{ "glytoucan_ac": "G03067VG", "number_monosaccharides": 7, "number_monosaccharides_suffix": "", "mass": 1363.48, "mass_pme": 1713.87, "tool_support": { "sandbox": "yes", "pdb": "yes", "gnome": "yes", "gnome_glygen": "yes", "gnome_glygen_nglycans": "no", "gnome_glygen_oglycans": "no", "gnome_glycotree_nglycans": "no", "gnome_glycotree_oglycans": "no" }, "fully_determined": "yes", "missing_score": 0, "glycan_type": "Saccharide", "iupac": "alpha-D-Neup5Ac-(2->3)-beta-D-Galp-(1->4)-beta-D-GlcpNAc-(1->3)-beta-D-Galp-(1->4)-beta-D-GlcpNAc-(1->3)-beta-D-Galp-(1->4)-beta-D-Glcp-(1->", "iupac_compact": "NeuAca2-3Galb1-4GlcNAcb1-3Galb1-4GlcNAcb1-3Galb1-4Glcb", "iupac_condensed": "Neu5Ac(a2-3)Gal(b1-4)GlcNAc(b1-3)Gal(b1-4)GlcNAc(b1-3)Gal(b1-4)Glc(b1-", "wurcs": "WURCS=2.0/4,7,6/[a2122h-1b_1-5][a2112h-1b_1-5][a2122h-1b_1-5_2*NCC/3=O][Aad21122h-2a_2-6_5*NCC/3=O]/1-2-3-2-3-2-4/a4-b1_b3-c1_c4-d1_d3-e1_e4-f1_f3-g2", "glycoct": "RES 1b:b-dglc-HEX-1:5 2b:b-dgal-HEX-1:5 3b:b-dglc-HEX-1:5 4s:n-acetyl 5b:b-dgal-HEX-1:5 6b:b-dglc-HEX-1:5 7s:n-acetyl 8b:b-dgal-HEX-1:5 9b:a-dgro-dgal-NON-2:6|1:a|2:keto|3:d 10s:n-acetyl LIN 1:1o(4+1)2d 2:2o(3+1)3d 3:3d(2+1)4n 4:3o(4+1)5d 5:5o(3+1)6d 6:6d(2+1)7n 7:6o(4+1)8d 8:8o(3+2)9d 9:9d(5+1)10n", "inchi": "InChI=1S/C51H85N3O39/c1-12(62)52-23-15(65)4-51(50(79)80,92-40(23)26(67)16(66)5-55)93-43-29(70)19(8-58)84-49(36(43)77)88-38-22(11-61)86-46(25(31(38)72)54-14(3)64)90-41-27(68)17(6-56)82-47(34(41)75)87-37-21(10-60)85-45(24(30(37)71)53-13(2)63)91-42-28(69)18(7-57)83-48(35(42)76)89-39-20(9-59)81-44(78)33(74)32(39)73/h15-49,55-61,65-78H,4-11H2,1-3H3,(H,52,62)(H,53,63)(H,54,64)(H,79,80)/t15-,16+,17+,18+,19+,20+,21+,22+,23+,24+,25+,26+,27-,28-,29-,30+,31+,32+,33+,34+,35+,36+,37+,38+,39+,40+,41-,42-,43-,44+,45-,46-,47-,48-,49-,51-/m0/s1", "glycam": "DNeup5Aca2-3DGalpb1-4DGlcpNAcb1-3DGalpb1-4DGlcpNAcb1-3DGalpb1-4DGlcpb1-OH", "smiles_isomeric": "CC(=O)N[C@@H]1[C@H](C[C@@](O[C@H]1[C@@H]([C@@H](CO)O)O)(C(=O)O)O[C@H]2[C@H]([C@H](O[C@H]([C@@H]2O)O[C@@H]3[C@H](O[C@H]([C@@H]([C@H]3O)NC(=O)C)O[C@H]4[C@H]([C@H](O[C@H]([C@@H]4O)O[C@@H]5[C@H](O[C@H]([C@@H]([C@H]5O)NC(=O)C)O[C@H]6[C@H]([C@H](O[C@H]([C@@H]6O)O[C@@H]7[C@H](O[C@H]([C@@H]([C@H]7O)O)O)CO)CO)O)CO)CO)O)CO)CO)O)O", "inchi_key": { "key": "LCBUWAPXQBFZFM-WWNXOEQQSA-N", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/LCBUWAPXQBFZFM-WWNXOEQQSA-N" }, "byonic": "HexNAc(2)Hex(4)NeuAc(1) % 1363.47602054", "gwb": "freeEnd--1b1D-Glc,p--4b1D-Gal,p--3b1D-GlcNAc,p--4b1D-Gal,p--3b1D-GlcNAc,p--4b1D-Gal,p--3a2D-NeuAc,p$MONO,Und,0,0,freeEnd", "species": [ { "taxid": 9913, "name": "Bos taurus", "annotation_category": "direct", "evidence": [ { "database": "GlyCosmos", "id": "G03067VG", "url": "https://glycosmos.org/glycans/show/G03067VG" }, { "database": "PubMed", "id": "649619", "url": "https://glygen.org/publication/PubMed/649619" }, { "database": "PubMed", "id": "8027181", "url": "https://glygen.org/publication/PubMed/8027181" }, { "database": "GlyGen", "id": "GLY_001497", "url": "https://data.glygen.org/GLY_001497" } ], "common_name": "Bovine", "glygen_name": "Bovine", "reference_species": "Bos taurus [9913]" }, { "taxid": 10029, "name": "Cricetulus griseus", "annotation_category": "direct", "evidence": [ { "database": "GlyCosmos", "id": "G03067VG", "url": "https://glycosmos.org/glycans/show/G03067VG" }, { "database": "PubMed", "id": "2890642", "url": "https://glygen.org/publication/PubMed/2890642" }, { "database": "GlyGen", "id": "GLY_001484", "url": "https://data.glygen.org/GLY_001484" } ], "common_name": "Chinese hamster", "glygen_name": "Hamster", "reference_species": "Cricetulus griseus [10029]" }, { "taxid": 9606, "name": "Homo sapiens", "annotation_category": "direct", "evidence": [ { "database": "DOI", "id": "10.1021/bi951600r", "url": "https://glygen.org/publication/DOI/10.1021/bi951600r" }, { "database": "GlyCosmos", "id": "G03067VG", "url": "https://glycosmos.org/glycans/show/G03067VG" }, { "database": "PubMed", "id": "1998961", "url": "https://glygen.org/publication/PubMed/1998961" }, { "database": "PubMed", "id": "2016260", "url": "https://glygen.org/publication/PubMed/2016260" }, { "database": "PubMed", "id": "2419336", "url": "https://glygen.org/publication/PubMed/2419336" }, { "database": "PubMed", "id": "3112156", "url": "https://glygen.org/publication/PubMed/3112156" }, { "database": "PubMed", "id": "3121559", "url": "https://glygen.org/publication/PubMed/3121559" }, { "database": "PubMed", "id": "3374272", "url": "https://glygen.org/publication/PubMed/3374272" }, { "database": "PubMed", "id": "3855933", "url": "https://glygen.org/publication/PubMed/3855933" }, { "database": "PubMed", "id": "3978112", "url": "https://glygen.org/publication/PubMed/3978112" }, { "database": "PubMed", "id": "4853255", "url": "https://glygen.org/publication/PubMed/4853255" }, { "database": "PubMed", "id": "6203982", "url": "https://glygen.org/publication/PubMed/6203982" }, { "database": "PubMed", "id": "7696851", "url": "https://glygen.org/publication/PubMed/7696851" }, { "database": "PubMed", "id": "7829233", "url": "https://glygen.org/publication/PubMed/7829233" }, { "database": "PubMed", "id": "7918590", "url": "https://glygen.org/publication/PubMed/7918590" }, { "database": "PubMed", "id": "7952086", "url": "https://glygen.org/publication/PubMed/7952086" }, { "database": "PubMed", "id": "8318834", "url": "https://glygen.org/publication/PubMed/8318834" }, { "database": "PubMed", "id": "8395268", "url": "https://glygen.org/publication/PubMed/8395268" }, { "database": "PubMed", "id": "8449830", "url": "https://glygen.org/publication/PubMed/8449830" }, { "database": "GlyGen", "id": "GLY_001408", "url": "https://data.glygen.org/GLY_001408" } ], "common_name": "Human", "glygen_name": "Human", "reference_species": "Homo sapiens [9606]" }, { "taxid": 10090, "name": "Mus