{ "glytoucan_ac": "G06239NA", "number_monosaccharides": 3, "number_monosaccharides_suffix": "", "mass": 545.2, "mass_pme": 699.37, "tool_support": { "sandbox": "yes", "pdb": "yes", "gnome": "yes", "gnome_glygen": "yes", "gnome_glygen_nglycans": "no", "gnome_glygen_oglycans": "no", "gnome_glycotree_nglycans": "no", "gnome_glycotree_oglycans": "no" }, "fully_determined": "yes", "missing_score": 0, "glycan_type": "Saccharide", "iupac": "beta-D-GlcpNAc-(1->3)-beta-D-Galp-(1->4)-beta-D-Glcp-(1->", "iupac_compact": "GlcNAcb1-3Galb1-4Glcb", "iupac_condensed": "GlcNAc(b1-3)Gal(b1-4)Glc(b1-", "wurcs": "WURCS=2.0/3,3,2/[a2122h-1b_1-5][a2112h-1b_1-5][a2122h-1b_1-5_2*NCC/3=O]/1-2-3/a4-b1_b3-c1", "glycoct": "RES 1b:b-dglc-HEX-1:5 2b:b-dgal-HEX-1:5 3b:b-dglc-HEX-1:5 4s:n-acetyl LIN 1:1o(4+1)2d 2:2o(3+1)3d 3:3d(2+1)4n", "inchi": "InChI=1S/C20H35NO16/c1-5(25)21-9-12(28)10(26)6(2-22)34-19(9)37-17-11(27)7(3-23)35-20(15(17)31)36-16-8(4-24)33-18(32)14(30)13(16)29/h6-20,22-24,26-32H,2-4H2,1H3,(H,21,25)/t6-,7-,8-,9-,10-,11+,12-,13-,14-,15-,16-,17+,18-,19+,20+/m1/s1", "glycam": "DGlcpNAcb1-3DGalpb1-4DGlcpb1-OH", "smiles_isomeric": "CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1O[C@H]2[C@H]([C@H](O[C@H]([C@@H]2O)O[C@@H]3[C@H](O[C@H]([C@@H]([C@H]3O)O)O)CO)CO)O)CO)O)O", "inchi_key": { "key": "CRTJRHPGCOAOQC-QLFGYAPHSA-N", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/CRTJRHPGCOAOQC-QLFGYAPHSA-N" }, "byonic": "HexNAc(1)Hex(2) % 545.195584305", "gwb": "freeEnd--1b1D-Glc,p--4b1D-Gal,p--3b1D-GlcNAc,p$MONO,Und,0,0,freeEnd", "species": [ { "taxid": 9913, "name": "Bos taurus", "annotation_category": "direct", "evidence": [ { "database": "GlyCosmos", "id": "G06239NA", "url": "https://glycosmos.org/glycans/show/G06239NA" }, { "database": "PubMed", "id": "78708", "url": "https://glygen.org/publication/PubMed/78708" }, { "database": "GlyGen", "id": "GLY_001497", "url": "https://data.glygen.org/GLY_001497" } ], "common_name": "Bovine", "glygen_name": "Bovine", "reference_species": "Bos taurus [9913]" }, { "taxid": 9606, "name": "Homo sapiens", "annotation_category": "direct", "evidence": [ { "database": "DOI", "id": "10.1093/oxfordjournals.jbchem.a131106", "url": "https://glygen.org/publication/DOI/10.1093/oxfordjournals.jbchem.a131106" }, { "database": "GlyCosmos", "id": "G06239NA", "url": "https://glycosmos.org/glycans/show/G06239NA" }, { "database": "PubMed", "id": "1147978", "url": "https://glygen.org/publication/PubMed/1147978" }, { "database": "PubMed", "id": "2250046", "url": "https://glygen.org/publication/PubMed/2250046" }, { "database": "PubMed", "id": "2419336", "url": "https://glygen.org/publication/PubMed/2419336" }, { "database": "PubMed", "id": "3112156", "url": "https://glygen.org/publication/PubMed/3112156" }, { "database": "PubMed", "id": "3121559", "url": "https://glygen.org/publication/PubMed/3121559" }, { "database": "PubMed", "id": "3855933", "url": "https://glygen.org/publication/PubMed/3855933" }, { "database": "PubMed", "id": "60462", "url": "https://glygen.org/publication/PubMed/60462" }, { "database": "PubMed", "id": "7789411", "url": "https://glygen.org/publication/PubMed/7789411" }, { "database": "PubMed", "id": "7811747", "url": "https://glygen.org/publication/PubMed/7811747" }, { "database": "PubMed", "id": "7949652", "url": "https://glygen.org/publication/PubMed/7949652" }, { "database": "PubMed", "id": "8059957", "url": "https://glygen.org/publication/PubMed/8059957" }, { "database": "PubMed", "id": "8452876", "url": "https://glygen.org/publication/PubMed/8452876" }, { "database": "PubMed", "id": "8489255", "url": "https://glygen.org/publication/PubMed/8489255" }, { "database": "GlyGen", "id": "GLY_001408", "url": "https://data.glygen.org/GLY_001408" } ], "common_name": "Human", "glygen_name": "Human", "reference_species": "Homo sapiens [9606]" }, { "taxid": 10090, "name": "Mus musculus", "annotation_category": "direct", "evidence": [ { "database": "GlyCosmos", "id": "G06239NA", "url": "https://glycosmos.org/glycans/show/G06239NA" } ], "common_name": "Mouse", "glygen_name": "Mouse", "reference_species": "Mus musculus [10090]" }, { "taxid": 10114, "name": "Rattus", "annotation_category": "direct", "evidence": [ { "database": "GlyCosmos", "id": "G06239NA", "url": "https://glycosmos.org/glycans/show/G06239NA" } ], "common_name": "Rattus", "glygen_name": "Rattus", "reference_species": "Rattus [10114]" } ], "classification": [ { "type": { "name": "Human Milk Oligosaccharide" }, "subtype": { "name": "Other", "url": "" } } ], "enzyme": [ { "uniprot_canonical_ac": "G5E897-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G06239NA", "protein_name": "Protein O-glucosyltransferase 3", "gene": "Poglut3", "gene_link": "https://www.uniprot.org/uniprotkb/G5E897", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G06239NA", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G06239NA" } ] }, { "uniprot_canonical_ac": "Q6UW63-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G06239NA", "protein_name": "Protein O-glucosyltransferase 