{
    "number_monosaccharides": 1, 
    "inchi_key": {}, 
    "glycans": [
        {
            "url": "https://glytoucan.org/Structures/Glycans/G72548RZ", 
            "glytoucan_ac": "G72548RZ"
        }
    ], 
    "smiles_isomeric": "C([C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)O)O)OS(=O)(=O)O)O)O", 
    "mass_pme": 316.08, 
    "names": [
        {
            "domain": "Semantic Name", 
            "name": "Seminolipid"
        }, 
        {
            "domain": "Semantic Name", 
            "name": "Sulfatide"
        }, 
        {
            "domain": "motifname", 
            "name": "Seminolipid"
        }
    ], 
    "fully_determined": "yes", 
    "keywords": [
        {
            "url": "https://glycomotif.glyomics.org/glycomotif/Glycolipid", 
            "label": "Glycolipid"
        }
    ], 
    "wurcs": "WURCS=2.0/1,1,0/[a2112h-1b_1-5_3*OSO/3=O/3=O]/1/", 
    "publication": [
        {
            "reference": [
                {
                    "url": "https://www.ncbi.nlm.nih.gov/pubmed/4855831", 
                    "type": [
                        "PubMed"
                    ], 
                    "id": "4855831"
                }
            ], 
            "title": "Preparation and properties of anti-sulfatide serum.", 
            "journal": "Journal of immunology (Baltimore, Md. : 1950)", 
            "evidence": [
                {
                    "url": "https://glycomotif.glyomics.org/glycomotif/GGM.000063", 
                    "id": "GGM.000063", 
                    "database": "Glycan Motif"
                }
            ], 
            "authors": "Hakomori S", 
            "date": "1974"
        }, 
        {
            "reference": [
                {
                    "url": "https://www.ncbi.nlm.nih.gov/pubmed/14583626", 
                    "type": [
                        "PubMed"
                    ], 
                    "id": "14583626"
                }
            ], 
            "title": "Cerebroside sulfotransferase deficiency ameliorates L-selectin-dependent monocyte infiltration in the kidney after ureteral obstruction.", 
            "journal": "The Journal of biological chemistry", 
            "evidence": [
                {
                    "url": "https://glytoucan.org/Structures/Glycans/G72548RZ", 
                    "id": "G72548RZ", 
                    "database": "GlyTouCan"
                }
            ], 
            "authors": "Ogawa D, Shikata K, Honke K, Sato S, Matsuda M, Nagase R, Tone A, Okada S, Usui H, Wada J, Miyasaka M, Kawashima H, Suzuki Y, Suzuki T, Taniguchi N, Hirahara Y, Tadano-Aritomi K, Ishizuka I, Tedder TF, Makino H", 
            "date": "2004"
        }, 
        {
            "reference": [
                {
                    "url": "https://www.ncbi.nlm.nih.gov/pubmed/19756298", 
                    "type": [
                        "PubMed"
                    ], 
                    "id": "19756298"
                }
            ], 
            "title": "The repertoire of glycan determinants in the human glycome.", 
            "journal": "Molecular bioSystems", 
            "evidence": [
                {
                    "url": "https://glycomotif.glyomics.org/glycomotif/GGM.000062", 
                    "id": "GGM.000062", 
                    "database": "Glycan Motif"
                }
            ], 
            "authors": "Cummings RD", 
            "date": "2009"
        }, 
        {
            "reference": [
                {
                    "url": "https://www.ncbi.nlm.nih.gov/pubmed/2373957", 
                    "type": [
                        "PubMed"
                    ], 
                    "id": "2373957"
                }
            ], 
            "title": "High-resolution proton nuclear magnetic resonance characterization of seminolipid from bovine spermatozoa.", 
            "journal": "Journal of lipid research", 
            "evidence": [
                {
                    "url": "https://glycomotif.glyomics.org/glycomotif/GGM.000062", 
                    "id": "GGM.000062", 
                    "database": "Glycan Motif"
                }
            ], 
            "authors": "Alvarez JG, Storey BT, Hemling ML, Grob RL", 
            "date": "1990"
        }, 
        {
            "reference": [
                {
                    "url": "https://www.ncbi.nlm.nih.gov/pubmed/6379201", 
                    "type": [
                        "PubMed"
                    ], 
                    "id": "6379201"
                }
            ], 
            "title": "Production and characterization of monoclonal antibodies to the myelin glycolipid sulfatide.", 
            "journal": "Journal of neuroscience research", 
            "evidence": [
                {
                    "url": "https://glytoucan.org/Structures/Glycans/G72548RZ", 
                    "id": "G72548RZ", 
                    "database": "GlyTouCan"
                }
            ], 
            "authors": "Hofstetter W, Bologa L, Wetterwald A, Z'graggen A, Blaser K, Herschkowitz N", 
            "date": "1984"
        }
    ], 
    "subsumption": [
        {
            "type": "Topology", 
            "id": "G40843KY"
        }, 
        {
            "type": "BaseComposition", 
            "id": "G66133LO"
        }, 
        {
            "type": "Topology", 
            "id": "G82909UF"
        }, 
        {
            "type": "Saccharide", 
            "id": "G07169WN"
        }, 
        {
            "type": "Saccharide", 
            "id": "G31618LI"
        }, 
        {
            "type": "BaseComposition", 
            "id": "G94024VN"
        }
    ], 
    "motif_ac": "GGM.000062", 
    "glytoucan_ac": "G72548RZ", 
    "composition": [
        {
            "residue": "dhex", 
            "count": 0, 
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840", 
            "name": "6-Deoxy-Hexose", 
            "cid": "840"
        }, 
        {
            "residue": "neugc", 
            "count": 0, 
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001", 
            "name": "N-Glycolyl-Neuraminic Acid", 
            "cid": "440001"
        }, 
        {
            "residue": "other", 
            "count": 0, 
            "name": "Other"
        }, 
        {
            "residue": "s", 
            "count": 1, 
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117", 
            "name": "Sulfate", 
            "cid": "1117"
        }, 
        {
            "residue": "neuac", 
            "count": 0, 
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197", 
            "name": "N-Acetyl-Neuraminic Acid", 
            "cid": "439197"
        }, 
        {
            "residue": "hexn", 
            "count": 0, 
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739", 
            "name": "2-Amino-2-Deoxy-Hexose", 
            "cid": "739"
        }, 
        {
            "residue": "hexa", 
            "count": 0, 
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610", 
            "name": "Hexuronic Acid", 
            "cid": "610"
        }, 
        {
            "residue": "hex", 
            "count": 1, 
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206", 
            "name": "Hexose", 
            "cid": "206"
        }, 
        {
            "residue": "hexnac", 
            "count": 0, 
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899", 
            "name": "N-Acetylhexosamine", 
            "cid": "899"
        }, 
        {
            "residue": "p", 
            "count": 0, 
            "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061", 
            "name": "Phosphate", 
            "cid": "1061"
        }
    ], 
    "alignment_method": "Whole-Glycan", 
    "residues": [], 
    "glycam": "DGalp[3S]b1-", 
    "inchi": "", 
    "crossref": [
        {
            "url": "https://glytoucan.org/Structures/Glycans/G72548RZ", 
            "id": "G72548RZ", 
            "database": "GlyTouCan"
        }
    ], 
    "synonym": [], 
    "reducing_end": "true", 
    "glycoct": "RES 1b:b-dgal-HEX-1:5 2s:sulfate LIN 1:1o(3+1)2n", 
    "iupac": "beta-D-Galp3S-(1->", 
    "aglycon": "Cer", 
    "mass": 260.02
}