{ "glytoucan": { "glytoucan_ac": "G17689DH", "glytoucan_url": "https://glytoucan.org/Structures/Glycans/G17689DH" }, "mass": 2368.84, "iupac": "alpha-D-NeupAc-(2->3)-beta-D-Galp-(1->4)-beta-D-GlcpNAc-(1->2)-alpha-D-Manp-(1->3)[alpha-D-NeupAc-(2->3)-beta-D-Galp-(1->4)-beta-D-GlcpNAc-(1->2)-alpha-D-Manp-(1->6)]-beta-D-Manp-(1->4)-beta-D-GlcpNAc-(1->4)[alpha-L-Fucp-(1->6)]-beta-D-GlcpNAc(1->", "wurcs": "WURCS=2.0/6,12,11/[a2122h-1b_1-5_2*NCC/3=O][a1122h-1b_1-5][a1122h-1a_1-5][a2112h-1b_1-5][Aad21122h-2a_2-6_5*NCC/3=O][a1221m-1a_1-5]/1-1-2-3-1-4-5-3-1-4-5-6/a4-b1_a6-l1_b4-c1_c3-d1_c6-h1_d2-e1_e4-f1_f3-g2_h2-i1_i4-j1_j3-k2", "glycoct": "RES 1b:b-dglc-HEX-1:5 2s:n-acetyl 3b:b-dglc-HEX-1:5 4s:n-acetyl 5b:b-dman-HEX-1:5 6b:a-dman-HEX-1:5 7b:b-dglc-HEX-1:5 8s:n-acetyl 9b:b-dgal-HEX-1:5 10b:a-dgro-dgal-NON-2:6|1:a|2:keto|3:d 11s:n-acetyl 12b:a-dman-HEX-1:5 13b:b-dglc-HEX-1:5 14s:n-acetyl 15b:b-dgal-HEX-1:5 16b:a-dgro-dgal-NON-2:6|1:a|2:keto|3:d 17s:n-acetyl 18b:a-lgal-HEX-1:5|6:d LIN 1:1d(2+1)2n 2:1o(4+1)3d 3:3d(2+1)4n 4:3o(4+1)5d 5:5o(3+1)6d 6:6o(2+1)7d 7:7d(2+1)8n 8:7o(4+1)9d 9:9o(3+2)10d 10:10d(5+1)11n 11:5o(6+1)12d 12:12o(2+1)13d 13:13d(2+1)14n 14:13o(4+1)15d 15:15o(3+2)16d 16:16d(5+1)17n 17:1o(6+1)18d", "species": [ { "evidence": [ { "url": "http://www.unicarbkb.org/structure/1189", "id": "1189", "database": "UniCarbKB" } ], "taxid": 10090, "name": "Mus musculus" }, { "evidence": [ { "url": "https://glyconnect.expasy.org/browser/structures/1077", "id": "1077", "database": "GlyConnect" }, { "url": "https://glytoucan.org/Structures/Glycans/G17689DH", "id": "G17689DH", "database": "GlyTouCan" }, { "url": "http://www.unicarbkb.org/structure/1189", "id": "1189", "database": "UniCarbKB" } ], "taxid": 9606, "name": "Homo sapiens" }, { "evidence": [ { "url": "http://www.unicarbkb.org/structure/1189", "id": "1189", "database": "UniCarbKB" } ], "taxid": 10116, "name": "Rattus norvegicus" } ], "classification": [ { "subtype": { "url": "http://bioportal.bioontology.org/ontologies/GLYCO/?p=classes&conceptid=complex_N-glycan&jump_to_nav=true", "name": "complex" }, "type": { "url": "http://bioportal.bioontology.org/ontologies/GLYCO/?p=classes&conceptid=N-glycan&jump_to_nav=true", "name": "N-glycan" } } ], "glycoprotein": [ { "residue": "Asn", "uniprot_canonical_ac": "P14210-1", "protein_name": "Hepatocyte growth factor; Scatter factor; SF; Hepatopoietin-A", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P14210/annotated", "id": "P14210", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/8407880", "id": "8407880", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/1482348", "id": "1482348", "database": "PubMed" }, { "url": "https://glyconnect.expasy.org/browser/proteins/219", "id": "219", "database": "GlyConnect" } ], "position": 566, "tax_name": "Homo sapiens", "gene_name": "HGF; HPTA; DFNB39; F-TCF; HGFB; HPTA; SF", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "P0DN86-1", "protein_name": "Choriogonadotropin subunit beta 3; Choriogonadotropin subunit beta; CG-beta; Chorionic gonadotropin chain beta", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P0DN86/annotated", "id": "P0DN86", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/468798", "id": "468798", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/1374031", "id": "1374031", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/1820200", "id": "1820200", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/9449027", "id": "9449027", "database": "PubMed" }, { "url": "https://glyconnect.expasy.org/browser/proteins/91", "id": "91", "database": "GlyConnect" } ], "position": 33, "tax_name": "Homo