{ "glytoucan_ac": "G07617FP", "number_monosaccharides": 7, "number_monosaccharides_suffix": "", "mass": 1234.43, "mass_pme": 1556.79, "tool_support": { "sandbox": "yes", "pdb": "yes", "gnome": "yes", "gnome_glygen": "yes", "gnome_glygen_nglycans": "yes", "gnome_glygen_oglycans": "no", "gnome_glycotree_nglycans": "yes", "gnome_glycotree_oglycans": "no" }, "fully_determined": "yes", "missing_score": 0, "glycan_type": "Saccharide", "iupac": "alpha-D-Manp-(1->2)-alpha-D-Manp-(1->3)[alpha-D-Manp-(1->3)-alpha-D-Manp-(1->6)]-beta-D-Manp-(1->4)-beta-D-GlcpNAc-(1->4)-beta-D-GlcpNAc-(1->", "iupac_compact": "Mana1-2Mana1-3(Mana1-3Mana1-6)Manb1-4GlcNAcb1-4GlcNAcb", "iupac_condensed": "Man(a1-2)Man(a1-3)[Man(a1-3)Man(a1-6)]Man(b1-4)GlcNAc(b1-4)GlcNAc(b1-", "wurcs": "WURCS=2.0/3,7,6/[a2122h-1b_1-5_2*NCC/3=O][a1122h-1b_1-5][a1122h-1a_1-5]/1-1-2-3-3-3-3/a4-b1_b4-c1_c3-d1_c6-f1_d2-e1_f3-g1", "glycoct": "RES 1b:b-dglc-HEX-1:5 2s:n-acetyl 3b:b-dglc-HEX-1:5 4s:n-acetyl 5b:b-dman-HEX-1:5 6b:a-dman-HEX-1:5 7b:a-dman-HEX-1:5 8b:a-dman-HEX-1:5 9b:a-dman-HEX-1:5 LIN 1:1d(2+1)2n 2:1o(4+1)3d 3:3d(2+1)4n 4:3o(4+1)5d 5:5o(3+1)6d 6:6o(2+1)7d 7:5o(6+1)8d 8:8o(3+1)9d", "inchi": "InChI=1S/C46H78N2O36/c1-10(55)47-19-26(62)35(16(7-53)73-40(19)71)80-41-20(48-11(2)56)27(63)36(17(8-54)78-41)81-45-34(70)38(83-46-39(30(66)23(59)14(5-51)77-46)84-44-32(68)29(65)22(58)13(4-50)76-44)25(61)18(79-45)9-72-42-33(69)37(24(60)15(6-52)74-42)82-43-31(67)28(64)21(57)12(3-49)75-43/h12-46,49-54,57-71H,3-9H2,1-2H3,(H,47,55)(H,48,56)/t12-,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23-,24-,25-,26-,27-,28+,29+,30+,31+,32+,33+,34+,35-,36-,37+,38+,39+,40-,41+,42+,43-,44-,45+,46-/m1/s1", "glycam": "DManpa1-2DManpa1-3[DManpa1-3DManpa1-6]DManpb1-4DGlcpNAcb1-4DGlcpNAcb1-OH", "smiles_isomeric": "CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1O)CO)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O[C@H]3[C@H]([C@H]([C@@H]([C@H](O3)CO[C@@H]4[C@H]([C@H]([C@@H]([C@H](O4)CO)O)O[C@@H]5[C@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)O)O)O[C@@H]6[C@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O[C@@H]7[C@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)O)O)NC(=O)C)O", "inchi_key": { "key": "KVAHXPCLQGSXNG-JFEACSNWSA-N", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/KVAHXPCLQGSXNG-JFEACSNWSA-N" }, "byonic": "HexNAc(2)Hex(5) % 1234.43342741", "gwb": "freeEnd--1b1D-GlcNAc,p--4b1D-GlcNAc,p--4b1D-Man,p(--3a1D-Man,p--2a1D-Man,p)--6a1D-Man,p--3a1D-Man,p$MONO,Und,0,0,freeEnd", "species": [ { "taxid": 9606, "name": "Homo sapiens", "annotation_category": "direct", "evidence": [ { "database": "GlyConnect", "id": "1964", "url": "https://glyconnect.expasy.org/browser/structures/1964" }, { "database": "GlyGen", "id": "GLY_001412", "url": "https://data.glygen.org/GLY_001412" }, { "database": "PubMed", "id": "10704524", "url": "https://glygen.org/publication/PubMed/10704524" }, { "database": "PubMed", "id": "19704023", "url": "https://glygen.org/publication/PubMed/19704023" }, { "database": "PubMed", "id": "23106217", "url": "https://glygen.org/publication/PubMed/23106217" }, { "database": "PubMed", "id": "24385486", "url": "https://glygen.org/publication/PubMed/24385486" }, { "database": "PubMed", "id": "26388028", "url": "https://glygen.org/publication/PubMed/26388028" }, { "database": "PubMed", "id": "27114034", "url": "https://glygen.org/publication/PubMed/27114034" }, { "database": "PubMed", "id": "27617431", "url": "https://glygen.org/publication/PubMed/27617431" }, { "database": "PubMed", "id": "28100831", "url": "https://glygen.org/publication/PubMed/28100831" }, { "database": "PubMed", "id": "28423342", "url": "https://glygen.org/publication/PubMed/28423342" }, { "database": "PubMed", "id": "29287995", "url": "https://glygen.org/publication/PubMed/29287995" }, { "database": "PubMed", "id": "29769533", "url": "https://glygen.org/publication/PubMed/29769533" }, { "database": "PubMed", "id": "30069035", "url": "https://glygen.org/publication/PubMed/30069035" }, { "database": "PubMed", "id": "30209313", "url": "https://glygen.org/publication/PubMed/30209313" }, { "database": "PubMed", "id": "31142836", "url": "https://glygen.org/publication/PubMed/31142836" }, { "database": "PubMed", "id": "31792452", "url": "https://glygen.org/publication/PubMed/31792452" }, { "database": "PubMed", "id": "32004464", "url": "https://glygen.org/publication/PubMed/32004464" }, { "database": "PubMed", "id": "33782388", "url": "https://glygen.org/publication/PubMed/33782388" }, { "database": "PubMed", "id": "34272380", "url": "https://glygen.org/publication/PubMed/34272380" }, { "database": "PubMed", "id": "37209096", "url": "https://glygen.org/publication/PubMed/37209096" }, { "database": "PubMed", "id": "37544422", "url": "https://glygen.org/publication/PubMed/37544422" }, { "database": "PubMed", "id": "38642076", "url": "https://glygen.org/publication/PubMed/38642076" }, { "database": "PubMed", "id": "38665238", "url": "https://glygen.org/publication/PubMed/38665238" }, { "database": "PubMed", "id": "39582378", "url": "https://glygen.org/publication/PubMed/39582378" }, { "database": "PubMed", "id": "39826122", "url": "https://glygen.org/publication/PubMed/39826122" }, { "database": "PubMed", "id": "39843743", "url": "https://glygen.org/publication/PubMed/39843743" }, { "database": "UniCarbKB", "id": "GLY_000341", "url": "http://data.glygen.org/GLY_000341" } ], "common_name": "Human", "glygen_name": "Human", "reference_species": "Homo sapiens [9606]" } ], "classification": [ { "type": { "name": "N-linked", "url": "" }, "subtype": { "name": "High mannose", "url": "" } } ], "enzyme": [ { "uniprot_canonical_ac": "P42867-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07617FP", "protein_name": "UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase", "gene": "Dpagt1", "gene_link": "https://www.uniprot.org/uniprotkb/P42867", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G07617FP", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07617FP" } ] }, { "uniprot_canonical_ac": "Q9H3H5-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07617FP", "protein_name": "UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase", "gene": "DPAGT1", "gene_link": "https://www.uniprot.org/uniprotkb/Q9H3H5", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G07617FP", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07617FP" } ] }, { "uniprot_canonical_ac": "Q8BML3-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07617FP", "protein_name": "UDP-N-acetylglucosamine transferase subunit ALG13", "gene": "Glt28d2", "gene_link": "https://www.uniprot.org/uniprotkb/Q8BML3", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G07617FP", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07617FP" } ] }, { "uniprot_canonical_ac": "Q96F25-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07617FP", "protein_name": "UDP-N-acetylglucosamine transferase subunit ALG14", "gene": "ALG14", "gene_link": "https://www.uniprot.org/uniprotkb/Q96F25", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G07617FP", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07617FP" } ] }, { "uniprot_canonical_ac": "Q9D081-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07617FP", "protein_name": "UDP-N-acetylglucosamine transferase subunit ALG14", "gene": "Alg14", "gene_link": "https://www.uniprot.org/uniprotkb/Q9D081", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G07617FP", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07617FP" } ] }, { "uniprot_canonical_ac": "Q9D8C3-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07617FP", "protein_name": "UDP-N-acetylglucosamine transferase subunit ALG13", "gene": "Alg13", "gene_link": "https://www.uniprot.org/uniprotkb/Q9D8C3", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G07617FP", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07617FP" } ] }, { "uniprot_canonical_ac": "Q9NP73-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07617FP", "protein_name": "UDP-N-acetylglucosamine transferase subunit ALG13", "gene": "ALG13", "gene_link": "https://www.uniprot.org/uniprotkb/Q9NP73", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G07617FP", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07617FP" } ] }, { "uniprot_canonical_ac": "Q921Q3-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07617FP", "protein_name": "Chitobiosyldiphosphodolichol beta-mannosyltransferase", "gene": "Alg1", "gene_link": "https://www.uniprot.org/uniprotkb/Q921Q3", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G07617FP", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07617FP" } ] }, { "uniprot_canonical_ac": "Q9BT22-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07617FP", "protein_name": "Chitobiosyldiphosphodolichol beta-mannosyltransferase", "gene": "ALG1", "gene_link": "https://www.uniprot.org/uniprotkb/Q9BT22", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G07617FP", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07617FP" } ] }, { "uniprot_canonical_ac": "Q9DBE8-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07617FP", "protein_name": "Alpha-1,3/1,6-mannosyltransferase ALG2", "gene": "Alg2", "gene_link": "https://www.uniprot.org/uniprotkb/Q9DBE8", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G07617FP", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07617FP" } ] }, { "uniprot_canonical_ac": "Q9H553-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07617FP", "protein_name": "Alpha-1,3/1,6-mannosyltransferase ALG2", "gene": "ALG2", "gene_link": "https://www.uniprot.org/uniprotkb/Q9H553", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G07617FP", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07617FP" } ] }, { "uniprot_canonical_ac": "Q8K2A8-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07617FP", "protein_name": "Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase", "gene": "Alg3", "gene_link": "https://www.uniprot.org/uniprotkb/Q8K2A8", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G07617FP", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07617FP" } ] }, { "uniprot_canonical_ac": "Q92685-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07617FP", "protein_name": "Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase", "gene": "ALG3", "gene_link": "https://www.uniprot.org/uniprotkb/Q92685", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G07617FP", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07617FP" } ] }, { "uniprot_canonical_ac": "Q2TAA5-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07617FP", "protein_name": "GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase", "gene": "ALG11", "gene_link": "https://www.uniprot.org/uniprotkb/Q2TAA5", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G07617FP", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07617FP" } ] }, { "uniprot_canonical_ac": "Q3TZM9-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G07617FP", "protein_name": "GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase", "gene": "Alg11", "gene_link": "https://www.uniprot.org/uniprotkb/Q3TZM9", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G07617FP", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G07617FP" } ] } ], "crossref": [ { "id": "91849820", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91849820", "database": "PubChem Compound", "categories": [ "Chemical" ] }, { "id": "252281536", "url": "https://pubchem.ncbi.nlm.nih.gov/substance/252281536", "database": "PubChem Substance", "categories": [ "Chemical" ] }, { "id": "1629", "url": "", "database": "UniCarbKB", "categories": [ "Discontinued" ] }, { "id": "1juh", "url": "https://www.rcsb.org/structure/1juh", "database": "PDB", "categories": [ "3D Structure" ] }, { "id": "4f9v", "url": "https://www.rcsb.org/structure/4f9v", "database": "PDB", "categories": [ "3D