpha1,2fucosyltransferase.", "journal": "Glycobiology", "date": "2002", "authors": "Yazawa S, Nishimura T, Ide M, Asao T, Okamura A, Tanaka S, Takai I, Yagihashi Y, Saniabadi AR, Kochibe N", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "12213787", "url": "https://glygen.org/publication/PubMed/12213787" } ] }, { "title": "Reactivity profiles of leukemic myeloblasts with monoclonal antibodies directed to sialosyl-Le(x) and other lacto-series type 2 chain antigens:absence of reactivity with normal hematopoietic progenitor cells.", "journal": "Blood", "date": "1992", "authors": "Muroi K, Suda T, Nojiri H, Ema H, Amemiya Y, Miura Y, Nakauchi H, Singhal A, Hakomori S", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "1370643", "url": "https://glygen.org/publication/PubMed/1370643" } ] }, { "title": "Identification of a D-glycero-D-manno-heptosyltransferase gene from Helicobacter pylori.", "journal": "Journal of bacteriology", "date": "2005", "authors": "Hiratsuka K, Logan SM, Conlan JW, Chandan V, Aubry A, Smirnova N, Ulrichsen H, Chan KH, Griffith DW, Harrison BA, Li J, Altman E", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "16030209", "url": "https://glygen.org/publication/PubMed/16030209" } ] }, { "title": "Characterization of murine monoclonal antibodies against Helicobacter pylori lipopolysaccharide specific for Lex and Ley blood group determinants.", "journal": "Biochemistry and cell biology = Biochimie et biologie cellulaire", "date": "2005", "authors": "Altman E, Harrison BA, Hirama T, Chandan V, To R, MacKenzie R", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "16234847", "url": "https://glygen.org/publication/PubMed/16234847" } ] }, { "title": "Normal colon of Sprague-Dawley rats. An immunohistochemical study.", "journal": "Anatomy and embryology", "date": "1992", "authors": "Shetye JD, Rubio CA, Mellstedt HT", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "1736686", "url": "https://glygen.org/publication/PubMed/1736686" } ] }, { "title": "Lewis x is highly expressed in normal tissues: a comparative immunohistochemical study and literature revision.", "journal": "Pathology oncology research : POR", "date": "2007", "authors": "Croce MV, Isla-Larrain M, Rabassa ME, Demichelis S, Colussi AG, Crespo M, Lacunza E, Segal-Eiras A", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "17607374", "url": "https://glygen.org/publication/PubMed/17607374" } ] }, { "title": "High idiotypic connectivity of the VH7183-encoded antibodies directed to a murine embryonic carbohydrate antigen, Lewis Y, as ascertained by syngenic anti-idiotype monoclonal antibodies.", "journal": "Journal of immunology (Baltimore, Md. : 1950)", "date": "1990", "authors": "Hirashima K, Zenita K, Takada A, Kitahara A, Ishihara G, Harada R, Ohmori K, Hirohashi S, Kyoizumi S, Akiyama M, et al.", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "1972718", "url": "https://glygen.org/publication/PubMed/1972718" } ] }, { "title": "Immunohistological and biochemical detection of fucosylated polylactosamine antigen with monoclonal antibody ACFH18 in gastric cancer and normal gastric mucosa.", "journal": "Japanese journal of cancer research : Gann", "date": "1990", "authors": "Dohi T, Abe K, Ohshiba S, Yamaguchi K, Oshima M", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "2119368", "url": "https://glygen.org/publication/PubMed/2119368" } ] }, { "title": "Tumor-associated antigens common to humans and chemically induced colonic tumors of the rat.", "journal": "Cancer research", "date": "1990", "authors": "Shetye JD, Rubio CA, Harmenberg U, Ware J, Duvander A, Mellstedt HT", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "2400995", "url": "https://glygen.org/publication/PubMed/2400995" } ] }, { "title": "Circulating blood group-related antigen(s) in cancer patients detected by the monoclonal antibodies produced against hepatocellular carcinoma cell line.", "journal": "Tumour biology : the journal of the International Society for Oncodevelopmental Biology and Medicine", "date": "1985", "authors": "Imai K, Sasanami T, Nakanishi T, Noguchi T, Yachi A", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "2416034", "url": "https://glygen.org/publication/PubMed/2416034" } ] }, { "title": "Y and blood group B type 2 