{
    "glytoucan_ac": "G00672PE",
    "number_monosaccharides": 4,
    "number_monosaccharides_suffix": "",
    "mass": 900.25,
    "mass_pme": 1096.47,
    "tool_support": {
        "sandbox": "no",
        "pdb": "yes",
        "gnome": "yes",
        "gnome_glygen": "yes",
        "gnome_glygen_nglycans": "no",
        "gnome_glygen_oglycans": "no",
        "gnome_glycotree_nglycans": "no",
        "gnome_glycotree_oglycans": "no"
    },
    "fully_determined": "yes",
    "missing_score": 0,
    "glycan_type": "Saccharide",
    "iupac": "alpha-D-Neup5Ac-(2->3)-beta-D-Galp6S-(1->4)[alpha-L-Fucp-(1->3)]-beta-D-GlcpNAc-(1->",
    "iupac_compact": "Fuca1-3(NeuAca2-3(6S)Galb1-4)GlcNAcb",
    "iupac_condensed": "Neu5Ac(a2-3)Gal6S(b1-4)[Fuc(a1-3)]GlcNAc(b1-",
    "wurcs": "WURCS=2.0/4,4,3/[a2122h-1b_1-5_2*NCC/3=O][a1221m-1a_1-5][a2112h-1b_1-5_6*OSO/3=O/3=O][Aad21122h-2a_2-6_5*NCC/3=O]/1-2-3-4/a3-b1_a4-c1_c3-d2",
    "glycoct": "RES 1b:b-dglc-HEX-1:5 2s:n-acetyl 3b:a-lgal-HEX-1:5|6:d 4b:b-dgal-HEX-1:5 5b:a-dgro-dgal-NON-2:6|1:a|2:keto|3:d 6s:n-acetyl 7s:sulfate LIN 1:1d(2+1)2n 2:1o(3+1)3d 3:1o(4+1)4d 4:4o(3+2)5d 5:5d(5+1)6n 6:4o(6+1)7n",
    "inchi": "InChI=1S/C31H52N2O26S/c1-8-17(40)20(43)21(44)28(53-8)57-25-16(33-10(3)37)27(46)54-13(6-35)23(25)56-29-22(45)26(19(42)14(55-29)7-52-60(49,50)51)59-31(30(47)48)4-11(38)15(32-9(2)36)24(58-31)18(41)12(39)5-34/h8,11-29,34-35,38-46H,4-7H2,1-3H3,(H,32,36)(H,33,37)(H,47,48)(H,49,50,51)/t8-,11-,12+,13+,14+,15+,16+,17+,18+,19-,20+,21-,22+,23+,24+,25+,26-,27+,28-,29-,31-/m0/s1",
    "glycam": "DNeup5Aca2-3DGalp[6S]b1-4[LFucpa1-3]DGlcpNAcb1-OH",
    "smiles_isomeric": "C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H](O[C@@H]([C@H]2O[C@H]3[C@@H]([C@H]([C@H]([C@H](O3)COS(=O)(=O)O)O)O[C@@]4(C[C@@H]([C@H]([C@@H](O4)[C@@H]([C@@H](CO)O)O)NC(=O)C)O)C(=O)O)O)CO)O)NC(=O)C)O)O)O",
    "inchi_key": {
        "key": "NWWSDBBCJHHGNB-UQTBNESHSA-N",
        "url": "https://pubchem.ncbi.nlm.nih.gov/compound/NWWSDBBCJHHGNB-UQTBNESHSA-N"
    },
    "byonic": "HexNAc(1)Hex(1)dHex(1)NeuAc(1)Sulpho(1) % 900.2529009",
    "gwb": "freeEnd--1b1D-GlcNAc,p(--3a1L-Fuc,p)--4b1D-Gal,p(--6S)--3a2D-NeuAc,p$MONO,Und,0,0,freeEnd",
    "species": [
        {
            "taxid": 10090,
            "name": "Mus musculus",
            "annotation_category": "direct",
            "evidence": [
                {
                    "database": "GlyCosmos",
                    "id": "G00672PE",
                    "url": "https://glycosmos.org/glycans/show/G00672PE"
                }
            ],
            "common_name": "Mouse",
            "glygen_name": "Mouse",
            "reference_species": "Mus musculus [10090]"
        }
    ],
    "classification": [
        {
            "type": {
                "name": "Other",
                "url": ""
            },
            "subtype": {
                "name": "Other",
                "url": ""
            }
        }
    ],
    "enzyme": [],
    "crossref": [
        {
            "id": "70698387",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/70698387",
            "database": "PubChem Compound",
            "categories": [
                "Chemical"
            ]
        },
        {
            "id": "252285736",
            "url": "https://pubchem.ncbi.nlm.nih.gov/substance/252285736",
            "database": "PubChem Substance",
            "categories": [
                "Chemical"
            ]
        },
        {
            "id": "15440",
            "url": "",
            "database": "Glycosciences.de",
            "categories": [
                "Discontinued"
            ]
        },
        {
            "id": "carbSynthe_0160_D000",
            "url": "",
            "database": "CFG",
            "categories": [
                "Discontinued"
            ]
        },
        {
            "id": "carbSynthe_0926_D000",
            "url": "",
            "database": "CFG",
            "categories": [
                "Discontinued"
            ]
        },
        {
            "id": "47487",
            "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+47487",
            "database": "CarbBank",
            "categories": [
                "Glycomics"
            ]
        },
        {
            "id": "71558",
            "url": "https://www.ebi.ac.uk/chebi/searchId.do?chebiId=71558",
            "database": "ChEBI",
            "categories": []
        },
        {
            "id": "EP0014",
            "url": "https://www.glycoepitope.jp/epitopes/EP0014",
            "database": "GlycoEpitope",
            "categories": [
                "Glycomics"
            ]
        },
        {
            "id": "G00672PE",
            "url": "https://glytoucan.org/Structures/Glycans/G00672PE",
            "database": "GlyTouCan",
            "categories": [
                "Glycomics"
            ]
        },
        {
            "id": "G00672PE",
            "url": "https://gnome.glyomics.org/restrictions/GlyGen.StructureBrowser.html?focus=G00672PE",
            "database": "GNOme",
            "categories": [
                "Glycomics",
                "Ontology and Dictionary"
            ]
        },
        {
            "id": "G00672PE",
            "url": "https://glycosmos.org/glycans/show/G00672PE",
            "database": "GlyCosmos",
            "categories": [
                "Glycoproteomics",
                "Glycomics"
            ]
        },
        {
            "id": "GSD000011",
            "url": "https://wiki.glygen.org/Glycan_structure_dictionary#GSD000011",
            "database": "Glycan Structure Dictionary",
            "categories": [
                "Ontology and Dictionary"
