{ "glycoprotein": [ { "residue": "Asn", "uniprot_canonical_ac": "P02788-1", "protein_name": "Lactotransferrin", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P02788/annotated", "id": "P02788", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2390069", "id": "2390069", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7774715", "id": "7774715", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7068558", "id": "7068558", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/12151713", "id": "12151713", "database": "PubMed" } ], "start_pos": 156, "tax_name": "Homo sapiens", "end_pos": 156, "gene_name": "LTF", "tax_id": 9606 }, { "uniprot_canonical_ac": "P01854-1", "protein_name": "Immunoglobulin heavy constant epsilon", "tax_name": "Homo sapiens", "tax_id": 9606, "gene_name": "IGHE", "evidence": [ { "url": "https://glyconnect.expasy.org/browser/proteins/765", "id": "765", "database": "GlyConnect" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/4361831", "id": "4361831", "database": "PubMed" } ] }, { "residue": "Asn", "uniprot_canonical_ac": "P07911-1", "protein_name": "Uromodulin", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P07911/annotated", "id": "P07911", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/9884403", "id": "9884403", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2136357", "id": "2136357", "database": "PubMed" } ], "start_pos": 80, "tax_name": "Homo sapiens", "end_pos": 80, "gene_name": "UMOD", "tax_id": 9606 }, { "uniprot_canonical_ac": "P01860-1", "protein_name": "Immunoglobulin heavy constant gamma 3", "tax_name": "Homo sapiens", "tax_id": 9606, "gene_name": "IGHG3", "evidence": [ { "url": "https://glyconnect.expasy.org/browser/proteins/233", "id": "233", "database": "GlyConnect" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/1639758", "id": "1639758", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7540366", "id": "7540366", "database": "PubMed" } ] }, { "residue": "Asn", "uniprot_canonical_ac": "P15800-1", "protein_name": "Laminin subunit beta-2", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P15800/annotated", "id": "P15800", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/24090084", "id": "24090084", "database": "PubMed" } ], "start_pos": 1502, "tax_name": "Rattus norvegicus", "end_pos": 1502, "gene_name": "Lamb2", "tax_id": 10116 }, { "uniprot_canonical_ac": "P01859-1", "protein_name": "Immunoglobulin heavy constant gamma 2", "tax_name": "Homo sapiens", "tax_id": 9606, "gene_name": "IGHG2", "evidence": [ { "url": "https://glyconnect.expasy.org/browser/proteins/233", "id": "233", "database": "GlyConnect" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/1639758", "id": "1639758", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7540366", "id": "7540366", "database": "PubMed" } ] }, { "uniprot_canonical_ac": "P02788-1", "protein_name": "Lactotransferrin", "tax_name": "Homo sapiens", "tax_id": 9606, "gene_name": "LTF", "evidence": [ { "url": "https://glyconnect.expasy.org/browser/proteins/320", "id": "320", "database": "GlyConnect" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7060557", "id": "7060557", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/12151713", "id": "12151713", "database": "PubMed" } ] }, { "residue": "Asn", "uniprot_canonical_ac": "P07911-1", "protein_name": "Uromodulin", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P07911/annotated", "id": "P07911", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2136357", "id": "2136357", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/9884403", "id": "9884403", "database": "PubMed" } ], "start_pos": 275, "tax_name": "Homo sapiens", "end_pos": 275, "gene_name": "UMOD", "tax_id": 9606 }, { "uniprot_canonical_ac": "P01857-1", "protein_name": "Immunoglobulin heavy constant gamma 1", "tax_name": "Homo sapiens", "tax_id": 9606, "gene_name": "IGHG1", "evidence": [ { "url": "https://glyconnect.expasy.org/browser/proteins/233", "id": "233", "database": "GlyConnect" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/1639758", "id": "1639758", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7540366", "id": "7540366", "database": "PubMed" } ] }, { "residue": "Asn", "uniprot_canonical_ac": "P07911-1", "protein_name": "Uromodulin", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P07911/annotated", "id": "P07911", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/9884403", "id": "9884403", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2136357", "id": "2136357", "database": "PubMed" } ], "start_pos": 76, "tax_name": "Homo sapiens", "end_pos": 76, "gene_name": "UMOD", "tax_id": 9606 }, { "uniprot_canonical_ac": "P02787-1", "protein_name": "Serotransferrin", "tax_name": "Homo sapiens", "tax_id": 9606, "gene_name": "TF", "evidence": [ { "url": "https://glyconnect.expasy.org/browser/proteins/558", "id": "558", "database": "GlyConnect" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/9751792", "id": "9751792", "database": "PubMed" } ] }, { "uniprot_canonical_ac": "P08648-1", "protein_name": "Integrin alpha-5", "tax_name": "Homo sapiens", "tax_id": 9606, "gene_name": "ITGA5", "evidence": [ { "url": "https://glyconnect.expasy.org/browser/proteins/283", "id": "283", "database": "GlyConnect" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/8620897", "id": "8620897", "database": "PubMed" } ] }, { "residue": "Asn", "uniprot_canonical_ac": "P02788-1", "protein_name": "Lactotransferrin", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P02788/annotated", "id": "P02788", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/12151713", "id": "12151713", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7068558", "id": "7068558", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7774715", "id": "7774715", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2390069", "id": "2390069", "database": "PubMed" } ], "start_pos": 497, "tax_name": "Homo sapiens", "end_pos": 497, "gene_name": "LTF", "tax_id": 9606 }, { "uniprot_canonical_ac": "P01877-1", "protein_name": "Immunoglobulin heavy constant alpha 2", "tax_name": "Homo sapiens", "tax_id": 9606, "gene_name": "IGHA2", "evidence": [ { "url": "https://glyconnect.expasy.org/browser/proteins/231", "id": "231", "database": "GlyConnect" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7117239", "id": "7117239", "database": "PubMed" } ] }, { "residue": "Asn", "uniprot_canonical_ac": "P07911-1", "protein_name": "Uromodulin", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P07911/annotated", "id": "P07911", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/9884403", "id": "9884403", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2136357", "id": "2136357", "database": "PubMed" } ], "start_pos": 396, "tax_name": "Homo sapiens", "end_pos": 396, "gene_name": "UMOD", "tax_id": 9606 }, { "uniprot_canonical_ac": "P01861-1", "protein_name": "Immunoglobulin heavy constant gamma 4", "tax_name": "Homo sapiens", "tax_id": 9606, "gene_name": "IGHG4", "evidence": [ { "url": "https://glyconnect.expasy.org/browser/proteins/233", "id": "233", "database": "GlyConnect" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/1639758", "id": "1639758", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7540366", "id": "7540366", "database": "PubMed" } ] }, { "uniprot_canonical_ac": "P07911-1", "protein_name": "Uromodulin", "tax_name": "Homo sapiens", "tax_id": 9606, "gene_name": "UMOD", "evidence": [ { "url": "https://glyconnect.expasy.org/browser/proteins/613", "id": "613", "database": "GlyConnect" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/1425697", "id": "1425697", "database": "PubMed" } ] }, { "residue": "Asn", "uniprot_canonical_ac": "P07911-1", "protein_name": "Uromodulin", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P07911/annotated", "id": "P07911", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2136357", "id": "2136357", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/9884403", "id": "9884403", "database": "PubMed" } ], "start_pos": 322, "tax_name": "Homo sapiens", "end_pos": 322, "gene_name": "UMOD", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "P02771-1", "protein_name": "Alpha-fetoprotein", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P02771/annotated", "id": "P02771", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7679920", "id": "7679920", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/1694115", "id": "1694115", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/6192908", "id": "6192908", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7686446", "id": "7686446", "database": "PubMed" }, { "url": "https://glyconnect.expasy.org/browser/proteins/41", "id": "41", "database": "GlyConnect" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7511099", "id": "7511099", "database": "PubMed" } ], "start_pos": 251, "tax_name": "Homo sapiens", "end_pos": 251, "gene_name": "AFP", "tax_id": 9606 }, { "uniprot_canonical_ac": "P05556-1", "protein_name": "Integrin beta-1", "tax_name": "Homo sapiens", "tax_id": 9606, "gene_name": "ITGB1", "evidence": [ { "url": "https://glyconnect.expasy.org/browser/proteins/283", "id": "283", "database": "GlyConnect" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/8620897", "id": "8620897", "database": "PubMed" } ] }, { "residue": "Asn", "uniprot_canonical_ac": "P07911-1", "protein_name": "Uromodulin", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P07911/annotated", "id": "P07911", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/9884403", "id": "9884403", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2136357", "id": "2136357", "database": "PubMed" } ], "start_pos": 232, "tax_name": "Homo sapiens", "end_pos": 232, "gene_name": "UMOD", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "Q63345-1", "protein_name": "Myelin-oligodendrocyte glycoprotein", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/Q63345/annotated", "id": "Q63345", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/24090084", "id": "24090084", "database": "PubMed" } ], "start_pos": 58, "tax_name": "Rattus norvegicus", "end_pos": 58, "gene_name": "Mog", "tax_id": 10116 }, { "residue": "Asn", "uniprot_canonical_ac": "P00747-1", "protein_name": "Plasminogen", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P00747/annotated", "id": "P00747", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2065054", "id": "2065054", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2386787", "id": "2386787", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2059624", "id": "2059624", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/1899031", "id": "1899031", "database": "PubMed" }, { "url": "https://glyconnect.expasy.org/browser/proteins/502", "id": "502", "database": "GlyConnect" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/3356193", "id": "3356193", "database": "PubMed" } ], "start_pos": 308, "tax_name": "Homo sapiens", "end_pos": 308, "gene_name": "PLG", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "Q9JJW1-1", "protein_name": "Tetraspanin-2", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/Q9JJW1/annotated", "id": "Q9JJW1", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/24090084", "id": "24090084", "database": "PubMed" } ], "start_pos": 139, "tax_name": "Rattus norvegicus", "end_pos": 139, "gene_name": "Tspan2", "tax_id": 10116 }, { "uniprot_canonical_ac": "P01876-1", "protein_name": "Immunoglobulin heavy constant alpha 1", "tax_name": "Homo sapiens", "tax_id": 9606, "gene_name": "IGHA1", "evidence": [ { "url": "https://glyconnect.expasy.org/browser/proteins/231", "id": "231", "database": "GlyConnect" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7117239", "id": "7117239", "database": "PubMed" } ] }, { "residue": "Asn", "uniprot_canonical_ac": "P07911-1", "protein_name": "Uromodulin", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P07911/annotated", "id": "P07911", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2136357", "id": "2136357", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/9884403", "id": "9884403", "database": "PubMed" } ], "start_pos": 513, "tax_name": "Homo sapiens", "end_pos": 513, "gene_name": "UMOD", "tax_id": 9606 } ], "number_monosaccharides": 11, "inchi_key": { "url": "https://pubchem.ncbi.nlm.nih.gov/compound/QOLZEOWXKBNBLE-CBYKEYACSA-N", "key": "QOLZEOWXKBNBLE-CBYKEYACSA-N" }, "classification": [ { "subtype": { "url": "http://bioportal.bioontology.org/ontologies/GLYCO/?p=classes&conceptid=complex_N-glycan&jump_to_nav=true", "name": "Complex" }, "type": { "url": "http://bioportal.bioontology.org/ontologies/GLYCO/?p=classes&conceptid=N-glycan&jump_to_nav=true", "name": "N-linked" } }, { "subtype": { "name": "Core-fucosylated" }, "type": { "url": "http://bioportal.bioontology.org/ontologies/GLYCO/?p=classes&conceptid=N-glycan&jump_to_nav=true", "name": "N-linked" } } ], "mass_pme": 