glycolipid antigens accumulate in a human gastric carcinoma cell line as detected by monoclonal antibody. Isolation and characterization by mass spectrometry and NMR spectroscopy.", "journal": "The Journal of biological chemistry", "date": "1987", "authors": "Blaszczyk-Thurin M, Thurin J, Hindsgaul O, Karlsson KA, Steplewski Z, Koprowski H", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "2432062", "url": "https://glygen.org/publication/PubMed/2432062" } ] }, { "title": "Blood-group-related antigen Lewis(x) and Lewis(y) in the differential diagnosis of cholangiocarcinoma and hepatocellular carcinoma.", "journal": "Archives of pathology & laboratory medicine", "date": "1989", "authors": "Jovanovic R, Jagirdar J, Thung SN, Paronetto F", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "2537068", "url": "https://glygen.org/publication/PubMed/2537068" } ] }, { "title": "Immunohistochemical study of carbohydrate antigen expression in gastric carcinoma.", "journal": "Gastroenterologia Japonica", "date": "1989", "authors": "Dohi T, Abe K, Ohshiba S", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "2663606", "url": "https://glygen.org/publication/PubMed/2663606" } ] }, { "title": "The tumor-associated antigens BR55-2, GA73-3 and GICA 19-9 in normal and corresponding neoplastic human tissues, especially gastrointestinal tissues.", "journal": "Anticancer research", "date": "1989", "authors": "Shetye J, Christensson B, Rubio C, Rodensjo M, Biberfeld P, Mellstedt H", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "2665636", "url": "https://glygen.org/publication/PubMed/2665636" } ] }, { "title": "Oncofetal expression of Lex carbohydrate antigens in human colonic adenocarcinomas. Regulation through type 2 core chain synthesis rather than fucosylation.", "journal": "The Journal of biological chemistry", "date": "1987", "authors": "Holmes EH, Ostrander GK, Clausen H, Graem N", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "3112156", "url": "https://glygen.org/publication/PubMed/3112156" } ] }, { "title": "Expression of blood group-related antigens ABH, Lewis A, Lewis B, Lewis X, Lewis Y, and CA 19-9 in pancreatic cancer cells in comparison with the patient's blood group type.", "journal": "Cancer research", "date": "1988", "authors": "Pour PM, Tempero MM, Takasaki H, Uchida E, Takiyama Y, Burnett DA, Steplewski Z", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "3166398", "url": "https://glygen.org/publication/PubMed/3166398" } ] }, { "title": "Expression of Ley antigen in human immunodeficiency virus-infected human T cell lines and in peripheral lymphocytes of patients with acquired immune deficiency syndrome (AIDS) and AIDS-related complex (ARC).", "journal": "The Journal of experimental medicine", "date": "1988", "authors": "Adachi M, Hayami M, Kashiwagi N, Mizuta T, Ohta Y, Gill MJ, Matheson DS, Tamaoki T, Shiozawa C, Hakomori S", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "3258005", "url": "https://glygen.org/publication/PubMed/3258005" } ] }, { "title": "Expression of Lewisa, Lewisb, X, and Y blood group antigens in human colonic tumors and normal tissue and in human tumor-derived cell lines.", "journal": "Cancer research", "date": "1986", "authors": "Sakamoto J, Furukawa K, Cordon-Cardo C, Yin BW, Rettig WJ, Oettgen HF, Old LJ, Lloyd KO", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "3510728", "url": "https://glygen.org/publication/PubMed/3510728" } ] }, { "title": "Blood group-active carbohydrate chains on the receptor for epidermal growth factor of A431 cells.", "journal": "The EMBO journal", "date": "1984", "authors": "Childs RA, Gregoriou M, Scudder P, Thorpe SJ, Rees AR, Feizi T", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "6094178", "url": "https://glygen.org/publication/PubMed/6094178" } ] }, { "title": "Mouse monoclonal antibody F-3 recognizes the difucosyl type-2 blood group structure.", "journal": "Immunogenetics", "date": "1983", "authors": "Lloyd KO, Larson G, Stromberg N, Thurin J, Karlsson KA", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "6188690", "url": "https://glygen.org/publication/PubMed/6188690" } ] }, { "title": "A monoclonal antibody against human colonic adenoma recognizes difucosylated Type-2-blood-group chains.", "journal": "Bioscience