            ]
        },
        {
            "id": "8012202GAR",
            "url": "https://glygen.ccrc.uga.edu/ggarray/glycanDetail/8012202GAR",
            "database": "Glycan Array Data Repository",
            "categories": []
        },
        {
            "id": "G00672PE",
            "url": "https://glycoshape.org/glycan?glytoucan=G00672PE",
            "database": "GlycoShape",
            "categories": [
                "3D Structure"
            ]
        }
    ],
    "glycoprotein": [],
    "publication": [
        {
            "title": "Reconstitution of functional L-selectin ligands on a cultured human endothelial cell line by cotransfection of alpha1-->3 fucosyltransferase VII and newly cloned GlcNAcbeta:6-sulfotransferase cDNA.",
            "journal": "Proceedings of the National Academy of Sciences of the United States of America",
            "date": "1999",
            "authors": "Kimura N, Mitsuoka C, Kanamori A, Hiraiwa N, Uchimura K, Muramatsu T, Tamatani T, Kansas GS, Kannagi R",
            "evidence": [
                {
                    "database": "GlyTouCan",
                    "id": "G00672PE",
                    "url": "https://glytoucan.org/Structures/Glycans/G00672PE"
                }
            ],
            "reference": [
                {
                    "type": "PubMed",
                    "id": "10200296",
                    "url": "https://glygen.org/publication/PubMed/10200296"
                }
            ]
        },
        {
            "title": "Sulfotransferases of two specificities function in the reconstitution of high endothelial cell ligands for L-selectin.",
            "journal": "The Journal of cell biology",
            "date": "1999",
            "authors": "Bistrup A, Bhakta S, Lee JK, Belov YY, Gunn MD, Zuo FR, Huang CC, Kannagi R, Rosen SD, Hemmerich S",
            "evidence": [
                {
                    "database": "GlyTouCan",
                    "id": "G00672PE",
                    "url": "https://glytoucan.org/Structures/Glycans/G00672PE"
                }
            ],
            "reference": [
                {
                    "type": "PubMed",
                    "id": "10330415",
                    "url": "https://glygen.org/publication/PubMed/10330415"
                }
            ]
        },
        {
            "title": "L-selectin ligands expressed by human leukocytes are HECA-452 antibody-defined carbohydrate epitopes preferentially displayed by P-selectin glycoprotein ligand-1.",
            "journal": "Journal of immunology (Baltimore, Md. : 1950)",
            "date": "1999",
            "authors": "Tu L, Murphy PG, Li X, Tedder TF",
            "evidence": [
                {
                    "database": "GlyTouCan",
                    "id": "G00672PE",
                    "url": "https://glytoucan.org/Structures/Glycans/G00672PE"
                }
            ],
            "reference": [
                {
                    "type": "PubMed",
                    "id": "10528213",
                    "url": "https://glygen.org/publication/PubMed/10528213"
                }
            ]
        },
        {
            "title": "Sulfation of L-selectin ligands by an HEV-restricted sulfotransferase regulates lymphocyte homing to lymph nodes.",
            "journal": "Immunity",
            "date": "2001",
            "authors": "Hemmerich S, Bistrup A, Singer MS, van Zante A, Lee JK, Tsay D, Peters M, Carminati JL, Brennan TJ, Carver-Moore K, Leviten M, Fuentes ME, Ruddle NH, Rosen SD",
            "evidence": [
                {
                    "database": "GlyTouCan",
                    "id": "G00672PE",
                    "url": "https://glytoucan.org/Structures/Glycans/G00672PE"
                }
            ],
            "reference": [
                {
                    "type": "PubMed",
                    "id": "11520459",
                    "url": "https://glygen.org/publication/PubMed/11520459"
                }
            ]
        },
        {
            "title": "High endothelial venule-like vessels in the interstitial lesions of human glomerulonephritis.",
            "journal": "American journal of nephrology",
            "date": "2002",
            "authors": "Takaeda M, Yokoyama H, Segawa-Takaeda C, Wada T, Kobayashi K",
            "evidence": [
                {
                    "database": "GlyTouCan",
                    "id": "G00672PE",
                    "url": "https://glytoucan.org/Structures/Glycans/G00672PE"
                }
            ],
            "reference": [
                {
                    "type": "PubMed",
                    "id": "11919403",
                    "url": "https://glygen.org/publication/PubMed/11919403"
                }
            ]
        },
        {
            "title": "Glycosylation might provide endothelial zip codes for organ-specific leukocyte traffic into inflammatory sites.",
            "journal": "The American journal of pathology",
            "date": "2002",
            "authors": "Renkonen J, Tynninen O, Hayry P, Paavonen T, Renkonen R",
            "evidence": [
                {
                    "database": "GlyTouCan",
                    "id": "G00672PE",
                    "url": "https://glytoucan.org/Structures/Glycans/G00672PE"
                }
            ],
            "reference": [
                {
                    "type": "PubMed",
                    "id": "12163379",
                    "url": "https://glygen.org/publication/PubMed/12163379"
                }
            ]
        },
        {