2582.31, "names": [], "fully_determined": "yes", "keywords": [ "fully_determined" ], "wurcs": "WURCS=2.0/6,11,10/[a2122h-1b_1-5_2*NCC/3=O][a1122h-1b_1-5][a1122h-1a_1-5][a2112h-1b_1-5][Aad21122h-2a_2-6_5*NCC/3=O][a1221m-1a_1-5]/1-1-2-3-1-4-5-3-1-4-6/a4-b1_a6-k1_b4-c1_c3-d1_c6-h1_d2-e1_e4-f1_f6-g2_h2-i1_i4-j1", "species": [ { "common_name": "Human", "annotation_category": "Direct", "evidence": [ { "url": "https://glyconnect.expasy.org/browser/structures/2481", "id": "2481", "database": "GlyConnect" }, { "url": "https://glytoucan.org/Structures/Glycans/G11041DA", "id": "G11041DA", "database": "GlyTouCan" }, { "url": "http://www.unicarbkb.org/structure/1119", "id": "1119", "database": "UniCarbKB" } ], "taxid": 9606, "name": "Homo sapiens" }, { "common_name": "Rat", "annotation_category": "Direct", "evidence": [ { "url": "http://www.unicarbkb.org/structure/1119", "id": "1119", "database": "UniCarbKB" } ], "taxid": 10116, "name": "Rattus norvegicus" } ], "publication": [ { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/1639758", "type": [ "PubMed" ], "id": "1639758" } ], "title": "A simple method for the release of asparagine-linked oligosaccharides from a glycoprotein purified by SDS-polyacrylamide gel electrophoresis.", "journal": "Journal of biochemistry", "evidence": [ { "url": "https://glyconnect.expasy.org/browser/proteins/233", "id": "233", "database": "GlyConnect" } ], "authors": "Kawashima H, Murata T, Yamamoto K, Tateishi A, Irimura T, Osawa T", "date": "1992" }, { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7060557", "type": [ "PubMed" ], "id": "7060557" } ], "title": "Primary structure of the glycans from human lactotransferrin.", "journal": "European journal of biochemistry", "evidence": [ { "url": "https://glyconnect.expasy.org/browser/proteins/320", "id": "320", "database": "GlyConnect" } ], "authors": "Spik G, Strecker G, Fournet B, Bouquelet S, Montreuil J, Dorland L, van Halbeek H, Vliegenthart JF", "date": "1982" }, { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7511099", "type": [ "PubMed" ], "id": "7511099" } ], "title": "Characterization of E-PHA-reactive alpha-fetoprotein isoforms by two-dimensional lectin affinity electrophoresis.", "journal": "Electrophoresis", "evidence": [ { "url": "https://glyconnect.expasy.org/browser/proteins/41", "id": "41", "database": "GlyConnect" } ], "authors": "Taketa K, Fujii Y, Taga H", "date": "1993" }, { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/12151713", "type": [ "PubMed" ], "id": "12151713" } ], "title": "N-glycosylation potential of maize: the human lactoferrin used as a model.", "journal": "Glycoconjugate journal", "evidence": [ { "url": "http://www.unicarbkb.org/structure/1119", "id": "1119", "database": "UniCarbKB" }, { "url": "http://unicarbkb.org/proteinsummary/P02788/annotated", "id": "P02788", "database": "UniCarbKB" }, { "url": "https://glyconnect.expasy.org/browser/proteins/320", "id": "320", "database": "GlyConnect" } ], "authors": "Samyn-Petit B, Gruber V, Flahaut C, Wajda-Dubos JP, Farrer S, Pons A, Desmaizieres G, Slomianny MC, Theisen M, Delannoy P", "date": "2001" }, { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2136357", "type": [ "PubMed" ], "id": "2136357" } ], "title": "Pregnancy-associated changes in oligomannose oligosaccharides of human and bovine uromodulin (Tamm-Horsfall glycoprotein).", "journal": "Glycoconjugate journal", "evidence": [ { "url": "http://www.unicarbkb.org/structure/1119", "id": "1119", "database": "UniCarbKB" }, { "url": "http://unicarbkb.org/proteinsummary/P07911/annotated", "id": "P07911", "database": "UniCarbKB" } ], "authors": "Smagula RM, Van Halbeek H, Decker JM, Muchmore AV, Moody CE, Sherblom AP", "date": "1990" }, { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7679920", "type": [ "PubMed" ], "id": "7679920" } ], "title": "Carbohydrate structures of human alpha-fetoprotein of patients with hepatocellular carcinoma: presence of fucosylated and non-fucosylated triantennary glycans.", "journal": "British journal of cancer", "evidence": [ { "url": "http://www.unicarbkb.org/structure/1119", "id": "1119", "database": "UniCarbKB" }, { "url": "http://unicarbkb.org/proteinsummary/P02771/annotated", "id": "P02771", "database": "UniCarbKB" } ], "authors": "Aoyagi Y, Suzuki Y, Igarashi K, Saitoh A, Oguro M, Yokota T, Mori S, Suda T, Isemura M, Asakura H", "date": "1993" }, { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/1425697", "type": [ "PubMed" ], "id": "1425697" } ], "title": "The Asn-linked carbohydrate chains of human Tamm-Horsfall glycoprotein of one male. Novel sulfated and novel N-acetylgalactosamine-containing N-linked carbohydrate chains.", "journal": "European journal of biochemistry", "evidence": [ { "url": "https://glyconnect.expasy.org/browser/proteins/613", "id": "613", "database": "GlyConnect" } ], "authors": "Hard K, Van Zadelhoff G, Moonen P, Kamerling JP, Vliegenthart FG", "date": "1992" }, { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/8620897", "type": [ "PubMed" ], "id": "8620897" } ], "title": "Detailed oligosaccharide structures of human integrin alpha 5 beta 1 analyzed by a three-dimensional mapping technique.", "journal": "European journal of biochemistry", "evidence": [ { "url": "https://glyconnect.expasy.org/browser/proteins/283", "id": "283", "database": "GlyConnect" } ], "authors": "Nakagawa H, Zheng M, Hakomori S, Tsukamoto Y, Kawamura Y, Takahashi N", "date": "1996" }, { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/9884403", "type": [ "PubMed" ], "id": "9884403" } ], "title": "Glycosylation sites and site-specific glycosylation in human Tamm-Horsfall glycoprotein.", "journal": "Glycobiology", "evidence": [ { "url": "http://www.unicarbkb.org/structure/1119", "id": "1119", "database": "UniCarbKB" }, { "url": "http://unicarbkb.org/proteinsummary/P07911/annotated", "id": "P07911", "database": "UniCarbKB" } ], "authors": "van Rooijen JJ, Voskamp AF, Kamerling JP, Vliegenthart JF", "date": "1999" }, { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/3356193", "type": [ "PubMed" ], "id": "3356193" } ], "title": "The N- and O-linked carbohydrate chains of human, bovine and porcine plasminogen. Species specificity in relation to sialylation and fucosylation patterns.", "journal": "European journal of biochemistry", "evidence": [ { "url": "https://glyconnect.expasy.org/browser/proteins/502", "id": "502", "database": "GlyConnect" } ], "authors": "Marti T, Schaller J, Rickli EE, Schmid K, Kamerling JP, Gerwig GJ, van Halbeek H, Vliegenthart JF", "date": "1988" }, { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/6192908", "type": [ "PubMed" ], "id": "6192908" } ], "title": "Sugar chain of alpha-fetoprotein produced in human yolk sac tumor.", "journal": "Cancer research", "evidence": [ { "url": "http://www.unicarbkb.org/structure/1119", "id": "1119", "database": "UniCarbKB" }, { "url": "http://unicarbkb.org/proteinsummary/P02771/annotated", "id": "P02771", "database": "UniCarbKB" } ], "authors": "Yamashita K, Hitoi A, Tsuchida Y, Nishi S, Kobata A", "date": "1983" }, { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2386787", "type": [ "PubMed" ], "id": "2386787" } ], "title": "Oligosaccharide processing in the expression of human plasminogen cDNA by lepidopteran insect (Spodoptera frugiperda) cells.", "journal": "Biochemistry", "evidence": [ { "url": "http://www.unicarbkb.org/structure/1119", "id": "1119", "database": "UniCarbKB" }, { "url": "http://unicarbkb.org/proteinsummary/P00747/annotated", "id": "P00747", "database": "UniCarbKB" } ], "authors": "Davidson DJ, Fraser MJ, Castellino FJ", "date": "1990" }, { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/9751792", "type": [ "PubMed" ], "id": "9751792" } ], "title": "Expression of N-linked sialyl Le(x) determinants and O-glycans in the carbohydrate moiety of human amniotic fluid transferrin during pregnancy.", "journal": "Glycobiology", "evidence": [ { "url": "https://glyconnect.expasy.org/browser/proteins/558", "id": "558", "database": "GlyConnect" } ], "authors": "van Rooijen JJ, Jeschke U, Kamerling JP, Vliegenthart JF", "date": "1998" }, { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2059624", "type": [ "PubMed" ], "id": "2059624" } ], "title": "Asparagine-linked oligosaccharide processing in lepidopteran insect cells. Temporal dependence of the nature of the oligosaccharides assembled on asparagine-289 of recombinant human plasminogen produced in baculovirus vector infected Spodoptera frugiperda (IPLB-SF-21AE) cells.", "journal": "Biochemistry", "evidence": [ { "url": "http://www.unicarbkb.org/structure/1119", "id": "1119", "database": "UniCarbKB" }, { "url": "http://unicarbkb.org/proteinsummary/P00747/annotated", "id": "P00747", "database": "UniCarbKB" } ], "authors": "Davidson DJ, Castellino FJ", "date": "1991" }, { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/4361831", "type": [ "PubMed" ], "id": "4361831" } ], "title": "Structure of the carbohydrate units of IgE immunoglobulin. II. Sequence of the sialic acid-containing glycopeptides.", "journal": "The Journal of biological chemistry", "evidence": [ { "url": "https://glyconnect.expasy.org/browser/proteins/765", "id": "765", "database": "GlyConnect" } ], "authors": "Baenziger J, Kornfeld S, Kochwa S", "date": "1974" }, { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2065054", "type": [ "PubMed" ], "id": "2065054" } ], "title": "Structures of the asparagine-289-linked oligosaccharides assembled on recombinant human plasminogen expressed in a Mamestra brassicae cell line (IZD-MBO503).", "journal": "Biochemistry", "evidence": [ { "url": "http://www.unicarbkb.org/structure/1119", "id": "1119", "database": "UniCarbKB" }, { "url": "http://unicarbkb.org/proteinsummary/P00747/annotated", "id": "P00747", "database": "UniCarbKB" } ], "authors": "Davidson DJ, Castellino FJ", "date": "1991" }, { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7686446", "type": [ "PubMed" ], "id": "7686446" } ], "title": "Sugar chains of human cord serum alpha-fetoprotein: characteristics of N-linked sugar chains of glycoproteins produced in human liver and hepatocellular carcinomas.", "journal": "Cancer research", "evidence": [ { "url": "http://www.unicarbkb.org/structure/1119", "id": "1119", "database": "UniCarbKB" }, { "url": "http://unicarbkb.org/proteinsummary/P02771/annotated", "id": "P02771", "database": "UniCarbKB" }, { "url": "https://glyconnect.expasy.org/browser/proteins/41", "id": "41", "database": "GlyConnect" } ], "authors": "Yamashita K, Taketa K, Nishi S, Fukushima K, Ohkura T", "date": "1993" }, { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2390069", "type": [ "PubMed" ], "id": "2390069" } ], "title": "Primary structure of glycans isolated from human leucocyte lactotransferrin. Absence of fucose residues questions the proposed mechanism of hyposideraemia.", "journal": "The Biochemical journal", "evidence": [ { "url": "http://www.unicarbkb.org/structure/1119", "id": "1119", "database": "UniCarbKB" }, { "url": "http://unicarbkb.org/proteinsummary/P02788/annotated", "id": "P02788", "database": "UniCarbKB" } ], "authors": "Derisbourg P, Wieruszeski JM, Montreuil J, Spik G", "date": "1990" }, { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/1694115", "type": [ "PubMed" ], "id": "1694115" } ], "title": "Unique structure of glycopeptide from alpha-fetoprotein produced in human hepatoma cell line, as determined by 1H-nuclear magnetic resonance spectroscopy.", "journal": "Clinical chemistry", "evidence": [ { "url": "http://www.unicarbkb.org/structure/1119", "id": "1119", "database": "UniCarbKB" }, { "url": "http://unicarbkb.org/proteinsummary/P02771/annotated", "id": "P02771", "database": "UniCarbKB" } ], "authors": "Terrana B, Tecce MF, Manetti R, Ceccarini C, Lamba D, Segre AL", "date": "1990" }, { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7774715", "type": [ "PubMed" ], "id": "7774715" } ], "title": "Structural determination of two N-linked glycans isolated from recombinant human lactoferrin expressed in BHK cells.", "journal": "FEBS letters", "evidence": [ { "url": "http://www.unicarbkb.org/structure/1119", "id": "1119", "database": "UniCarbKB" }, { "url": "http://unicarbkb.org/proteinsummary/P02788/annotated", "id": "P02788", "database": "UniCarbKB" } ], "authors": "Legrand D, Salmon V, Coddeville