2", "gene": "POGLUT2", "gene_link": "https://www.uniprot.org/uniprotkb/Q6UW63", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G06239NA", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G06239NA" } ] }, { "uniprot_canonical_ac": "Q7Z4H8-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G06239NA", "protein_name": "Protein O-glucosyltransferase 3", "gene": "POGLUT3", "gene_link": "https://www.uniprot.org/uniprotkb/Q7Z4H8", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G06239NA", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G06239NA" } ] }, { "uniprot_canonical_ac": "Q8BYB9-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G06239NA", "protein_name": "Protein O-glucosyltransferase 1", "gene": "Poglut1", "gene_link": "https://www.uniprot.org/uniprotkb/Q8BYB9", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G06239NA", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G06239NA" } ] }, { "uniprot_canonical_ac": "Q8NBL1-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G06239NA", "protein_name": "Protein O-glucosyltransferase 1", "gene": "POGLUT1", "gene_link": "https://www.uniprot.org/uniprotkb/Q8NBL1", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G06239NA", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G06239NA" } ] }, { "uniprot_canonical_ac": "Q9JHP7-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G06239NA", "protein_name": "Protein O-glucosyltransferase 2", "gene": "Poglut2", "gene_link": "https://www.uniprot.org/uniprotkb/Q9JHP7", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G06239NA", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G06239NA" } ] } ], "crossref": [ { "id": "10230777", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10230777", "database": "PubChem Compound", "categories": [ "Chemical" ] }, { "id": "252280989", "url": "https://pubchem.ncbi.nlm.nih.gov/substance/252280989", "database": "PubChem Substance", "categories": [ "Chemical" ] }, { "id": "4ee5", "url": "https://www.rcsb.org/structure/4ee5", "database": "PDB", "categories": [ "3D Structure" ] }, { "id": "G00036", "url": "https://www.genome.jp/dbget-bin/www_bget?gl:G00036", "database": "KEGG Glycan", "categories": [ "Enzyme and Pathway" ] }, { "id": "12302", "url": "", "database": "Glycosciences.de", "categories": [ "Discontinued" ] }, { "id": "14651", "url": "", "database": "Glycosciences.de", "categories": [ "Discontinued" ] }, { "id": "16564", "url": "", "database": "Glycosciences.de", "categories": [ "Discontinued" ] }, { "id": "2376", "url": "", "database": "Glycosciences.de", "categories": [ "Discontinued" ] }, { "id": "754", "url": "", "database": "Glycosciences.de", "categories": [ "Discontinued" ] }, { "id": "carbGlipid_20412_D000", "url": "", "database": "CFG", "categories": [ "Discontinued" ] }, { "id": "carbSynthe_0032_D000", "url": "", "database": "CFG", "categories": [ "Discontinued" ] }, { "id": "carbSynthe_0179_D000", "url": "", "database": "CFG", "categories": [ "Discontinued" ] }, { "id": "carbSynthe_0693_D000", "url": "", "database": "CFG", "categories": [ "Discontinued" ] }, { "id": "12048", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+12048", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "12300", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+12300", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "14424", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+14424", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "14494", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+14494", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "16241", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+16241", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "16343", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+16343", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "16355", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+16355", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "16404", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+16404", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "16461", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+16461", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "17108", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+17108", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "17496", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+17496", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "17710", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+17710", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "18449", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+18449", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "18454", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+18454", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "18481", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+18481", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "18634", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+18634", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "20338", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