reports", "date": "1983", "authors": "Brown A, Feizi T, Gooi HC, Embleton MJ, Picard JK, Baldwin RW", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" }, { "database": "Glycan Motif", "id": "GGM.000045", "url": "https://glycomotif.glyomics.org/glycomotif/GGM.000045" } ], "reference": [ { "type": [ "PubMed" ], "id": "6189529", "url": "https://glygen.org/publication/PubMed/6189529" } ] }, { "title": "The monoclonal antibody directed to difucosylated type 2 chain (Fuc alpha 1 leads to 2Gal beta 1 leads to 4[Fuc alpha 1 leads to 3]GlcNAc; Y Determinant).", "journal": "The Journal of biological chemistry", "date": "1983", "authors": "Abe K, McKibbin JM, Hakomori S", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "6194156", "url": "https://glygen.org/publication/PubMed/6194156" } ] }, { "title": "The glycosidic antigen recognised by a novel monoclonal antibody, 75.12, is developmentally regulated on mouse embryonal carcinoma cells.", "journal": "The EMBO journal", "date": "1983", "authors": "Blaineau C, Le Pendu J, Arnaud D, Connan F, Avner P", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "6667675", "url": "https://glygen.org/publication/PubMed/6667675" } ] }, { "title": "Monoclonal antibody directed to Le(y) oligosaccharide inhibits implantation in the mouse.", "journal": "Biology of reproduction", "date": "1995", "authors": "Zhu ZM, Kojima N, Stroud MR, Hakomori S, Fenderson BA", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "7780013", "url": "https://glygen.org/publication/PubMed/7780013" } ] }, { "title": "Specificity analysis of blood group Lewis-y (Le(y)) antibodies generatedagainst synthetic and natural Le(y) determinants.", "journal": "Proceedings of the National Academy of Sciences of the United States of America", "date": "1994", "authors": "Kitamura K, Stockert E, Garin-Chesa P, Welt S, Lloyd KO, Armour KL, Wallace TP, Harris WJ, Carr FJ, Old LJ", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "7809154", "url": "https://glygen.org/publication/PubMed/7809154" } ] }, { "title": "The recognition of cancer-associated fucosylated antigens in colorectal cancer by a novel monoclonal antibody, YB-2.", "journal": "Surgery today", "date": "1994", "authors": "Naitoh H, Yazawa S, Asao T, Nakajima T, Nakamura J, Takenoshita S, Nagamachi Y", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "8038519", "url": "https://glygen.org/publication/PubMed/8038519" } ] }, { "title": "Preparation of mouse-human chimeric antibody to an embryonic carbohydrate antigen, Lewis Y.", "journal": "Journal of biochemistry", "date": "1993", "authors": "Kaneko T, Iba Y, Zenita K, Shigeta K, Nakano K, Itoh W, Kurosawa Y, Kannagi R, Yasukawa K", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "8095932", "url": "https://glygen.org/publication/PubMed/8095932" } ] }, { "title": "Development and characterization of a novel anti-fucosylated antigen monoclonal antibody YB-2 and its usefulness in the immunohistochemical diagnosis of colorectal cancer.", "journal": "Japanese journal of cancer research : Gann", "date": "1993", "authors": "Yazawa S, Akamatsu S, Tachikawa T, Naito H, Nakamura J, Asao T, Nagamachi Y, Nakajima T, Shin S, Chia D", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "8340252", "url": "https://glygen.org/publication/PubMed/8340252" } ] }, { "title": "BR96 sFv-PE40, a potent single-chain immunotoxin that selectively kills carcinoma cells.", "journal": "Cancer research", "date": "1993", "authors": "Friedman PN, McAndrew SJ, Gawlak SL, Chace D, Trail PA, Brown JP, Siegall CB", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "8417827", "url": "https://glygen.org/publication/PubMed/8417827" } ] }, { "title": "Serological and immunochemical analysis of Lewis y (Ley) blood group antigen expression in epithelial ovarian cancer.", "journal": "International journal of cancer", "date": "1996", "authors": "Yin BW, Finstad CL, Kitamura K, Federici MG, Welshinger M, Kudryashov V, Hoskins WJ, Welt S, Lloyd KO", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "8621218", "url": "https://glygen.org/publication/PubMed/8621218" } ] }, { "title": "Expression of alpha-3/4-monofucosylated polylactosaminoglycan epitope, as defined by monoclonal antibody FW6, is a marker of the colorectal adenoma-carcinoma