B, Benaissa M, Plancke Y, Spik G", "date": "1995" }, { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7540366", "type": [ "PubMed" ], "id": "7540366" } ], "title": "Three-dimensional elution mapping of pyridylaminated N-linked neutral and sialyl oligosaccharides.", "journal": "Analytical biochemistry", "evidence": [ { "url": "https://glyconnect.expasy.org/browser/proteins/233", "id": "233", "database": "GlyConnect" } ], "authors": "Takahashi N, Nakagawa H, Fujikawa K, Kawamura Y, Tomiya N", "date": "1995" }, { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/1899031", "type": [ "PubMed" ], "id": "1899031" } ], "title": "Oligosaccharide structures present on asparagine-289 of recombinant human plasminogen expressed in a Chinese hamster ovary cell line.", "journal": "Biochemistry", "evidence": [ { "url": "http://www.unicarbkb.org/structure/1119", "id": "1119", "database": "UniCarbKB" }, { "url": "http://unicarbkb.org/proteinsummary/P00747/annotated", "id": "P00747", "database": "UniCarbKB" } ], "authors": "Davidson DJ, Castellino FJ", "date": "1991" }, { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/24090084", "type": [ "PubMed" ], "id": "24090084" } ], "title": "Site-specific glycan-peptide analysis for determination of N-glycoproteome heterogeneity.", "journal": "Journal of proteome research", "evidence": [ { "url": "http://www.unicarbkb.org/structure/1119", "id": "1119", "database": "UniCarbKB" }, { "url": "http://unicarbkb.org/proteinsummary/P15800/annotated", "id": "P15800", "database": "UniCarbKB" }, { "url": "http://unicarbkb.org/proteinsummary/Q63345/annotated", "id": "Q63345", "database": "UniCarbKB" }, { "url": "http://unicarbkb.org/proteinsummary/Q9JJW1/annotated", "id": "Q9JJW1", "database": "UniCarbKB" } ], "authors": "Parker BL, Thaysen-Andersen M, Solis N, Scott NE, Larsen MR, Graham ME, Packer NH, Cordwell SJ", "date": "2013" }, { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7117239", "type": [ "PubMed" ], "id": "7117239" } ], "title": "Primary structure of the N-glycosidically linked sialoglycans of secretory immunoglobulins A from human milk.", "journal": "European journal of biochemistry", "evidence": [ { "url": "https://glyconnect.expasy.org/browser/proteins/231", "id": "231", "database": "GlyConnect" } ], "authors": "Pierce-Cretel A, Pamblanco M, Strecker G, Montreuil J, Spik G, Dorland L, Van Halbeek H, Vliegenthart JF", "date": "1982" }, { "reference": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7068558", "type": [ "PubMed" ], "id": "7068558" } ], "title": "Structural study of the sugar chains of human lactoferrin: finding of four novel complex-type asparagine-linked sugar chains.", "journal": "Journal of biochemistry", "evidence": [ { "url": "http://www.unicarbkb.org/structure/1119", "id": "1119", "database": "UniCarbKB" }, { "url": "http://unicarbkb.org/proteinsummary/P02788/annotated", "id": "P02788", "database": "UniCarbKB" } ], "authors": "Matsumoto A, Yoshima H, Takasaki S, Kobata A", "date": "1982" } ], "subsumption": [ { "type": "composition", "id": "G40436IV", "relationship": "composition" }, { "type": "basecomposition", "id": "G70382FA", "relationship": "basecomposition" }, { "type": "topology", "id": "G32340DX", "relationship": "topology" } ], "enzyme": [ { "uniprot_canonical_ac": "Q96JF0-1", "gene_link": "https://www.uniprot.org/uniprot/Q96JF0", "evidence": [ { "url": "https://data.glygen.org/GLY_000284", "id": "GLY_000284", "database": "GlyGen" } ], "protein_name": "Beta-galactoside alpha-2,6-sialyltransferase 2", "tax_name": "Homo sapiens", "tax_common_name": "Human", "gene": "ST6GAL2", "tax_id": 9606 }, { "uniprot_canonical_ac": "P26572-1", "gene_link": "https://www.uniprot.org/uniprot/P26572", "evidence": [ { "url": "https://data.glygen.org/GLY_000284", "id": "GLY_000284", "database": "GlyGen" } ], "protein_name": "Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase", "tax_name": "Homo sapiens", "tax_common_name": "Human", "gene": "MGAT1", "tax_id": 9606 }, { "uniprot_canonical_ac": "Q9BT22-1", "gene_link": "https://www.uniprot.org/uniprot/Q9BT22", "evidence": [ { "url": "https://data.glygen.org/GLY_000284", "id": "GLY_000284", "database": "GlyGen" } ], "protein_name": "Chitobiosyldiphosphodolichol beta-mannosyltransferase", "tax_name": "Homo sapiens", "tax_common_name": "Human", "gene": "ALG1", "tax_id": 9606 }, { "uniprot_canonical_ac": "O60909-1", "gene_link": "https://www.uniprot.org/uniprot/O60909", "evidence": [ { "url": "https://data.glygen.org/GLY_000284", "id": "GLY_000284", "database": "GlyGen" } ], "protein_name": "Beta-1,4-galactosyltransferase 2", "tax_name": "Homo sapiens", "tax_common_name": "Human", "gene": "B4GALT2", "tax_id": 9606 }, { "uniprot_canonical_ac": "P15291-1", "gene_link": "https://www.uniprot.org/uniprot/P15291", "evidence": [ { "url": "https://data.glygen.org/GLY_000284", "id": "GLY_000284", "database": "GlyGen" } ], "protein_name": "Processed beta-1,4-galactosyltransferase 1", "tax_name": "Homo sapiens", "tax_common_name": "Human", "gene": "B4GALT1", "tax_id": 9606 }, { "uniprot_canonical_ac": "Q921V5-1", "gene_link": "https://www.uniprot.org/uniprot/Q921V5", "evidence": [ { "url": "https://data.glygen.org/GLY_000284", "id": "GLY_000284", "database": "GlyGen" } ], "protein_name": "Alpha-1,6-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase", "tax_name": "Mus musculus", "tax_common_name": "Mouse", "gene": "Mgat2", "tax_id": 10090 }, { "uniprot_canonical_ac": "Q9H553-1", "gene_link": "https://www.uniprot.org/uniprot/Q9H553", "evidence": [ { "url": "https://data.glygen.org/GLY_000284", "id": "GLY_000284", "database": "GlyGen" } ], "protein_name": "Alpha-1,3/1,6-mannosyltransferase ALG2", "tax_name": "Homo sapiens", "tax_common_name": "Human", "gene": "ALG2", "tax_id": 9606 }, { "uniprot_canonical_ac": "Q9DBE8-1", "gene_link": "https://www.uniprot.org/uniprot/Q9DBE8", "evidence": [ { "url": "https://data.glygen.org/GLY_000284", "id": "GLY_000284", "database": "GlyGen" } ], "protein_name": "Alpha-1,3/1,6-mannosyltransferase ALG2", "tax_name": "Mus musculus", "tax_common_name": "Mouse", "gene": "Alg2", "tax_id": 10090 }, { "uniprot_canonical_ac": "Q921Q3-1", "gene_link": "https://www.uniprot.org/uniprot/Q921Q3", "evidence": [ { "url": "https://data.glygen.org/GLY_000284", "id": "GLY_000284", "database": "GlyGen" } ], "protein_name": "Chitobiosyldiphosphodolichol beta-mannosyltransferase", "tax_name": "Mus musculus", "tax_common_name": "Mouse", "gene": "Alg1", "tax_id": 10090 }, { "uniprot_canonical_ac": "Q96F25-1", "gene_link": "https://www.uniprot.org/uniprot/Q96F25", "evidence": [ { "url": "https://data.glygen.org/GLY_000284", "id": "GLY_000284", "database": "GlyGen" } ], "protein_name": "UDP-N-acetylglucosamine transferase subunit ALG14 homolog", "tax_name": "Homo sapiens", "tax_common_name": "Human", "gene": "ALG14", "tax_id": 9606 }, { "uniprot_canonical_ac": "Q8BML3-1", "gene_link": "https://www.uniprot.org/uniprot/Q8BML3", "evidence": [ { "url": "https://data.glygen.org/GLY_000284", "id": "GLY_000284", "database": "GlyGen" } ], "protein_name": "N-acetylglucosaminyldiphosphodolichol N-acetylglucosaminyltransferase", "tax_name": "Mus musculus", "tax_common_name": "Mouse", "gene": "Glt28d2", "tax_id": 10090 }, { "uniprot_canonical_ac": "Q9D081-1", "gene_link": "https://www.uniprot.org/uniprot/Q9D081", "evidence": [ { "url": "https://data.glygen.org/GLY_000284", "id": "GLY_000284", "database": "GlyGen" } ], "protein_name": "UDP-N-acetylglucosamine transferase subunit ALG14 homolog", "tax_name": "Mus musculus", "tax_common_name": "Mouse", "gene": "Alg14", "tax_id": 10090 }, { "uniprot_canonical_ac": "Q76K27-1", "gene_link": "https://www.uniprot.org/uniprot/Q76K27", "evidence": [ { "url": "https://data.glygen.org/GLY_000284", "id": "GLY_000284", "database": "GlyGen" } ], "protein_name": "Beta-galactoside alpha-2,6-sialyltransferase 2", "tax_name": "Mus musculus", "tax_common_name": "Mouse", "gene": "St6gal2", "tax_id": 10090 }, { "uniprot_canonical_ac": "Q9Z2Y2-1", "gene_link": "https://www.uniprot.org/uniprot/Q9Z2Y2", "evidence": [ { "url": "https://data.glygen.org/GLY_000284", "id": "GLY_000284", "database": "GlyGen" } ], "protein_name": "Beta-1,4-galactosyltransferase 2", "tax_name": "Mus musculus", "tax_common_name": "Mouse", "gene": "B4galt2", "tax_id": 10090 }, { "uniprot_canonical_ac": "P42867-1", "gene_link": "https://www.uniprot.org/uniprot/P42867", "evidence": [ { "url": "https://data.glygen.org/GLY_000284", "id": "GLY_000284", "database": "GlyGen" } ], "protein_name": "UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase", "tax_name": "Mus musculus", "tax_common_name": "Mouse", "gene": "Dpagt1", "tax_id": 10090 }, { "uniprot_canonical_ac": "Q64685-1", "gene_link": "https://www.uniprot.org/uniprot/Q64685", "evidence": [ { "url": "https://data.glygen.org/GLY_000284", "id": "GLY_000284", "database": "GlyGen" } ], "protein_name": "Beta-galactoside alpha-2,6-sialyltransferase 1", "tax_name": "Mus musculus", "tax_common_name": "Mouse", "gene": "St6gal1", "tax_id": 10090 }, { "uniprot_canonical_ac": "P15907-1", "gene_link": "https://www.uniprot.org/uniprot/P15907", "evidence": [ { "url": "https://data.glygen.org/GLY_000284", "id": "GLY_000284", "database": "GlyGen" } ], "protein_name": "Beta-galactoside alpha-2,6-sialyltransferase 1", "tax_name": "Homo sapiens", "tax_common_name": "Human", "gene": "ST6GAL1", "tax_id": 9606 }, { "uniprot_canonical_ac": "Q9D8C3-1", "gene_link": "https://www.uniprot.org/uniprot/Q9D8C3", "evidence": [ { "url": "https://data.glygen.org/GLY_000284", "id": "GLY_000284", "database": "GlyGen" } ], "protein_name": "Putative bifunctional UDP-N-acetylglucosamine transferase and deubiquitinase ALG13", "tax_name": "Mus musculus", "tax_common_name": "Mouse", "gene": "Alg13", "tax_id": 10090 }, { "uniprot_canonical_ac": "P15535-1", "gene_link": "https://www.uniprot.org/uniprot/P15535", "evidence": [ { "url": "https://data.glygen.org/GLY_000284", "id": "GLY_000284", "database": "GlyGen" } ], "protein_name": "Processed beta-1,4-galactosyltransferase 1", "tax_name": "Mus musculus", "tax_common_name": "Mouse", "gene": "B4galt1", "tax_id": 10090 }, { "uniprot_canonical_ac": "Q10469-1", "gene_link": "https://www.uniprot.org/uniprot/Q10469", "evidence": [ { "url": "https://data.glygen.org/GLY_000284", "id": "GLY_000284", "database": "GlyGen" } ], "protein_name": "Alpha-1,6-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase", "tax_name": "Homo sapiens", "tax_common_name": "Human", "gene": "MGAT2", "tax_id": 9606 }, { "uniprot_canonical_ac": "Q9WTS2-1", "gene_link": "https://www.uniprot.org/uniprot/Q9WTS2", "evidence": [ { "url": "https://data.glygen.org/GLY_000284", "id": "GLY_000284", "database": "GlyGen" } ], "protein_name": "Alpha-(1,6)-fucosyltransferase", "tax_name": "Mus musculus", "tax_common_name": "Mouse", "gene": "Fut8", "tax_id": 10090 }, { "uniprot_canonical_ac": "Q91YY2-1", "gene_link": "https://www.uniprot.org/uniprot/Q91YY2", "evidence": [ { "url": "https://data.glygen.org/GLY_000284", "id": "GLY_000284", "database": "GlyGen" } ], "protein_name": "Beta-1,4-galactosyltransferase 3", "tax_name": "Mus musculus", "tax_common_name": "Mouse", "gene": "B4galt3", "tax_id": 10090 }, { "uniprot_canonical_ac": "P27808-1", "gene_link": "https://www.uniprot.org/uniprot/P27808", "evidence": [ { "url": "https://data.glygen.org/GLY_000284", "id": "GLY_000284", "database": "GlyGen" } ], "protein_name": "Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase", "tax_name": "Mus musculus", "tax_common_name": "Mouse", "gene": "Mgat1", "tax_id": 10090 }, { "uniprot_canonical_ac": "Q9H3H5-1", "gene_link": "https://www.uniprot.org/uniprot/Q9H3H5", "evidence": [ { "url": "https://data.glygen.org/GLY_000284", "id": "GLY_000284", "database": "GlyGen" } ], "protein_name": "UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase", "tax_name": "Homo sapiens", "tax_common_name": "Human", "gene": "DPAGT1", "tax_id": 9606 }, { "uniprot_canonical_ac": "Q9NP73-1", "gene_link": "https://www.uniprot.org/uniprot/Q9NP73", "evidence": [ { "url": "https://data.glygen.org/GLY_000284", "id": "GLY_000284", "database": "GlyGen" } ], "protein_name": "Putative bifunctional UDP-N-acetylglucosamine transferase and deubiquitinase ALG13", "tax_name": "Homo sapiens", "tax_common_name": "Human", "gene": "ALG13", "tax_id": 9606 }, { "uniprot_canonical_ac": "Q9BYC5-1", "gene_link": "https://www.uniprot.org/uniprot/Q9BYC5", "evidence": [ { "url": "https://data.glygen.org/GLY_000284", "id": "GLY_000284", "database": "GlyGen" } ], "protein_name": "Alpha-(1,6)-fucosyltransferase", "tax_name": "Homo