{ "number_monosaccharides": 5, "inchi_key": { "url": "https://pubchem.ncbi.nlm.nih.gov/compound/UPMYJLDHPCCTMK-ZTBPGHTDSA-N", "key": "UPMYJLDHPCCTMK-ZTBPGHTDSA-N" }, "glycans": [ { "url": "https://glytoucan.org/Structures/Glycans/G99053DY", "glytoucan_ac": "G99053DY" } ], "smiles_isomeric": "CC(=O)N[C@@H]1[C@H]([C@H]([C@H](O[C@H]1O[C@H]2[C@H]([C@H](O[C@@H]([C@@H]2O)O[C@H]3[C@H](O[C@H]([C@@H]([C@H]3O)O)O[C@@H]4[C@H](O[C@H]([C@@H]([C@H]4O)O)O)CO)CO)CO)O)CO)O)O[C@H]5[C@@H]([C@H]([C@H]([C@H](O5)CO)O)O)O", "mass_pme": 1107.57, "names": [ { "domain": "Semantic Name", "name": "Gb5" }, { "domain": "Semantic Name", "name": "SSEA-3" }, { "domain": "motifname", "name": "Gb5" } ], "fully_determined": "yes", "keywords": [ { "url": "https://glycomotif.glyomics.org/glycomotif/Glycolipid", "label": "Glycolipid" } ], "wurcs": "WURCS=2.0/4,5,4/[a2122h-1b_1-5][a2112h-1b_1-5][a2112h-1a_1-5][a2112h-1b_1-5_2*NCC/3=O]/1-2-3-4-2/a4-b1_b4-c1_c3-d1_d3-e1", "publication": [ { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2837767", "type": [ "PubMed" ], "id": "2837767" } ], "title": "Recognition of galactosylgloboside by monoclonal antibodies derived from patients with primary lung cancer.", "journal": "Proceedings of the National Academy of Sciences of the United States of America", "evidence": [ { "url": "https://glytoucan.org/Structures/Glycans/G99053DY", "id": "G99053DY", "database": "GlyTouCan" } ], "authors": "Schrump DS, Furukawa K, Yamaguchi H, Lloyd KO, Old LJ", "date": "1988" }, { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/19756298", "type": [ "PubMed" ], "id": "19756298" } ], "title": "The repertoire of glycan determinants in the human glycome.", "journal": "Molecular bioSystems", "evidence": [ { "url": "https://glycomotif.glyomics.org/glycomotif/GGM.000076", "id": "GGM.000076", "database": "Glycan Motif" } ], "authors": "Cummings RD", "date": "2009" }, { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/6183004", "type": [ "PubMed" ], "id": "6183004" } ], "title": "Monoclonal antibody to murine embryos defines a stage-specific embryonic antigen expressed on mouse embryos and human teratocarcinoma cells.", "journal": "Cell", "evidence": [ { "url": "https://glycomotif.glyomics.org/glycomotif/GGM.000079", "id": "GGM.000079", "database": "Glycan Motif" } ], "authors": "Shevinsky LH, Knowles BB, Damjanov I, Solter D", "date": "1982" }, { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/3297853", "type": [ "PubMed" ], "id": "3297853" } ], "title": "Glycolipid core structure switching from globo- to lacto- and ganglio-series during retinoic acid-induced differentiation of TERA-2-derived human embryonal carcinoma cells.", "journal": "Developmental biology", "evidence": [ { "url": "https://glycomotif.glyomics.org/glycomotif/GGM.000076", "id": "GGM.000076", "database": "Glycan Motif" } ], "authors": "Fenderson BA, Andrews PW, Nudelman E, Clausen H, Hakomori S", "date": "1987" }, { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/3364985", "type": [ "PubMed" ], "id": "3364985" } ], "title": "Monoclonal antibodies that bind to galactosylgloboside (SSEA-3 antigen).", "journal": "Archives of biochemistry and biophysics", "evidence": [ { "url": "https://glytoucan.org/Structures/Glycans/G99053DY", "id": "G99053DY", "database": "GlyTouCan" } ], "authors": "Marcus DM, Gilbert S, Sekine M, Suzuki A", "date": "1988" } ], "subsumption": [ { "type": "Saccharide", "id": "G19298OA" }, { "type": "BaseComposition", "id": "G59986YN" }, { "type": "Topology", "id": "G42925XE" }, { "type": "BaseComposition", "id": "G15666IG" }, { "type": "Saccharide", "id": "G90539LD" }, { "type": "Composition", "id": "G47397QL" }, { "type": "Topology", "id": "G36723FO" } ], "motif_ac": "GGM.000076", "glytoucan_ac": "G99053DY", "composition": [ { "residue": "neuac", "count": 0, "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197", "name": "N-Acetyl-Neuraminic Acid", "cid": "439197" }, { "residue": "s", "count": 0, "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117", "name": "Sulfate", "cid": "1117" }, { "residue": "hexn", "count": 0, "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739", "name": "2-Amino-2-Deoxy-Hexose", "cid": "739" }, { "residue": "neugc", "count": 0, "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001", "name": "N-Glycolyl-Neuraminic Acid", "cid": "440001" }, { "residue": "p", "count": 0, "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061", "name": "Phosphate", "cid": "1061" }, { "residue": "other", "count": 0, "name": "Other" }, { "residue": "hex", "count": 4, "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206", "name": "Hexose", "cid": "206" }, { "residue": "dhex", "count": 0, "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840", "name": "6-Deoxy-Hexose", "cid": "840" }, { "residue": "hexa", "count": 0, "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610", "name": "Hexuronic Acid", "cid": "610" }, { "residue": "hexnac", "count": 1, "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899", "name": "N-Acetylhexosamine", "cid": "899" } ], "alignment_method": "Whole-Glycan", "residues": [], "glycam": "DGalpb1-3DGalpNAcb1-3DGalpa1-4DGalpb1-4DGlcpb1-", "inchi": "InChI=1S/C32H55NO26/c1-7(39)33-13-26(58-30-21(47)17(43)14(40)8(2-34)53-30)15(41)9(3-35)52-29(13)59-27-16(42)10(4-36)54-32(23(27)49)57-25-12(6-38)55-31(22(48)19(25)45)56-24-11(5-37)51-28(50)20(46)18(24)44/h8-32,34-38,40-50H,2-6H2,1H3,(H,33,39)/t8-,9-,10-,11-,12-,13-,14+,15+,16+,17+,18-,19-,20-,21-,22-,23-,24-,25+,26-,27+,28-,29+,30+,31+,32-/m1/s1", "crossref": [ { "url": "https://glytoucan.org/Structures/Glycans/G99053DY", "id": "G99053DY", "database": "GlyTouCan" } ], "synonym": [ "Globopentaosylceramide" ], "reducing_end": "true", "glycoct": "RES 1b:b-dglc-HEX-1:5 2b:b-dgal-HEX-1:5 3b:a-dgal-HEX-1:5 4b:b-dgal-HEX-1:5 5s:n-acetyl 6b:b-dgal-HEX-1:5 LIN 1:1o(4+1)2d 2:2o(4+1)3d 3:3o(3+1)4d 4:4d(2+1)5n 5:4o(3+1)6d", "iupac": "beta-D-Galp-(1->3)-beta-D-GalpNAc-(1->3)-alpha-D-Galp-(1->4)-beta-D-Galp-(1->4)-beta-D-Glcp-(1->", "aglycon": "Cer", "mass": 869.3 }