{
    "number_monosaccharides": 3, 
    "inchi_key": {
        "url": "https://pubchem.ncbi.nlm.nih.gov/compound/CILYIEBUXJIHCO-UITFWXMXSA-N", 
        "key": "CILYIEBUXJIHCO-UITFWXMXSA-N"
    }, 
    "glycans": [
        {
            "url": "https://glytoucan.org/Structures/Glycans/G91237TK", 
            "glytoucan_ac": "G91237TK"
        }
    ], 
    "smiles_isomeric": "CC(=O)N[C@@H]1[C@H](C[C@@](O[C@H]1[C@@H]([C@@H](CO)O)O)(C(=O)O)O[C@H]2[C@H]([C@H](O[C@H]([C@@H]2O)O[C@@H]3[C@H](O[C@H]([C@@H]([C@H]3O)O)O)CO)CO)O)O", 
    "mass_pme": 815.42, 
    "names": [
        {
            "domain": "Semantic Name", 
            "name": "GM3"
        }, 
        {
            "domain": "motifname", 
            "name": "GM3"
        }
    ], 
    "fully_determined": "yes", 
    "keywords": [
        {
            "url": "https://glycomotif.glyomics.org/glycomotif/Glycolipid", 
            "label": "Glycolipid"
        }
    ], 
    "wurcs": "WURCS=2.0/3,3,2/[a2122h-1b_1-5][a2112h-1b_1-5][Aad21122h-2a_2-6_5*NCC/3=O]/1-2-3/a4-b1_b3-c2", 
    "publication": [
        {
            "reference": [
                {
                    "url": "https://www.ncbi.nlm.nih.gov/pubmed/1627599", 
                    "type": [
                        "PubMed"
                    ], 
                    "id": "1627599"
                }
            ], 
            "title": "Generation of one set of monoclonal antibodies specific for a-pathway ganglio-series gangliosides.", 
            "journal": "Biochimica et biophysica acta", 
            "evidence": [
                {
                    "url": "https://glytoucan.org/Structures/Glycans/G91237TK", 
                    "id": "G91237TK", 
                    "database": "GlyTouCan"
                }
            ], 
            "authors": "Kotani M, Ozawa H, Kawashima I, Ando S, Tai T", 
            "date": "1992"
        }, 
        {
            "reference": [
                {
                    "url": "https://www.ncbi.nlm.nih.gov/pubmed/2908845", 
                    "type": [
                        "PubMed"
                    ], 
                    "id": "2908845"
                }
            ], 
            "title": "Two human monoclonal antibodies reacting with the major gangliosides of human melanomas and comparison with corresponding mouse monoclonal antibodies.", 
            "journal": "Cancer research", 
            "evidence": [
                {
                    "url": "https://glytoucan.org/Structures/Glycans/G91237TK", 
                    "id": "G91237TK", 
                    "database": "GlyTouCan"
                }
            ], 
            "authors": "Furukawa K, Yamaguchi H, Oettgen HF, Old LJ, Lloyd KO", 
            "date": "1989"
        }, 
        {
            "reference": [
                {
                    "url": "https://www.ncbi.nlm.nih.gov/pubmed/8262898", 
                    "type": [
                        "PubMed"
                    ], 
                    "id": "8262898"
                }
            ], 
            "title": "Characterization of ganglioside expression in human melanoma cells: immunological and biochemical analysis.", 
            "journal": "Journal of biochemistry", 
            "evidence": [
                {
                    "url": "https://glytoucan.org/Structures/Glycans/G91237TK", 
                    "id": "G91237TK", 
                    "database": "GlyTouCan"
                }
            ], 
            "authors": "Kawashima I, Ozawa H, Kotani M, Suzuki M, Kawano T, Gomibuchi M, Tai T", 
            "date": "1993"
        }, 
        {
            "reference": [
                {
                    "url": "https://www.ncbi.nlm.nih.gov/pubmed/19756298", 
                    "type": [
                        "PubMed"
                    ], 
                    "id": "19756298"
                }
            ], 
            "title": "The repertoire of glycan determinants in the human glycome.", 
            "journal": "Molecular bioSystems", 
            "evidence": [
                {
                    "url": "https://glycomotif.glyomics.org/glycomotif/GGM.000090", 
                    "id": "GGM.000090", 
                    "database": "Glycan Motif"
                }
            ], 
            "authors": "Cummings RD", 
            "date": "2009"
        }, 
        {
            "reference": [
                {
                    "url": "https://www.ncbi.nlm.nih.gov/pubmed/8891271", 
