{ "glytoucan_ac": "G57321FI", "number_monosaccharides": 1, "mass": 221.09, "mass_pme": 291.17, "fully_determined": "yes", "iupac": "alpha-D-GalpNAc-(1->", "wurcs": "WURCS=2.0/1,1,0/[a2112h-1a_1-5_2*NCC/3=O]/1/", "glycoct": "RES 1b:a-dgal-HEX-1:5 2s:n-acetyl LIN 1:1d(2+1)2n", "inchi": "InChI=1S/C8H15NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-8,10,12-14H,2H2,1H3,(H,9,11)/t4-,5-,6+,7-,8+/m1/s1", "glycam": "DGalpNAca1-OH", "smiles_isomeric": "CC(=O)N[C@@H]1[C@H]([C@H]([C@H](O[C@@H]1O)CO)O)O", "inchi_key": { "key": "OVRNDRQMDRJTHS-CBQIKETKSA-N", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/OVRNDRQMDRJTHS-CBQIKETKSA-N" }, "crossref": [ { "id": "G57321FI", "database": "GlyTouCan", "url": "https://glytoucan.org/Structures/Glycans/G57321FI", "categories": [ "Glycomics" ] }, { "id": "GSD000167", "url": "https://wiki.glygen.org/Glycan_structure_dictionary#GSD000167", "database": "Glycan Structure Dictionary", "categories": [ "Ontology and Dictionary" ] } ], "publication": [ { "title": "Tn epitopes, immunoreactive with ordinary anti-Tn antibodies, on normal, desialylated human erythrocytes and on Thomsen-Friedenreich antigen isolated therefrom.", "journal": "Molecular immunology", "date": "1985", "authors": "Springer GF, Desai PR", "evidence": [ { "database": "Glycan Motif", "id": "GGM.000008", "url": "https://glycomotif.glyomics.org/glycomotif/GGM.000008" } ], "reference": [ { "type": "PubMed", "id": "2417112", "url": "https://glygen.org/publication/PubMed/2417112" } ] }, { "title": "Acquired hemolytic anemia with polyagglutinability of red blood cells due to a new factor present in normal human serum (Anti-Tn).", "journal": "Blood", "date": "1959", "authors": "DAUSSET J, MOULLEC J, BERNARD J", "evidence": [ { "database": "Glycan Motif", "id": "GGM.000008", "url": "https://glycomotif.glyomics.org/glycomotif/GGM.000008" } ], "reference": [ { "type": "PubMed", "id": "13814231", "url": "https://glygen.org/publication/PubMed/13814231" } ] }, { "title": "The repertoire of glycan determinants in the human glycome.", "journal": "Molecular bioSystems", "date": "2009", "authors": "Cummings RD", "evidence": [ { "database": "Glycan Motif", "id": "GGM.000008", "url": "https://glycomotif.glyomics.org/glycomotif/GGM.000008" } ], "reference": [ { "type": "PubMed", "id": "19756298", "url": "https://glygen.org/publication/PubMed/19756298" } ] } ], "residues": [ { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.O08912-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q10472-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q6PB93-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q10471-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.P70419-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q14435-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.O08832-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8N4A0-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8C102-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q7Z7M9-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8C7U7-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8NCL4-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q80VA0-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q86SF2-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.G3X942-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q9HCQ5-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q6P9S7-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q86SR1-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q921L8-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8NCW6-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8BGT9-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8IXK2-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8CF93-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8IUC8-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8BVG5-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q96FL9-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q9JJ61-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8N428-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q9D2N8-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8N3T1-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q8K1B9-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q6P9A2-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q9D4M9-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q7Z4T8-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q7TT15-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q6IS24-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q49A17-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.D3ZQA1-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.D4A3A9-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.O88422-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.D4A864-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.D4A849-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q925R7-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q10473-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q6UE39-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.F1LQN1-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q6P6V1-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.D3ZFD2-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0A8I5ZYW6-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q9R0C5-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q5CD99-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0A8J8XFR5-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q07537-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q29121-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.F1