{ "glytoucan_ac": "G36123IU", "number_monosaccharides": 2, "mass": 512.19, "mass_pme": 652.34, "fully_determined": "yes", "iupac": "alpha-D-Neup5Ac-(2->6)-alpha-D-GalpNAc-(1->", "wurcs": "WURCS=2.0/2,2,1/[a2112h-1a_1-5_2*NCC/3=O][Aad21122h-2a_2-6_5*NCC/3=O]/1-2/a6-b2", "glycoct": "RES 1b:a-dgal-HEX-1:5 2s:n-acetyl 3b:a-dgro-dgal-NON-2:6|1:a|2:keto|3:d 4s:n-acetyl LIN 1:1d(2+1)2n 2:1o(6+2)3d 3:3d(5+1)4n", "inchi": "InChI=1S/C19H32N2O14/c1-6(23)20-11-8(25)3-19(18(31)32,35-16(11)13(27)9(26)4-22)33-5-10-14(28)15(29)12(17(30)34-10)21-7(2)24/h8-17,22,25-30H,3-5H2,1-2H3,(H,20,23)(H,21,24)(H,31,32)/t8-,9+,10+,11+,12+,13+,14-,15+,16+,17-,19+/m0/s1", "glycam": "DNeup5Aca2-6DGalpNAca1-OH", "smiles_isomeric": "CC(=O)N[C@@H]1[C@H](C[C@@](O[C@H]1[C@@H]([C@@H](CO)O)O)(C(=O)O)OC[C@@H]2[C@@H]([C@@H]([C@H]([C@H](O2)O)NC(=O)C)O)O)O", "inchi_key": { "key": "CZOGCRVBCLRHQJ-WHWAGLCYSA-N", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/CZOGCRVBCLRHQJ-WHWAGLCYSA-N" }, "crossref": [ { "id": "G36123IU", "database": "GlyTouCan", "url": "https://glytoucan.org/Structures/Glycans/G36123IU", "categories": [ "Glycomics" ] }, { "id": "GSD000157", "url": "https://wiki.glygen.org/Glycan_structure_dictionary#GSD000157", "database": "Glycan Structure Dictionary", "categories": [ "Ontology and Dictionary" ] } ], "publication": [ { "title": "Preparation and characterization of monoclonal antibodies directed to the tumor-associated O-linked sialosyl-2----6 alpha-N-acetylgalactosaminyl (sialosyl-Tn) epitope.", "journal": "Cancer research", "date": "1988", "authors": "Kjeldsen T, Clausen H, Hirohashi S, Ogawa T, Iijima H, Hakomori S", "evidence": [ { "database": "Glycan Motif", "id": "GGM.000012", "url": "https://glycomotif.glyomics.org/glycomotif/GGM.000012" } ], "reference": [ { "type": "PubMed", "id": "2450649", "url": "https://glygen.org/publication/PubMed/2450649" } ] }, { "title": "The repertoire of glycan determinants in the human glycome.", "journal": "Molecular bioSystems", "date": "2009", "authors": "Cummings RD", "evidence": [ { "database": "Glycan Motif", "id": "GGM.000012", "url": "https://glycomotif.glyomics.org/glycomotif/GGM.000012" } ], "reference": [ { "type": "PubMed", "id": "19756298", "url": "https://glygen.org/publication/PubMed/19756298" } ] } ], "residues": [ { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.O08912-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q10472-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q6PB93-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q10471-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.P70419-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q14435-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.O08832-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8N4A0-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8C102-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q7Z7M9-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8C7U7-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8NCL4-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q80VA0-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q86SF2-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.G3X942-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q9HCQ5-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q6P9S7-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q86SR1-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q921L8-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8NCW6-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8BGT9-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8IXK2-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8CF93-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8IUC8-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8BVG5-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q96FL9-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q9JJ61-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8N428-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q9D2N8-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8N3T1-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8K1B9-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q6P9A2-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q9D4M9-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q7Z4T8-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q7TT15-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q6IS24-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q49A17-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.D3ZQA1-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.D4A3A9-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.O88422-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.D4A864-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.D4A849-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q925R7-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q10473-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q6UE39-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.F1LQN1-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q6P6V1-