Structure" ] }, { "id": "4g1m", "url": "https://www.rcsb.org/structure/4g1m", "database": "PDB", "categories": [ "3D Structure" ] }, { "id": "2145", "url": "", "database": "Glycosciences.de", "categories": [ "Discontinued" ] }, { "id": "22747", "url": "", "database": "Glycosciences.de", "categories": [ "Discontinued" ] }, { "id": "1964", "url": "https://glyconnect.expasy.org/browser/structures/1964", "database": "GlyConnect", "categories": [ "Glycoproteomics", "Glycomics" ] }, { "id": "39414", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+39414", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "147189", "url": "https://www.ebi.ac.uk/chebi/searchId.do?chebiId=147189", "database": "ChEBI", "categories": [] }, { "id": "G07617FP", "url": "https://glytoucan.org/Structures/Glycans/G07617FP", "database": "GlyTouCan", "categories": [ "Glycomics" ] }, { "id": "G07617FP", "url": "https://sandbox.glyomics.org/explore.html?G07617FP", "database": "SandBox", "categories": [ "Enzyme and Pathway" ] }, { "id": "G07617FP", "url": "https://gnome.glyomics.org/restrictions/GlyGen.StructureBrowser.html?focus=G07617FP", "database": "GNOme", "categories": [ "Glycomics", "Ontology and Dictionary" ] }, { "id": "G07617FP", "url": "https://glycosmos.org/glycans/show/G07617FP", "database": "GlyCosmos", "categories": [ "Glycoproteomics", "Glycomics" ] }, { "id": "G07617FP", "url": "https://glycoshape.org/glycan?glytoucan=G07617FP", "database": "GlycoShape", "categories": [ "3D Structure" ] } ], "glycoprotein": [ { "uniprot_canonical_ac": "P17050-1", "start_pos": 201, "end_pos": 201, "residue": "asn", "evidence": [ { "database": "PubMed", "id": "10704524", "url": "https://glygen.org/publication/PubMed/10704524" }, { "database": "UniCarbKB", "id": "GLY_000040", "url": "http://data.glygen.org/GLY_000040" } ], "protein_name": "Alpha-N-acetylgalactosaminidase", "gene_name": "NAGA", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P17050-1", "start_pos": 385, "end_pos": 385, "residue": "asn", "evidence": [ { "database": "PubMed", "id": "10704524", "url": "https://glygen.org/publication/PubMed/10704524" }, { "database": "UniCarbKB", "id": "GLY_000040", "url": "http://data.glygen.org/GLY_000040" } ], "protein_name": "Alpha-N-acetylgalactosaminidase", "gene_name": "NAGA", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P17050-1", "start_pos": 124, "end_pos": 124, "residue": "asn", "evidence": [ { "database": "PubMed", "id": "10704524", "url": "https://glygen.org/publication/PubMed/10704524" }, { "database": "UniCarbKB", "id": "GLY_000040", "url": "http://data.glygen.org/GLY_000040" } ], "protein_name": "Alpha-N-acetylgalactosaminidase", "gene_name": "NAGA", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P17050-1", "start_pos": 359, "end_pos": 359, "residue": "asn", "evidence": [ { "database": "PubMed", "id": "10704524", "url": "https://glygen.org/publication/PubMed/10704524" }, { "database": "UniCarbKB", "id": "GLY_000040", "url": "http://data.glygen.org/GLY_000040" } ], "protein_name": "Alpha-N-acetylgalactosaminidase", "gene_name": "NAGA", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P17050-1", "start_pos": 177, "end_pos": 177, "residue": "asn", "evidence": [ { "database": "PubMed", "id": "10704524", "url": "https://glygen.org/publication/PubMed/10704524" }, { "database": "UniCarbKB", "id": "GLY_000040", "url": "http://data.glygen.org/GLY_000040" } ], "protein_name": "Alpha-N-acetylgalactosaminidase", "gene_name": "NAGA", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P17050-1", "evidence": [ { "database": "PubMed", "id": "10704524", "url": "https://glygen.org/publication/PubMed/10704524" }, { "database": "GlyConnect", "id": "45", "url": "https://glyconnect.expasy.org/browser/proteins/45" } ], "protein_name": "Alpha-N-acetylgalactosaminidase", "gene_name": "NAGA", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P06756-1", "start_pos": 296, "end_pos": 296, "residue": "ASN", "evidence": [ { "database": "RCSB PDB", "id": "4G1M", "url": "https://www.rcsb.org/structure/4G1M" } ], "protein_name": "Integrin alpha-V", "gene_name": "ITGAV", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P20702-1", "start_pos": 392, "end_pos": 392, "residue": "ASN", "evidence": [ { "database": "RCSB PDB", "id": "4NEH", "url": "https://www.rcsb.org/structure/4NEH" } ], "protein_name": "Integrin alpha-X", "gene_name": "ITGAX", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P29460-1", "start_pos": 222, "end_pos": 222, "residue": "ASN", "evidence": [ { "database": "RCSB PDB", "id": "5MZV", "url": "https://www.rcsb.org/structure/5MZV" } ], "protein_name": "Interleukin-12 subunit beta", "gene_name": "IL12B", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P01854-2", "start_pos": 275, "end_pos": 275, "residue": "ASN", "evidence": [ { "database": "RCSB PDB", "id": "6EYO", "url": "https://www.rcsb.org/structure/6EYO" } ], "protein_name": "Immunoglobulin heavy constant epsilon", "gene_name": "IGHE", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "Q9NR97-1", "start_pos": 293, "end_pos": 293, "residue": "ASN", "evidence": [ { "database": "RCSB PDB", "id": "7CRF", "url": "https://www.rcsb.org/structure/7CRF" } ], "protein_name": "Toll-like receptor 8", "gene_name": "TLR8", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "Q9NR97-1", "start_pos": 590, "end_pos": 590, "residue": "ASN", "evidence": [ { "database": "RCSB PDB", "id": "7YTX", "url": "https://www.rcsb.org/structure/7YTX" } ], "protein_name": "Toll-like receptor 8", "gene_name": "TLR8", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P47869-1", "start_pos": 138, "end_pos": 138, "residue": "ASN", "evidence": [ { "database": "RCSB PDB", "id": "9CRV", "url": "https://www.rcsb.org/structure/9CRV" } ], "protein_name": "Gamma-aminobutyric acid receptor subunit alpha-2", "gene_name": "GABRA2", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P14867-1", "start_pos": 138, "end_pos": 