musculus", "annotation_category": "direct", "evidence": [ { "database": "GlyCosmos", "id": "G03067VG", "url": "https://glycosmos.org/glycans/show/G03067VG" } ], "common_name": "Mouse", "glygen_name": "Mouse", "reference_species": "Mus musculus [10090]" }, { "taxid": 9823, "name": "Sus scrofa", "annotation_category": "direct", "evidence": [ { "database": "GlyCosmos", "id": "G03067VG", "url": "https://glycosmos.org/glycans/show/G03067VG" }, { "database": "PubMed", "id": "6860704", "url": "https://glygen.org/publication/PubMed/6860704" }, { "database": "PubMed", "id": "8373173", "url": "https://glygen.org/publication/PubMed/8373173" }, { "database": "GlyGen", "id": "GLY_001490", "url": "https://data.glygen.org/GLY_001490" } ], "common_name": "Pig", "glygen_name": "Pig", "reference_species": "Sus scrofa [9823]" } ], "classification": [ { "type": { "name": "Glycosphingolipid" }, "subtype": { "name": "Neo-lacto series" } } ], "enzyme": [ { "uniprot_canonical_ac": "G5E897-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G03067VG", "protein_name": "Protein O-glucosyltransferase 3", "gene": "Poglut3", "gene_link": "https://www.uniprot.org/uniprotkb/G5E897", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G03067VG", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G03067VG" } ] }, { "uniprot_canonical_ac": "Q6UW63-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G03067VG", "protein_name": "Protein O-glucosyltransferase 2", "gene": "POGLUT2", "gene_link": "https://www.uniprot.org/uniprotkb/Q6UW63", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G03067VG", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G03067VG" } ] }, { "uniprot_canonical_ac": "Q7Z4H8-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G03067VG", "protein_name": "Protein O-glucosyltransferase 3", "gene": "POGLUT3", "gene_link": "https://www.uniprot.org/uniprotkb/Q7Z4H8", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G03067VG", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G03067VG" } ] }, { "uniprot_canonical_ac": "Q8BYB9-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G03067VG", "protein_name": "Protein O-glucosyltransferase 1", "gene": "Poglut1", "gene_link": "https://www.uniprot.org/uniprotkb/Q8BYB9", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G03067VG", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G03067VG" } ] }, { "uniprot_canonical_ac": "Q8NBL1-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G03067VG", "protein_name": "Protein O-glucosyltransferase 1", "gene": "POGLUT1", "gene_link": "https://www.uniprot.org/uniprotkb/Q8NBL1", "tax_id": 9606, "tax_name": "Homo sapiens", "tax_common_name": "Human", "evidence": [ { "id": "G03067VG", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G03067VG" } ] }, { "uniprot_canonical_ac": "Q9JHP7-1", "xref_key": "glycan_xref_sandbox", "xref_id": "G03067VG", "protein_name": "Protein O-glucosyltransferase 2", "gene": "Poglut2", "gene_link": "https://www.uniprot.org/uniprotkb/Q9JHP7", "tax_id": 10090, "tax_name": "Mus musculus", "tax_common_name": "Mouse", "evidence": [ { "id": "G03067VG", "database": "SandBox", "url": "https://sandbox.glyomics.org/explore.html?G03067VG" } ] } ], "crossref": [ { "id": "91847190", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91847190", "database": "PubChem Compound", "categories": [ "Chemical" ] }, { "id": "252278423", "url": "https://pubchem.ncbi.nlm.nih.gov/substance/252278423", "database": "PubChem Substance", "categories": [ "Chemical" ] }, { "id": "G00088", "url": "https://www.genome.jp/dbget-bin/www_bget?gl:G00088", "database": "KEGG Glycan", "categories": [ "Enzyme and Pathway" ] }, { "id": "780", "url": "", "database": "Glycosciences.de", "categories": [ "Discontinued" ] }, { "id": "12352", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+12352", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "1257", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+1257", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "1258", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+1258", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "1259", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+1259", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "1260", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+1260", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "14056", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+14056", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "14387", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+14387", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "14438", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+14438", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "14485", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+14485", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "15282", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+15282", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "16365", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+16365", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "16413", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+16413", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "16472", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+16472", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "16480", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+16480", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "16896", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+16896", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "17113", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+17113", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "17363", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+17363", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "18427", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+18427", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "18490", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+18490", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "18970", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+18970", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "19313", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+19313", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "21058", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+21058", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "21295", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+21295", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "21325", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+21325", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "21335", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+21335", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "21707", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+21707", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "22398", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+22398", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "23161", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+23161", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "25464", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+25464", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "25836", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+25836", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "26023", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+26023", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "26186", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+26186", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "27602", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+27602", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "29785", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+29785", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "36176", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+36176", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "36652", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+36652", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "36913", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+36913", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "3711", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+3711", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "37579", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+37579", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "37642", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+37642", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "38067", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+38067", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "40734", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+40734", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "40801", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+40801", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "41131", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+41131", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "44629", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+44629", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "45487", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+45487", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "48171", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+48171", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "5408", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+5408", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "7591", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+7591", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "8585", "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+8585", "database": "CarbBank", "categories": [ "Glycomics" ] }, { "id": "145579", "url": "https://www.ebi.ac.uk/chebi/searchId.do?chebiId=145579", "database": "ChEBI", "categories": [] }, { "id": "G03067VG", "url": "https://glytoucan.org/Structures/Glycans/G03067VG", "database": "GlyTouCan", "categories": [ "Glycomics" ] }, { "id": "G03067VG", "url": "https://sandbox.glyomics.org/explore.html?G03067VG", "database": "SandBox", "categories": [ "Enzyme and Pathway" ] }, { "id": "G03067VG", "url": "https://gnome.glyomics.org/restrictions/GlyGen.StructureBrowser.html?focus=G03067VG", "database": "GNOme", "categories": [ "Glycomics", "Ontology and Dictionary" ] }, { "id": "G03067VG", "url": "https://glycosmos.org/glycans/show/G03067VG", "database": "GlyCosmos", "categories": [ "Glycoproteomics", "Glycomics" ] }, { "id": "G03067VG", "url": "https://glycoshape.org/glycan?glytoucan=G03067VG", "database": "GlycoShape", "categories": [ "3D Structure" ] } ], "glycoprotein": [], "publication": [ { "title": "Characterization of gangliosides from bovine erythrocyte membranes.", "journal": "The Journal of biological chemistry", "date": "1978-06-10", "authors": "Chien J L, Li S C, Laine R A, Li Y T", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G03067VG", "url": "https://glytoucan.org/Structures/Glycans/G03067VG" } ], "reference": [ { "type": "PubMed", "id": "649619", "url": "https://glygen.org/publication/PubMed/649619" } ] }, { "title": "Glycosphingolipid antigens in cultured bovine brain microvascular endothelial cells: sulfoglucuronosyl paragloboside as a target of monoclonal IgM in demyelinative neuropathy [corrected].", "journal": "The Journal of cell biology", "date": "1994-07", "authors": "Kanda T, Yoshino H, Ariga T, Yamawaki M, Yu R K", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G03067VG", "url": "https://glytoucan.org/Structures/Glycans/G03067VG" } ], "reference": [ { "type": "PubMed", "id": "8027181", "url": "https://glygen.org/publication/PubMed/8027181" } ] }, { "title": "The GDP-fucose:N-acetylglucosaminide 3-alpha-L-fucosyltransferases of LEC11 and LEC12 Chinese hamster ovary mutants exhibit novel specificities for glycolipid substrates.", "journal": "The Journal of biological chemistry", "date": "1987-12-15", "authors": "Howard D R, Fukuda M, Fukuda M N, Stanley P", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G03067VG", "url": "https://glytoucan.org/Structures/Glycans/G03067VG" } ], "reference": [ { "type": "PubMed", "id": "2890642", "url": "https://glygen.org/publication/PubMed/2890642" } ] }, { "title": "Gangliosides and allied glycosphingolipids in human peripheral nerve and spinal cord.", "journal": "Biochimica et biophysica acta", "date": "1994-09-15", "authors": "Svennerholm L, Bostr\u00f6m K, Fredman P, Jungbjer B, Lekman A, M\u00e5nsson J E, Rynmark B M", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G03067VG", "url": "https://glytoucan.org/Structures/Glycans/G03067VG" } ], "reference": [ { "type": "PubMed", "id": "7918590", "url": "https://glygen.org/publication/PubMed/7918590" } ] }, { "title": "Improved thin-layer chromatographic separation of gangliosides by automated multiple development.", "journal": "Journal of chromatography. B, Biomedical applications", "date": "1994-07-01", "authors": "M\u00fcthing J", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G03067VG", "url": "https://glytoucan.org/Structures/Glycans/G03067VG" } ], "reference": [ { "type": "PubMed", "id": "7952086", "url": "https://glygen.org/publication/PubMed/7952086" } ] }, { "title": "Biosynthesis of the sialyl-Lex determinant carried by type 2 chain glycosphingolipids (IV3NeuAcIII3FucnLc4, VI3NeuAcV3FucnLc6, and VI3NeuAcIII3V3Fuc2nLc6) in human lung carcinoma PC9 cells.", "journal": "The Journal of biological chemistry", "date": "1986-03-15", "authors": "Holmes E H, Ostrander G K, Hakomori S", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G03067VG", "url": "https://glytoucan.org/Structures/Glycans/G03067VG" } ], "reference": [ { "type": "PubMed", "id": "2419336", "url": "https://glygen.org/publication/PubMed/2419336" } ] }, { "title": "Glycolipid antigens with blood group I and i specificities from human adult and umbilical cord erythrocytes.", "journal": "Journal of immunology (Baltimore, Md. : 1950)", "date": "1984-08", "authors": "Okada Y, Kannagi R, Levery S B, Hakomori S", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G03067VG", "url": "https://glytoucan.org/Structures/Glycans/G03067VG" } ], "reference": [ { "type": "PubMed", "id": "6203982", "url": "https://glygen.org/publication/PubMed/6203982" } ] }, { "title": "A comparative assessment of TLC overlay technique and microwell adsorption assay in the examination of influenza A and Sendai virus specificities towards oligosaccharides and sialic acid linkages of gangliosides.", "journal": "Glycoconjugate journal", "date": "1994-10", "authors": "M\u00fcthing J, Unland F", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G03067VG", "url": "https://glytoucan.org/Structures/Glycans/G03067VG" } ], "reference": [ { "type": "PubMed", "id": "7696851", "url": "https://glygen.org/publication/PubMed/7696851" } ] }, { "title": "Had-1, a uridine 5'-diphosphogalactose transport-defective mutant of mouse mammary tumor cell FM3A: composition of glycolipids, cell growth inhibition by lactosylceramide, and loss of tumorigenicity.", "journal": "Cancer research", "date": "1991-03-15", "authors": "Taki T, Ogura K, Rokukawa C, Hara T, Kawakita M, Endo T, Kobata A, Handa S", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G03067VG", "url": "https://glytoucan.org/Structures/Glycans/G03067VG" } ], "reference": [ { "type": "PubMed", "id": "1998961", "url": "https://glygen.org/publication/PubMed/1998961" } ] }, { "title": "Oncofetal expression of Lex carbohydrate antigens in human colonic adenocarcinomas. Regulation through type 2 core chain synthesis rather than fucosylation.", "journal": "The Journal of biological chemistry", "date": "1987", "authors": "Holmes EH, Ostrander GK, Clausen H, Graem N", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G03067VG", "url": "https://glytoucan.org/Structures/Glycans/G03067VG" } ], "reference": [ { "type": "PubMed", "id": "3112156", "url": "https://glygen.org/publication/PubMed/3112156" } ] }, { "title": "Glycolipid antigens of human polymorphonuclear neutrophils and the inducible HL-60 myeloid leukemia line.", "journal": "Journal of immunology (Baltimore, Md. : 1950)", "date": "1985-04", "authors": "Symington F W, Hedges D L, Hakomori S", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G03067VG", "url": "https://glytoucan.org/Structures/Glycans/G03067VG" } ], "reference": [ { "type": "PubMed", "id": "3855933", "url": "https://glygen.org/publication/PubMed/3855933" } ] }, { "title": "Circulating gangliosides of breast-cancer patients.", "journal": "International journal of cancer", "date": "1995-01-27", "authors": "Wiesner D A, Sweeley C C", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G03067VG", "url": "https://glytoucan.org/Structures/Glycans/G03067VG" } ], "reference": [ { "type": "PubMed", "id": "7829233", "url": "https://glygen.org/publication/PubMed/7829233" } ] }, { "title": "Monosialo-lactoisohexaosyl-ceramide: a ganglioside from human spleen.", "journal": "European journal of biochemistry", "date": "1974-06-15", "authors": "Wiegandt H", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G03067VG", "url": "https://glytoucan.org/Structures/Glycans/G03067VG" } ], "reference": [ { "type": "PubMed", "id": "4853255", "url": "https://glygen.org/publication/PubMed/4853255" } ] }, { "title": "Human placenta