                    "type": [
                        "PubMed"
                    ], 
                    "id": "8891271"
                }
            ], 
            "title": "Immunocytochemical analysis of gangliosides in rat primary cerebellar cultures using specific monoclonal antibodies.", 
            "journal": "Brain research", 
            "evidence": [
                {
                    "url": "https://glytoucan.org/Structures/Glycans/G91237TK", 
                    "id": "G91237TK", 
                    "database": "GlyTouCan"
                }
            ], 
            "authors": "Kawashima I, Nagata I, Tai T", 
            "date": "1996"
        }, 
        {
            "reference": [
                {
                    "url": "https://www.ncbi.nlm.nih.gov/pubmed/2414279", 
                    "type": [
                        "PubMed"
                    ], 
                    "id": "2414279"
                }
            ], 
            "title": "Syngeneic monoclonal antibody against melanoma antigen with interspecies cross-reactivity recognizes GM3, a prominent ganglioside of B16 melanoma.", 
            "journal": "The Journal of biological chemistry", 
            "evidence": [
                {
                    "url": "https://glycomotif.glyomics.org/glycomotif/GGM.000090", 
                    "id": "GGM.000090", 
                    "database": "Glycan Motif"
                }
            ], 
            "authors": "Hirabayashi Y, Hamaoka A, Matsumoto M, Matsubara T, Tagawa M, Wakabayashi S, Taniguchi M", 
            "date": "1985"
        }, 
        {
            "reference": [
                {
                    "url": "https://www.ncbi.nlm.nih.gov/pubmed/3167827", 
                    "type": [
                        "PubMed"
                    ], 
                    "id": "3167827"
                }
            ], 
            "title": "An IgG3 monoclonal antibody established after immunization with GM3 lactone: immunochemical specificity and inhibition of melanoma cell growth in vitro and in vivo.", 
            "journal": "Cancer research", 
            "evidence": [
                {
                    "url": "https://glytoucan.org/Structures/Glycans/G91237TK", 
                    "id": "G91237TK", 
                    "database": "GlyTouCan"
                }
            ], 
            "authors": "Dohi T, Nores G, Hakomori S", 
            "date": "1988"
        }, 
        {
            "reference": [
                {
                    "url": "https://www.ncbi.nlm.nih.gov/pubmed/16621820", 
                    "type": [
                        "PubMed"
                    ], 
                    "id": "16621820"
                }
            ], 
            "title": "Mutation of waaC, encoding heptosyltransferase I in Campylobacter jejuni 81-176, affects the structure of both lipooligosaccharide and capsular carbohydrate.", 
            "journal": "Journal of bacteriology", 
            "evidence": [
                {
                    "url": "https://glytoucan.org/Structures/Glycans/G91237TK", 
                    "id": "G91237TK", 
                    "database": "GlyTouCan"
                }
            ], 
            "authors": "Kanipes MI, Papp-Szabo E, Guerry P, Monteiro MA", 
            "date": "2006"
        }, 
        {
            "reference": [
                {
                    "url": "https://www.ncbi.nlm.nih.gov/pubmed/2414279", 
                    "type": [
                        "PubMed"
                    ], 
                    "id": "2414279"
                }
            ], 
            "title": "Syngeneic monoclonal antibody against melanoma antigen with interspecies cross-reactivity recognizes GM3, a prominent ganglioside of B16 melanoma.", 
            "journal": "The Journal of biological chemistry", 
            "evidence": [
                {
                    "url": "https://glytoucan.org/Structures/Glycans/G91237TK", 
                    "id": "G91237TK", 
                    "database": "GlyTouCan"
                }
            ], 
            "authors": "Hirabayashi Y, Hamaoka A, Matsumoto M, Matsubara T, Tagawa M, Wakabayashi S, Taniguchi M", 
            "date": "1985"
        }, 
        {
            "reference": [
                {
                    "url": "https://www.ncbi.nlm.nih.gov/pubmed/3031684", 
                    "type": [