sapiens", "gene_name": "CGB5; CGB; CGB8; CGB; CGB5; CGB7; CGB8; hCGB; CGB3", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "P07911-1", "protein_name": "Uromodulin; Tamm-Horsfall urinary glycoprotein; THP", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P07911/annotated", "id": "P07911", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/9884403", "id": "9884403", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2136357", "id": "2136357", "database": "PubMed" } ], "position": 322, "tax_name": "Homo sapiens", "gene_name": "UMOD; ADMCKD2; FJHN; HNFJ; HNFJ1; MCKD2; THGP; THP", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "P01588-1", "protein_name": "Erythropoietin", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P01588/annotated", "id": "P01588", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/10764840", "id": "10764840", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/3179269", "id": "3179269", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/11805077", "id": "11805077", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/8460945", "id": "8460945", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2550193", "id": "2550193", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/8477709", "id": "8477709", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2813359", "id": "2813359", "database": "PubMed" } ], "position": 110, "tax_name": "Homo sapiens", "gene_name": "EPO; DBAL; ECYT5; EP; MVCD2", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "P07911-1", "protein_name": "Uromodulin; Tamm-Horsfall urinary glycoprotein; THP", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P07911/annotated", "id": "P07911", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/9884403", "id": "9884403", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2136357", "id": "2136357", "database": "PubMed" } ], "position": 513, "tax_name": "Homo sapiens", "gene_name": "UMOD; ADMCKD2; FJHN; HNFJ; HNFJ1; MCKD2; THGP; THP", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "P17050-1", "protein_name": "Alpha-N-acetylgalactosaminidase; 3.2.1.49; Alpha-galactosidase B", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P17050/annotated", "id": "P17050", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/10704524", "id": "10704524", "database": "PubMed" } ], "position": 201, "tax_name": "Homo sapiens", "gene_name": "D22S674; GALB; NAGA", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "P02788-1", "protein_name": "Lactotransferrin; Lactoferrin; 3.4.21.-; Growth-inhibiting protein 12; Talalactoferrin", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P02788/annotated", "id": "P02788", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7774715", "id": "7774715", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7068558", "id": "7068558", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2390069", "id": "2390069", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/12151713", "id": "12151713", "database": "PubMed" } ], "position": 156, "tax_name": "Homo sapiens", "gene_name": "LF; GIG12; HEL110; HLF2; LF; LTF; GIG12", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "P17050-1", "protein_name": "Alpha-N-acetylgalactosaminidase; 3.2.1.49; Alpha-galactosidase B", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P17050/annotated", "id": "P17050", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/10704524", "id": "10704524", "database": "PubMed" } ], "position": 124, "tax_name": "Homo sapiens", "gene_name": "D22S674; GALB; NAGA", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "P14210-1", "protein_name": "Hepatocyte growth factor; Scatter