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.D3ZFD2-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0A8I5ZYW6-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q9R0C5-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q5CD99-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0A8J8XFR5-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q07537-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q29121-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.F1N554-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.F1RQC2-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.E1BDW8-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0A287B5N4-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.F1SSE9-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0A287AU55-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0AAA9S1Y7-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.F1S3Y5-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.E1BHN6-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0A287ASH2-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.F1S4B7-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.E1B9U7-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.F1RJJ7-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.F6RJ62-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.F1S6W6-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0A3Q1M986-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0A287A6N0-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0AAA9S5W3-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0A4X1VPB2-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0A5G2R0V1-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.E1BKQ9-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.I3LCH7-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q5EA41-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0A287A7J0-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0AAA9T153-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.F1RIZ9-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0A287AIU3-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.G3N0Q1-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.F1SSN3-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0AAA9TS02-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0A4X1V6H3-1", "detachedby": "", "parentid": "0" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.Q9QZ39-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.Q9NSC7-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.P70277-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.Q9UJ37-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.Q9WUV2-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.Q8NDV1-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.Q9R2B6-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.Q9H4F1-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.Q9QYJ1-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.Q9BVH7-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.Q9JM95-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.Q969X2-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.Q64686-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.G3V9C4-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.Q6ZXY9-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.A0A8J8XJY2-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.A0ABK0LQS8-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.Q6ZYN8-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.F1N6V7-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.F1RZ66-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.A0A3Q1LRX1-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.G3N3B2-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.F1RWP7-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.A0A3Q1N3L6-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.I3LS82-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.F6PZ23-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.F1MXN8-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.A0A287ACU7-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.Q08E15-1", "detachedby": "", "parentid": "OC" }, { "id": "O535", "name": "O-glycan_a-D-NeupNAc_535", "attachedby": "rxn.F1RS05-1", "detachedby": "", "parentid": "OC" } ], "composition": [ { "name": "6-Deoxy-Hexose", "residue": "dhex", "count": 0, "cid": "840", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840" }, { "name": "Hexose", "residue": "hex", "count": 0, "cid": "206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206" }, { "name": "N-Acetylhexosamine", "residue": "hexnac", "count": 1, "cid": "899", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899" }, { "name": "Hexuronic Acid", "residue": "hexa", "count": 0, "cid": "610", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610" }, { "name": "2-Amino-2-Deoxy-Hexose", "residue": "hexn", "count": 0, "cid": "739", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739" }, { "name": "N-Acetyl-Neuraminic Acid", "residue": "neuac", "count": 1, "cid": "439197", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197" }, { "name": "N-Glycolyl-Neuraminic