+20338", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "21063", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+21063", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "21304", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+21304", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "21613", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+21613", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "21625", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+21625", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "21920", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+21920", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "22106", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+22106", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "23023", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+23023", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "23891", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+23891", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "23938", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+23938", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "24649", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+24649", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "25307", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+25307", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "25475", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+25475", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "25519", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+25519", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "25846", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+25846", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "27471", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+27471", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "27710", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+27710", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "31584", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+31584", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "31619", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+31619", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "32049", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+32049", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "333", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+333", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "335", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+335", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "33882", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+33882", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "35360", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+35360", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "35738", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+35738", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "36112", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+36112", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "36164", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+36164", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "37106", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+37106", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "37213", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+37213", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "4047", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+4047", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "41770", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+41770", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "41778", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+41778", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "41904", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+41904", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "44079", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+44079", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "44599", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+44599", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "4487", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+4487", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "45291", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+45291", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "46803", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+46803", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "46812", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+46812", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "47188", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+47188", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "47191", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+47191", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "47636", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+47636", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "48133", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+48133", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "48547", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+48547", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "49329", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+49329", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "5294", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+5294", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "6232", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+6232", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "8765", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+8765", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "1762", "url": "http://csdb.glycoscience.ru/database/core/search_id.php?mode=record&id_list=1762", "database": "BCSDB", "categories": [ "Glycomics" ] }, { "id": "25819", "url": "http://csdb.glycoscience.ru/database/core/search_id.php?mode=record&id_list=25819", "database": "BCSDB", "categories": [ "Glycomics" ] }, { "id": "7247", "url": "http://csdb.glycoscience.ru/database/core/search_id.php?mode=record&id_list=7247", "database": "BCSDB", "categories": [ "Glycomics" ] }, { "id": "61758", "url": "https://www.ebi.ac.uk/chebi/searchId.do?chebiId=61758", "database": "ChEBI", "categories": [] }, { "id": "G06239NA", "url": "https://glytoucan.org/Structures/Glycans/G06239NA", "database": "GlyTouCan", "categories": [ "Glycomics" ] }, { "id": "G06239NA", "url": "https://sandbox.glyomics.org/explore.html?G06239NA", "database": "SandBox", "categories": [ "Enzyme and Pathway" ] }, { "id": "G06239NA", "url": "https://gnome.glyomics.org/restrictions/GlyGen.StructureBrowser.html?focus=G06239NA", "database": "GNOme", "categories": [ "Glycomics", "Ontology and Dictionary" ] }, { "id": "G06239NA", "url": "https://glycosmos.org/glycans/show/G06239NA", "database": "GlyCosmos", "categories": [ "Glycoproteomics", "Glycomics" ] }, { "id": "GSD000117", "url": "https://wiki.glygen.org/Glycan_structure_dictionary#GSD000117", "database": "Glycan Structure Dictionary", "categories": [ "Ontology and Dictionary" ] }, { "id": "9192985GAR", "url": "https://glygen.ccrc.uga.edu/ggarray/glycanDetail/9192985GAR", "database": "Glycan Array Data Repository", "categories": [] }, { "id": "G06239NA", "url": "https://glycoshape.org/glycan?glytoucan=G06239NA", "database": "GlycoShape", "categories": [ "3D Structure" ] } ], "glycoprotein": [], "publication": [ { "title": "Blood group i and I activities of `lacto-N-norhexaosylceramide` and its analogues: the structural requirements for i-specificities.", "journal": "Biochemical and biophysical research communications", "date": "1978", "authors": "Niemann H, Watanabe K, Hakomori S", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G06239NA", "url": "https://glytoucan.org/Structures/Glycans/G06239NA" } ], "reference": [ { "type": "PubMed", "id": "78708", "url": "https://glygen.org/publication/PubMed/78708" } ] }, { "title": "Sequential changes in glycolipid expression during human B cell differentiation: enzymatic bases.", "journal": "Biochimica et biophysica acta", "date": "1995-01-03", "authors": "Taga S, T\u00e9taud C, Mangeney M, Tursz T, Wiels J", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G06239NA", "url": "https://glytoucan.org/Structures/Glycans/G06239NA" } ], "reference": [ { "type": "PubMed", "id": "7811747", "url": "https://glygen.org/publication/PubMed/7811747" } ] }, { "title": "Age-related changes in ganglioside composition in human lens.", "journal": "Experimental eye research", "date": "1995-03", "authors": "Ogiso M, Komoto M, Okinaga T, Koyota S, Hoshi M", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G06239NA", "url": "https://glytoucan.org/Structures/Glycans/G06239NA" } ], "reference": [ { "type": "PubMed", "id": "7789411", "url": "https://glygen.org/publication/PubMed/7789411" } ] }, { "title": "Beta 1-3-N-acetylglucosaminyltransferase in human leukocytes: properties and role in regulating neolacto glycosphingolipid biosynthesis.", "journal": "Archives of biochemistry and biophysics", "date": "1993-05-15", "authors": "Stults C L, Macher B A", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G06239NA", "url": "https://glytoucan.org/Structures/Glycans/G06239NA" } ], "reference": [ { "type": "PubMed", "id": "8489255", "url": "https://glygen.org/publication/PubMed/8489255" } ] }, { "title": "Alteration of lacto-series glycolipid glycosyltransferase activities in human colonic adenocarcinoma DLD-1 cells after culture in N,N-dimethylformamide-containing medium.", "journal": "Journal of cellular biochemistry", "date": "1990-10", "authors": "Holmes E H, Greene T G", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G06239NA", "url": "https://glytoucan.org/Structures/Glycans/G06239NA" } ], "reference": [ { "type": "PubMed", "id": "2250046", "url": "https://glygen.org/publication/PubMed/2250046" } ] }, { "title": "Structural characterization of intermediates in the biosynthetic pathway of neolacto glycosphingolipids: differential expression