factor; SF; Hepatopoietin-A", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P14210/annotated", "id": "P14210", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/1482348", "id": "1482348", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/8407880", "id": "8407880", "database": "PubMed" }, { "url": "https://glyconnect.expasy.org/browser/proteins/219", "id": "219", "database": "GlyConnect" } ], "position": 653, "tax_name": "Homo sapiens", "gene_name": "HGF; HPTA; DFNB39; F-TCF; HGFB; HPTA; SF", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "P0DN86-1", "protein_name": "Choriogonadotropin subunit beta 3; Choriogonadotropin subunit beta; CG-beta; Chorionic gonadotropin chain beta", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P0DN86/annotated", "id": "P0DN86", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/1820200", "id": "1820200", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/9449027", "id": "9449027", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/1374031", "id": "1374031", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/468798", "id": "468798", "database": "PubMed" }, { "url": "https://glyconnect.expasy.org/browser/proteins/91", "id": "91", "database": "GlyConnect" } ], "position": 50, "tax_name": "Homo sapiens", "gene_name": "CGB5; CGB; CGB8; CGB; CGB5; CGB7; CGB8; hCGB; CGB3", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "P17050-1", "protein_name": "Alpha-N-acetylgalactosaminidase; 3.2.1.49; Alpha-galactosidase B", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P17050/annotated", "id": "P17050", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/10704524", "id": "10704524", "database": "PubMed" } ], "position": 177, "tax_name": "Homo sapiens", "gene_name": "D22S674; GALB; NAGA", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "P07911-1", "protein_name": "Uromodulin; Tamm-Horsfall urinary glycoprotein; THP", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P07911/annotated", "id": "P07911", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2136357", "id": "2136357", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/9884403", "id": "9884403", "database": "PubMed" } ], "position": 76, "tax_name": "Homo sapiens", "gene_name": "UMOD; ADMCKD2; FJHN; HNFJ; HNFJ1; MCKD2; THGP; THP", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "P01730-1", "protein_name": "T-cell surface glycoprotein CD4; Leu-3", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P01730/annotated", "id": "P01730", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2592374", "id": "2592374", "database": "PubMed" }, { "url": "https://glyconnect.expasy.org/browser/proteins/587", "id": "587", "database": "GlyConnect" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2001369", "id": "2001369", "database": "PubMed" } ], "position": 296, "tax_name": "Homo sapiens", "gene_name": "CD4; CD4mut", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "P01730-1", "protein_name": "T-cell surface glycoprotein CD4; Leu-3", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P01730/annotated", "id": "P01730", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2592374", "id": "2592374", "database": "PubMed" }, { "url": "https://glyconnect.expasy.org/browser/proteins/587", "id": "587", "database": "GlyConnect" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2001369", "id": "2001369", "database": "PubMed" } ], "position": 325, "tax_name": "Homo sapiens", "gene_name": "CD4; CD4mut", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "P07911-1", "protein_name": "Uromodulin; Tamm-Horsfall urinary glycoprotein; THP", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P07911/annotated", "id": "P07911", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/9884403", "id": "9884403", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2136357", "id": "2136357", "database": "PubMed" } ], "position": 