{ "glytoucan_ac": "G02149VR", "number_monosaccharides": 7, "number_monosaccharides_suffix": "", "mass": 1580.53, "mass_pme": 1986.99, "tool_support": { "gnome_glygen_oglycans": "no", "sandbox": "no", "gnome_glygen": "yes", "gnome": "yes", "gnome_glycotree_oglycans": "no", "pdb": "yes", "gnome_glygen_nglycans": "no", "gnome_glycotree_nglycans": "no" }, "fully_determined": "yes", "missing_score": 0, "glycan_type": "Saccharide", "iupac": "alpha-D-Neup5Ac-(2->3)[alpha-D-Neup5Ac-(2->3)-beta-D-Galp-(1->3)[alpha-D-Neup5Ac-(2->6)]-beta-D-GalpNAc-(1->4)]-beta-D-Galp-(1->4)-beta-D-Glcp-(1->", "wurcs": "WURCS=2.0/4,7,6/[a2122h-1b_1-5][a2112h-1b_1-5][Aad21122h-2a_2-6_5*NCC/3=O][a2112h-1b_1-5_2*NCC/3=O]/1-2-3-4-2-3-3/a4-b1_b3-c2_b4-d1_d3-e1_d6-g2_e3-f2", "glycoct": "RES 1b:b-dglc-HEX-1:5 2b:b-dgal-HEX-1:5 3b:a-dgro-dgal-NON-2:6|1:a|2:keto|3:d 4s:n-acetyl 5b:b-dgal-HEX-1:5 6s:n-acetyl 7b:b-dgal-HEX-1:5 8b:a-dgro-dgal-NON-2:6|1:a|2:keto|3:d 9s:n-acetyl 10b:a-dgro-dgal-NON-2:6|1:a|2:keto|3:d 11s:n-acetyl LIN 1:1o(4+1)2d 2:2o(3+2)3d 3:3d(5+1)4n 4:2o(4+1)5d 5:5d(2+1)6n 6:5o(3+1)7d 7:7o(3+2)8d 8:8d(5+1)9n 9:5o(6+2)10d 10:10d(5+1)11n", "inchi": "InChI=1S/C59H96N4O45/c1-15(70)60-29-19(74)5-57(54(90)91,104-45(29)33(80)22(77)8-64)96-14-28-37(84)44(103-52-40(87)48(36(83)25(11-67)98-52)107-58(55(92)93)6-20(75)30(61-16(2)71)46(105-58)34(81)23(78)9-65)32(63-18(4)73)51(100-28)102-43-27(13-69)99-53(101-42-26(12-68)97-50(89)39(86)38(42)85)41(88)49(43)108-59(56(94)95)7-21(76)31(62-17(3)72)47(106-59)35(82)24(79)10-66/h19-53,64-69,74-89H,5-14H2,1-4H3,(H,60,70)(H,61,71)(H,62,72)(H,63,73)(H,90,91)(H,92,93)(H,94,95)/t19-,20-,21-,22+,23+,24+,25+,26+,27+,28+,29+,30+,31+,32+,33+,34+,35+,36-,37-,38+,39+,40+,41+,42+,43-,44+,45+,46+,47+,48-,49+,50+,51-,52-,53-,57+,58-,59-/m0/s1", "glycam": "DNeup5Aca2-3DGalpb1-3[DNeup5Aca2-6]DGalpNAcb1-4[DNeup5Aca2-3]DGalpb1-4DGlcpb1-OH", "smiles_isomeric": "CC(=O)N[C@@H]1[C@H](C[C@@](O[C@H]1[C@@H]([C@@H](CO)O)O)(C(=O)O)OC[C@@H]2[C@@H]([C@@H]([C@H]([C@@H](O2)O[C@H]3[C@H](O[C@H]([C@@H]([C@H]3O[C@@]4(C[C@@H]([C@H]([C@@H](O4)[C@@H]([C@@H](CO)O)O)NC(=O)C)O)C(=O)O)O)O[C@@H]5[C@H](O[C@H]([C@@H]([C@H]5O)O)O)CO)CO)NC(=O)C)O[C@H]6[C@@H]([C@H]([C@H]([C@H](O6)CO)O)O[C@@]7(C[C@@H]([C@H]([C@@H](O7)[C@@H]([C@@H](CO)O)O)NC(=O)C)O)C(=O)O)O)O)O", "inchi_key": { "key": "VVLIVNLBGFKOTA-UUAMBNPOSA-N", "url": "" }, "byonic": "HexNAc(1)Hex(3)NeuAc(3) % 1580.53465771", "gwb": "freeEnd--1b1D-Glc,p--4b1D-Gal,p(--3a2D-NeuAc,p)--4b1D-GalNAc,p(--3b1D-Gal,p--3a2D-NeuAc,p)--6a2D-NeuAc,p$MONO,Und,0,0,freeEnd", "species": [ { "taxid": 10114, "name": "Rattus", "annotation_category": "Direct", "evidence": [ { "database": "GlyCosmos", "id": "G02149VR", "url": "https://glycosmos.org/glycans/show/G02149VR" } ], "common_name": "Rat" }, { "taxid": 10116, "name": "Rattus norvegicus", "annotation_category": "Direct", "evidence": [ { "database": "GlyCosmos", "id": "G02149VR", "url": "https://glycosmos.org/glycans/show/G02149VR" }, { "database": "GlyTouCan", "id": "G02149VR", "url": "https://glytoucan.org/Structures/Glycans/G02149VR" } ], "common_name": "Rat" } ], "classification": [ { "type": { "name": "Glycosphingolipid" }, "subtype": { "name": "Ganglio series" } } ], "enzyme": [], "crossref": [ { "id": "91851751", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91851751", "database": "PubChem Compound" }, { "id": "252283840", "url": "https://pubchem.ncbi.nlm.nih.gov/substance/252283840", "database": "PubChem Substance" }, { "id": "G00128", "url": "https://www.genome.jp/dbget-bin/www_bget?gl:G00128", "database": "KEGG Glycan" }, { "id": "3043", "url": "", "database": "Glycosciences.de" }, { "id": "1374", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+1374", "database": "CarbBank" }, { "id": "1375", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+1375", "database": "CarbBank" }, { "id": "17779", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+17779", "database": "CarbBank" }, { "id": "21377", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+21377", "database": "CarbBank" }, { "id": "33113", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+33113", "database": "CarbBank" }, { "id": "44855", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+44855", "database": "CarbBank" }, { "id": "46831", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+46831", "database": "CarbBank" }, { "id": "47971", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+47971", "database": "CarbBank" }, { "id": "6592", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+6592", "database": "CarbBank" }, { "id": "156678", "url": "https://www.ebi.ac.uk/chebi/searchId.do?chebiId=156678", "database": "ChEBI" }, { "id": "EP0111", "url": "https://www.glycoepitope.jp/epitopes/EP0111", "database": "GlycoEpitope" }, { "id": "G02149VR", "url": "https://glytoucan.org/Structures/Glycans/G02149VR", "database": "GlyTouCan" }, { "id": "G02149VR", "url": "https://gnome.glyomics.org/restrictions/GlyGen.StructureBrowser.html?focus=G02149VR", "database": "GNOme" }, { "id": "G02149VR", "url": "https://glycosmos.org/glycans/show/G02149VR", "database": "GlyCosmos" }, { "id": "GSD000100", "url": "https://wiki.glygen.org/Glycan_structure_dictionary#GSD000100", "database": "Glycan Structure Dictionary" } ], "glycoprotein": [], "publication": [ { "title": "A trisialoganglioside containing a sialyl alpha 2-6 N-acetylgalactosamine residue is a cholinergic-specific antigen, Chol-1 alpha.", "journal": "Journal of biochemistry", "date": "1992", "authors": "Ando S, Hirabayashi Y, Kon K, Inagaki F, Tate S, Whittaker VP", "evidence": [ { "database": "GlyTouCan", "id": "G02149VR", "url": "https://glytoucan.org/Structures/Glycans/G02149VR" } ], "reference": [ { "type": "PubMed", "id": "1587788", "url": "https://glygen.org/publication/PubMed/1587788" } ] }, { "title": "Structural characterization of a novel cholinergic neuron-specific ganglioside in bovine brain.", "journal": "The Journal of biological chemistry", "date": "1992", "authors": "Hirabayashi Y, Nakao T, Irie F, Whittaker VP, Kon K, Ando S", "evidence": [ { "database": "GlyTouCan", "id": "G02149VR", "url": "https://glytoucan.org/Structures/Glycans/G02149VR" } ], "reference": [ { "type": "PubMed", "id": "1618794", "url": "https://glygen.org/publication/PubMed/1618794" } ] }, { "title": "Identification of a cholinergic-specific antigen Chol-1 as a ganglioside.", "journal": "Journal of neurochemistry", "date": "1982", "authors": "Richardson PJ, Walker JH, Jones RT, Whittaker VP", "evidence": [ { "database": "GlyTouCan", "id": "G02149VR", "url": "https://glytoucan.org/Structures/Glycans/G02149VR" } ], "reference": [ { "type": "PubMed", "id": "7042914", "url": "https://glygen.org/publication/PubMed/7042914" } ] }, { "title": "Distribution of cholinergic neuron-specific gangliosides (GT1a alpha and GQ1b alpha) in the rat central nervous system.", "journal": "Brain research", "date": "1994", "authors": "Irie F, Hashikawa T, Tai T, Seyama Y, Hirabayashi Y", "evidence": [ { "database": "GlyTouCan", "id": "G02149VR", "url": "https://glytoucan.org/Structures/Glycans/G02149VR" } ], "reference": [ { "type": "PubMed", "id": "7710562", "url": "https://glygen.org/publication/PubMed/7710562" } ] }, { "title": "Generation of a monoclonal antibody specific for a new class of minor ganglioside antigens, GQ1b alpha and GT1a alpha: its binding to dorsal and lateral horn of human thoracic cord.", "journal": "Brain research", "date": "1993", "authors": "Kusunoki S, Chiba A, Hirabayashi Y, Irie F, Kotani M, Kawashima I, Tai T, Nagai Y", "evidence": [ { "database": "GlyTouCan", "id": "G02149VR", "url": "https://glytoucan.org/Structures/Glycans/G02149VR" }, { "database": "", "id": "GGM.000111", "url": "" } ], "reference": [ { "type": "PubMed", "id": "8221098", "url": "https://glygen.org/publication/PubMed/8221098" } ] }, { "title": "The repertoire of glycan determinants in the human glycome.", "journal": "Molecular bioSystems", "date": "2009", "authors": "Cummings RD", "evidence": [ { "database": "", "id": "GGM.000111", "url": "" } ], "reference": [ { "type": "PubMed", "id": "19756298", "url": "https://glygen.org/publication/PubMed/19756298" } ] } ], "residues": [], "composition": [ { "name": "6-Deoxy-Hexose", "residue": "dhex", "count": 0, "cid": "840", "url": "" }, { "name": "Hexose", "residue": "hex", "count": 3, "cid": "206", "url": "" }, { "name": "N-Acetylhexosamine", "residue": "hexnac", "count": 1, "cid": "899", "url": "" }, { "name": "Hexuronic Acid", "residue": "hexa", "count": 0, "cid": "610", "url": "" }, { "name": "2-Amino-2-Deoxy-Hexose", "residue": "hexn", "count": 0, "cid": "739", "url": "" }, { "name": "N-Acetyl-Neuraminic Acid", "residue": "neuac", "count": 3, "cid": "439197", "url": "" }, { "name": "N-Glycolyl-Neuraminic Acid", "residue": "neugc", "count": 0, "cid": "440001", "url": "" }, { "name": "Phosphate", "residue": "p", "count": 0, "cid": "1061", "url": "" }, { "name": "Pentose", "residue": "pent", "count": 0, "cid": "229", "url": "" }, { "name": "Sulfate", "residue": "s", "count": 0, "cid": "1117", "url": "" }, { "name": "Other", "residue": "other", "count": 0 } ], "composition_expanded": [ { "name": "Alditol", "residue": "aldi", "count": 