in human leukaemia cells.", "journal": "Glycobiology", "date": "1994-06", "authors": "Hu J, Stults C L, Holmes E H, Macher B A", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G06239NA", "url": "https://glytoucan.org/Structures/Glycans/G06239NA" } ], "reference": [ { "type": "PubMed", "id": "7949652", "url": "https://glygen.org/publication/PubMed/7949652" } ] }, { "title": "Accumulation of glycolipids containing N-acetylglucosamine in erythrocyte stroma of patients with congenital dyserythropoietic anemia type II (HEMPAS).", "journal": "Biochemical and biophysical research communications", "date": "1975-07-08", "authors": "Joseph K C, Gockerman J P", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G06239NA", "url": "https://glytoucan.org/Structures/Glycans/G06239NA" } ], "reference": [ { "type": "PubMed", "id": "1147978", "url": "https://glygen.org/publication/PubMed/1147978" } ] }, { "title": "Comparison of glycolipids in various human leukemia cells.", "journal": "Japanese journal of cancer research : Gann", "date": "1987-11", "authors": "Kyogashima M, Uemura K, Taketomi T", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G06239NA", "url": "https://glytoucan.org/Structures/Glycans/G06239NA" } ], "reference": [ { "type": "PubMed", "id": "3121559", "url": "https://glygen.org/publication/PubMed/3121559" } ] }, { "title": "Biosynthesis of the sialyl-Lex determinant carried by type 2 chain glycosphingolipids (IV3NeuAcIII3FucnLc4, VI3NeuAcV3FucnLc6, and VI3NeuAcIII3V3Fuc2nLc6) in human lung carcinoma PC9 cells.", "journal": "The Journal of biological chemistry", "date": "1986-03-15", "authors": "Holmes E H, Ostrander G K, Hakomori S", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G06239NA", "url": "https://glytoucan.org/Structures/Glycans/G06239NA" } ], "reference": [ { "type": "PubMed", "id": "2419336", "url": "https://glygen.org/publication/PubMed/2419336" } ] }, { "title": "Glycosphingolipid patterns in human promyelocytic HL-60 leukemia cells susceptible or resistant to differentiation induction by phorbol 12-myristate 13-acetate.", "journal": "Biochimica et biophysica acta", "date": "1993-03-10", "authors": "Kiguchi K, Henning-Chubb C, Huberman E", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G06239NA", "url": "https://glytoucan.org/Structures/Glycans/G06239NA" } ], "reference": [ { "type": "PubMed", "id": "8452876", "url": "https://glygen.org/publication/PubMed/8452876" } ] }, { "title": "Analysis of glycosphingolipid glycosyltransferase products on TLC plates by combined storage phosphor and immunostaining techniques.", "journal": "Analytical biochemistry", "date": "1994-05-15", "authors": "Stults C L, Sullivan M T, Macher B A, Johnston R F, Stack R J", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G06239NA", "url": "https://glytoucan.org/Structures/Glycans/G06239NA" } ], "reference": [ { "type": "PubMed", "id": "8059957", "url": "https://glygen.org/publication/PubMed/8059957" } ] }, { "title": "Oncofetal expression of Lex carbohydrate antigens in human colonic adenocarcinomas. Regulation through type 2 core chain synthesis rather than fucosylation.", "journal": "The Journal of biological chemistry", "date": "1987", "authors": "Holmes EH, Ostrander GK, Clausen H, Graem N", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G06239NA", "url": "https://glytoucan.org/Structures/Glycans/G06239NA" } ], "reference": [ { "type": "PubMed", "id": "3112156", "url": "https://glygen.org/publication/PubMed/3112156" } ] }, { "title": "Glycolipid antigens of human polymorphonuclear neutrophils and the inducible HL-60 myeloid leukemia line.", "journal": "Journal of immunology (Baltimore, Md. : 1950)", "date": "1985-04", "authors": "Symington F W, Hedges D L, Hakomori S", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G06239NA", "url": "https://glytoucan.org/Structures/Glycans/G06239NA" } ], "reference": [ { "type": "PubMed", "id": "3855933", "url": "https://glygen.org/publication/PubMed/3855933" } ] }, { "title": "Status of blood group carbohydrate chains in ontogenesis and in oncogenesis.", "journal": "The Journal of experimental medicine", "date": "1976-09-01", "authors": "Watanabe K, Hakomori S I", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G06239NA", "url": "https://glytoucan.org/Structures/Glycans/G06239NA" } ], "reference": [ { "type": "PubMed", "id": "60462", "url": "https://glygen.org/publication/PubMed/60462" } ] }, { "title": "Identification of the smallest structure capable of evoking opsonophagocytic antibodies against Streptococcus pneumoniae type 14.", "journal": "Infection and immunity", "date": "2008", "authors": "Safari D, Dekker HA, Joosten JA, Michalik D, de Souza AC, Adamo R, Lahmann M, Sundgren A, Oscarson S, Kamerling JP, Snippe H", "evidence": [ { "database": "GlyTouCan", "id": "G06239NA", "url": "https://glytoucan.org/Structures/Glycans/G06239NA" } ], "reference": [ { "type": "PubMed", "id": "18678667", "url": "https://glygen.org/publication/PubMed/18678667" } ] }, { "title": "Neisseria gonorrhoeae that infect men