Acid", "residue": "neugc", "count": 0, "cid": "440001", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001" }, { "name": "Phosphate", "residue": "p", "count": 0, "cid": "1061", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061" }, { "name": "Pentose", "residue": "pent", "count": 0, "cid": "229", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229" }, { "name": "Sulfate", "residue": "s", "count": 0, "cid": "1117", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117" }, { "name": "Other", "residue": "other", "count": 0 } ], "composition_expanded": [ { "name": "Alditol", "residue": "aldi", "count": 0 }, { "name": "6-Deoxy-Hexose", "residue": "dhex", "count": 0, "cid": "840", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840" }, { "name": "6-Deoxy-Hexitol", "residue": "dhex+aldi", "count": 0 }, { "name": "L-Fucose", "residue": "fuc", "count": 0, "cid": "17106", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/17106" }, { "name": "L-Fucitol", "residue": "fuc+aldi", "count": 0, "cid": "445724", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/445724" }, { "name": "D-Galactose", "residue": "gal", "count": 0, "cid": "6036", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6036" }, { "name": "D-Galactitol", "residue": "gal+aldi", "count": 0, "cid": "11850", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11850" }, { "name": "N-Acetyl-D-galactosamine", "residue": "galnac", "count": 1, "cid": "35717", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/35717" }, { "name": "N-Acetylgalactosaminitol", "residue": "galnac+aldi", "count": 0, "cid": "165880", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165880" }, { "name": "D-Galacturonic Acid", "residue": "gala", "count": 0, "cid": "439215", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439215" }, { "name": "D-Glucose", "residue": "glc", "count": 0, "cid": "5793", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5793" }, { "name": "D-Glucitol", "residue": "glc+aldi", "count": 0, "cid": "5780", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5780" }, { "name": "D-Glucuronic acid", "residue": "glca", "count": 0, "cid": "94715", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/94715" }, { "name": "D-Glucosamine", "residue": "glcn", "count": 0, "cid": "439213", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439213" }, { "name": "N-Acetyl-D-Glucosamine", "residue": "glcnac", "count": 0, "cid": "439174", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439174" }, { "name": "N-Acetyl-D-glucosaminitol", "residue": "glcnac+aldi", "count": 0, "cid": "165206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165206" }, { "name": "Hexose", "residue": "hex", "count": 0, "cid": "206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206" }, { "name": "N-Acetylhexosamine", "residue": "hexnac", "count": 1, "cid": "899", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899" }, { "name": "Hexuronic Acid", "residue": "hexa", "count": 0, "cid": "610", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610" }, { "name": "2-Amino-2-Deoxy-Hexose", "residue": "hexn", "count": 0, "cid": "739", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739" }, { "name": "Hexitol", "residue": "hex+aldi", "count": 0, "cid": "453", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/453" }, { "name": "N-Acetylhexosaminitol", "residue": "hexnac+aldi", "count": 0 }, { "name": "L-Iduronic acid", "residue": "idoa", "count": 0, "cid": "441039", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/441039" }, { "name": "D-Mannose", "residue": "man", "count": 0, "cid": "18950", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18950" }, { "name": "D-Mannitol", "residue": "man+aldi", "count": 0, "cid": "6251", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6251" }, { "name": "N-Acetyl-D-mannosamine", "residue": "mannac", "count": 0, "cid": "439281", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439281" }, { "name": "Methyl", "residue": "me", "count": 0 }, { "name": "N-Acetyl-Neuraminic Acid", "residue": "neuac", "count": 1, "cid": "439197", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197" }, { "name": "N-Glycolyl-Neuraminic Acid", "residue": "neugc", "count": 0, "cid": "440001", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001" }, { "name": "Phosphate", "residue": "p", "count": 0, "cid": "1061", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061" }, { "name": "Pentose", "residue": "pent", "count": 0, "cid": "229", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229" }, { "name": "Sulfate", "residue": "s", "count": 0, "cid": "1117", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117" }, { "name": "Sialic acid", "residue": "sia", "count": 1 }, { "name": "Other", "residue": "other", "count": 0 }, { "name": "Floating substituent", "residue": "x", "count": 0 }, { "name": "D-Xylose", "residue": "xyl", "count": 0, "cid": "135191", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135191" }, { "name": "Ketodeoxynononic acid", "residue": "kdn", "count": 