0 }, { "name": "6-Deoxy-Hexose", "residue": "dhex", "count": 0, "cid": "840", "url": "" }, { "name": "6-Deoxy-Hexitol", "residue": "dhex+aldi", "count": 0 }, { "name": "L-Fucose", "residue": "fuc", "count": 0, "cid": "17106", "url": "" }, { "name": "L-Fucitol", "residue": "fuc+aldi", "count": 0, "cid": "445724", "url": "" }, { "name": "D-Galactose", "residue": "gal", "count": 2, "cid": "6036", "url": "" }, { "name": "D-Galacitol", "residue": "gal+aldi", "count": 0, "cid": "11850", "url": "" }, { "name": "D-Galactosamine", "residue": "galn", "count": 0, "cid": "24154", "url": "" }, { "name": "N-Acetyl-D-galactosamine", "residue": "galnac", "count": 1, "cid": "35717", "url": "" }, { "name": "N-Acetylgalactosaminitol", "residue": "galnac+aldi", "count": 0, "cid": "165880", "url": "" }, { "name": "D-Galacturonic Acid", "residue": "gala", "count": 0, "cid": "439215", "url": "" }, { "name": "D-Glucose", "residue": "glc", "count": 1, "cid": "5793", "url": "" }, { "name": "D-Glucitol", "residue": "glc+aldi", "count": 0, "cid": "5780", "url": "" }, { "name": "D-Glucuronic acid", "residue": "glca", "count": 0, "cid": "94715", "url": "" }, { "name": "D-Glucosamine", "residue": "glcn", "count": 0, "cid": "439213", "url": "" }, { "name": "N-Acetyl-D-Glucosamine", "residue": "glcnac", "count": 0, "cid": "439174", "url": "" }, { "name": "N-Acetyl-D-glucosaminitol", "residue": "glcnac+aldi", "count": 0, "cid": "165206", "url": "" }, { "name": "Hexose", "residue": "hex", "count": 3, "cid": "206", "url": "" }, { "name": "N-Acetylhexosamine", "residue": "hexnac", "count": 1, "cid": "899", "url": "" }, { "name": "Hexuronic Acid", "residue": "hexa", "count": 0, "cid": "610", "url": "" }, { "name": "2-Amino-2-Deoxy-Hexose", "residue": "hexn", "count": 0, "cid": "739", "url": "" }, { "name": "Hexitol", "residue": "hex+aldi", "count": 0, "cid": "453", "url": "" }, { "name": "N-Acetylhexosaminitol", "residue": "hexnac+aldi", "count": 0 }, { "name": "L-Iduronic acid", "residue": "idoa", "count": 0, "cid": "441039", "url": "" }, { "name": "D-Mannose", "residue": "man", "count": 0, "cid": "18950", "url": "" }, { "name": "D-Mannitol", "residue": "man+aldi", "count": 0, "cid": "6251", "url": "" }, { "name": "D-Mannosamine", "residue": "mann", "count": 0, "cid": "440049", "url": "" }, { "name": "N-Acetyl-D-mannosamine", "residue": "mannac", "count": 0, "cid": "439281", "url": "" }, { "name": "Methyl", "residue": "me", "count": 0 }, { "name": "N-Acetyl-Neuraminic Acid", "residue": "neuac", "count": 3, "cid": "439197", "url": "" }, { "name": "N-Glycolyl-Neuraminic Acid", "residue": "neugc", "count": 0, "cid": "440001", "url": "" }, { "name": "Phosphate", "residue": "p", "count": 0, "cid": "1061", "url": "" }, { "name": "Pentose", "residue": "pent", "count": 0, "cid": "229", "url": "" }, { "name": "Sulfate", "residue": "s", "count": 0, "cid": "1117", "url": "" }, { "name": "Sialic acid", "residue": "sia", "count": 3, "cid": "906", "url": "" }, { "name": "Other", "residue": "other", "count": 0 }, { "name": "Floating