            "title": "Increased expression of sialyl Lewis(x) antigen in penetrating growth type A early gastric cancer.",
            "journal": "Journal of experimental & clinical cancer research : CR",
            "date": "2002",
            "authors": "Nakagoe T, Fukushima K, Sawai T, Tsuji T, Jibiki M, Nanashima A, Tanaka K, Yamaguchi H, Yasutake T, Ayabe H, Ishikawa H",
            "evidence": [
                {
                    "database": "GlyTouCan",
                    "id": "G00672PE",
                    "url": "https://glytoucan.org/Structures/Glycans/G00672PE"
                }
            ],
            "reference": [
                {
                    "type": "PubMed",
                    "id": "12385579",
                    "url": "https://glygen.org/publication/PubMed/12385579"
                }
            ]
        },
        {
            "title": "Endoglycan, a member of the CD34 family, functions as an L-selectin ligand through modification with tyrosine sulfation and sialyl Lewis x.",
            "journal": "The Journal of biological chemistry",
            "date": "2003",
            "authors": "Fieger CB, Sassetti CM, Rosen SD",
            "evidence": [
                {
                    "database": "GlyTouCan",
                    "id": "G00672PE",
                    "url": "https://glytoucan.org/Structures/Glycans/G00672PE"
                }
            ],
            "reference": [
                {
                    "type": "PubMed",
                    "id": "12889478",
                    "url": "https://glygen.org/publication/PubMed/12889478"
                }
            ]
        },
        {
            "title": "Complement regulatory protein C1 inhibitor binds to selectins and interferes with endothelial-leukocyte adhesion.",
            "journal": "Journal of immunology (Baltimore, Md. : 1950)",
            "date": "2003",
            "authors": "Cai S, Davis AE 3rd",
            "evidence": [
                {
                    "database": "GlyTouCan",
                    "id": "G00672PE",
                    "url": "https://glytoucan.org/Structures/Glycans/G00672PE"
                }
            ],
            "reference": [
                {
                    "type": "PubMed",
                    "id": "14568956",
                    "url": "https://glygen.org/publication/PubMed/14568956"
                }
            ]
        },
        {
            "title": "Core 2 branching beta1,6-N-acetylglucosaminyltransferase and high endothelial venule-restricted sulfotransferase collaboratively control lymphocyte homing.",
            "journal": "The Journal of biological chemistry",
            "date": "2004",
            "authors": "Hiraoka N, Kawashima H, Petryniak B, Nakayama J, Mitoma J, Marth JD, Lowe JB, Fukuda M",
            "evidence": [
                {
                    "database": "GlyTouCan",
                    "id": "G00672PE",
                    "url": "https://glytoucan.org/Structures/Glycans/G00672PE"
                }
            ],
            "reference": [
                {
                    "type": "PubMed",
                    "id": "14593101",
                    "url": "https://glygen.org/publication/PubMed/14593101"
                }
            ]
        },
        {
            "title": "N-acetylglucosamine 6-O-sulfotransferase-1 regulates expression of L-selectin ligands and lymphocyte homing.",
            "journal": "The Journal of biological chemistry",
            "date": "2004",
            "authors": "Uchimura K, Kadomatsu K, El-Fasakhany FM, Singer MS, Izawa M, Kannagi R, Takeda N, Rosen SD, Muramatsu T",
            "evidence": [
                {
                    "database": "GlyTouCan",
                    "id": "G00672PE",
                    "url": "https://glytoucan.org/Structures/Glycans/G00672PE"
                }
            ],
            "reference": [
                {
                    "type": "PubMed",
                    "id": "15175329",
                    "url": "https://glygen.org/publication/PubMed/15175329"
                }
            ]
        },
        {
            "title": "Recognition of consensus CHO structure in ligands for selectins by novel antibody against sialyl Lewis X.",
            "journal": "The American journal of physiology",
            "date": "1995",
            "authors": "Tamatani T, Suematsu M, Tezuka K, Hanzawa N, Tsuji T, Ishimura Y, Kannagi R, Toyoshima S, Homma M",
            "evidence": [
                {
                    "database": "GlyTouCan",
                    "id": "G00672PE",
                    "url": "https://glytoucan.org/Structures/Glycans/G00672PE"
                }
            ],
            "reference": [
                {
                    "type": "PubMed",
                    "id": "7485559",
                    "url": "https://glygen.org/publication/PubMed/7485559"
                }
            ]
        },
        {
            "title": "Sulfation-dependent recognition of high endothelial venules (HEV)-ligands by L-selectin and MECA 79, and adhesion-blocking monoclonal antibody.",
            "journal": "The Journal of experimental medicine",
            "date": "1994",
            "authors": "Hemmerich S, Butcher EC, Rosen SD",
            "evidence": [
                {
                    "database": "GlyTouCan",
                    "id": "G00672PE",
                    "url": "https://glytoucan.org/Structures/Glycans/G00672PE"
                }
            ],
            "reference": [
                {
                    "type": "PubMed",
                    "id": "7525849",