0, "cid": "13991616", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13991616" } ], "glycans": [ { "glytoucan_ac": "G08178PQ", "url": "https://glytoucan.org/Structures/Glycans/G08178PQ" }, { "glytoucan_ac": "G08371CD", "url": "https://glytoucan.org/Structures/Glycans/G08371CD" }, { "glytoucan_ac": "G15807NZ", "url": "https://glytoucan.org/Structures/Glycans/G15807NZ" }, { "glytoucan_ac": "G23061NF", "url": "https://glytoucan.org/Structures/Glycans/G23061NF" }, { "glytoucan_ac": "G31194II", "url": "https://glytoucan.org/Structures/Glycans/G31194II" }, { "glytoucan_ac": "G35255WG", "url": "https://glytoucan.org/Structures/Glycans/G35255WG" }, { "glytoucan_ac": "G36123IU", "url": "https://glytoucan.org/Structures/Glycans/G36123IU" }, { "glytoucan_ac": "G37193ED", "url": "https://glytoucan.org/Structures/Glycans/G37193ED" }, { "glytoucan_ac": "G37584UP", "url": "https://glytoucan.org/Structures/Glycans/G37584UP" }, { "glytoucan_ac": "G54624RV", "url": "https://glytoucan.org/Structures/Glycans/G54624RV" }, { "glytoucan_ac": "G66874OD", "url": "https://glytoucan.org/Structures/Glycans/G66874OD" }, { "glytoucan_ac": "G67772KL", "url": "https://glytoucan.org/Structures/Glycans/G67772KL" }, { "glytoucan_ac": "G69099KE", "url": "https://glytoucan.org/Structures/Glycans/G69099KE" }, { "glytoucan_ac": "G77900OU", "url": "https://glytoucan.org/Structures/Glycans/G77900OU" }, { "glytoucan_ac": "G92345KY", "url": "https://glytoucan.org/Structures/Glycans/G92345KY" }, { "glytoucan_ac": "G93542QZ", "url": "https://glytoucan.org/Structures/Glycans/G93542QZ" } ], "subsumption": [ { "id": "G08178PQ", "type": "Topology" }, { "id": "G08371CD", "type": "Saccharide" }, { "id": "G11378EW", "type": "Saccharide" }, { "id": "G15807NZ", "type": "Saccharide" }, { "id": "G16823MF", "type": "Topology" }, { "id": "G19399OS", "type": "Composition" }, { "id": "G23061NF", "type": "Saccharide" }, { "id": "G31194II", "type": "Topology" }, { "id": "G32354FH", "type": "Topology" }, { "id": "G35255WG", "type": "Saccharide" }, { "id": "G37193ED", "type": "Saccharide" }, { "id": "G37584UP", "type": "Saccharide" }, { "id": "G53789TU", "type": "Saccharide" }, { "id": "G54624RV", "type": "Saccharide" }, { "id": "G66874OD", "type": "Saccharide" }, { "id": "G67772KL", "type": "Saccharide" }, { "id": "G69099KE", "type": "Topology" }, { "id": "G77854OM", "type": "Composition" }, { "id": "G77900OU", "type": "Saccharide" }, { "id": "G87636JF", "type": "BaseComposition" }, { "id": "G90085MT", "type": "Composition" }, { "id": "G92345KY", "type": "Saccharide" }, { "id": "G93542QZ", "type": "Saccharide" } ], "names": [ { "name": "Sialyl Tn antigen", "domain": "Semantic Name" }, { "name": "Sialyl Tn antigen", "domain": "motifname" } ], "synonym": [], "keywords": [], "reducing_end": "true", "aglycon": "Ser/Thr", "alignment_method": "Whole-Glycan", "dictionary": { "term": "Sialyl-Tn antigen", "term_in_sentence": "The interaction between Siglec-15 and tumor-associated sialyl-Tn antigen enhances TGF-\u03b2 secretion from monocytes/macrophages through the DAP12-Syk pathway.[PMID:23035012]", "publication": "23035012|29273237|15770530|31595388|26617889|1720922|15466199|10971172|14652017|8616877|1543361|16965854|21566901|9269833|9834267|24970145|22367369|10778170|30018351|28628803|16149605|32134186|28632300|11308020|10365852|17195456|23567325|11014575|2342728|8575847|1851822|11735169|20960853|7846011", "definition": "N-acetyl-alpha-neuraminyl-(2\u21926)-N-acetyl-alpha-D-galactosamine is an N-acetyl-alpha-neuraminyl-(2\u21926)-N-acetyl-D-galactosamine in which the carbon bearing the anomeric hydroxy group has alpha configuration. It has a role as an epitope. It derives from a N-acetyl-alpha-D-galactosamine and a N-acetyl-alpha-neuraminic acid.[CHEBI:61818]", "term_xref": "GTC:G36123IU|GlycoEpitope:EP0022|CID:51351800|CHEBI:61818", "synonymns": [ "" ], "function": "apoptosis of monocyte-derived dendritic cells[GlycoEpitope:EP0022]|decrease of adhesion and increase of migration[GlycoEpitope:EP0022]|increase of tumor growth[GlycoEpitope:EP0022]|associated with morphological changes, decreased growth and increased migration of MDA-MB-231 cells.[GlycoEpitope:EP0022]", "disease_associations": "anaplastic meningioma[GlycoEpitope:EP0022]|Barrett's esophagus[GlycoEpitope:EP0022]|bladder cancer[GlycoEpitope:EP0022]|breast cancer[GlycoEpitope:EP0022]|colon cancer[GlycoEpitope:EP0022]|colorectal cancer[GlycoEpitope:EP0022]|erythroblastic leukemia[GlycoEpitope:EP0022]|esophageal cancer[GlycoEpitope:EP0022]|gastric cancer[GlycoEpitope:EP0022]|helicobacter pylori chronic gastritis(HpCG)[GlycoEpitope:EP0022]|liver cancer[GlycoEpitope:EP0022]|iterome cancer[GlycoEpitope:EP0022]|ovary tumor[GlycoEpitope:EP0022]|pancreas cancer[GlycoEpitope:EP0022]", "wikipedia": "", "essentials_of_glycobiology": "Chapter 56", "evidence": [ { "id": "GSD000157", "url": "https://wiki.glygen.org/Glycan_structure_dictionary#GSD000157", "database": "Glycan Structure Dictionary" } ] }, "biomarkers": [], "motif_ac": "GGM.000012", "section_stats": [ { "table_id": "results", "table_stats": [ { "field": "total", "count": 16 } ], "sort_fields": [ "glytoucan_ac", "url" ] } ] }