N554-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.F1RQC2-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.E1BDW8-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0A287B5N4-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.F1SSE9-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0A287AU55-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0AAA9S1Y7-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.F1S3Y5-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.E1BHN6-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0A287ASH2-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.F1S4B7-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.E1B9U7-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.F1RJJ7-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.F6RJ62-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.F1S6W6-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0A3Q1M986-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0A287A6N0-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0AAA9S5W3-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0A4X1VPB2-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0A5G2R0V1-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.E1BKQ9-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.I3LCH7-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.Q5EA41-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0A287A7J0-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0AAA9T153-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.F1RIZ9-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0A287AIU3-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.G3N0Q1-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.F1SSN3-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0AAA9TS02-1", "detachedby": "", "parentid": "0" }, { "id": "OC", "name": "O-glycan_core_x-D-GalpNAc_C", "attachedby": "rxn.A0A4X1V6H3-1", "detachedby": "", "parentid": "0" } ], "composition": [ { "name": "6-Deoxy-Hexose", "residue": "dhex", "count": 0, "cid": "840", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840" }, { "name": "Hexose", "residue": "hex", "count": 0, "cid": "206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206" }, { "name": "N-Acetylhexosamine", "residue": "hexnac", "count": 1, "cid": "899", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899" }, { "name": "Hexuronic Acid", "residue": "hexa", "count": 0, "cid": "610", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610" }, { "name": "2-Amino-2-Deoxy-Hexose", "residue": "hexn", "count": 0, "cid": "739", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739" }, { "name": "N-Acetyl-Neuraminic Acid", "residue": "neuac", "count": 0, "cid": "439197", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197" }, { "name": "N-Glycolyl-Neuraminic Acid", "residue": "neugc", "count": 0, "cid": "440001", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001" }, { "name": "Phosphate", "residue": "p", "count": 0, "cid": "1061", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061" }, { "name": "Pentose", "residue": "pent", "count": 0, "cid": "229", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229" }, { "name": "Sulfate", "residue": "s", "count": 0, "cid": "1117", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117" }, { "name": "Other", "residue": "other", "count": 0 } ], "composition_expanded": [ { "name": "Alditol", "residue": "aldi", "count": 0 }, { "name": "6-Deoxy-Hexose", "residue": "dhex", "count": 0, "cid": "840", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840" }, { "name": "6-Deoxy-Hexitol", "residue": "dhex+aldi", "count": 0 }, { "name": "L-Fucose", "residue": "fuc", "count": 0, "cid": "17106", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/17106" }, { "name": "L-Fucitol", "residue": "fuc+aldi", "count": 0, "cid": "445724", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/445724" }, { "name": "D-Galactose", "residue": "gal", "count": 0, "cid": "6036", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6036" }, { "name": "D-Galactitol", "residue": "gal+aldi", "count": 0, "cid": "11850", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11850" }, { "name": "N-Acetyl-D-galactosamine", "residue": "galnac", "count": 1, "cid": "35717", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/35717" }, { "name": "N-Acetylgalactosaminitol", "residue": "galnac+aldi", "count": 0, "cid": "165880", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165880" }, { "name": "D-Galacturonic Acid", "residue": "gala", "count": 0, "cid": "439215", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439215" }, { "name": "D-Glucose", "residue": "glc", "count": 0, "cid": "5793", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5793" }, { "name": "D-Glucitol", "residue": "glc+aldi", "count": 0, "cid": "5780", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5780" }, { "name": "D-Glucuronic acid", "residue": "glca", "count": 0, "cid": "94715", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/94715" }, { "name": "D-Glucosamine", "residue": "glcn", "count": 0, "cid": "439213", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439213" }, { "name": "N-Acetyl-D-Glucosamine", "residue": "glcnac", "count": 0, "cid": "439174", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439174" }, { "name": "N-Acetyl-D-glucosaminitol", "residue": "glcnac+aldi", "count": 0, "cid": "165206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165206" }, { "name": "Hexose", "residue": "hex", "count": 0, "cid": "206", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206" }, { "name": "N-Acetylhexosamine", "residue": "hexnac", "count": 