gangliosides.", "journal": "Lipids", "date": "1988-03", "authors": "Taki T, Matsuo K, Yamamoto K, Matsubara T, Hayashi A, Abe T, Matsumoto M", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G03067VG", "url": "https://glytoucan.org/Structures/Glycans/G03067VG" } ], "reference": [ { "type": "PubMed", "id": "3374272", "url": "https://glygen.org/publication/PubMed/3374272" } ] }, { "title": "Selective detection of terminally alpha 2-3 and alpha 2-6 sialylated neolacto-series gangliosides by immunostaining on thin layer chromatograms.", "journal": "Biomedical chromatography : BMC", "date": "1993", "authors": "M\u00fcthing J, Neumann U", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G03067VG", "url": "https://glytoucan.org/Structures/Glycans/G03067VG" } ], "reference": [ { "type": "PubMed", "id": "8318834", "url": "https://glygen.org/publication/PubMed/8318834" } ] }, { "title": "Different binding capacities of influenza A and Sendai viruses to gangliosides from human granulocytes.", "journal": "Glycoconjugate journal", "date": "1993-02", "authors": "M\u00fcthing J, Unland F, Heitmann D, Orlich M, Hanisch F G, Peter-Katalini\u0107 J, Kn\u00e4uper V, Tschesche H, Kelm S, Schauer R", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G03067VG", "url": "https://glytoucan.org/Structures/Glycans/G03067VG" } ], "reference": [ { "type": "PubMed", "id": "8395268", "url": "https://glygen.org/publication/PubMed/8395268" } ] }, { "title": "Acidic glycosphingolipids of human amnion.", "journal": "Journal of biochemistry", "date": "1991-01", "authors": "Asano K, Suzuki M, Handa S, Oshima M", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G03067VG", "url": "https://glytoucan.org/Structures/Glycans/G03067VG" } ], "reference": [ { "type": "PubMed", "id": "2016260", "url": "https://glygen.org/publication/PubMed/2016260" } ] }, { "title": "Chemical structure of carcinoma ganglioside antigens defined by monoclonal antibody C-50 and some allied gangliosides of human pancreatic adenocarcinoma.", "journal": "Biochimica et biophysica acta", "date": "1985-03-27", "authors": "M\u00e5nsson J E, Fredman P, Nilsson O, Lindholm L, Holmgren J, Svennerholm L", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G03067VG", "url": "https://glytoucan.org/Structures/Glycans/G03067VG" } ], "reference": [ { "type": "PubMed", "id": "3978112", "url": "https://glygen.org/publication/PubMed/3978112" } ] }, { "title": "A cancer-reactive human monoclonal antibody derived from a colonic cancer patient treated with local immunotherapy.", "journal": "Japanese journal of cancer research : Gann", "date": "1993-01", "authors": "Yagyu T, Monden T, Baba M, Tamaki Y, Takeda T, Kobayashi T, Shimano T, Tsuji Y, Matsushita H, Osawa H", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G03067VG", "url": "https://glytoucan.org/Structures/Glycans/G03067VG" } ], "reference": [ { "type": "PubMed", "id": "8449830", "url": "https://glygen.org/publication/PubMed/8449830" } ] }, { "title": "Comparison of glycolipids in various human leukemia cells.", "journal": "Japanese journal of cancer research : Gann", "date": "1987-11", "authors": "Kyogashima M, Uemura K, Taketomi T", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G03067VG", "url": "https://glytoucan.org/Structures/Glycans/G03067VG" } ], "reference": [ { "type": "PubMed", "id": "3121559", "url": "https://glygen.org/publication/PubMed/3121559" } ] }, { "title": "Gangliosides of hog skeletal muscle.", "journal": "Biochimica et biophysica acta", "date": "1983-07-12", "authors": "Nakamura K, Nagashima M, Sekine M, Igarashi M, Ariga T, Atsumi T, Miyatake T, Suzuki A, Yamakawa T", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G03067VG", "url": "https://glytoucan.org/Structures/Glycans/G03067VG" } ], "reference": [ { "type": "PubMed", "id": "6860704", "url": "https://glygen.org/publication/PubMed/6860704" } ] }, { "title": "Glycosphingolipids of rabbit, sheep, and pig thymus.", "journal": "Archives of biochemistry and biophysics", "date": "1993-09", "authors": "He P, Hu J, Macher B A", "evidence": [ { "database": "TableMaker", "id": "TG10381046", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "database": "GlyTouCan", "id": "G03067VG", "url": "https://glytoucan.org/Structures/Glycans/G03067VG" } ], "reference": [ { "type": "PubMed", "id": "8373173", "url": "https://glygen.org/publication/PubMed/8373173" } ] } ], "residues": [ { "id": "OC3", "name": "O-glycan_core_x-D-Glcx_C3", "attachedby": "rxn.G5E897-1", "detachedby": "", "parentid": "0" }, { "id": "OC3", "name": "O-glycan_core_x-D-Glcx_C3", "attachedby": "rxn.Q6UW63-1", "detachedby": "", "parentid": "0" }, { "id": "OC3", "name": "O-glycan_core_x-D-Glcx_C3", "attachedby": "rxn.Q7Z4H8-1", "detachedby": "", "parentid": "0" }, { "id": "OC3", "name": "O-glycan_core_x-D-Glcx_C3", "attachedby": "rxn.Q8BYB9-1", "detachedby": "", "parentid": "0" }, { "id": "OC3", "name": "O-glycan_core_x-D-Glcx_C3", "attachedby": "rxn.Q8NBL1-1", "detachedby": "", "parentid": "0" }, { "id": "OC3", "name": "O-glycan_core_x-D-Glcx_C3", "attachedby": "rxn.Q9JHP7-1", "detachedby": "", "parentid": "0" } ], "composition": [ { "name": "6-Deoxy-Hexose", "residue": "dhex", "count": 0, "cid": "840", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840" }, { "name": "Hexose", "residue": "hex", "count": 4, "cid": "206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206" }, { "name": "N-Acetylhexosamine", "residue": "hexnac", "count": 2, "cid": "899", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899" }, { "name": "Hexuronic Acid", "residue": "hexa", "count": 0, "cid": "610", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610" }, { "name": "2-Amino-2-Deoxy-Hexose", "residue": "hexn", "count": 0, "cid": "739", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739" }, { "name": "N-Acetyl-Neuraminic