sapiens", "tax_common_name": "Human", "gene": "FUT8", "tax_id": 9606 }, { "uniprot_canonical_ac": "O60512-1", "gene_link": "https://www.uniprot.org/uniprot/O60512", "evidence": [ { "url": "https://data.glygen.org/GLY_000284", "id": "GLY_000284", "database": "GlyGen" } ], "protein_name": "Beta-1,4-galactosyltransferase 3", "tax_name": "Homo sapiens", "tax_common_name": "Human", "gene": "B4GALT3", "tax_id": 9606 } ], "motifs": [ { "synonym": "N-acetyllactosamine", "id": "GGM.000001", "name": "Type 2 LN" } ], "glytoucan_ac": "G11041DA", "composition": [ { "residue": "neugc", "count": 0, "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001", "name": "N-Glycolyl-Neuraminic Acid", "cid": "440001" }, { "residue": "other", "count": 0, "name": "Other" }, { "residue": "neuac", "count": 1, "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197", "name": "N-Acetyl-Neuraminic Acid", "cid": "439197" }, { "residue": "p", "count": 0, "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061", "name": "Phosphate", "cid": "1061" }, { "residue": "dhex", "count": 1, "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840", "name": "6-Deoxy-Hexose", "cid": "840" }, { "residue": "s", "count": 0, "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117", "name": "Sulfate", "cid": "1117" }, { "residue": "hexnac", "count": 4, "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899", "name": "N-Acetylhexosamine", "cid": "899" }, { "residue": "hexn", "count": 0, "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739", "name": "2-Amino-2-Deoxy-Hexose", "cid": "739" }, { "residue": "hex", "count": 5, "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206", "name": "Hexose", "cid": "206" }, { "residue": "hexa", "count": 0, "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610", "name": "Hexuronic Acid", "cid": "610" } ], "interactions": [], "residues": [ { "attachedby": "rxn.Q10469-1", "detachedby": "", "id": "N5", "parentid": "N4", "name": "N-glycan_b-D-GlcpNAc_5" }, { "attachedby": "rxn.Q921V5-1", "detachedby": "", "id": "N5", "parentid": "N4", "name": "N-glycan_b-D-GlcpNAc_5" }, { "attachedby": "rxn.Q96F25-1", "detachedby": "", "id": "NB", "parentid": "NA", "name": "N-glycan_core_b-D-GlcpNAc_B" }, { "attachedby": "rxn.Q921Q3-1", "detachedby": "", "id": "NC", "parentid": "NB", "name": "N-glycan_core_b-D-Manp_C" }, { "attachedby": "rxn.Q9NP73-1", "detachedby": "", "id": "NB", "parentid": "NA", "name": "N-glycan_core_b-D-GlcpNAc_B" }, { "attachedby": "rxn.Q9D8C3-1", "detachedby": "", "id": "NB", "parentid": "NA", "name": "N-glycan_core_b-D-GlcpNAc_B" }, { "attachedby": "rxn.Q9H3H5-1", "detachedby": "", "id": "NA", "parentid": "0", "name": "N-glycan_core_D-GlcNAc_A" }, { "attachedby": "rxn.Q9D081-1", "detachedby": "", "id": "NB", "parentid": "NA", "name": "N-glycan_core_b-D-GlcpNAc_B" }, { "attachedby": "rxn.Q91YY2-1", "detachedby": "", "id": "N3", "parentid": "N2", "name": "N-glycan_b-D-Galp_3" }, { "attachedby": "rxn.P15535-1", "detachedby": "", "id": "N3", "parentid": "N2", "name": "N-glycan_b-D-Galp_3" }, { "attachedby": "rxn.O60512-1", "detachedby": "", "id": "N6", "parentid": "N5", "name": "N-glycan_b-D-Galp_6" }, { "attachedby": "rxn.Q9Z2Y2-1", "detachedby": "", "id": "N3", "parentid": "N2", "name": "N-glycan_b-D-Galp_3" }, { "attachedby": "rxn.O60512-1", "detachedby": "", "id": "N3", "parentid": "N2", "name": "N-glycan_b-D-Galp_3" }, { "attachedby": "rxn.Q9WTS2-1", "detachedby": "", "id": "N15", "parentid": "NA", "name": "N-glycan_a-L-Fucp_15" }, { "attachedby": "rxn.P15291-1", "detachedby": "", "id": "N3", "parentid": "N2", "name": "N-glycan_b-D-Galp_3" }, { "attachedby": "rxn.O60909-1", "detachedby": "", "id": "N3", "parentid": "N2", "name": "N-glycan_b-D-Galp_3" }, { "attachedby": "rxn.P15291-1", "detachedby": "", "id": "N6", "parentid": "N5", "name": "N-glycan_b-D-Galp_6" }, { "attachedby": "rxn.O60909-1", "detachedby": "", "id": "N6", "parentid": "N5", "name": "N-glycan_b-D-Galp_6" }, { "attachedby": "rxn.Q9DBE8-1", "detachedby": "", "id": "N1", "parentid": "NC", "name": "N-glycan_a-D-Manp_1" }, { "attachedby": "rxn.Q9DBE8-1", "detachedby": "", "id": "N4", "parentid": "NC", "name": "N-glycan_a-D-Manp_4" }, { "attachedby": "rxn.Q9H553-1", "detachedby": "", "id": "N1", "parentid": "NC", "name": "N-glycan_a-D-Manp_1" }, { "attachedby": "rxn.P15907-1", "detachedby": "", "id": "N12", "parentid": "N3", "name": "N-glycan_a-D-NeupNAc_12" }, { "attachedby": "rxn.Q9H553-1", "detachedby": "", "id": "N4", "parentid": "NC", "name": "N-glycan_a-D-Manp_4" }, { "attachedby": "rxn.Q76K27-1", "detachedby": "", "id": "N12", "parentid": "N3", "name": "N-glycan_a-D-NeupNAc_12" }, { "attachedby": "rxn.Q64685-1", "detachedby": "", "id": "N12", "parentid": "N3", "name": "N-glycan_a-D-NeupNAc_12" }, { "attachedby": "rxn.Q9BYC5-1", "detachedby": "", "id": "N15", "parentid": "NA", "name": "N-glycan_a-L-Fucp_15" }, { "attachedby": "rxn.Q96JF0-1", "detachedby": "", "id": "N12", "parentid": "N3", "name": "N-glycan_a-D-NeupNAc_12" }, { "attachedby": "rxn.P15535-1", "detachedby": "", "id": "N6", "parentid": "N5", "name": "N-glycan_b-D-Galp_6" }, { "attachedby": "rxn.Q91YY2-1", "detachedby": "", "id": "N6", "parentid": "N5", "name": "N-glycan_b-D-Galp_6" }, { "attachedby": "rxn.Q9Z2Y2-1", "detachedby": "", "id": "N6", "parentid": "N5", "name": "N-glycan_b-D-Galp_6" }, { "attachedby": "rxn.P26572-1", "detachedby": "", "id": "N2", "parentid": "N1", "name": "N-glycan_b-D-GlcpNAc_2" }, { "attachedby": "rxn.P27808-1", "detachedby": "", "id": "N2", "parentid": "N1", "name": "N-glycan_b-D-GlcpNAc_2" }, { "attachedby": "rxn.Q8BML3-1", "detachedby": "", "id": "NB", "parentid": "NA", "name": "N-glycan_core_b-D-GlcpNAc_B" }, { "attachedby": "rxn.Q9BT22-1", "detachedby": "", "id": "NC", "parentid": "NB", "name": "N-glycan_core_b-D-Manp_C" }, { "attachedby": "rxn.P42867-1", "detachedby": "", "id": "NA", "parentid": "0", "name": "N-glycan_core_D-GlcNAc_A" } ], "glycam": "DNeup5Aca2-6DGalpb1-4DGlcpNAcb1-2DManpa1-3[DGalpb1-4DGlcpNAcb1-2DManpa1-6]DManpb1-4DGlcpNAcb1-4[LFucpa1-6]DGlcpNAcb1-", "inchi": "InChI=1S/C79H131N5O58/c1-18-40(99)51(110)56(115)72(125-18)122-16-34-63(47(106)36(68(119)126-34)81-20(3)93)135-69-37(82-21(4)94)48(107)62(31(14-91)130-69)138-75-59(118)65(46(105)32(133-75)15-123-76-66(54(113)43(102)27(10-87)128-76)140-70-38(83-22(5)95)49(108)60(29(12-89)131-70)136-73-57(116)52(111)42(101)26(9-86)127-73)139-77-67(55(114)44(103)28(11-88)129-77)141-71-39(84-23(6)96)50(109)61(30(13-90)132-71)137-74-58(117)53(112)45(104)33(134-74)17-124-79(78(120)121)7-24(97)35(80-19(2)92)64(142-79)41(100)25(98)8-85/h18,24-77,85-91,97-119H,7-17H2,1-6H3,(H,80,92)(H,81,93)(H,82,94)(H,83,95)(H,84,96)(H,120,121)/t18-,24-,25+,26+,27+,28+,29+,30+,31+,32+,33+,34+,35+,36+,37+,38+,39+,40+,41+,42-,43+,44+,45-,46+,47+,48+,49+,50+,51+,52-,53-,54-,55-,56-,57+,58+,59-,60+,61+,62+,63+,64+,65-,66-,67-,68+,69-,70-,71-,72+,73-,74-,75-,76-,77+,79+/m0/s1", "crossref": [ { "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=268", "id": "268", "database": "Glycosciences.de" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+46608", "id": "46608", "database": "CarbBank" }, { "url": "https://raw.githack.com/CCRC-will/glycoTree/master/portal/explore.html?G11041DA", "id": "G11041DA", "database": "SandBox" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+8190", "id": "8190", "database": "CarbBank" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+8193", "id": "8193", "database": "CarbBank" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+8194", "id": "8194", "database": "CarbBank" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+8195", "id": "8195", "database": "CarbBank" }, { "url": "https://glyconnect.expasy.org/browser/structures/2481", "id": "2481", "database": "GlyConnect" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+16371", "id": "16371", "database": "CarbBank" }, { "url": "https://www.glygen.org/glycan/G11041DA", "id": "G11041DA", "database": "GNOme" }, { "url": "http://www.functionalglycomics.org/glycomics/CarbohydrateServlet?pageType=view&view=view&operationType=view&carbId=carbSynthe_0575_D000", "id": "carbSynthe_0575_D000", "database": "CFG" }, { "url": "https://glytoucan.org/Structures/Glycans/G11041DA", "id": "G11041DA", "database": "GlyTouCan" }, { "url": "https://www.ebi.ac.uk/chebi/searchId.do?chebiId=147450", "id": "147450", "database": "ChEBI" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+5252", "id": "5252", "database": "CarbBank" }, { "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=3422", "id": "3422", "database": "Glycosciences.de" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+1881", "id": "1881", "database": "CarbBank" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+1880", "id": "1880", "database": "CarbBank" }, { "url": "https://pubchem.ncbi.nlm.nih.gov/substance/252293181", "id": "252293181", "database": "PubChem Substance" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+1878", "id": "1878", "database": "CarbBank" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+1879", "id": "1879", "database": "CarbBank" }, { "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=2928", "id": "2928", "database": "Glycosciences.de" }, { "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91859566", "id": "91859566", "database": "PubChem Compound" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+44711", "id": "44711", "database": "CarbBank" }, { "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=22982", "id": "22982", "database": "Glycosciences.de" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+12758", "id": "12758", "database": "CarbBank" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+8173", "id": "8173", "database": "CarbBank" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+8302", "id": "8302", "database": "CarbBank" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?gl:G10706", "id": "G10706", "database": "KEGG Glycan" }, { "url": "http://www.unicarbkb.org/structure/1119", "id": "1119", "database": "UniCarbKB" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+40727", "id": "40727", "database": "CarbBank" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+46618", "id": "46618", "database": "CarbBank" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+8189", "id": "8189", "database": "CarbBank" } ], "tool_support": { "sandbox": "yes", "gnome": "yes" }, "glycoct": "RES 1b:b-dglc-HEX-1:5 2s:n-acetyl 3b:b-dglc-HEX-1:5 4s:n-acetyl 5b:b-dman-HEX-1:5 6b:a-dman-HEX-1:5 7b:b-dglc-HEX-1:5 8s:n-acetyl 9b:b-dgal-HEX-1:5 10b:a-dgro-dgal-NON-2:6|1:a|2:keto|3:d 11s:n-acetyl 12b:a-dman-HEX-1:5 13b:b-dglc-HEX-1:5 14s:n-acetyl 15b:b-dgal-HEX-1:5 16b:a-lgal-HEX-1:5|6:d LIN 1:1d(2+1)2n 2:1o(4+1)3d 3:3d(2+1)4n 4:3o(4+1)5d 5:5o(3+1)6d 6:6o(2+1)7d 7:7d(2+1)8n 8:7o(4+1)9d 9:9o(6+2)10d 10:10d(5+1)11n 11:5o(6+1)12d 12:12o(2+1)13d 13:13d(2+1)14n 14:13o(4+1)15d 15:1o(6+1)16d", "iupac": "alpha-D-NeupAc-(2->6)-beta-D-Galp-(1->4)-beta-D-GlcpNAc-(1->2)-alpha-D-Manp-(1->3)[beta-D-Galp-(1->4)-beta-D-GlcpNAc-(1->2)-alpha-D-Manp-(1->6)]-beta-D-Manp-(1->4)-beta-D-GlcpNAc-(1->4)[alpha-L-Fucp-(1->6)]-beta-D-GlcpNAc-(1->", "smiles_isomeric": "C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)O)NC(=O)C)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O[C@H]4[C@H]([C@H]([C@@H]([C@H](O4)CO[C@@H]5[C@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O[C@H]7[C@@H]([C@H]([C@H]([C@H](O7)CO)O)O)O)O)NC(=O)C)O)O[C@@H]8[C@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)CO[C@@]1(C[C@@H]([C@H]([C@@H](O1)[C@@H]([C@@H](CO)O)O)NC(=O)C)O)C(=O)O)O)O)O)O)NC(=O)C)O)O)NC(=O)C)O)O)O", "mass": 2077.75, "expression": [ { "residue": "Asn", "uniprot_canonical_ac": "P02771-1", "evidence": [ { "url": "https://glyconnect.expasy.org/browser/structures/2481", "id": "2481", "database": "GlyConnect" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7686446", "id": "7686446", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7511099", "id": "7511099", "database": "PubMed" } ], "tissue": { "uberon_id": "UBERON_0001977", "url": "http://purl.obolibrary.org/obo/UBERON_0001977", "name": "Blood Serum" }, "start_pos": 251, "cell_line": {}, "end_pos": 251 }, { "residue": "Asn", "uniprot_canonical_ac": "P00747-1", "evidence": [ { "url": "https://glyconnect.expasy.org/browser/structures/2481", "id": "2481", "database": "GlyConnect" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/3356193", "id": "3356193", "database": "PubMed" } ], "tissue": { "uberon_id": "UBERON_0001969", "url": "http://purl.obolibrary.org/obo/UBERON_0001969", "name": "Blood Plasma" }, "start_pos": 308, "cell_line": {}, "end_pos": 308 } ] }