1, "cid": "899", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899" }, { "name": "Hexuronic Acid", "residue": "hexa", "count": 0, "cid": "610", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/610" }, { "name": "2-Amino-2-Deoxy-Hexose", "residue": "hexn", "count": 0, "cid": "739", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/739" }, { "name": "Hexitol", "residue": "hex+aldi", "count": 0, "cid": "453", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/453" }, { "name": "N-Acetylhexosaminitol", "residue": "hexnac+aldi", "count": 0 }, { "name": "L-Iduronic acid", "residue": "idoa", "count": 0, "cid": "441039", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/441039" }, { "name": "D-Mannose", "residue": "man", "count": 0, "cid": "18950", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18950" }, { "name": "D-Mannitol", "residue": "man+aldi", "count": 0, "cid": "6251", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6251" }, { "name": "N-Acetyl-D-mannosamine", "residue": "mannac", "count": 0, "cid": "439281", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439281" }, { "name": "Methyl", "residue": "me", "count": 0 }, { "name": "N-Acetyl-Neuraminic Acid", "residue": "neuac", "count": 0, "cid": "439197", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197" }, { "name": "N-Glycolyl-Neuraminic Acid", "residue": "neugc", "count": 0, "cid": "440001", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440001" }, { "name": "Phosphate", "residue": "p", "count": 0, "cid": "1061", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1061" }, { "name": "Pentose", "residue": "pent", "count": 0, "cid": "229", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229" }, { "name": "Sulfate", "residue": "s", "count": 0, "cid": "1117", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1117" }, { "name": "Sialic acid", "residue": "sia", "count": 0 }, { "name": "Other", "residue": "other", "count": 0 }, { "name": "Floating substituent", "residue": "x", "count": 0 }, { "name": "D-Xylose", "residue": "xyl", "count": 0, "cid": "135191", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135191" }, { "name": "Ketodeoxynononic acid", "residue": "kdn", "count": 0, "cid": "13991616", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13991616" } ], "glycans": [ { "glytoucan_ac": "G27025MB", "url": "https://glytoucan.org/Structures/Glycans/G27025MB" }, { "glytoucan_ac": "G39738WL", "url": "https://glytoucan.org/Structures/Glycans/G39738WL" }, { "glytoucan_ac": "G49575MY", "url": "https://glytoucan.org/Structures/Glycans/G49575MY" }, { "glytoucan_ac": "G57321FI", "url": "https://glytoucan.org/Structures/Glycans/G57321FI" }, { "glytoucan_ac": "G86164WK", "url": "https://glytoucan.org/Structures/Glycans/G86164WK" } ], "subsumption": [ { "id": "G27025MB", "type": "Topology" }, { "id": "G29068FM", "type": "BaseComposition" }, { "id": "G39738WL", "type": "Composition" }, { "id": "G49575MY", "type": "Topology" }, { "id": "G53869BW", "type": "Saccharide" }, { "id": "G56558YT", "type": "Topology" }, { "id": "G70994MS", "type": "Topology" }, { "id": "G81202UN", "type": "Composition" }, { "id": "G86164WK", "type": "Saccharide" } ], "names": [ { "name": "Tn antigen", "domain": "Semantic Name" }, { "name": "Tn antigen", "domain": "motifname" } ], "synonym": [], "keywords": [], "reducing_end": "true", "aglycon": "Ser/Thr", "alignment_method": "Whole-Glycan", "dictionary": { "term": "Tn antigen", "term_in_sentence": "Furthermore, we confirmed that LS174T cells (Tn-positive) transfected with wild-type Cosmc, thus expressing no Tn antigen, had down-regulation of H-Ras expression and subsequent inhibition of EMT process.[PMID:30637914]", "publication": "27679419|31938254|30637914|24643043|31225574|21259410|31742337|28514044|33014816|28708980|27432485|33050853|26045765|27542280|24411673|27760846|30115016|1410473|29802864|29669308|29251002|32541028|31019509|1582597|2981150|10842187|29638123|22367369|10778170|1510031|19372570|20641477|16149605|15770530|27856425|23814067|28068458|32134186|8174100|10571017|27453399|1727666|23740330", "definition": "Tn anitigen or alpha-galnac or N-Acetylgalactosamine is an N-acetyl-D-galactosamine having alpha-configuration at the anomeric centre. It has a role as an epitope. It derives from an alpha-D-galactosamine.[CHEBI:40356,HMDB0000212]", "term_xref": "GTC:G57321FI|GlycoEpitope:EP0021|CID:84265|CHEBI:40356|HMDB0000212|GlycoMotif:GGM.000008", "synonymns": [ "" ], "function": "lymphatic metastasis[GlycoEpitope:EP0021]|tube formation in Drosophila development[GlycoEpitope:EP0021]|modulation of malignant phenotype (gastric carcinoma cell)[GlycoEpitope:EP0021]|correlation with tumor stage, lymphatic invasion and lymph node matastasis[GlycoEpitope:EP0021]", "disease_associations": "breast cancer[GlycoEpitope:EP0021]|cervical cancer[GlycoEpitope:EP0021]|colon cancer[GlycoEpitope:EP0021]|colorectal cancer[GlycoEpitope:EP0021]|fibrosarcoma[GlycoEpitope:EP0021]|gastric cancer[GlycoEpitope:EP0021]|liver cancer[GlycoEpitope:EP0021]|ovarian cancer[GlycoEpitope:EP0021]|pancreas cancer[GlycoEpitope:EP0021]|prostate cancer[GlycoEpitope:EP0021]|Tn syndorome[GlycoEpitope:EP0021]|Barrett'sesophagus[GlycoEpitope:EP0021]|Schindler/Kanzaki desease (alpha-N acetylgalactosaminidase deficiency)[GlycoEpitope:EP0021].", "wikipedia": "", "essentials_of_glycobiology": "", "evidence": [ { "id": "GSD000167", "url": "https://wiki.glygen.org/Glycan_structure_dictionary#GSD000167", "database": "Glycan Structure Dictionary" } ] }, "biomarkers": [], "motif_ac": "GGM.000008", "section_stats": [ { "table_id": "results", "table_stats": [ { "field": "total", "count": 5 } ], "sort_fields": [ "glytoucan_ac", "url" ] } ] }