Acid", "residue": "neuac", "count": 1, "cid": "439197", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197" }, { "name": "N-Glycolyl-Neuraminic Acid", "residue": "neugc", "count": 0, "cid": "440001", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001" }, { "name": "Phosphate", "residue": "p", "count": 0, "cid": "1061", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061" }, { "name": "Pentose", "residue": "pent", "count": 0, "cid": "229", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229" }, { "name": "Sulfate", "residue": "s", "count": 0, "cid": "1117", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117" }, { "name": "Other", "residue": "other", "count": 0 } ], "composition_expanded": [ { "name": "Alditol", "residue": "aldi", "count": 0 }, { "name": "6-Deoxy-Hexose", "residue": "dhex", "count": 0, "cid": "840", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840" }, { "name": "6-Deoxy-Hexitol", "residue": "dhex+aldi", "count": 0 }, { "name": "L-Fucose", "residue": "fuc", "count": 0, "cid": "17106", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/17106" }, { "name": "L-Fucitol", "residue": "fuc+aldi", "count": 0, "cid": "445724", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/445724" }, { "name": "D-Galactose", "residue": "gal", "count": 3, "cid": "6036", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6036" }, { "name": "D-Galactitol", "residue": "gal+aldi", "count": 0, "cid": "11850", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11850" }, { "name": "N-Acetyl-D-galactosamine", "residue": "galnac", "count": 0, "cid": "35717", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/35717" }, { "name": "N-Acetylgalactosaminitol", "residue": "galnac+aldi", "count": 0, "cid": "165880", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165880" }, { "name": "D-Galacturonic Acid", "residue": "gala", "count": 0, "cid": "439215", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439215" }, { "name": "D-Glucose", "residue": "glc", "count": 1, "cid": "5793", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5793" }, { "name": "D-Glucitol", "residue": "glc+aldi", "count": 0, "cid": "5780", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5780" }, { "name": "D-Glucuronic acid", "residue": "glca", "count": 0, "cid": "94715", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/94715" }, { "name": "D-Glucosamine", "residue": "glcn", "count": 0, "cid": "439213", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439213" }, { "name": "N-Acetyl-D-Glucosamine", "residue": "glcnac", "count": 2, "cid": "439174", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439174" }, { "name": "N-Acetyl-D-glucosaminitol", "residue": "glcnac+aldi", "count": 0, "cid": "165206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165206" }, { "name": "Hexose", "residue": "hex", "count": 4, "cid": "206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206" }, { "name": "N-Acetylhexosamine", "residue": "hexnac", "count": 2, "cid": "899", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899" }, { "name": "Hexuronic Acid", "residue": "hexa", "count": 0, "cid": "610", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610" }, { "name": "2-Amino-2-Deoxy-Hexose", "residue": "hexn", "count": 0, "cid": "739", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739" }, { "name": "Hexitol", "residue": "hex+aldi", "count": 0, "cid": "453", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/453" }, { "name": "N-Acetylhexosaminitol", "residue": "hexnac+aldi", "count": 0 }, { "name": "L-Iduronic acid", "residue": "idoa", "count": 0, "cid": "441039", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/441039" }, { "name": "D-Mannose", "residue": "man", "count": 0, "cid": "18950", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18950" }, { "name": "D-Mannitol", "residue": "man+aldi", "count": 0, "cid": "6251", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6251" }, { "name": "N-Acetyl-D-mannosamine", "residue": "mannac", "count": 0, "cid": "439281", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439281" }, { "name": "Methyl", "residue": "me", "count": 0 }, { "name": "N-Acetyl-Neuraminic Acid", "residue": "neuac", "count": 1, "cid": "439197", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197" }, { "name": "N-Glycolyl-Neuraminic Acid", "residue": "neugc", "count": 0, "cid": "440001", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001" }, { "name": "Phosphate", "residue": "p", "count": 0, "cid": "1061", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061" }, { "name": "Pentose", "residue": "pent", "count": 0, "cid": "229", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229" }, { "name": "Sulfate", "residue": "s", "count": 0, "cid": "1117", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117" }, { "name": "Sialic acid", "residue": "sia", "count": 1 }, { "name": "Other", "residue": "other", "count": 0 }, { "name": "Floating substituent", "residue": "x", "count": 0 }, { "name": "D-Xylose", "residue": "xyl", "count": 0, "cid": "135191", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135191" }, { "name": "Ketodeoxynononic acid", "residue": "kdn", "count": 0, "cid": "13991616", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13991616" } ], "motifs": [ { "id": "GGM.000001", "name": "Type 2 LN", "synonym": "N-acetyllactosamine", "keywords": "LacNAc; N-acetyllactosamine; N-acetyllactosamine type 2" }, { "id": "GGM.000002", "name": "Type 2 LN2", "synonym": "i antigen", "keywords": "LacNAc; N-acetyllactosamine; N-acetyllactosamine type 2" }, { "id": "GGM.000034", "name": "3-Sialyl-LN (type 2)", "synonym": "", "keywords": "LacNAc; N-acetyllactosamine; N-acetyllactosamine type 2" } ], "interactions": [], "expression": [ { "category": "tissue", "tissue": { "name": "", "namespace": "UBERON", "id": "0001267", "url": "http://purl.obolibrary.org/obo/UBERON_0001267" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "7918590", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/7918590" } ] }, { "category": "tissue", "tissue": { "name": "", "namespace": "UBERON", "id": "0006798", "url": "http://purl.obolibrary.org/obo/UBERON_0006798" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "7918590", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/7918590" } ] }, { "category": "tissue", "tissue": { "name": "", "namespace": "UBERON", "id": "0012337", "url": "http://purl.obolibrary.org/obo/UBERON_0012337" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "7918590", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/7918590" } ] }, { "category": "tissue", "tissue": { "name": "lung", "namespace": "UBERON", "id": "0002048", "url": "http://purl.obolibrary.org/obo/UBERON_0002048" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "2419336", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/2419336" } ] }, { "category": "tissue", "tissue": { "name": "placenta", "namespace": "UBERON", "id": "0001987", "url": "http://purl.obolibrary.org/obo/UBERON_0001987" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "1998961", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/1998961" }, { "id": "3374272", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/3374272" }, { "id": "8449830", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/8449830" } ] }, { "category": "tissue", "tissue": { "name": "colon", "namespace": "UBERON", "id": "0001155", "url": "http://purl.obolibrary.org/obo/UBERON_0001155" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "3112156", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/3112156" } ] }, { "category": "tissue", "tissue": { "name": "spinal cord", "namespace": "UBERON", "id": "0002240", "url": "http://purl.obolibrary.org/obo/UBERON_0002240" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "7918590", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/7918590" } ] }, { "category": "tissue", "tissue": { "name": "blood serum", "namespace": "UBERON", "id": "0001977", "url": "http://purl.obolibrary.org/obo/UBERON_0001977" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "7829233", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/7829233" } ] }, { "category": "tissue", "tissue": { "name": "spleen", "namespace": "UBERON", "id": "0002106", "url": "http://purl.obolibrary.org/obo/UBERON_0002106" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "4853255", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/4853255" } ] }, { "category": "tissue", "tissue": { "name": "amnion", "namespace": "UBERON", "id": "0000305", "url": "http://purl.obolibrary.org/obo/UBERON_0000305" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "2016260", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/2016260" } ] }, { "category": "tissue", "tissue": { "name": "breast", "namespace": "UBERON", "id": "0000310", "url": "http://purl.obolibrary.org/obo/UBERON_0000310" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "7829233", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/7829233" } ] }, { "category": "tissue", "tissue": { "name": "", "namespace": "UBERON", "id": "0001027", "url": "http://purl.obolibrary.org/obo/UBERON_0001027" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "7918590", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/7918590" } ] }, { "category": "tissue", "tissue": { "name": "thymus", "namespace": "UBERON", "id": "0002370", "url": "http://purl.obolibrary.org/obo/UBERON_0002370" }, "cell_line": {}, "abundance": "", "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "8373173", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/8373173" } ] } ], "tissue": [ { "tissue": { "name": "", "namespace": "UBERON", "id": "0001267", "url": "http://purl.obolibrary.org/obo/UBERON_0001267" }, "species": { "name": "Homo sapiens", "taxid": 9606, "reference_species": "Homo sapiens [9606]", "common_name": "Human", "glygen_name": "Human" }, "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "7918590", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/7918590" } ] }, { "tissue": { "name": "", "namespace": "UBERON", "id": "0006798", "url": "http://purl.obolibrary.org/obo/UBERON_0006798" }, "species": { "name": "Homo sapiens", "taxid": 9606, "reference_species": "Homo sapiens [9606]", "common_name": "Human", "glygen_name": "Human" }, "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "7918590", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/7918590" } ] }, { "tissue": { "name": "", "namespace": "UBERON", "id": "0012337", "url": "http://purl.obolibrary.org/obo/UBERON_0012337" }, "species": { "name": "Homo sapiens", "taxid": 9606, "reference_species": "Homo sapiens [9606]", "common_name": "Human", "glygen_name": "Human" }, "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "7918590", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/7918590" } ] }, { "tissue": { "name": "lung", "namespace": "UBERON", "id": "0002048", "url": "http://purl.obolibrary.org/obo/UBERON_0002048" }, "species": { "name": "Homo sapiens", "taxid": 9606, "reference_species": "Homo sapiens [9606]", "common_name": "Human", "glygen_name": "Human" }, "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "2419336", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/2419336" } ] }, { "tissue": { "name": "placenta", "namespace": "UBERON", "id": "0001987", "url": "http://purl.obolibrary.org/obo/UBERON_0001987" }, "species": { "name": "Homo sapiens", "taxid": 9606, "reference_species": "Homo sapiens [9606]", "common_name": "Human", "glygen_name": "Human" }, "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "1998961", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/1998961" }, { "id": "3374272", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/3374272" }, { "id": "8449830", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/8449830" } ] }, { "tissue": { "name": "colon", "namespace": "UBERON", "id": "0001155", "url": "http://purl.obolibrary.org/obo/UBERON_0001155" }, "species": { "name": "Homo sapiens", "taxid": 9606, "reference_species": "Homo sapiens [9606]", "common_name": "Human", "glygen_name": "Human" }, "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "3112156", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/3112156" } ] }, { "tissue": { "name": "spinal cord", "namespace": "UBERON", "id": "0002240", "url": "http://purl.obolibrary.org/obo/UBERON_0002240" }, "species": { "name": "Homo sapiens", "taxid": 9606, "reference_species": "Homo sapiens [9606]", "common_name": "Human", "glygen_name": "Human" }, "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "7918590", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/7918590" } ] }, { "tissue": { "name": "blood serum", "namespace": "UBERON", "id": "0001977", "url": "http://purl.obolibrary.org/obo/UBERON_0001977" }, "species": { "name": "Homo sapiens", "taxid": 9606, "reference_species": "Homo sapiens [9606]", "common_name": "Human", "glygen_name": "Human" }, "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "7829233", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/7829233" } ] }, { "tissue": { "name": "spleen", "namespace": "UBERON", "id": "0002106", "url": "http://purl.obolibrary.org/obo/UBERON_0002106" }, "species": { "name": "Homo sapiens", "taxid": 9606, "reference_species": "Homo sapiens [9606]", "common_name": "Human", "glygen_name": "Human" }, "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "4853255", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/4853255" } ] }, { "tissue": { "name": "amnion", "namespace": "UBERON", "id": "0000305", "url": "http://purl.obolibrary.org/obo/UBERON_0000305" }, "species": { "name": "Homo sapiens", "taxid": 9606, "reference_species": "Homo sapiens [9606]", "common_name": "Human", "glygen_name": "Human" }, "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "2016260", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/2016260" } ] }, { "tissue": { "name": "breast", "namespace": "UBERON", "id": "0000310", "url": "http://purl.obolibrary.org/obo/UBERON_0000310" }, "species": { "name": "Homo sapiens", "taxid": 9606, "reference_species": "Homo sapiens [9606]", "common_name": "Human", "glygen_name": "Human" }, "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "7829233", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/7829233" } ] }, { "tissue": { "name": "", "namespace": "UBERON", "id": "0001027", "url": "http://purl.obolibrary.org/obo/UBERON_0001027" }, "species": { "name": "Homo sapiens", "taxid": 9606, "reference_species": "Homo sapiens [9606]", "common_name": "Human", "glygen_name": "Human" }, "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "7918590", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/7918590" } ] }, { "tissue": { "name": "thymus", "namespace": "UBERON", "id": "0002370", "url": "http://purl.obolibrary.org/obo/UBERON_0002370" }, "species": { "name": "Sus scrofa", "taxid": 9823, "reference_species": "Sus scrofa [9823]", "common_name": "Pig", "glygen_name": "Pig" }, "evidence": [ { "id": "TG10381046", "database": "TableMaker", "url": "https://glygen.ccrc.uga.edu/tablemaker/data/dataset/TG10381046" }, { "id": "8373173", "database": "PubMed", "url": "https://glygen.org/publication/PubMed/8373173" } ] } ], "subsumption": [ { "related_accession": "G04371QE", "relationship": "ancestor" }, { "related_accession": "G11923HZ", "relationship": "ancestor" }, { "related_accession": "G14149FY", "relationship": "ancestor" }, { "related_accession": "G22893MK", "relationship": "ancestor" }, { "related_accession": "G33454WQ", "relationship": "ancestor" }, { "related_accession": "G38752GW", "relationship": "ancestor" }, { "related_accession": "G44183QC", "relationship": "ancestor" }, { "related_accession": "G49124LP", "relationship": "ancestor" }, { "related_accession": "G67517BF", "relationship": "ancestor" }, { "related_accession": "G75178ER", "relationship": "ancestor" }, { "related_accession": "G83693ZR", "relationship": "ancestor" }, { "related_accession": "G91331SN", "relationship": "ancestor" }, { "related_accession": "G97205DE", "relationship": "ancestor" }, { "related_accession": "G04371QE", "relationship": "basecomposition" }, { "related_accession": "G75178ER", "relationship": "composition" }, { "related_accession": "G44183QC", "relationship": "subsumedby" }, { "related_accession": "G49124LP", "relationship": "subsumedby" }, { "related_accession": "G11923HZ", "relationship": "topology" } ], "names": [], "keywords": [ "fully_determined" ], "glycotree_pathways": [], "dictionary": {}, "biomarkers": [], "section_stats": [ { "table_id": "glycoprotein", "table_stats": [ { "field": "total", "count": 0 }, { "field": "total_sites", "count": 0 } ], "sort_fields": [] }, { "table_id": "expression", "table_stats": [ { "field": "total", "count": 13 }, { "field": "total_sites", "count": 0 } ], "sort_fields": [ "category", "tissue.name", "tissue.namespace", "tissue.id", "tissue.url", "abundance" ] }, { "table_id": "expression_tissue", "table_stats": [ { "field": "total", "count": 13 }, { "field": "total_sites", "count": 0 } ], "sort_fields": [ "category", "tissue.name", "tissue.namespace", "tissue.id", "tissue.url", "abundance" ] }, { "table_id": "expression_cell_line", "table_stats": [ { "field": "total", "count": 0 }, { "field": "total_sites", "count": 0 } ], "sort_fields": [ "category", "abundance" ] }, { "table_id": "publication", "table_stats": [ { "field": "total", "count": 22 } ], "sort_fields": [ "title", "journal", "date", "authors" ] } ] }