                        "PubMed"
                    ], 
                    "id": "3031684"
                }
            ], 
            "title": "Cell-surface antigens of melanoma recognized by human monoclonal antibodies.", 
            "journal": "Proceedings of the National Academy of Sciences of the United States of America", 
            "evidence": [
                {
                    "url": "https://glytoucan.org/Structures/Glycans/G91237TK", 
                    "id": "G91237TK", 
                    "database": "GlyTouCan"
                }
            ], 
            "authors": "Yamaguchi H, Furukawa K, Fortunato SR, Livingston PO, Lloyd KO, Oettgen HF, Old LJ", 
            "date": "1987"
        }, 
        {
            "reference": [
                {
                    "url": "https://www.ncbi.nlm.nih.gov/pubmed/23747419", 
                    "type": [
                        "PubMed"
                    ], 
                    "id": "23747419"
                }
            ], 
            "title": "Influenza virus utilizes N-linked sialoglycans as receptors in A549 cells.", 
            "journal": "Biochemical and biophysical research communications", 
            "evidence": [
                {
                    "url": "https://glytoucan.org/Structures/Glycans/G91237TK", 
                    "id": "G91237TK", 
                    "database": "GlyTouCan"
                }
            ], 
            "authors": "Hidari KI, Yamaguchi M, Ueno F, Abe T, Yoshida K, Suzuki T", 
            "date": "2013"
        }, 
        {
            "reference": [
                {
                    "url": "https://www.ncbi.nlm.nih.gov/pubmed/8586620", 
                    "type": [
                        "PubMed"
                    ], 
                    "id": "8586620"
                }
            ], 
            "title": "Production of monoclonal antibodies directed to Hanganutziu-Deicher active gangliosides, N-glycolylneuraminic acid-containing gangliosides.", 
            "journal": "Journal of biochemistry", 
            "evidence": [
                {
                    "url": "https://glytoucan.org/Structures/Glycans/G91237TK", 
                    "id": "G91237TK", 
                    "database": "GlyTouCan"
                }
            ], 
            "authors": "Watarai S, Kushi Y, Shigeto R, Misawa N, Eishi Y, Handa S, Yasuda T", 
            "date": "1995"
        }, 
        {
            "reference": [
                {
                    "url": "https://www.ncbi.nlm.nih.gov/pubmed/7734848", 
                    "type": [
                        "PubMed"
                    ], 
                    "id": "7734848"
                }
            ], 
            "title": "Immunohistochemical localization of minor gangliosides in the rat central nervous system.", 
            "journal": "Glycobiology", 
            "evidence": [
                {
                    "url": "https://glytoucan.org/Structures/Glycans/G91237TK", 
                    "id": "G91237TK", 
                    "database": "GlyTouCan"
                }
            ], 
            "authors": "Kotani M, Kawashima I, Ozawa H, Ogura K, Ishizuka I, Terashima T, Tai T", 
            "date": "1994"
        }
    ], 
    "subsumption": [
        {
            "type": "Saccharide", 
            "id": "G88648CM"
        }, 
        {
            "type": "Topology", 
            "id": "G55935LQ"
        }, 
        {
            "type": "Composition", 
            "id": "G66150FA"
        }, 
        {
            "type": "Saccharide", 
            "id": "G93210GW"
        }, 
        {
            "type": "Saccharide", 
            "id": "G38552LX"
        }, 
        {
            "type": "Saccharide", 
            "id": "G56516VH"
        }, 
        {
            "type": "Topology", 
            "id": "G04286CT"
        }, 
        {
            "type": "Topology", 
            "id": "G46542GF"
        }, 
        {
            "type": "Saccharide", 
            "id": "G27512ST"
        }, 
        {
            "type": "Saccharide", 
            "id": "G55169DK"
        }, 
        {
            "type": "Topology", 
            "id": "G19024QK"
        }, 
        {
            "type": "Saccharide", 
            "id": "G40764VP"
        }, 
        {
            "type": "Saccharide", 
            "id": "G02123VE"
        }, 
        {
            "type": "Composition", 