have lipooligosaccharides with terminal N-acetyllactosamine repeats.", "journal": "The Journal of biological chemistry", "date": "1999", "authors": "John CM, Schneider H, Griffiss JM", "evidence": [ { "database": "GlyTouCan", "id": "G06239NA", "url": "https://glytoucan.org/Structures/Glycans/G06239NA" } ], "reference": [ { "type": "PubMed", "id": "9873046", "url": "https://glygen.org/publication/PubMed/9873046" } ] }, { "title": "Fine specificity of a monoclonal anti-testicular cell antibody for glycolipids with terminal N-acetyl-D-glucosamine structure.", "journal": "Molecular immunology", "date": "1984", "authors": "Symington FW, Fenderson BA, Hakomori S", "evidence": [ { "database": "Glycan Motif", "id": "GGM.000067", "url": "https://glycomotif.glyomics.org/glycomotif/GGM.000067" } ], "reference": [ { "type": "PubMed", "id": "6209560", "url": "https://glygen.org/publication/PubMed/6209560" } ] }, { "title": "The repertoire of glycan determinants in the human glycome.", "journal": "Molecular bioSystems", "date": "2009", "authors": "Cummings RD", "evidence": [ { "database": "Glycan Motif", "id": "GGM.000067", "url": "https://glycomotif.glyomics.org/glycomotif/GGM.000067" } ], "reference": [ { "type": "PubMed", "id": "19756298", "url": "https://glygen.org/publication/PubMed/19756298" } ] }, { "title": "Structures Common to Different Glycans", "journal": "missing tag=JT", "date": "2015", "authors": "Stanley P, Cummings RD", "evidence": [ { "database": "Glycan Motif", "id": "GGM.000067", "url": "https://glycomotif.glyomics.org/glycomotif/GGM.000067" } ], "reference": [ { "type": "PubMed", "id": "28876849", "url": "https://glygen.org/publication/PubMed/28876849" } ] } ], "residues": [ { "id": "OC3", "name": "O-glycan_core_x-D-Glcx_C3", "attachedby": "rxn.G5E897-1", "detachedby": "", "parentid": "0" }, { "id": "OC3", "name": "O-glycan_core_x-D-Glcx_C3", "attachedby": "rxn.Q6UW63-1", "detachedby": "", "parentid": "0" }, { "id": "OC3", "name": "O-glycan_core_x-D-Glcx_C3", "attachedby": "rxn.Q7Z4H8-1", "detachedby": "", "parentid": "0" }, { "id": "OC3", "name": "O-glycan_core_x-D-Glcx_C3", "attachedby": "rxn.Q8BYB9-1", "detachedby": "", "parentid": "0" }, { "id": "OC3", "name": "O-glycan_core_x-D-Glcx_C3", "attachedby": "rxn.Q8NBL1-1", "detachedby": "", "parentid": "0" }, { "id": "OC3", "name": "O-glycan_core_x-D-Glcx_C3", "attachedby": "rxn.Q9JHP7-1", "detachedby": "", "parentid": "0" } ], "composition": [ { "name": "6-Deoxy-Hexose", "residue": "dhex", "count": 0, "cid": "840", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840" }, { "name": "Hexose", "residue": "hex", "count": 2, "cid": "206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206" }, { "name": "N-Acetylhexosamine", "residue": "hexnac", "count": 1, "cid": "899", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899" }, { "name": "Hexuronic Acid", "residue": "hexa", "count": 0, "cid": "610", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610" }, { "name": "2-Amino-2-Deoxy-Hexose", "residue": "hexn", "count": 0, "cid": "739", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739" }, { "name": "N-Acetyl-Neuraminic Acid", "residue": "neuac", "count": 0, "cid": "439197", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197" }, { "name": "N-Glycolyl-Neuraminic Acid", "residue": "neugc", "count": 0, "cid": "440001", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001" }, { "name": "Phosphate", "residue": "p", "count": 0, "cid": "1061", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061" }, { "name": "Pentose", "residue": "pent", "count": 0, "cid": "229", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229" }, { "name": "Sulfate", "residue": "s", "count": 0, "cid": "1117", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117" }, { "name": "Other", "residue": "other", "count": 0 } ], "composition_expanded": [ { "name": "Alditol", "residue": "aldi", "count": 0 }, { "name": "6-Deoxy-Hexose", "residue": "dhex", "count": 0, "cid": "840", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840" }, { "name": "6-Deoxy-Hexitol", "residue": "dhex+aldi", "count": 0 }, { "name": "L-Fucose", "residue": "fuc", "count": 0, "cid": "17106", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/17106" }, { "name": "L-Fucitol", "residue": "fuc+aldi", "count": 0, "cid": "445724", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/445724" }, { "name": "D-Galactose", "residue": "gal", "count": 1, "cid": "6036", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6036" }, { "name": "D-Galactitol", "residue": "gal+aldi", "count": 0, "cid": "11850", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11850" }, { "name": "N-Acetyl-D-galactosamine", "residue": "galnac", "count": 0, "cid": "35717", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/35717" }, { "name": "N-Acetylgalactosaminitol", "residue": "galnac+aldi", "count": 0, "cid": "165880", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165880" }, { "name": "D-Galacturonic Acid", "residue": "gala", "count": 