                    "url": "https://glygen.org/publication/PubMed/7525849"
                }
            ]
        },
        {
            "title": "Structure of the O-glycans in GlyCAM-1, an endothelial-derived ligand for L-selectin.",
            "journal": "The Journal of biological chemistry",
            "date": "1995",
            "authors": "Hemmerich S, Leffler H, Rosen SD",
            "evidence": [
                {
                    "database": "GlyTouCan",
                    "id": "G00672PE",
                    "url": "https://glytoucan.org/Structures/Glycans/G00672PE"
                }
            ],
            "reference": [
                {
                    "type": "PubMed",
                    "id": "7538131",
                    "url": "https://glygen.org/publication/PubMed/7538131"
                }
            ]
        },
        {
            "title": "Impairment of selectin-mediated leukocyte adhesion to venular endothelium in spontaneously hypertensive rats.",
            "journal": "The Journal of clinical investigation",
            "date": "1995",
            "authors": "Suematsu M, Suzuki H, Tamatani T, Iigou Y, DeLano FA, Miyasaka M, Forrest MJ, Kannagi R, Zweifach BW, Ishimura Y, et al.",
            "evidence": [
                {
                    "database": "GlyTouCan",
                    "id": "G00672PE",
                    "url": "https://glytoucan.org/Structures/Glycans/G00672PE"
                }
            ],
            "reference": [
                {
                    "type": "PubMed",
                    "id": "7560094",
                    "url": "https://glygen.org/publication/PubMed/7560094"
                }
            ]
        },
        {
            "title": "Specific expression of a complex sialyl Lewis X antigen on high endothelial venules of human lymph nodes: possible candidate for L-selectin ligand.",
            "journal": "Biochemical and biophysical research communications",
            "date": "1993",
            "authors": "Sawada M, Takada A, Ohwaki I, Takahashi N, Tateno H, Sakamoto J, Kannagi R",
            "evidence": [
                {
                    "database": "GlyTouCan",
                    "id": "G00672PE",
                    "url": "https://glytoucan.org/Structures/Glycans/G00672PE"
                }
            ],
            "reference": [
                {
                    "type": "PubMed",
                    "id": "7684905",
                    "url": "https://glygen.org/publication/PubMed/7684905"
                }
            ]
        },
        {
            "title": "6'-sulfated sialyl Lewis x is a major capping group of GlyCAM-1.",
            "journal": "Biochemistry",
            "date": "1994",
            "authors": "Hemmerich S, Rosen SD",
            "evidence": [
                {
                    "database": "GlyTouCan",
                    "id": "G00672PE",
                    "url": "https://glytoucan.org/Structures/Glycans/G00672PE"
                }
            ],
            "reference": [
                {
                    "type": "PubMed",
                    "id": "8161542",
                    "url": "https://glygen.org/publication/PubMed/8161542"
                }
            ]
        },
        {
            "title": "Expression of sialyl Lewis(X) in rat heart with ischaemia/reperfusion and reduction of myocardial reperfusion injury by a monoclonal antibody against sialyl Lewis(X)",
            "journal": "The Journal of pathology",
            "date": "1996",
            "authors": "Seko Y, Enokawa Y, Tamatani T, Kannagi R, Yagita H, Okumura K, Yazaki Y",
            "evidence": [
                {
                    "database": "GlyTouCan",
                    "id": "G00672PE",
                    "url": "https://glytoucan.org/Structures/Glycans/G00672PE"
                }
            ],
            "reference": [
                {
                    "type": "PubMed",
                    "id": "8958810",
                    "url": "https://glygen.org/publication/PubMed/8958810"
                }
            ]
        },
        {
            "title": "Sulfated sialyl Lewis X, the putative L-selectin ligand, detected on endothelial cells of high endothelial venules by a distinct set of anti-sialyl Lewis X antibodies.",
            "journal": "Biochemical and biophysical research communications",
            "date": "1997",
            "authors": "Mitsuoka C, Kawakami-Kimura N, Kasugai-Sawada M, Hiraiwa N, Toda K, Ishida H, Kiso M, Hasegawa A, Kannagi R",
            "evidence": [
                {
                    "database": "GlyTouCan",
                    "id": "G00672PE",
                    "url": "https://glytoucan.org/Structures/Glycans/G00672PE"
                }
            ],
            "reference": [
                {
                    "type": "PubMed",
                    "id": "9015359",
                    "url": "https://glygen.org/publication/PubMed/9015359"
                }
            ]
        },
        {
            "title": "Role of a sialyl Lewis(x)-like epitope selectively expressed on vascular endothelial cells in local skin inflammation of the rat.",
            "journal": "Journal of immunology (Baltimore, Md. : 1950)",
            "date": "1997",
            "authors": "Akahori T, Yuzawa Y, Nishikawa K, Tamatani T, Kannagi R, Miyasaka M, Okada H, Hotta N, Matsuo S",
            "evidence": [
                {
                    "database": "GlyTouCan",
                    "id": "G00672PE",
                    "url": "https://glytoucan.org/Structures/Glycans/G00672PE"
                }
            ],
            "reference": [