            "id": "G17756LB"
        }, 
        {
            "type": "Saccharide", 
            "id": "G32698HD"
        }, 
        {
            "type": "Topology", 
            "id": "G98253AE"
        }, 
        {
            "type": "Topology", 
            "id": "G39794DJ"
        }, 
        {
            "type": "Topology", 
            "id": "G15736PY"
        }, 
        {
            "type": "Topology", 
            "id": "G52038HJ"
        }, 
        {
            "type": "Saccharide", 
            "id": "G82513QY"
        }, 
        {
            "type": "Saccharide", 
            "id": "G46110TF"
        }, 
        {
            "type": "Saccharide", 
            "id": "G10479NG"
        }, 
        {
            "type": "Saccharide", 
            "id": "G04610NG"
        }, 
        {
            "type": "Composition", 
            "id": "G44859EL"
        }, 
        {
            "type": "Topology", 
            "id": "G04256AW"
        }, 
        {
            "type": "Composition", 
            "id": "G94094XU"
        }, 
        {
            "type": "Saccharide", 
            "id": "G91260HM"
        }, 
        {
            "type": "Saccharide", 
            "id": "G25984EB"
        }, 
        {
            "type": "Composition", 
            "id": "G69972LT"
        }, 
        {
            "type": "BaseComposition", 
            "id": "G62055US"
        }, 
        {
            "type": "Composition", 
            "id": "G35498QW"
        }
    ], 
    "motif_ac": "GGM.000090", 
    "glytoucan_ac": "G91237TK", 
    "composition": [
        {
            "residue": "p", 
            "count": 0, 
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061", 
            "name": "Phosphate", 
            "cid": "1061"
        }, 
        {
            "residue": "neugc", 
            "count": 0, 
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001", 
            "name": "N-Glycolyl-Neuraminic Acid", 
            "cid": "440001"
        }, 
        {
            "residue": "neuac", 
            "count": 1, 
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197", 
            "name": "N-Acetyl-Neuraminic Acid", 
            "cid": "439197"
        }, 
        {
            "residue": "s", 
            "count": 0, 
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117", 
            "name": "Sulfate", 
            "cid": "1117"
        }, 
        {
            "residue": "hex", 
            "count": 2, 
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206", 
            "name": "Hexose", 
            "cid": "206"
        }, 
        {
            "residue": "hexn", 
            "count": 0, 
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739", 
            "name": "2-Amino-2-Deoxy-Hexose", 
            "cid": "739"
        }, 
        {
            "residue": "hexa", 
            "count": 0, 
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610", 
            "name": "Hexuronic Acid", 
            "cid": "610"
        }, 
        {
            "residue": "hexnac", 
            "count": 0, 
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899", 
            "name": "N-Acetylhexosamine", 
            "cid": "899"
        }, 
        {
            "residue": "dhex", 
            "count": 0, 
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840", 
            "name": "6-Deoxy-Hexose", 
            "cid": "840"
        }, 
        {
            "residue": "other", 
            "count": 0, 
            "name": "Other"
        }
    ], 
    "alignment_method": "Whole-Glycan", 
    "residues": [], 
    "glycam": "DNeup5Aca2-3DGalpb1-4DGlcpb1-", 
    "inchi": "InChI=1S/C23H39NO19/c1-6(28)24-11-7(29)2-23(22(37)38,42-18(11)12(31)8(30)3-25)43-19-13(32)9(4-26)40-21(16(19)35)41-17-10(5-27)39-20(36)15(34)14(17)33/h7-21,25-27,29-36H,2-5H2,1H3,(H,24,28)(H,37,38)/t7-,8+,9+,10+,11+,12+,13-,14+,15+,16+,17+,18+,19-,20+,21-,23-/m0/s1", 
    "crossref": [
        {
            "url": "https://glytoucan.org/Structures/Glycans/G91237TK", 
            "id": "G91237TK", 
            "database": "GlyTouCan"
        }
    ], 
    "synonym": [], 
    "reducing_end": "true", 
    "glycoct": "RES 1b:b-dglc-HEX-1:5 2b:b-dgal-HEX-1:5 3b:a-dgro-dgal-NON-2:6|1:a|2:keto|3:d 4s:n-acetyl LIN 1:1o(4+1)2d 2:2o(3+2)3d 3:3d(5+1)4n", 
    "iupac": "alpha-D-NeupAc-(2->3)-beta-D-Galp-(1->4)-beta-D-Glcp-(1->", 
    "aglycon": "Cer", 
    "mass": 633.21
}