sequence.", "journal": "Cancer", "date": "1995", "authors": "Baldus SE, Vierbuchen M, Hanisch FG, Schwonzen M, Fischer R", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "8625220", "url": "https://glygen.org/publication/PubMed/8625220" } ] }, { "title": "The usefulness of anti-fucosylated antigen antibody YB-2 for diagnosis of hepatocellular carcinoma.", "journal": "Glycoconjugate journal", "date": "1997", "authors": "Nakamura J, Yazawa S, Hada T, Asao T, Naitoh H, Takenoshita S, Kosaka M, Akamatsu S, Tachikawa T, Nagamachi Y", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "9076517", "url": "https://glygen.org/publication/PubMed/9076517" } ] }, { "title": "Le(y) glycolipid acts as a co-factor for tumor procoagulant activity.", "journal": "International journal of cancer", "date": "1997", "authors": "Suzuki M, Inufusa H, Yamamoto S, Hamada T, Aga M, Ando O, Ohta T, Yasutomi M, Kurimoto M", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "9399674", "url": "https://glygen.org/publication/PubMed/9399674" } ] }, { "title": "Simultaneous expression of type 1 and type 2 Lewis blood group antigens by Helicobacter pylori lipopolysaccharides. Molecular mimicry between h. pylori lipopolysaccharides and human gastric epithelial cell surface glycoforms.", "journal": "The Journal of biological chemistry", "date": "1998", "authors": "Monteiro MA, Chan KH, Rasko DA, Taylor DE, Zheng PY, Appelmelk BJ, Wirth HP, Yang M, Blaser MJ, Hynes SO, Moran AP, Perry MB", "evidence": [ { "database": "GlyTouCan", "id": "G00052MO", "url": "https://glytoucan.org/Structures/Glycans/G00052MO" } ], "reference": [ { "type": [ "PubMed" ], "id": "9565568", "url": "https://glygen.org/publication/PubMed/9565568" } ] }, { "title": "The repertoire of glycan determinants in the human glycome.", "journal": "Molecular bioSystems", "date": "2009", "authors": "Cummings RD", "evidence": [ { "database": "Glycan Motif", "id": "GGM.000045", "url": "https://glycomotif.glyomics.org/glycomotif/GGM.000045" } ], "reference": [ { "type": [ "PubMed" ], "id": "19756298", "url": "https://glygen.org/publication/PubMed/19756298" } ] } ], "residues": [], "composition": [ { "name": "6-Deoxy-Hexose", "residue": "dhex", "count": 2, "cid": "840", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840" }, { "name": "Hexose", "residue": "hex", "count": 1, "cid": "206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206" }, { "name": "N-Acetylhexosamine", "residue": "hexnac", "count": 1, "cid": "899", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899" }, { "name": "Hexuronic Acid", "residue": "hexa", "count": 0, "cid": "610", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610" }, { "name": "2-Amino-2-Deoxy-Hexose", "residue": "hexn", "count": 0, "cid": "739", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739" }, { "name": "N-Acetyl-Neuraminic Acid", "residue": "neuac", "count": 0, "cid": "439197", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197" }, { "name": "N-Glycolyl-Neuraminic Acid", "residue": "neugc", "count": 0, "cid": "440001", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001" }, { "name": "Phosphate", "residue": "p", "count": 0, "cid": "1061", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061" }, { "name": "Pentose", "residue": "pent", "count": 0, "cid": "229", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229" }, { "name": "Sulfate", "residue": "s", "count": 0, "cid": "1117", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117" }, { "name": "Other", "residue": "other", "count": 0 } ], "composition_expanded": [ { "name": "Alditol", "residue": "aldi", "count": 0 }, { "name": "6-Deoxy-Hexose", "residue": "dhex", "count": 2, "cid": "840", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840" }, { "name": "6-Deoxy-Hexitol", "residue": "dhex+aldi", "count": 0 }, { "name": "L-Fucose", "residue": "fuc", "count": 2, "cid": "17106", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/17106" }, { "name": "L-Fucitol", "residue": "fuc+aldi", "count": 0, "cid": "445724", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/445724" }, { "name": "D-Galactose", "residue": "gal", "count": 1, "cid": "6036", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6036" }, { "name": "D-Galacitol", "residue": "gal+aldi", "count": 