                {
                    "type": "PubMed",
                    "id": "9164959",
                    "url": "https://glygen.org/publication/PubMed/9164959"
                }
            ]
        },
        {
            "title": "Expression of leukocyte fucosyltransferases regulates binding to E-selectin: relationship to previously implicated carbohydrate epitopes.",
            "journal": "Journal of immunology (Baltimore, Md. : 1950)",
            "date": "1997",
            "authors": "Wagers AJ, Stoolman LM, Kannagi R, Craig R, Kansas GS",
            "evidence": [
                {
                    "database": "GlyTouCan",
                    "id": "G00672PE",
                    "url": "https://glytoucan.org/Structures/Glycans/G00672PE"
                }
            ],
            "reference": [
                {
                    "type": "PubMed",
                    "id": "9257857",
                    "url": "https://glygen.org/publication/PubMed/9257857"
                }
            ]
        },
        {
            "title": "L-Selectin ligands that are O-glycoprotease resistant and distinct from MECA-79 antigen are sufficient for tethering and rolling of lymphocytes on human high endothelial venules.",
            "journal": "The Journal of cell biology",
            "date": "1998",
            "authors": "Clark RA, Fuhlbrigge RC, Springer TA",
            "evidence": [
                {
                    "database": "GlyTouCan",
                    "id": "G00672PE",
                    "url": "https://glytoucan.org/Structures/Glycans/G00672PE"
                }
            ],
            "reference": [
                {
                    "type": "PubMed",
                    "id": "9456330",
                    "url": "https://glygen.org/publication/PubMed/9456330"
                }
            ]
        },
        {
            "title": "Identification of a major carbohydrate capping group of the L-selectin ligand on high endothelial venules in human lymph nodes as 6-sulfo sialyl Lewis X.",
            "journal": "The Journal of biological chemistry",
            "date": "1998",
            "authors": "Mitsuoka C, Sawada-Kasugai M, Ando-Furui K, Izawa M, Nakanishi H, Nakamura S, Ishida H, Kiso M, Kannagi R",
            "evidence": [
                {
                    "database": "GlyTouCan",
                    "id": "G00672PE",
                    "url": "https://glytoucan.org/Structures/Glycans/G00672PE"
                }
            ],
            "reference": [
                {
                    "type": "PubMed",
                    "id": "9556613",
                    "url": "https://glygen.org/publication/PubMed/9556613"
                }
            ]
        },
        {
            "title": "Molecular cloning and characterization of an N-acetylglucosamine-6-O-sulfotransferase.",
            "journal": "The Journal of biological chemistry",
            "date": "1998",
            "authors": "Uchimura K, Muramatsu H, Kadomatsu K, Fan QW, Kurosawa N, Mitsuoka C, Kannagi R, Habuchi O, Muramatsu T",
            "evidence": [
                {
                    "database": "GlyTouCan",
                    "id": "G00672PE",
                    "url": "https://glytoucan.org/Structures/Glycans/G00672PE"
                }
            ],
            "reference": [
                {
                    "type": "PubMed",
                    "id": "9712885",
                    "url": "https://glygen.org/publication/PubMed/9712885"
                }
            ]
        },
        {
            "title": "Novel monoclonal antibodies to putative selectin carbohydrate ligands that inhibit selectin binding to myeloid cells.",
            "journal": "Hybridoma",
            "date": "1998",
            "authors": "Zhang K, Chuluyan HE, Hardie D, Shen DC, Larsen R, Issekutz A",
            "evidence": [
                {
                    "database": "GlyTouCan",
                    "id": "G00672PE",
                    "url": "https://glytoucan.org/Structures/Glycans/G00672PE"
                }
            ],
            "reference": [
                {
                    "type": "PubMed",
                    "id": "9873990",
                    "url": "https://glygen.org/publication/PubMed/9873990"
                }
            ]
        },
        {
            "title": "Immunohistopathological characterizatin of spontaneous metastases in a human lung mucoepidermoid adenocarcinoma (HLMC) xenograft.",
            "journal": "Pathology oncology research : POR",
            "date": "1998",
            "authors": "Croce MV, Colussi AG, De Bravo MG, Price MR, Segal-Eiras A",
            "evidence": [
                {
                    "database": "GlyTouCan",
                    "id": "G00672PE",
                    "url": "https://glytoucan.org/Structures/Glycans/G00672PE"
                }
            ],
            "reference": [
                {
                    "type": "PubMed",
                    "id": "9887355",
                    "url": "https://glygen.org/publication/PubMed/9887355"
                }
            ]
        },
        {
            "title": "Mouse Siglec-F and human Siglec-8 are functionally convergent paralogs that are selectively expressed on eosinophils and recognize 6'-sulfo-sialyl Lewis X as a preferred glycan ligand.",
            "journal": "Glycobiology",
            "date": "2005",
            "authors": "Tateno H, Crocker PR, Paulson JC",
            "evidence": [
                {
                    "database": "Glycan Motif",
                    "id": "GGM.000025",