275, "tax_name": "Homo sapiens", "gene_name": "UMOD; ADMCKD2; FJHN; HNFJ; HNFJ1; MCKD2; THGP; THP", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "P00750-1", "protein_name": "Tissue-type plasminogen activator; tPA; 3.4.21.68; t-PA; t-plasminogen activator", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P00750/annotated", "id": "P00750", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/8687384", "id": "8687384", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2226797", "id": "2226797", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2513186", "id": "2513186", "database": "PubMed" } ], "position": 219, "tax_name": "Homo sapiens", "gene_name": "T-PA; TPA; PLAT", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "P14210-1", "protein_name": "Hepatocyte growth factor; Scatter factor; SF; Hepatopoietin-A", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P14210/annotated", "id": "P14210", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/1482348", "id": "1482348", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/8407880", "id": "8407880", "database": "PubMed" }, { "url": "https://glyconnect.expasy.org/browser/proteins/219", "id": "219", "database": "GlyConnect" } ], "position": 402, "tax_name": "Homo sapiens", "gene_name": "HGF; HPTA; DFNB39; F-TCF; HGFB; HPTA; SF", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "P07911-1", "protein_name": "Uromodulin; Tamm-Horsfall urinary glycoprotein; THP", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P07911/annotated", "id": "P07911", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2136357", "id": "2136357", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/9884403", "id": "9884403", "database": "PubMed" } ], "position": 80, "tax_name": "Homo sapiens", "gene_name": "UMOD; ADMCKD2; FJHN; HNFJ; HNFJ1; MCKD2; THGP; THP", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "P01588-1", "protein_name": "Erythropoietin", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P01588/annotated", "id": "P01588", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/10764840", "id": "10764840", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/3179269", "id": "3179269", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/11805077", "id": "11805077", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/8460945", "id": "8460945", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2550193", "id": "2550193", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/8477709", "id": "8477709", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2813359", "id": "2813359", "database": "PubMed" } ], "position": 51, "tax_name": "Homo sapiens", "gene_name": "EPO; DBAL; ECYT5; EP; MVCD2", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "P40225-1", "protein_name": "Thrombopoietin; C-mpl ligand; ML; Megakaryocyte growth and development factor; MGDF; Megakaryocyte colony-stimulating factor; Myeloproliferative leukemia virus oncogene ligand", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P40225/annotated", "id": "P40225", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/8942648", "id": "8942648", "database": "PubMed" } ], "position": 197, "tax_name": "Homo sapiens", "gene_name": "MGDF; MKCSF; ML; MPLLG; THCYT1; TPO; MGDF; THPO", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "P01588-1", "protein_name": "Erythropoietin", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P01588/annotated", "id": "P01588", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2813359", "id": "2813359", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/8477709", "id": "8477709", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2550193", "id": "2550193", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/8460945", "id": "8460945", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/11805077", "id": "11805077", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/3179269", "id": "3179269", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/10764840", "id": "10764840", "database": "PubMed" } ], "position": 