0, "cid": "11850", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11850" }, { "name": "D-Galactosamine", "residue": "galn", "count": 0, "cid": "24154", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/24154" }, { "name": "N-Acetyl-D-galactosamine", "residue": "galnac", "count": 0, "cid": "35717", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/35717" }, { "name": "N-Acetylgalactosaminitol", "residue": "galnac+aldi", "count": 0, "cid": "165880", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165880" }, { "name": "D-Glucose", "residue": "glc", "count": 0, "cid": "5793", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5793" }, { "name": "D-Glucitol", "residue": "glc+aldi", "count": 0, "cid": "5780", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5780" }, { "name": "D-Glucuronic acid", "residue": "glca", "count": 0, "cid": "94715", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/94715" }, { "name": "D-Glucosamine", "residue": "glcn", "count": 0, "cid": "439213", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439213" }, { "name": "N-Acetyl-D-Glucosamine", "residue": "glcnac", "count": 1, "cid": "439174", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439174" }, { "name": "N-Acetyl-D-glucosaminitol", "residue": "glcnac+aldi", "count": 0, "cid": "165206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165206" }, { "name": "Hexose", "residue": "hex", "count": 1, "cid": "206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206" }, { "name": "N-Acetylhexosamine", "residue": "hexnac", "count": 1, "cid": "899", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899" }, { "name": "Hexuronic Acid", "residue": "hexa", "count": 0, "cid": "610", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610" }, { "name": "2-Amino-2-Deoxy-Hexose", "residue": "hexn", "count": 0, "cid": "739", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739" }, { "name": "Hexitol", "residue": "hex+aldi", "count": 0, "cid": "453", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/453" }, { "name": "N-Acetylhexosaminitol", "residue": "hexnac+aldi", "count": 0 }, { "name": "L-Iduronic acid", "residue": "idoa", "count": 0, "cid": "441039", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/441039" }, { "name": "D-Mannose", "residue": "man", "count": 0, "cid": "18950", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18950" }, { "name": "D-Mannitol", "residue": "man+aldi", "count": 0, "cid": "6251", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6251" }, { "name": "D-Mannosamine", "residue": "mann", "count": 0, "cid": "440049", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440049" }, { "name": "N-Acetyl-D-mannosamine", "residue": "mannac", "count": 0, "cid": "439281", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439281" }, { "name": "Methyl", "residue": "me", "count": 0 }, { "name": "N-Acetyl-Neuraminic Acid", "residue": "neuac", "count": 0, "cid": "439197", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197" }, { "name": "N-Glycolyl-Neuraminic Acid", "residue": "neugc", "count": 0, "cid": "440001", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001" }, { "name": "Phosphate", "residue": "p", "count": 0, "cid": "1061", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061" }, { "name": "Pentose", "residue": "pent", "count": 0, "cid": "229", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229" }, { "name": "Sulfate", "residue": "s", "count": 0, "cid": "1117", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117" }, { "name": "Sialic acid", "residue": "sia", "count": 0, "cid": "906", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/906" }, { "name": "Other", "residue": "other", "count": 0 }, { "name": "Floating substituent", "residue": "x", "count": 0 }, { "name": "D-Xylose", "residue": "xyl", "count": 0, "cid": "135191", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135191" }, { "name": "Ketodeoxynononic acid", "residue": "kdn", "count": 0, "cid": "13991616", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13991616" } ], "motifs": [ { "id": "GGM.000001", "name": "Type 2 LN", "synonym": "N-acetyllactosamine", "keywords": "LacNAc; N-acetyllactosamine; N-acetyllactosamine type 2" }, { "id": "GGM.000018", "name": "Lewis