substituent", "residue": "x", "count": 0 }, { "name": "D-Xylose", "residue": "xyl", "count": 0, "cid": "135191", "url": "" }, { "name": "Ketodeoxynononic acid", "residue": "kdn", "count": 0, "cid": "13991616", "url": "" } ], "motifs": [ { "id": "GGM.000035", "name": "6-Sialyl-GalNAc", "synonym": "6-Sialyl LN (type 1); 6-Sialyl LN (type 2)", "keywords": "" }, { "id": "GGM.000111", "name": "GT1aa", "synonym": "GT1aalpha", "keywords": "Glycolipid; Trisialylated ganglioside" } ], "interactions": [], "expression": [], "subsumption": [ { "related_accession": "G00970CP", "relationship": "ancestor" }, { "related_accession": "G03756ZH", "relationship": "ancestor" }, { "related_accession": "G03828AM", "relationship": "ancestor" }, { "related_accession": "G17486WU", "relationship": "ancestor" }, { "related_accession": "G25993OX", "relationship": "ancestor" }, { "related_accession": "G34092QJ", "relationship": "ancestor" }, { "related_accession": "G54353FA", "relationship": "ancestor" }, { "related_accession": "G62695XZ", "relationship": "ancestor" }, { "related_accession": "G86941TB", "relationship": "ancestor" }, { "related_accession": "G34092QJ", "relationship": "basecomposition" }, { "related_accession": "G25993OX", "relationship": "composition" }, { "related_accession": "G17486WU", "relationship": "subsumedby" }, { "related_accession": "G03828AM", "relationship": "topology" } ], "names": [ { "name": "GT1aa", "domain": "Semantic Name" } ], "keywords": [ "fully_determined" ], "glycotree_pathways": [], "dictionary": { "term": "GT1a alpha", "term_in_sentence": "A new class of gangliosides, GT1a alpha and GQ1b alpha, were initially identified as cholinergic neuron-specific antigens in bovine brain. [PMID:8082783]", "publication": "7710562|8082783|10972137|9468624|9143254|8221098|9679279|11368158|11878808", "definition": "", "term_xref": "GlycoMotif:GGM.000111|GTC:G02149VR|GlycoEpitope:EP0111|CID:91851751|CHEBI:156678|KEGG:G00128", "synonymns": [ "GT1aa" ], "function": "GT1a alpha was a cholinerginic-specific antigen.[GlycoEpitope:EP0111]", "disease_associations": "", "wikipedia": "", "essentials_of_glycobiology": "", "evidence": [ { "id": "GSD000100", "url": "https://wiki.glygen.org/Glycan_structure_dictionary#GSD000100", "database": "Glycan Structure Dictionary" } ] }, "biomarkers": [], "section_stats": [ { "table_id": "glycoprotein", "table_stats": [ { "field": "total", "count": 0 }, { "field": "total_sites", "count": 0 } ], "sort_fields": [] }, { "table_id": "expression", "table_stats": [ { "field": "total", "count": 0 }, { "field": "total_sites", "count": 0 } ], "sort_fields": [] }, { "table_id": "expression_tissue", "table_stats": [ { "field": "total", "count": 0 }, { "field": "total_sites", "count": 0 } ], "sort_fields": [] }, { "table_id": "expression_cell_line", "table_stats": [ { "field": "total", "count": 0 }, { "field": "total_sites", "count": 0 } ], "sort_fields": [] }, { "table_id": "publication", "table_stats": [ { "field": "total", "count": 6 } ], "sort_fields": [ "title", "journal", "date", "authors" ] } ] }