                    "url": "https://glycomotif.glyomics.org/glycomotif/GGM.000025"
                }
            ],
            "reference": [
                {
                    "type": "PubMed",
                    "id": "15972893",
                    "url": "https://glygen.org/publication/PubMed/15972893"
                }
            ]
        },
        {
            "title": "The repertoire of glycan determinants in the human glycome.",
            "journal": "Molecular bioSystems",
            "date": "2009",
            "authors": "Cummings RD",
            "evidence": [
                {
                    "database": "Glycan Motif",
                    "id": "GGM.000025",
                    "url": "https://glycomotif.glyomics.org/glycomotif/GGM.000025"
                }
            ],
            "reference": [
                {
                    "type": "PubMed",
                    "id": "19756298",
                    "url": "https://glygen.org/publication/PubMed/19756298"
                }
            ]
        }
    ],
    "residues": [],
    "composition": [
        {
            "name": "6-Deoxy-Hexose",
            "residue": "dhex",
            "count": 1,
            "cid": "840",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840"
        },
        {
            "name": "Hexose",
            "residue": "hex",
            "count": 1,
            "cid": "206",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206"
        },
        {
            "name": "N-Acetylhexosamine",
            "residue": "hexnac",
            "count": 1,
            "cid": "899",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899"
        },
        {
            "name": "Hexuronic Acid",
            "residue": "hexa",
            "count": 0,
            "cid": "610",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610"
        },
        {
            "name": "2-Amino-2-Deoxy-Hexose",
            "residue": "hexn",
            "count": 0,
            "cid": "739",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739"
        },
        {
            "name": "N-Acetyl-Neuraminic Acid",
            "residue": "neuac",
            "count": 1,
            "cid": "439197",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197"
        },
        {
            "name": "N-Glycolyl-Neuraminic Acid",
            "residue": "neugc",
            "count": 0,
            "cid": "440001",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001"
        },
        {
            "name": "Phosphate",
            "residue": "p",
            "count": 0,
            "cid": "1061",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061"
        },
        {
            "name": "Pentose",
            "residue": "pent",
            "count": 0,
            "cid": "229",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229"
        },
        {
            "name": "Sulfate",
            "residue": "s",
            "count": 1,
            "cid": "1117",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117"
        },
        {
            "name": "Other",
            "residue": "other",
            "count": 0
        }
    ],
    "composition_expanded": [
        {
            "name": "Alditol",
            "residue": "aldi",
            "count": 0
        },
        {
            "name": "6-Deoxy-Hexose",
            "residue": "dhex",
            "count": 1,
            "cid": "840",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840"
        },
        {
            "name": "6-Deoxy-Hexitol",
            "residue": "dhex+aldi",
            "count": 0
        },
        {
            "name": "L-Fucose",
            "residue": "fuc",
            "count": 1,
            "cid": "17106",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/17106"
        },
        {
            "name": "L-Fucitol",
            "residue": "fuc+aldi",
            "count": 0,
            "cid": "445724",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/445724"
        },
        {
            "name": "D-Galactose",
            "residue": "gal",
            "count": 1,
            "cid": "6036",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6036"
        },
        {
            "name": "D-Galactitol",
            "residue": "gal+aldi",
            "count": 0,
            "cid": "11850",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11850"
        },
        {
            "name": "N-Acetyl-D-galactosamine",
            "residue": "galnac",
            "count": 0,
            "cid": "35717",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/35717"
        },
        {
            "name": "N-Acetylgalactosaminitol",
            "residue": "galnac+aldi",
            "count": 0,
            "cid": "165880",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165880"
        },
        {
            "name": "D-Galacturonic Acid",
            "residue": "gala",
            "count": 0,
            "cid": "439215",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439215"
        },
        {
            "name": "D-Glucose",
            "residue": "glc",
            "count": 0,
            "cid": "5793",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5793"
        },
        {
            "name": "D-Glucitol",
            "residue": "glc+aldi",
            "count": 0,
            "cid": "5780",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5780"
        },
        {
            "name": "D-Glucuronic acid",
            "residue": "glca",
            "count": 0,
            "cid": "94715",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/94715"
        },
        {