138, "residue": "ASN", "evidence": [ { "database": "RCSB PDB", "id": "9CSB", "url": "https://www.rcsb.org/structure/9CSB" }, { "database": "RCSB PDB", "id": "9CT0", "url": "https://www.rcsb.org/structure/9CT0" }, { "database": "RCSB PDB", "id": "9CTJ", "url": "https://www.rcsb.org/structure/9CTJ" }, { "database": "RCSB PDB", "id": "9CXA", "url": "https://www.rcsb.org/structure/9CXA" } ], "protein_name": "Gamma-aminobutyric acid receptor subunit alpha-1", "gene_name": "GABRA1", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P17643-1", "start_pos": 304, "end_pos": 304, "residue": "ASN", "evidence": [ { "database": "RCSB PDB", "id": "9EY8", "url": "https://www.rcsb.org/structure/9EY8" } ], "protein_name": "5,6-dihydroxyindole-2-carboxylic acid oxidase", "gene_name": "TYRP1", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" }, { "uniprot_canonical_ac": "P01880-2", "start_pos": 225, "end_pos": 225, "residue": "ASN", "evidence": [ { "database": "RCSB PDB", "id": "9FMB", "url": "https://www.rcsb.org/structure/9FMB" } ], "protein_name": "Immunoglobulin heavy constant delta", "gene_name": "IGHD", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human" } ], "publication": [ { "title": "Human alpha-N-acetylgalactosaminidase: site occupancy and structure of N-linked oligosaccharides.", "journal": "Glycobiology", "date": "2000", "authors": "Ohta M, Ohnishi T, Ioannou YA, Hodgson ME, Matsuura F, Desnick RJ", "evidence": [ { "database": "UniCarbKB", "id": "GLY_000040", "url": "http://data.glygen.org/GLY_000040" }, { "database": "GlyTouCan", "id": "G07617FP", "url": "https://glytoucan.org/Structures/Glycans/G07617FP" }, { "database": "GlyConnect", "id": "45", "url": "https://glyconnect.expasy.org/browser/proteins/45" } ], "reference": [ { "type": "PubMed", "id": "10704524", "url": "https://glygen.org/publication/PubMed/10704524" } ] }, { "title": "Crystal structure of the complete integrin alphaVbeta3 ectodomain plus an alpha/beta transmembrane fragment.", "journal": "The Journal of cell biology", "date": "2009-08-24", "authors": "Xiong Jian-Ping, Mahalingham Bhuvaneshwari, Alonso Jose Luis, Borrelli Laura Ann, Rui Xianliang, Anand Saurabh, Hyman Bradley T, Rysiok Thomas, M\u00fcller-Pompalla Dirk, Goodman Simon L, Arnaout M Amin", "evidence": [ { "database": "GlyTouCan", "id": "G07617FP", "url": "https://glytoucan.org/Structures/Glycans/G07617FP" } ], "reference": [ { "type": "PubMed", "id": "19704023", "url": "https://glygen.org/publication/PubMed/19704023" } ] }, { "title": "\u03b1(V)\u03b2(3) integrin crystal structures and their functional implications.", "journal": "Biochemistry", "date": "2012-11-06", "authors": "Dong Xianchi, Mi Li-Zhi, Zhu Jianghai, Wang Wei, Hu Ping, Luo Bing-Hao, Springer Timothy A", "evidence": [ { "database": "GlyTouCan", "id": "G07617FP", "url": "https://glytoucan.org/Structures/Glycans/G07617FP" } ], "reference": [ { "type": "PubMed", "id": "23106217", "url": "https://glygen.org/publication/PubMed/23106217" } ] }, { "title": "An internal ligand-bound, metastable state of a leukocyte integrin, \u03b1X\u03b22.", "journal": "The Journal of cell biology", "date": "2013-11-25", "authors": "Sen Mehmet, Yuki Koichi, Springer Timothy A", "evidence": [ { "database": "GlyTouCan", "id": "G07617FP", "url": "https://glytoucan.org/Structures/Glycans/G07617FP" } ], "reference": [ { "type": "PubMed", "id": "24385486", "url": "https://glygen.org/publication/PubMed/24385486" } ] }, { "title": "Model Building and Refinement of a Natively Glycosylated HIV-1 Env Protein by High-Resolution Cryoelectron Microscopy.", "journal": "Structure (London, England : 1993)", "date": "2015-10-06", "authors": "Lee Jeong Hyun, de Val Natalia, Lyumkis Dmitry, Ward Andrew B", "evidence": [ { "database": "GlyTouCan", "id": "G07617FP", "url": "https://glytoucan.org/Structures/Glycans/G07617FP" } ], "reference": [ { "type": "PubMed", "id": "26388028", "url": "https://glygen.org/publication/PubMed/26388028" } ] }, { "title": "Trimeric HIV-1-Env Structures Define Glycan Shields from Clades A, B, and G.", "journal": "Cell", "date": "2016-05-05", "authors": "Stewart-Jones Guillaume B E, Soto Cinque, Lemmin Thomas, Chuang Gwo-Yu, Druz Aliaksandr, Kong Rui, Thomas Paul V, Wagh Kshitij, Zhou Tongqing, Behrens Anna-Janina, Bylund Tatsiana, Choi Chang W, Davison Jack R, Georgiev Ivelin S, Joyce M Gordon, Kwon Young Do, Pancera Marie, Taft Justin, Yang Yongping, Zhang Baoshan, Shivatare Sachin S, Shivatare Vidya S, Lee Chang-Chun D, Wu Chung-Yi, Bewley Carole A, Burton Dennis R, Koff Wayne C, Connors Mark, Crispin Max, Baxa Ulrich, Korber Bette T, Wong Chi-Huey, Mascola John R, Kwong Peter D", "evidence": [ { "database": "GlyTouCan", "id": "G07617FP", "url": "https://glytoucan.org/Structures/Glycans/G07617FP" } ], "reference": [ { "type": "PubMed", "id": "27114034", "url": "https://glygen.org/publication/PubMed/27114034" } ] }, { "title": "Natively glycosylated HIV-1 Env structure reveals new mode for antibody recognition of the CD4-binding site.", "journal": "Nature structural & molecular biology", "date": "2016-10", "authors": "Gristick Harry B, von Boehmer Lotta, West Anthony P, Schamber Michael, Gazumyan Anna, Golijanin Jovana, Seaman Michael S, F\u00e4tkenheuer Gerd, Klein Florian, Nussenzweig Michel C, Bjorkman Pamela J", "evidence": [ { "database": "GlyTouCan", "id": "G07617FP", "url": "https://glytoucan.org/Structures/Glycans/G07617FP" } ], "reference": [ { "type": "PubMed", "id": "27617431", "url": "https://glygen.org/publication/PubMed/27617431" } ] }, { "title": "Coexistence of potent HIV-1 broadly neutralizing antibodies and antibody-sensitive viruses in a viremic controller.", "journal": "Science translational medicine", "date": "2017-01-18", "authors": "Freund Natalia T, Wang Haoqing, Scharf Louise, Nogueira Lilian, Horwitz Joshua A, Bar-On Yotam, Golijanin Jovana, Sievers Stuart A, Sok Devin, Cai Hui, Cesar Lorenzi Julio C, Halper-Stromberg