x", "synonym": "Le^x; Lex; SSEA-1", "keywords": "Lewis x" }, { "id": "GGM.000019", "name": "Lewis y", "synonym": "Le^y; Ley", "keywords": "Lewis y" }, { "id": "GGM.000045", "name": "Blood group H (type 2) - Lewis y", "synonym": "H-Le^y; H-Ley", "keywords": "Blood group H; Blood group type 2; Lewis y" } ], "interactions": [], "expression": [], "subsumption": [ { "related_accession": "G02485MC", "relationship": "ancestor" }, { "related_accession": "G04690JX", "relationship": "ancestor" }, { "related_accession": "G11122XA", "relationship": "ancestor" }, { "related_accession": "G17991UN", "relationship": "ancestor" }, { "related_accession": "G18219LU", "relationship": "ancestor" }, { "related_accession": "G20009SF", "relationship": "ancestor" }, { "related_accession": "G22979OY", "relationship": "ancestor" }, { "related_accession": "G23571FL", "relationship": "ancestor" }, { "related_accession": "G27653YS", "relationship": "ancestor" }, { "related_accession": "G34542YM", "relationship": "ancestor" }, { "related_accession": "G35481DG", "relationship": "ancestor" }, { "related_accession": "G35534DU", "relationship": "ancestor" }, { "related_accession": "G36592JW", "relationship": "ancestor" }, { "related_accession": "G39442TM", "relationship": "ancestor" }, { "related_accession": "G49963IQ", "relationship": "ancestor" }, { "related_accession": "G57824FG", "relationship": "ancestor" }, { "related_accession": "G68835PZ", "relationship": "ancestor" }, { "related_accession": "G70505CA", "relationship": "ancestor" }, { "related_accession": "G81216LK", "relationship": "ancestor" }, { "related_accession": "G82458HY", "relationship": "ancestor" }, { "related_accession": "G96179XD", "relationship": "ancestor" }, { "related_accession": "G82458HY", "relationship": "basecomposition" }, { "related_accession": "G22979OY", "relationship": "composition" }, { "related_accession": "G20009SF", "relationship": "subsumedby" }, { "related_accession": "G35534DU", "relationship": "subsumedby" }, { "related_accession": "G49963IQ", "relationship": "subsumedby" }, { "related_accession": "G96179XD", "relationship": "subsumedby" }, { "related_accession": "G27653YS", "relationship": "topology" } ], "names": [], "keywords": [ "fully_determined" ], "glycotree_pathways": [], "dictionary": { "term": "Lewis y", "term_in_sentence": "In conclusion, Lewis y antigen and CD147 were significantly upregulated in ovarian tumors, and the altered expression of Lewis y may cause changes in CD147.[PMID:30816446]", "publication": "30816446|20003467|24692145|24998328|25726913|29299130|30816446|20003467|24692145|24998328|20127027|22138668|23894390|25726913|25416440|27646625|23725446|21294926|22312289|25973320|23242548|30328452|21119363|29130097|23443083|23708102|28671040|19715603|23468946|27723168|21747684|19771739", "definition": "A Lewis blood group antigen which is a branched amino tetrasaccharide with structure alpha-L-Fucp-(1->2)-beta-D-Galp-(1->4)-[alpha-L-Fucp-(1->3)]-beta-D-GlcpNAc, consisting of consisting of N-acetyl-beta-D-glucosamine at the reducing end having an alpha-L-fucosyl residue attached at the 3-position and an alpha-L-fucosyl-(1\u21922)-beta-D-galactosyl moiety attached at the 4-position. A cancer-associated tetrasaccharide antigen which constitutes the core structure recognised by therapeutic antibody BR96. Conformational restriction around the GlcNAc residue is a key feature of its structure. It has a role as an antigen and an epitope. [CHEBI:59045]]", "term_xref": "GTC:G00052MO|GlycoEpitope:EP0018|CID:45266908|CHEBI:59045|GlycoMotif:GGM.000019", "synonymns": [ "LeY", "Le(y)", "Ley", "Le^y" ], "function": "The expression of the fucosylated histo-blood group antigen CD174 in CD34+ hematopoietic progenitor cells and down-regulation of FUT1 in mature lymphocytes may be important factors influencing the homing process of hematopoietic stem cells to the bone marrow.[GlycoEpitope:EP0018]", "disease_associations": "AIDS/acquired immune deficiency syndrome[GlycoEpitope:EP0018]|cholangiocarcinoma[GlycoEpitope:EP0018]|hepatocellular carcinoma[GlycoEpitope:EP0018]", "wikipedia": "", "essentials_of_glycobiology": "Chapter 14", "evidence": [ { "id": "GSD000122", "url": "https://wiki.glygen.org/Glycan_structure_dictionary#GSD000122", "database": "Glycan Structure Dictionary" } ] } }