            "name": "D-Glucosamine",
            "residue": "glcn",
            "count": 0,
            "cid": "439213",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439213"
        },
        {
            "name": "N-Acetyl-D-Glucosamine",
            "residue": "glcnac",
            "count": 1,
            "cid": "439174",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439174"
        },
        {
            "name": "N-Acetyl-D-glucosaminitol",
            "residue": "glcnac+aldi",
            "count": 0,
            "cid": "165206",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165206"
        },
        {
            "name": "Hexose",
            "residue": "hex",
            "count": 1,
            "cid": "206",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206"
        },
        {
            "name": "N-Acetylhexosamine",
            "residue": "hexnac",
            "count": 1,
            "cid": "899",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899"
        },
        {
            "name": "Hexuronic Acid",
            "residue": "hexa",
            "count": 0,
            "cid": "610",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610"
        },
        {
            "name": "2-Amino-2-Deoxy-Hexose",
            "residue": "hexn",
            "count": 0,
            "cid": "739",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739"
        },
        {
            "name": "Hexitol",
            "residue": "hex+aldi",
            "count": 0,
            "cid": "453",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/453"
        },
        {
            "name": "N-Acetylhexosaminitol",
            "residue": "hexnac+aldi",
            "count": 0
        },
        {
            "name": "L-Iduronic acid",
            "residue": "idoa",
            "count": 0,
            "cid": "441039",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/441039"
        },
        {
            "name": "D-Mannose",
            "residue": "man",
            "count": 0,
            "cid": "18950",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18950"
        },
        {
            "name": "D-Mannitol",
            "residue": "man+aldi",
            "count": 0,
            "cid": "6251",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6251"
        },
        {
            "name": "N-Acetyl-D-mannosamine",
            "residue": "mannac",
            "count": 0,
            "cid": "439281",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439281"
        },
        {
            "name": "Methyl",
            "residue": "me",
            "count": 0
        },
        {
            "name": "N-Acetyl-Neuraminic Acid",
            "residue": "neuac",
            "count": 1,
            "cid": "439197",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197"
        },
        {
            "name": "N-Glycolyl-Neuraminic Acid",
            "residue": "neugc",
            "count": 0,
            "cid": "440001",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001"
        },
        {
            "name": "Phosphate",
            "residue": "p",
            "count": 0,
            "cid": "1061",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061"
        },
        {
            "name": "Pentose",
            "residue": "pent",
            "count": 0,
            "cid": "229",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229"
        },
        {
            "name": "Sulfate",
            "residue": "s",
            "count": 1,
            "cid": "1117",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117"
        },
        {
            "name": "Sialic acid",
            "residue": "sia",
            "count": 1
        },
        {
            "name": "Other",
            "residue": "other",
            "count": 0
        },
        {
            "name": "Floating substituent",
            "residue": "x",
            "count": 0
        },
        {
            "name": "D-Xylose",
            "residue": "xyl",
            "count": 0,
            "cid": "135191",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135191"
        },
        {
            "name": "Ketodeoxynononic acid",
            "residue": "kdn",
            "count": 0,
            "cid": "13991616",
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13991616"
        }
    ],
    "motifs": [
        {
            "id": "GGM.000001",
            "name": "Type 2 LN",
            "synonym": "N-acetyllactosamine",
            "keywords": "LacNAc; N-acetyllactosamine; N-acetyllactosamine type 2"
        },
        {
            "id": "GGM.000018",
            "name": "Lewis x",
            "synonym": "Le^x; Lex; SSEA-1",
            "keywords": "Lewis x"
        },
        {
            "id": "GGM.000022",
            "name": "Sialyl Lewis x",
            "synonym": "SLe^x; SLex; Slex",
            "keywords": "Lewis x"
        },
        {
            "id": "GGM.000025",
            "name": "6'-Sulfo-sialyl Lewis x",
            "synonym": "6'-Sulfo Sialyl Lewis x; 6'-sulfo SLe^x; 6'-sulfo SLex",
            "keywords": "Lewis x"
        },
        {
            "id": "GGM.000034",
            "name": "3-Sialyl-LN (type 2)",
            "synonym": "",
            "keywords": "LacNAc; N-acetyllactosamine; N-acetyllactosamine type 2"
        }
    ],
    "interactions": [],
    "expression": [],
    "tissue": [],
    "subsumption": [
        {
            "related_accession": "G00106LE",
            "relationship": "ancestor"
        },
        {
            "related_accession": "G05761AI",
            "relationship": "ancestor"