Ariel, Toth Ildiko, Piechocka-Trocha Alicja, Gristick Harry B, van Gils Marit J, Sanders Rogier W, Wang Lai-Xi, Seaman Michael S, Burton Dennis R, Gazumyan Anna, Walker Bruce D, West Anthony P, Bjorkman Pamela J, Nussenzweig Michel C", "evidence": [ { "database": "GlyTouCan", "id": "G07617FP", "url": "https://glytoucan.org/Structures/Glycans/G07617FP" } ], "reference": [ { "type": "PubMed", "id": "28100831", "url": "https://glygen.org/publication/PubMed/28100831" } ] }, { "title": "A Broadly Neutralizing Antibody Targets the Dynamic HIV Envelope Trimer Apex via a Long, Rigidified, and Anionic \u03b2-Hairpin Structure.", "journal": "Immunity", "date": "2017-04-18", "authors": "Lee Jeong Hyun, Andrabi Raiees, Su Ching-Yao, Yasmeen Anila, Julien Jean-Philippe, Kong Leopold, Wu Nicholas C, McBride Ryan, Sok Devin, Pauthner Matthias, Cottrell Christopher A, Nieusma Travis, Blattner Claudia, Paulson James C, Klasse Per Johan, Wilson Ian A, Burton Dennis R, Ward Andrew B", "evidence": [ { "database": "GlyTouCan", "id": "G07617FP", "url": "https://glytoucan.org/Structures/Glycans/G07617FP" } ], "reference": [ { "type": "PubMed", "id": "28423342", "url": "https://glygen.org/publication/PubMed/28423342" } ] }, { "title": "Structural Activation of Pro-inflammatory Human Cytokine IL-23 by Cognate IL-23 Receptor Enables Recruitment of the Shared Receptor IL-12Rbeta1.", "journal": "Immunity", "date": "2018", "authors": "Bloch Y, Bouchareychas L, Merceron R, Skladanowska K, Van den Bossche L, Detry S, Govindarajan S, Elewaut D, Haerynck F, Dullaers M, Adamopoulos IE, Savvides SN", "evidence": [ { "database": "GlyTouCan", "id": "G07617FP", "url": "https://glytoucan.org/Structures/Glycans/G07617FP" } ], "reference": [ { "type": "PubMed", "id": "29287995", "url": "https://glygen.org/publication/PubMed/29287995" } ] }, { "title": "Structure of a cleavage-independent HIV Env recapitulates the glycoprotein architecture of the native cleaved trimer.", "journal": "Nature communications", "date": "2018-05-16", "authors": "Sarkar Anita, Bale Shridhar, Behrens Anna-Janina, Kumar Sonu, Sharma Shailendra Kumar, de Val Natalia, Pallesen Jesper, Irimia Adriana, Diwanji Devan C, Stanfield Robyn L, Ward Andrew B, Crispin Max, Wyatt Richard T, Wilson Ian A", "evidence": [ { "database": "GlyTouCan", "id": "G07617FP", "url": "https://glytoucan.org/Structures/Glycans/G07617FP" } ], "reference": [ { "type": "PubMed", "id": "29769533", "url": "https://glygen.org/publication/PubMed/29769533" } ] }, { "title": "Structural basis for selective inhibition of immunoglobulin E-receptor interactions by an anti-IgE antibody.", "journal": "Scientific reports", "date": "2018-08-01", "authors": "Chen Jiun-Bo, Ramadani Faruk, Pang Marie O Y, Beavil Rebecca L, Holdom Mary D, Mitropoulou Alkistis N, Beavil Andrew J, Gould Hannah J, Chang Tse Wen, Sutton Brian J, McDonnell James M, Davies Anna M", "evidence": [ { "database": "GlyTouCan", "id": "G07617FP", "url": "https://glytoucan.org/Structures/Glycans/G07617FP" } ], "reference": [ { "type": "PubMed", "id": "30069035", "url": "https://glygen.org/publication/PubMed/30069035" } ] }, { "title": "Differential processing of HIV envelope glycans on the virus and soluble recombinant trimer.", "journal": "Nature communications", "date": "2018-09-12", "authors": "Cao Liwei, Pauthner Matthias, Andrabi Raiees, Rantalainen Kimmo, Berndsen Zachary, Diedrich Jolene K, Menis Sergey, Sok Devin, Bastidas Raiza, Park Sung-Kyu Robin, Delahunty Claire M, He Lin, Guenaga Javier, Wyatt Richard T, Schief William R, Ward Andrew B, Yates John R, Burton Dennis R, Paulson James C", "evidence": [ { "database": "GlyTouCan", "id": "G07617FP", "url": "https://glytoucan.org/Structures/Glycans/G07617FP" } ], "reference": [ { "type": "PubMed", "id": "30209313", "url": "https://glygen.org/publication/PubMed/30209313" } ] }, { "title": "Immunization expands B cells specific to HIV-1 V3 glycan in mice and macaques.", "journal": "Nature", "date": "2019-06", "authors": "Escolano Amelia, Gristick Harry B, Abernathy Morgan E, Merkenschlager Julia, Gautam Rajeev, Oliveira Thiago Y, Pai Joy, West Anthony P, Barnes Christopher O, Cohen Alexander A, Wang Haoqing, Golijanin Jovana, Yost Daniel, Keeffe Jennifer R, Wang Zijun, Zhao Peng, Yao Kai-Hui, Bauer Jens, Nogueira Lilian, Gao Han, Voll Alisa V, Montefiori David C, Seaman Michael S, Gazumyan Anna, Silva Murillo, McGuire Andrew T, Stamatatos Leonidas, Irvine Darrell J, Wells Lance, Martin Malcolm A, Bjorkman Pamela J, Nussenzweig Michel C", "evidence": [ { "database": "GlyTouCan", "id": "G07617FP", "url": "https://glytoucan.org/Structures/Glycans/G07617FP" } ], "reference": [ { "type": "PubMed", "id": "31142836", "url": "https://glygen.org/publication/PubMed/31142836" } ] }, { "title": "Asymmetric opening of HIV-1 Env bound to CD4 and a coreceptor-mimicking antibody.", "journal": "Nature structural & molecular biology", "date": "2019", "authors": "Yang Z, Wang H, Liu AZ, Gristick HB, Bjorkman PJ", "evidence": [ { "database": "GlyTouCan", "id": "G07617FP", "url": "https://glytoucan.org/Structures/Glycans/G07617FP" } ], "reference": [ { "type": "PubMed", "id": "31792452", "url": "https://glygen.org/publication/PubMed/31792452" } ] }, { "title": "Restriction of HIV-1 Escape by a Highly Broad and Potent Neutralizing Antibody.", "journal": "Cell", "date": "2020-02-06", "authors": "Schommers Philipp, Gruell Henning, Abernathy Morgan E, Tran My-Kim, Dingens Adam S, Gristick Harry B, Barnes Christopher O, Schoofs Till, Schlotz Maike, Vanshylla Kanika, Kreer Christoph, Weiland Daniela, Holtick Udo, Scheid Christof, Valter Markus M, van Gils Marit J, Sanders Rogier W, Vehreschild J\u00f6rg J, Cornely Oliver A, Lehmann Clara, F\u00e4tkenheuer Gerd, Seaman Michael S, Bloom Jesse D, Bjorkman Pamela J, Klein Florian", "evidence": [ { "database": "GlyTouCan", "id": "G07617FP", "url": "https://glytoucan.org/Structures/Glycans/G07617FP" } ], "reference": [ { "type": "PubMed", "id": "32004464", "url": "https://glygen.org/publication/PubMed/32004464" } ] }, { "title": "Cryo-EM structures of HIV-1 trimer bound to CD4-mimetics BNM-III-170 and M48U1 adopt a CD4-bound open conformation.", "journal": "Nature communications", "date": "2021-03-29", "authors": "Jette Claudia A, Barnes Christopher O, Kirk Sharon M, Melillo Bruno, Smith Amos B, Bjorkman Pamela J", "evidence": [ { "database": "GlyTouCan", "id": "G07617FP", "url": "https://glytoucan.org/Structures/Glycans/G07617FP" } ], "reference": [ { "type": "PubMed", "id": "33782388", "url": "https://glygen.org/publication/PubMed/33782388" } ] }, { "title": "Tetrasubstituted imidazoles as incognito Toll-like receptor 8\u2009a(nta)gonists.", "journal": "Nature communications", "date": "2021-07-16", "authors": "Yang Yi, Csakai Adam, Jiang Shuangshuang, Smith Christina, Tanji Hiromi, Huang Jian, Jones Torey, Sakaniwa Kentaro, Broadwell Lindsey, Shi Chengrui, Soti Subada, Ohto Umeharu, Fang Yaohui, Shen Shu, Deng Fei, Shimizu Toshiyuki, Yin Hang", "evidence": [ { "database": "GlyTouCan", "id": "G07617FP", "url": "https://glytoucan.org/Structures/Glycans/G07617FP" } ], "reference": [ { "type": "PubMed", "id": "34272380", "url": "https://glygen.org/publication/PubMed/34272380" } ] }, { "title": "Structural conservation of Lassa virus glycoproteins and recognition by neutralizing antibodies.", "journal": "Cell reports", "date": "2023-05-30", "authors": "Perrett Hailee R, Brouwer Philip J M, Hurtado Jonathan, Newby Maddy L, Liu Lin, M\u00fcller-Kr\u00e4uter Helena, M\u00fcller Aguirre Sarah, Burger Judith A, Bouhuijs Joey H, Gibson Grace, Messmer Terrence, Schieffelin John S, Antanasijevic Aleksandar, Boons Geert-Jan, Strecker Thomas, Crispin Max, Sanders Rogier W, Briney Bryan, Ward Andrew B", "evidence": [ { "database": "GlyTouCan", "id": "G07617FP", "url": "https://glytoucan.org/Structures/Glycans/G07617FP" } ], "reference": [ { "type": "PubMed", "id": "37209096", "url": "https://glygen.org/publication/PubMed/37209096" } ] }, { "title": "A novel Toll-like receptor 7/8-specific antagonist E6742 ameliorates clinically relevant disease parameters in murine models of lupus.", "journal": "European journal of pharmacology", "date": "2023-10-15", "authors": "Ishizaka Sally T, Hawkins Lynn, Chen Qian, Tago Fumitoshi, Yagi Takuya, Sakaniwa Kentaro, Zhang Zhikuan, Shimizu Toshiyuki, Shirato Manabu", "evidence": [ { "database": "GlyTouCan", "id": "G07617FP", "url": "https://glytoucan.org/Structures/Glycans/G07617FP" } ], "reference": [ { "type": "PubMed", "id": "37544422", "url": "https://glygen.org/publication/PubMed/37544422" } ] }, { "title": "Interactions of Phenylalanine Derivatives with Human Tyrosinase: Lessons from Experimental and Theoretical tudies.", "journal": "Chembiochem : a European journal of chemical biology", "date": "2024-06-17", "authors": "Faure Clarisse, Min Ng Yi, Belle Catherine, Soler-Lopez Montserrat, Khettabi Lyna, Sa\u00efdi M\u00e9lissa, Berthet Nathalie, Maresca Marc, Philouze Christian, Rachidi Walid, R\u00e9glier Marius, du Moulinet d'Hardemare Amaury, Jamet H\u00e9l\u00e8ne", "evidence": [ { "database": "GlyTouCan", "id": "G07617FP", "url": "https://glytoucan.org/Structures/Glycans/G07617FP" } ], "reference": [ { "type": "PubMed", "id": "38642076", "url": "https://glygen.org/publication/PubMed/38642076" } ] }, { "title": "An HIV-1 broadly neutralizing antibody overcomes structural and dynamic variation through highly focused epitope targeting.", "journal": "Npj viruses", "date": "2023", "authors": "Hodge Edgar A, Chatterjee Ananya, Chen Chengbo, Naika Gajendra S, Laohajaratsang Mint, Mangala Prasad Vidya, Lee Kelly K", "evidence": [ { "database": "GlyTouCan", "id": "G07617FP", "url": "https://glytoucan.org/Structures/Glycans/G07617FP" } ], "reference": [ { "type": "PubMed", "id": "38665238", "url": "https://glygen.org/publication/PubMed/38665238" } ] }, { "title": "The Crystal Structure of Human IgD-Fc Reveals Unexpected Differences With Other Antibody Isotypes.", "journal": "Proteins", "date": "2024-11-25", "authors": "Davies Anna M, Bui Tam T T, Pacheco-G\u00f3mez Ra\u00fal, Vester Susan K, Beavil Andrew J, Gould Hannah J, Sutton Brian J, McDonnell James M", "evidence": [ { "database": "GlyTouCan", "id": "G07617FP", "url": "https://glytoucan.org/Structures/Glycans/G07617FP" } ], "reference": [ { "type": "PubMed", "id": "39582378", "url": "https://glygen.org/publication/PubMed/39582378" } ] }, { "title": "Structural development of the HIV-1 apex-directed PGT145-PGDM1400 antibody lineage.", "journal": "Cell reports", "date": "2025-01-28", "authors": "Mason Rosemarie D, Zhang Baoshan, Morano Nicholas C, Shen Chen-Hsiang, McKee Krisha, Heimann Ashley, Du Renguang, Nazzari Alexandra F, Hodges Shelby, Kanai Tapan, Lin Bob C, Louder Mark K, Doria-Rose Nicole A, Zhou Tongqing, Shapiro Lawrence, Roederer Mario, Kwong Peter D, Gorman Jason", "evidence": [ { "database": "GlyTouCan", "id": "G07617FP", "url": "https://glytoucan.org/Structures/Glycans/G07617FP" } ], "reference": [ { "type": "PubMed", "id": "39826122", "url": "https://glygen.org/publication/PubMed/39826122" } ] }, { "title": "Resolving native GABAA receptor structures from the human brain.", "journal": "Nature", "date": "2025-01-22", "authors": "Zhou Jia, Noviello Colleen M, Teng Jinfeng, Moore Haley, Lega Bradley, Hibbs Ryan E", "evidence": [ { "database": "GlyTouCan", "id": "G07617FP", "url": "https://glytoucan.org/Structures/Glycans/G07617FP" } ], "reference": [ { "type": "PubMed", "id": "39843743", "url": "https://glygen.org/publication/PubMed/39843743" } ] } ], "residues": [ { "id": "NA", "name": "N-glycan_core_D-GlcNAc_A", "attachedby": "rxn.P42867-1", "detachedby": "", "parentid": "0" }, { "id": "NA", "name": "N-glycan_core_D-GlcNAc_A", "attachedby": "rxn.Q9H3H5-1", "detachedby": "", "parentid": "0" }, { "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "attachedby": "rxn.Q8BML3-1", "detachedby": "", "parentid": "NA" }, { "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "attachedby": "rxn.Q96F25-1", "detachedby": "", "parentid": "NA" }, { "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "attachedby": "rxn.Q9D081-1", "detachedby": "", "parentid": "NA" }, { "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "attachedby": "rxn.Q9D8C3-1", "detachedby": "", "parentid": "NA" }, { "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "attachedby": "rxn.Q9NP73-1", "detachedby": "", "parentid": "NA" }, { "id": "NC", "name": "N-glycan_core_b-D-Manp_C", "attachedby": "rxn.Q921Q3-1", "detachedby": "", "parentid": "NB" }, { "id": "NC", "name": "N-glycan_core_b-D-Manp_C", "attachedby": "rxn.Q9BT22-1", "detachedby": "", "parentid": "NB" }, { "id": "N1", "name": "N-glycan_a-D-Manp_1", "attachedby": "rxn.Q9DBE8-1", "detachedby": "", "parentid": "NC" }, { "id": "N1", "name": "N-glycan_a-D-Manp_1", "attachedby": "rxn.Q9H553-1", "detachedby": "", "parentid": "NC" }, { "id": "N4", "name": "N-glycan_a-D-Manp_4", "attachedby": "rxn.Q9DBE8-1", "detachedby": "", "parentid": "NC" }, { "id": "N4", "name": "N-glycan_a-D-Manp_4", "attachedby": "rxn.Q9H553-1", "detachedby": "", "parentid": "NC" }, { "id": "N19", "name": "N-glycan_a-D-Manp_19", "attachedby": "rxn.Q8K2A8-1", "detachedby": "", "parentid": "N4" }, { "id": "N19", "name": "N-glycan_a-D-Manp_19", "attachedby": "rxn.Q92685-1", "detachedby": "", "parentid": "N4" }, { "id": "N21", "name": "N-glycan_a-D-Manp_21", "attachedby": "rxn.Q2TAA5-1", "detachedby": "", "parentid": "N1" }, { "id": "N21", "name": "N-glycan_a-D-Manp_21", "attachedby": "rxn.Q3TZM9-1", "detachedby": "", "parentid": "N1" } ], "composition": [ { "name": "6-Deoxy-Hexose", "residue": "dhex", "count": 0, "cid": "840", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840" }, { "name": "Hexose", "residue": "hex", "count": 5, "cid": "206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206" }, { "name": "N-Acetylhexosamine", "residue": "hexnac", "count": 2, "cid": "899", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899" }, { "name": "Hexuronic Acid", "residue": "hexa", "count": 0, "cid": "610", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610" }, { "name": "2-Amino-2-Deoxy-Hexose", "residue": "hexn", "count": 0, "cid": "739", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739" }, { "name": "N-Acetyl-Neuraminic Acid", "residue": "neuac", "count": 0, "cid": "439197", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197" }, { "name": "N-Glycolyl-Neuraminic Acid", "residue": "neugc", "count": 0, "cid": "440001", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001" }, { "name": "Phosphate", "residue": "p", "count": 0, "cid": "1061", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061" }, { "name": "Pentose", "residue": "pent", "count": 0, "cid": "229", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229" }, { "name": "Sulfate", "residue": "s", "count": 0, "cid": "1117", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117" }, { "name": "Other", "residue": "other", "count": 0 } ], "composition_expanded": [ { "name": "Alditol", "residue": "aldi", "count": 0 }, { "name": "6-Deoxy-Hexose", "residue": "dhex", "count": 0, "cid": "840", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840" }, { "name": "6-Deoxy-Hexitol", "residue": "dhex+aldi", "count": 0 }, { "name": "L-Fucose", "residue": "fuc", "count": 0, "cid": "17106", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/17106" }, { "name": "L-Fucitol", "residue": "fuc+aldi", "count": 0, "cid": "445724", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/445724" }, { "name": "D-Galactose", "residue": "gal", "count": 0, "cid": "6036", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6036" }, { "name": "D-Galactitol", "residue": "gal+aldi", "count": 0, "cid": "11850", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11850" }, { "name": "N-Acetyl-D-galactosamine", "residue": "galnac", "count": 0, "cid": "35717", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/35717" }, { "name": "N-Acetylgalactosaminitol", "residue": "galnac+aldi", "count": 0, "cid": "165880", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165880" }, { "name": "D-Galacturonic Acid", "residue": "gala", "count": 0, "cid": "439215", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439215" }, { "name": "D-Glucose", "residue": "glc", "count": 0, "cid": "5793", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5793" }, { "name": "D-Glucitol", "residue": "glc+aldi", "count": 0, "cid": "5780", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5780" }, { "name": "D-Glucuronic acid", "residue": "glca", "count": 0, "cid": "94715", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/94715" }, { "name": "D-Glucosamine", "residue": "glcn", "count": 0, "cid": "439213", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439213" }, { "name": "N-Acetyl-D-Glucosamine", "residue": "glcnac", "count": 2, "cid": "439174", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439174" }, { "name": "N-Acetyl-D-glucosaminitol", "residue": "glcnac+aldi", "count": 0, "cid": "165206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165206" }, { "name": "Hexose", "residue": "hex", "count": 5, "cid": "206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206" }, { "name": "N-Acetylhexosamine", "residue": "hexnac", "count": 2, "cid": "899", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899" }, { "name": "Hexuronic Acid", "residue": "hexa", "count": 0, "cid": "610", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610" }, { "name": "2-Amino-2-Deoxy-Hexose", "residue": "hexn", "count": 0, "cid": "739", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739" }, { "name": "Hexitol", "residue": "hex+aldi", "count": 0, "cid": "453", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/453" }, { "name": "N-Acetylhexosaminitol", "residue": "hexnac+aldi", "count": 