65, "tax_name": "Homo sapiens", "gene_name": "EPO; DBAL; ECYT5; EP; MVCD2", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "P01574-1", "protein_name": "Interferon beta; IFN-beta; Fibroblast interferon", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P01574/annotated", "id": "P01574", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/3667593", "id": "3667593", "database": "PubMed" } ], "position": 101, "tax_name": "Homo sapiens", "gene_name": "IFB; IFF; IFN-beta; IFNB; IFNB; IFB; IFNB1", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "P07911-1", "protein_name": "Uromodulin; Tamm-Horsfall urinary glycoprotein; THP", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P07911/annotated", "id": "P07911", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2136357", "id": "2136357", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/9884403", "id": "9884403", "database": "PubMed" } ], "position": 396, "tax_name": "Homo sapiens", "gene_name": "UMOD; ADMCKD2; FJHN; HNFJ; HNFJ1; MCKD2; THGP; THP", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "P02788-1", "protein_name": "Lactotransferrin; Lactoferrin; 3.4.21.-; Growth-inhibiting protein 12; Talalactoferrin", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P02788/annotated", "id": "P02788", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/12151713", "id": "12151713", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2390069", "id": "2390069", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7068558", "id": "7068558", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7774715", "id": "7774715", "database": "PubMed" } ], "position": 497, "tax_name": "Homo sapiens", "gene_name": "LF; GIG12; HEL110; HLF2; LF; LTF; GIG12", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "P14210-1", "protein_name": "Hepatocyte growth factor; Scatter factor; SF; Hepatopoietin-A", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P14210/annotated", "id": "P14210", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/8407880", "id": "8407880", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/1482348", "id": "1482348", "database": "PubMed" }, { "url": "https://glyconnect.expasy.org/browser/proteins/219", "id": "219", "database": "GlyConnect" } ], "position": 294, "tax_name": "Homo sapiens", "gene_name": "HGF; HPTA; DFNB39; F-TCF; HGFB; HPTA; SF", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "P17050-1", "protein_name": "Alpha-N-acetylgalactosaminidase; 3.2.1.49; Alpha-galactosidase B", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P17050/annotated", "id": "P17050", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/10704524", "id": "10704524", "database": "PubMed" } ], "position": 385, "tax_name": "Homo sapiens", "gene_name": "D22S674; GALB; NAGA", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "Q63345-1", "protein_name": "Myelin-oligodendrocyte glycoprotein", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/Q63345/annotated", "id": "Q63345", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/24090084", "id": "24090084", "database": "PubMed" } ], "position": 58, "tax_name": "Rattus norvegicus", "gene_name": "Mog", "tax_id": 10116 }, { "residue": "Asn", "uniprot_canonical_ac": "P17050-1", "protein_name": "Alpha-N-acetylgalactosaminidase; 