        },
        {
            "related_accession": "G08961VV",
            "relationship": "ancestor"
        },
        {
            "related_accession": "G32987YD",
            "relationship": "ancestor"
        },
        {
            "related_accession": "G43616FK",
            "relationship": "ancestor"
        },
        {
            "related_accession": "G53619TU",
            "relationship": "ancestor"
        },
        {
            "related_accession": "G58326GX",
            "relationship": "ancestor"
        },
        {
            "related_accession": "G73357FZ",
            "relationship": "ancestor"
        },
        {
            "related_accession": "G77659VW",
            "relationship": "ancestor"
        },
        {
            "related_accession": "G87148SV",
            "relationship": "ancestor"
        },
        {
            "related_accession": "G93737GA",
            "relationship": "ancestor"
        },
        {
            "related_accession": "G98044QF",
            "relationship": "ancestor"
        },
        {
            "related_accession": "G73357FZ",
            "relationship": "basecomposition"
        },
        {
            "related_accession": "G98044QF",
            "relationship": "composition"
        },
        {
            "related_accession": "G77659VW",
            "relationship": "subsumedby"
        },
        {
            "related_accession": "G32987YD",
            "relationship": "topology"
        }
    ],
    "names": [
        {
            "name": "6'-Sulfo-sialyl Lewis x",
            "domain": "motifname"
        },
        {
            "name": "6'-Sulfo Sialyl Lewis x",
            "domain": "motifsynonym"
        },
        {
            "name": " 6'-sulfo SLe^x",
            "domain": "motifsynonym"
        },
        {
            "name": " 6'-sulfo SLex",
            "domain": "motifsynonym"
        }
    ],
    "keywords": [
        "fully_determined"
    ],
    "glycotree_pathways": [],
    "dictionary": {
        "term": "6'-Sulfo Sialyl Lewis x",
        "term_in_sentence": "Studies using sulfotransferase-deficient mice showed that 6-sulfo sialyl Lewis X (6-sulfo sLe(x)), a major ligand for L-selectin that is expressed on the high endothelial venules (HEVs), plays critical roles in lymphocyte homing to the peripheral lymph nodes.[PMID:2288521]",
        "publication": "2288521|26137907|9400621|32744401|9556613|15972893|9015359|22691873|18652681|9722682|10435581|19458105|19359410|15228275|18250165|10536036|17944600|10460836|27993973|19149511|19150806|17172261|17142960|27956273|7578028|22260995|24519996|21596021|21982762|21775439|17334369|9710564|14593101|16227985|11895802|22750968|15157883|19067429",
        "definition": "A branched amino tetrasaccharide comprised of a trisaccharide chain of N-acetyl-\u03b1-neuraminic acid, 6-O-sulfo-\u03b2-D-glactose and N-acetyl-\u03b2-D-glucosamine residues linked sequentially (2\u21923) and (1\u21924), to the GlcNAC residue of which is also linked (1\u21923) an \u03b1-L-fucose residue.[CHEBI:71558]",
        "term_xref": "GlycoMotif:GGM.000025|GTC:G00672PE|CID:70698387|GlycoEpitope:EP0014|CHEBI:71558|SugarBind_Ligand:128",
        "synonymns": [
            "6'-sulfated sialyl Lewis x-",
            "6'-sulfo-sLe(x)",
            "Su-SaiLex",
            "Su-Slex",
            "6'-Sulfo-sialyl Lewis x"
        ],
        "function": "lymphocyte homing[GlycoEpitope:EP0014]",
        "disease_associations": "Influenza[SugarBind_Ligand:128]",
        "wikipedia": "",
        "essentials_of_glycobiology": "Chapter 14",
        "evidence": [
            {
                "id": "GSD000011",
                "url": "https://wiki.glygen.org/Glycan_structure_dictionary#GSD000011",
                "database": "Glycan Structure Dictionary"
            }
        ]
    },
    "biomarkers": [],
    "section_stats": [
        {
            "table_id": "glycoprotein",
            "table_stats": [
                {
                    "field": "total",
                    "count": 0
                },
                {
                    "field": "total_sites",
                    "count": 0
                }
            ],
            "sort_fields": []
        },
        {
            "table_id": "expression",
            "table_stats": [
                {
                    "field": "total",
                    "count": 0
                },
                {
                    "field": "total_sites",
                    "count": 0
                }
            ],
            "sort_fields": []
        },
        {
            "table_id": "expression_tissue",
            "table_stats": [
                {
                    "field": "total",
                    "count": 0
                },
                {
                    "field": "total_sites",
                    "count": 0
                }
            ],
            "sort_fields": []
        },
        {
            "table_id": "expression_cell_line",
            "table_stats": [
                {
                    "field": "total",
                    "count": 0
                },
                {
                    "field": "total_sites",
                    "count": 0
                }
            ],
            "sort_fields": []
        },
        {
            "table_id": "publication",
            "table_stats": [
                {
                    "field": "total",
                    "count": 28
                }
            ],
            "sort_fields": [
                "title",
                "journal",
                "date",
                "authors"
            ]
        }
    ]
}