0 }, { "name": "L-Iduronic acid", "residue": "idoa", "count": 0, "cid": "441039", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/441039" }, { "name": "D-Mannose", "residue": "man", "count": 5, "cid": "18950", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18950" }, { "name": "D-Mannitol", "residue": "man+aldi", "count": 0, "cid": "6251", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6251" }, { "name": "N-Acetyl-D-mannosamine", "residue": "mannac", "count": 0, "cid": "439281", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439281" }, { "name": "Methyl", "residue": "me", "count": 0 }, { "name": "N-Acetyl-Neuraminic Acid", "residue": "neuac", "count": 0, "cid": "439197", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197" }, { "name": "N-Glycolyl-Neuraminic Acid", "residue": "neugc", "count": 0, "cid": "440001", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001" }, { "name": "Phosphate", "residue": "p", "count": 0, "cid": "1061", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061" }, { "name": "Pentose", "residue": "pent", "count": 0, "cid": "229", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229" }, { "name": "Sulfate", "residue": "s", "count": 0, "cid": "1117", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117" }, { "name": "Sialic acid", "residue": "sia", "count": 0 }, { "name": "Other", "residue": "other", "count": 0 }, { "name": "Floating substituent", "residue": "x", "count": 0 }, { "name": "D-Xylose", "residue": "xyl", "count": 0, "cid": "135191", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135191" }, { "name": "Ketodeoxynononic acid", "residue": "kdn", "count": 0, "cid": "13991616", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13991616" } ], "motifs": [], "interactions": [], "expression": [ { "category": "tissue", "tissue": { "name": "ovary", "namespace": "UBERON", "id": "0000992", "url": "http://purl.obolibrary.org/obo/UBERON_0000992" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "1964", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/1964" }, { "id": "10704524", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/10704524" } ], "uniprot_canonical_ac": "P17050-1" } ], "tissue": [ { "tissue": { "name": "ovary", "namespace": "UBERON", "id": "0000992", "url": "http://purl.obolibrary.org/obo/UBERON_0000992" }, "species": { "name": "Homo sapiens", "taxid": 9606, "reference_species": "Homo sapiens [9606]", "common_name": "Human", "glygen_name": "Human" }, "evidence": [ { "id": "1964", "database": "GlyConnect", "url": "https://glyconnect.expasy.org/browser/structures/1964" }, { "id": "10704524", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/10704524" } ] } ], "subsumption": [ { "related_accession": "G02815KT", "relationship": "ancestor" }, { "related_accession": "G06110VR", "relationship": "ancestor" }, { "related_accession": "G10640ZR", "relationship": "ancestor" }, { "related_accession": "G11812HI", "relationship": "ancestor" }, { "related_accession": "G13614FV", "relationship": "ancestor" }, { "related_accession": "G21286VC", "relationship": "ancestor" }, { "related_accession": "G27515YJ", "relationship": "ancestor" }, { "related_accession": "G32104JU", "relationship": "ancestor" }, { "related_accession": "G34650EM", "relationship": "ancestor" }, { "related_accession": "G35972HA", "relationship": "ancestor" }, { "related_accession": "G37605QB", "relationship": "ancestor" }, { "related_accession": "G40044DP", "relationship": "ancestor" }, { "related_accession": "G45841FE", "relationship": "ancestor" }, { "related_accession": "G47961RS", "relationship": "ancestor" }, { "related_accession": "G51623PN", "relationship": "ancestor" }, { "related_accession": "G53809TW", "relationship": "ancestor" }, { "related_accession": "G74524AQ", "relationship": "ancestor" }, { "related_accession": "G78696IJ", "relationship": "ancestor" }, { "related_accession": "G79807LP", "relationship": "ancestor" }, { "related_accession": "G88615UK", "relationship": "ancestor" }, { "related_accession": "G89929IA", "relationship": "ancestor" }, { "related_accession": "G91471TQ", "relationship": "ancestor" }, { "related_accession": "G98704PE", "relationship": "ancestor" }, { "related_accession": "G99555YD", "relationship": "ancestor" }, { "related_accession": "G02815KT", "relationship": "basecomposition" }, { "related_accession": "G89929IA", "relationship": "composition" }, { "related_accession": "G13614FV", "relationship": "subsumedby" }, { "related_accession": "G40044DP", "relationship": "subsumedby" }, { "related_accession": "G53809TW", "relationship": "topology" } ], "names": [], "keywords": [ "fully_determined" ], "glycotree_pathways": [], "dictionary": {}, "biomarkers": [], "section_stats": [ { "table_id": "glycoprotein", "table_stats": [ { "field": "total", "count": 16 }, { "field": "total_sites", "count": 15 } ], "sort_fields": [ "uniprot_canonical_ac", "start_pos", "end_pos", "residue", "protein_name", "gene_name", "tax_id", "tax_name", "tax_common_name" ] }, { "table_id": "expression", "table_stats": [ { "field": "total", "count": 1 }, { "field": "total_sites", "count": 0 } ], "sort_fields": [ "category", "tissue.name", "tissue.namespace", "tissue.id", "tissue.url", "abundance", "uniprot_canonical_ac" ] }, { "table_id": "expression_tissue", "table_stats": [ { "field": "total", "count": 1 }, { "field": "total_sites", "count": 0 } ], "sort_fields": [ "category", "tissue.name", "tissue.namespace", "tissue.id", "tissue.url", "abundance", "uniprot_canonical_ac" ] }, { "table_id": "expression_cell_line", "table_stats": [ { "field": "total", "count": 0 }, { "field": "total_sites", "count": 0 } ], "sort_fields": [ "category", "abundance", "uniprot_canonical_ac" ] }, { "table_id": "publication", "table_stats": [ { "field": "total", "count": 25 } ], "sort_fields": [ "title", "journal", "date", "authors" ] } ] }