3.2.1.49; Alpha-galactosidase B", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P17050/annotated", "id": "P17050", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/10704524", "id": "10704524", "database": "PubMed" } ], "position": 359, "tax_name": "Homo sapiens", "gene_name": "D22S674; GALB; NAGA", "tax_id": 9606 }, { "residue": "Asn", "uniprot_canonical_ac": "P07911-1", "protein_name": "Uromodulin; Tamm-Horsfall urinary glycoprotein; THP", "evidence": [ { "url": "http://unicarbkb.org/proteinsummary/P07911/annotated", "id": "P07911", "database": "UniCarbKB" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2136357", "id": "2136357", "database": "PubMed" }, { "url": "https://www.ncbi.nlm.nih.gov/pubmed/9884403", "id": "9884403", "database": "PubMed" } ], "position": 232, "tax_name": "Homo sapiens", "gene_name": "UMOD; ADMCKD2; FJHN; HNFJ; HNFJ1; MCKD2; THGP; THP", "tax_id": 9606 } ], "enzyme": [ { "uniprot_canonical_ac": "P27808-1", "gene_link": "https://www.uniprot.org/uniprot/P27808", "protein_name": "Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase; 2.4.1.101; N-glycosyl-oligosaccharide-glycoprotein N-acetylglucosaminyltransferase I; GNT-I; GlcNAc-T I", "tax_name": "Mus musculus", "gene": "Mgat1; Gnt1; Mgat-1", "tax_id": 10090 }, { "uniprot_canonical_ac": "Q9NP73-1", "gene_link": "https://www.uniprot.org/uniprot/Q9NP73", "protein_name": "Putative bifunctional UDP-N-acetylglucosamine transferase and deubiquitinase ALG13; 2.4.1.141; 3.4.19.12; Asparagine-linked glycosylation 13 homolog; Glycosyltransferase 28 domain-containing protein 1; UDP-N-acetylglucosamine transferase subunit ALG13 homolog", "tax_name": "Homo sapiens", "gene": "CDG1S; CXorf45; EIEE36; GLT28D1; MDS031; TDRD13; YGL047W; CXorf45; ALG13; MDS031; GLT28D1", "tax_id": 9606 }, { "uniprot_canonical_ac": "Q9Z2Y2-1", "gene_link": "https://www.uniprot.org/uniprot/Q9Z2Y2", "protein_name": "Beta-1,4-galactosyltransferase 2; Beta-1,4-GalTase 2; 2.4.1.-; Beta4Gal-T2; b4Gal-T2; Nal synthase; UDP-Gal:beta-GlcNAc beta-1,4-galactosyltransferase 2; UDP-galactose:beta-N-acetylglucosamine beta-1,4-galactosyltransferase 2; Beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase; 2.4.1.38; Lactose synthase A protein; 2.4.1.22; N-acetyllactosamine synthase; 2.4.1.90; Beta-N-acetylglucosaminyl-glycolipid beta-1,4-galactosyltransferase", "tax_name": "Mus musculus", "gene": "Ggtb2; B4galt2", "tax_id": 10090 }, { "uniprot_canonical_ac": "Q9D081-1", "gene_link": "https://www.uniprot.org/uniprot/Q9D081", "protein_name": "UDP-N-acetylglucosamine transferase subunit ALG14 homolog", "tax_name": "Mus musculus", "gene": "5430428G01Rik; AI854024; Alg14", "tax_id": 10090 }, { "uniprot_canonical_ac": "P15535-1", "gene_link": "https://www.uniprot.org/uniprot/P15535", "protein_name": "Beta-1,4-galactosyltransferase 1; Beta-1,4-GalTase 1; 2.4.1.-; Beta4Gal-T1; b4Gal-T1; UDP-Gal:beta-GlcNAc beta-1,4-galactosyltransferase 1; UDP-galactose:beta-N-acetylglucosamine beta-1,4-galactosyltransferase 1; Nal synthase; Beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase; 2.4.1.38; Lactose synthase A protein; 2.4.1.22; N-acetyllactosamine synthase; 2.4.1.90; Beta-N-acetylglucosaminyl-glycolipid beta-1,4-galactosyltransferase", "tax_name": "Mus musculus", "gene": "B4galt1; Ggtb; Ggtb2; 4-GalT; 4-GalT1; B-1; b4Gal-T1; beta-1; beta4Gal-T1; GalT; Ggtb; Ggtb2", "tax_id": 10090 }, { "uniprot_canonical_ac": "Q9WTS2-1", "gene_link": "https://www.uniprot.org/uniprot/Q9WTS2", "protein_name": "Alpha-(1,6)-fucosyltransferase; Alpha1-6FucT; 2.4.1.68; GDP-L-Fuc:N-acetyl-beta-D-glucosaminide alpha1,6-fucosyltransferase; Glycoprotein 6-alpha-L-fucosyltransferase; GDP-fucose--glycoprotein fucosyltransferase; Fucosyltransferase 8", "tax_name": "Mus musculus", "gene": "Fut8", "tax_id": 10090 }, { "uniprot_canonical_ac": "Q8VIB3-1", "gene_link": "https://www.uniprot.org/uniprot/Q8VIB3", "protein_name": "Type 2 lactosamine alpha-2,3-sialyltransferase; 2.4.99.