0, "cid": "439215", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439215" }, { "name": "D-Glucose", "residue": "glc", "count": 1, "cid": "5793", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5793" }, { "name": "D-Glucitol", "residue": "glc+aldi", "count": 0, "cid": "5780", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5780" }, { "name": "D-Glucuronic acid", "residue": "glca", "count": 0, "cid": "94715", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/94715" }, { "name": "D-Glucosamine", "residue": "glcn", "count": 0, "cid": "439213", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439213" }, { "name": "N-Acetyl-D-Glucosamine", "residue": "glcnac", "count": 1, "cid": "439174", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439174" }, { "name": "N-Acetyl-D-glucosaminitol", "residue": "glcnac+aldi", "count": 0, "cid": "165206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165206" }, { "name": "Hexose", "residue": "hex", "count": 2, "cid": "206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206" }, { "name": "N-Acetylhexosamine", "residue": "hexnac", "count": 1, "cid": "899", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899" }, { "name": "Hexuronic Acid", "residue": "hexa", "count": 0, "cid": "610", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610" }, { "name": "2-Amino-2-Deoxy-Hexose", "residue": "hexn", "count": 0, "cid": "739", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739" }, { "name": "Hexitol", "residue": "hex+aldi", "count": 0, "cid": "453", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/453" }, { "name": "N-Acetylhexosaminitol", "residue": "hexnac+aldi", "count": 0 }, { "name": "L-Iduronic acid", "residue": "idoa", "count": 0, "cid": "441039", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/441039" }, { "name": "D-Mannose", "residue": "man", "count": 0, "cid": "18950", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18950" }, { "name": "D-Mannitol", "residue": "man+aldi", "count": 0, "cid": "6251", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6251" }, { "name": "N-Acetyl-D-mannosamine", "residue": "mannac", "count": 0, "cid": "439281", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439281" }, { "name": "Methyl", "residue": "me", "count": 0 }, { "name": "N-Acetyl-Neuraminic Acid", "residue": "neuac", "count": 0, "cid": "439197", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197" }, { "name": "N-Glycolyl-Neuraminic Acid", "residue": "neugc", "count": 0, "cid": "440001", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001" }, { "name": "Phosphate", "residue": "p", "count": 0, "cid": "1061", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061" }, { "name": "Pentose", "residue": "pent", "count": 0, "cid": "229", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229" }, { "name": "Sulfate", "residue": "s", "count": 0, "cid": "1117", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117" }, { "name": "Sialic acid", "residue": "sia", "count": 0 }, { "name": "Other", "residue": "other", "count": 0 }, { "name": "Floating substituent", "residue": "x", "count": 0 }, { "name": "D-Xylose", "residue": "xyl", "count": 0, "cid": "135191", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135191" }, { "name": "Ketodeoxynononic acid", "residue": "kdn", "count": 0, "cid": "13991616", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13991616" } ], "motifs": [ { "id": "GGM.000067", "name": "Lactotriaosylceramide", "synonym": "Lc3; Lc_3", "keywords": "Glycolipid" } ], "interactions": [], "expression": [ { "category": "tissue", "tissue": { "name": "colon", "namespace": "UBERON", "id": "0001155", "url": "http://purl.obolibrary.org/obo/UBERON_0001155" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "2250046", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/2250046" }, { "id": "3112156", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/3112156" } ] }, { "category": "tissue", "tissue": { "name": "", "namespace": "UBERON", "id": "0003891", "url": "http://purl.obolibrary.org/obo/UBERON_0003891" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "1147978", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/1147978" } ] }, { "category": "tissue", "tissue": { "name": "lung", "namespace": "UBERON", "id": "0002048", "url": "http://purl.obolibrary.org/obo/UBERON_0002048" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "2419336", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/2419336" } ] } ], "tissue": [ { "tissue": { "name": "colon", "namespace": "UBERON", "id": "0001155", "url": "http://purl.obolibrary.org/obo/UBERON_0001155" }, "species": { "name": "Homo sapiens", "taxid": 9606, "reference_species": "Homo sapiens [9606]", "common_name": "Human", "glygen_name": "Human" }, "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "2250046", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/2250046" }, { "id": "3112156", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/3112156" } ] }, { "tissue": { "name": "", "namespace": "UBERON", "id": "0003891", "url": "http://purl.obolibrary.org/obo/UBERON_0003891" }, "species": { "name": "Homo