-; ST3Gal VI; ST3GalVI; CMP-NeuAc:beta-galactoside alpha-2,3-sialyltransferase VI; Sialyltransferase 10", "tax_name": "Mus musculus", "gene": "Siat10; St3gal6; 1700023B24Rik; AI930218; AW552396; Siat10; St3galVI", "tax_id": 10090 }, { "uniprot_canonical_ac": "Q91Y74-1", "gene_link": "https://www.uniprot.org/uniprot/Q91Y74", "protein_name": "CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 4; Alpha 2,3-ST 4; 2.4.99.2; Beta-galactoside alpha-2,3-sialyltransferase 4; 2.4.99.6; Sialyltransferase 4C; SIAT4-C; ST3Gal IV; ST3GalIV; Alpha 2,3-sialyltransferase IV; Gal-beta-1,4-GalNAc-alpha-2,3-sialyltransferase", "tax_name": "Mus musculus", "gene": "SIAT4-C; Siat4c; ST3Gal IV; ST3GalIV; Siat4c; St3gal4", "tax_id": 10090 }, { "uniprot_canonical_ac": "P42867-1", "gene_link": "https://www.uniprot.org/uniprot/P42867", "protein_name": "UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase; 2.7.8.15; GlcNAc-1-P transferase; GPT; G1PT; N-acetylglucosamine-1-phosphate transferase", "tax_name": "Mus musculus", "gene": "Dpagt2; Gnpta; Dpagt1; AU021132; Dpagt2; G1PT; Gnpta; GPT", "tax_id": 10090 }, { "uniprot_canonical_ac": "Q9H3H5-1", "gene_link": "https://www.uniprot.org/uniprot/Q9H3H5", "protein_name": "UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase; 2.7.8.15; GlcNAc-1-P transferase; GPT; G1PT; N-acetylglucosamine-1-phosphate transferase", "tax_name": "Homo sapiens", "gene": "DPAGT2; DPAGT1; ALG7; CDG-Ij; CDG1J; CMS13; CMSTA2; D11S366; DGPT; DPAGT; DPAGT2; G1PT; GPT; UAGT; UGAT", "tax_id": 9606 }, { "uniprot_canonical_ac": "Q10469-1", "gene_link": "https://www.uniprot.org/uniprot/Q10469", "protein_name": "Alpha-1,6-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase; 2.4.1.143; GlcNAc-T II; GNT-II; Beta-1,2-N-acetylglucosaminyltransferase II; N-glycosyl-oligosaccharide-glycoprotein N-acetylglucosaminyltransferase II; Mannoside acetylglucosaminyltransferase 2", "tax_name": "Homo sapiens", "gene": "MGAT2; CDG2A; CDGS2; GLCNACTII; GNT-II; GNT2", "tax_id": 9606 }, { "uniprot_canonical_ac": "Q11203-1", "gene_link": "https://www.uniprot.org/uniprot/Q11203", "protein_name": "CMP-N-acetylneuraminate-beta-1,4-galactoside alpha-2,3-sialyltransferase; 2.4.99.6; Beta-galactoside alpha-2,3-sialyltransferase 3; Alpha 2,3-ST 3; ST3Gal III; ST3GalIII; Sialyltransferase 6; Gal beta-1,3(4) GlcNAc alpha-2,3 sialyltransferase; ST3N; N-acetyllactosaminide alpha-2,3-sialyltransferase", "tax_name": "Homo sapiens", "gene": "ST3GAL3; EIEE15; MRT12; SIAT6; ST3Gal III; ST3GALII; ST3GalIII; ST3N; SIAT6", "tax_id": 9606 }, { "uniprot_canonical_ac": "Q9DBE8-1", "gene_link": "https://www.uniprot.org/uniprot/Q9DBE8", "protein_name": "Alpha-1,3/1,6-mannosyltransferase ALG2; 2.4.1.132; 2.4.1.257; GDP-Man:Man(2)GlcNAc(2)-PP-Dol alpha-1,6-mannosyltransferase; GDP-Man:Man(1)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase; Asparagine-linked glycosylation protein 2 homolog; GDP-Man:Man(1)GlcNAc(2)-PP-dolichol mannosyltransferase", "tax_name": "Mus musculus", "gene": "Alg2; MNCb-5081; 1110018A23Rik; 1300013N08Rik; ALPG2; CDGIi; MNCb-5081", "tax_id": 10090 }, { "uniprot_canonical_ac": "P97325-1", "gene_link": "https://www.uniprot.org/uniprot/P97325", "protein_name": "CMP-N-acetylneuraminate-beta-1,4-galactoside alpha-2,3-sialyltransferase; 2.4.99.6; Beta-galactoside alpha-2,3-sialyltransferase 3; Alpha 2,3-ST 3; ST3Gal III; ST3GalIII; Sialyltransferase 6; Gal beta-1,3(4) GlcNAc alpha-2,3 sialyltransferase; ST3N; N-acetyllactosaminide alpha-2,3-sialyltransferase", "tax_name": "Mus musculus", "gene": "St3gal3; Siat3; Siat3; Siat6; ST3GalIII; ST3N; Siat6", "tax_id": 10090 }, { "uniprot_canonical_ac": "Q9Y274-1", "gene_link": "https://www.uniprot.org/uniprot/Q9Y274", "protein_name": "Type 2 lactosamine alpha-2,3-sialyltransferase; 2.4.99.