sapiens", "taxid": 9606, "reference_species": "Homo sapiens [9606]", "common_name": "Human", "glygen_name": "Human" }, "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "1147978", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/1147978" } ] }, { "tissue": { "name": "lung", "namespace": "UBERON", "id": "0002048", "url": "http://purl.obolibrary.org/obo/UBERON_0002048" }, "species": { "name": "Homo sapiens", "taxid": 9606, "reference_species": "Homo sapiens [9606]", "common_name": "Human", "glygen_name": "Human" }, "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "2419336", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/2419336" } ] } ], "subsumption": [ { "related_accession": "G05394UY", "relationship": "ancestor" }, { "related_accession": "G09336GJ", "relationship": "ancestor" }, { "related_accession": "G11645JA", "relationship": "ancestor" }, { "related_accession": "G17468PU", "relationship": "ancestor" }, { "related_accession": "G27221EC", "relationship": "ancestor" }, { "related_accession": "G27247FZ", "relationship": "ancestor" }, { "related_accession": "G33177YW", "relationship": "ancestor" }, { "related_accession": "G46831QF", "relationship": "ancestor" }, { "related_accession": "G48980HE", "relationship": "ancestor" }, { "related_accession": "G52966FX", "relationship": "ancestor" }, { "related_accession": "G53371JK", "relationship": "ancestor" }, { "related_accession": "G68472YB", "relationship": "ancestor" }, { "related_accession": "G75660AY", "relationship": "ancestor" }, { "related_accession": "G79382TI", "relationship": "ancestor" }, { "related_accession": "G82056CH", "relationship": "ancestor" }, { "related_accession": "G87532JE", "relationship": "ancestor" }, { "related_accession": "G87727XV", "relationship": "ancestor" }, { "related_accession": "G92917CM", "relationship": "ancestor" }, { "related_accession": "G05394UY", "relationship": "basecomposition" }, { "related_accession": "G27221EC", "relationship": "composition" }, { "related_accession": "G87727XV", "relationship": "subsumedby" }, { "related_accession": "G17468PU", "relationship": "topology" } ], "names": [ { "name": "Lactotriaosylceramide", "domain": "Semantic Name" }, { "name": "Lactotriaosylceramide", "domain": "motifname" }, { "name": "Lc3", "domain": "motifsynonym" }, { "name": " Lc_3", "domain": "motifsynonym" } ], "keywords": [ "fully_determined" ], "glycotree_pathways": [], "dictionary": { "term": "Lactotriaosylceramide", "term_in_sentence": "The results showed that AML patients had higher expression of the GSL lactotriaosylceramide (Lc3), GM3 and neolactotetraosylceramide (nLc4) in their bone marrow than did the healthy donors (P < 0.05), especially the M1 subtype of AML.[PMID:22411838]", "publication": "22411838|20693232|26104834|27435676|26405105|32340400|25241919|23404501|32452379|2960671|272643|27711049|33202844|4060695|27638607|20547865|2277039|6238026|8448388|8489255|9363437|11836161|6892925|1551117|6811267|8059935|7861954|11283017|8514762|1291049|3805024|10816509|12393713|6417117|11054095|8781973|1692829", "definition": "A linear amino trisaccharide consisting of \u03b2-D-glucose at the reducing end having an N-acetyl-\u03b2-D-glucosaminyl-(1\u21923)-\u03b2-D-galactosyl group attached at the 4-position.[CHEBI:61758]", "term_xref": "GTC:G06239NA|GlycoMotif:GGM.000067|MeSH:C025575|CID:10230777|CHEBI:61758|SugarBind_Ligand:20", "synonymns": [ "Lc3", "Lc(3)Cer", "Lc_3" ], "function": "acute myeloid leukemia-associated glycosphingolipids lactotriaosylceramide, GM3 and neolactotetraosylceramide are possibly involved in initiation and differentiation of acute myeloid leukemia.[PMID:22411838]", "disease_associations": "Pharyngitis[SugarBind_Ligand:20]|Tracheobronchitis[SugarBind_Ligand:20]|Gonorrhea[SugarBind_Ligand:20]|Actinomycosis[SugarBind_Ligand:20]|Diarrhea[SugarBind_Ligand:20]", "wikipedia": "", "essentials_of_glycobiology": "Chapter 14", "evidence": [ { "id": "GSD000117", "url": "https://wiki.glygen.org/Glycan_structure_dictionary#GSD000117", "database": "Glycan Structure Dictionary" } ] }, "biomarkers": [], "section_stats": [ { "table_id": "glycoprotein", "table_stats": [ { "field": "total", "count": 0 }, { "field": "total_sites", "count": 0 } ], "sort_fields": [] }, { "table_id": "expression", "table_stats": [ { "field": "total", "count": 3 }, { "field": "total_sites", "count": 0 } ], "sort_fields": [ "category", "tissue.name", "tissue.namespace", "tissue.id", "tissue.url", "abundance" ] }, { "table_id": "expression_tissue", "table_stats": [ { "field": "total", "count": 3 }, { "field": "total_sites", "count": 0 } ], "sort_fields": [ "category", "tissue.name", "tissue.namespace", "tissue.id", "tissue.url", "abundance" ] }, { "table_id": "expression_cell_line", "table_stats": [ { "field": "total", "count": 0 }, { "field": "total_sites", "count": 0 } ], "sort_fields": [ "category", "abundance" ] }, { "table_id": "publication", "table_stats": [ { "field": "total", "count": 19 } ], "sort_fields": [ "title", "journal", "date", "authors" ] } ] }