-; ST3Gal VI; ST3GalVI; CMP-NeuAc:beta-galactoside alpha-2,3-sialyltransferase VI; Sialyltransferase 10", "tax_name": "Homo sapiens", "gene": "SIAT10; ST3GALVI; SIAT10; ST3GAL6", "tax_id": 9606 }, { "uniprot_canonical_ac": "Q9BYC5-1", "gene_link": "https://www.uniprot.org/uniprot/Q9BYC5", "protein_name": "Alpha-(1,6)-fucosyltransferase; Alpha1-6FucT; 2.4.1.68; GDP-L-Fuc:N-acetyl-beta-D-glucosaminide alpha1,6-fucosyltransferase; Glycoprotein 6-alpha-L-fucosyltransferase; GDP-fucose--glycoprotein fucosyltransferase; Fucosyltransferase 8", "tax_name": "Homo sapiens", "gene": "CDGF; CDGF1; FUT8", "tax_id": 9606 }, { "uniprot_canonical_ac": "Q96F25-1", "gene_link": "https://www.uniprot.org/uniprot/Q96F25", "protein_name": "UDP-N-acetylglucosamine transferase subunit ALG14 homolog", "tax_name": "Homo sapiens", "gene": "CMS15; ALG14", "tax_id": 9606 }, { "uniprot_canonical_ac": "Q8BML3-1", "gene_link": "https://www.uniprot.org/uniprot/Q8BML3", "protein_name": "MCG145726; Glycosyltransferase 28 domain-containing 2", "tax_name": "Mus musculus", "gene": "4732486J07Rik; Glt28d1l; Glt28d2; mCG_145726", "tax_id": 10090 }, { "uniprot_canonical_ac": "Q921V5-1", "gene_link": "https://www.uniprot.org/uniprot/Q921V5", "protein_name": "Alpha-1,6-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase; 2.4.1.143; GlcNAc-T II; GNT-II; Beta-1,2-N-acetylglucosaminyltransferase II; N-glycosyl-oligosaccharide-glycoprotein N-acetylglucosaminyltransferase II; Mannoside acetylglucosaminyltransferase 2", "tax_name": "Mus musculus", "gene": "Mgat2; AA407964; CDGS2; GLCNACTII; GNT-II; GNT2", "tax_id": 10090 }, { "uniprot_canonical_ac": "Q11206-1", "gene_link": "https://www.uniprot.org/uniprot/Q11206", "protein_name": "CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 4; Alpha 2,3-ST 4; 2.4.99.2; Beta-galactoside alpha-2,3-sialyltransferase 4; 2.4.99.4; Sialyltransferase 4C; SIAT4-C; ST3Gal IV; ST3GalIV; STZ; ST-4; ST3GalA.2; Alpha 2,3-sialyltransferase IV; Gal-beta-1,4-GalNAc-alpha-2,3-sialyltransferase; SAT-3; Gal-NAc6S", "tax_name": "Homo sapiens", "gene": "CGS23; gal-NAc6S; NANTA3; SAT3; SIAT4; SIAT4C; ST-4; ST3GalA.2; ST3GalIV; STZ; SIAT4C; ST3GAL4; NANTA3; CGS23; STZ", "tax_id": 9606 }, { "uniprot_canonical_ac": "Q921Q3-1", "gene_link": "https://www.uniprot.org/uniprot/Q921Q3", "protein_name": "Chitobiosyldiphosphodolichol beta-mannosyltransferase; 2.4.1.142; Beta-1,4-mannosyltransferase; Asparagine-linked glycosylation protein 1 homolog; GDP-Man:GlcNAc2-PP-dolichol mannosyltransferase; GDP-mannose-dolichol diphosphochitobiose mannosyltransferase", "tax_name": "Mus musculus", "gene": "Alg1; HMAT1; HMT1", "tax_id": 10090 }, { "uniprot_canonical_ac": "P26572-1", "gene_link": "https://www.uniprot.org/uniprot/P26572", "protein_name": "Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase; 2.4.1.101; N-glycosyl-oligosaccharide-glycoprotein N-acetylglucosaminyltransferase I; GNT-I; GlcNAc-T I", "tax_name": "Homo sapiens", "gene": "GGNT1; GLCT1; MGAT1; GLYT1; MGAT; GLCNAC-TI; GLCT1; GLYT1; GNT-1; GNT-I; GnTI; MGAT", "tax_id": 9606 }, { "uniprot_canonical_ac": "Q9BT22-1", "gene_link": "https://www.uniprot.org/uniprot/Q9BT22", "protein_name": "Chitobiosyldiphosphodolichol beta-mannosyltransferase; 2.4.1.142; Mannosyltransferase-1; MT-1; hMat-1; Beta-1,4-mannosyltransferase; Asparagine-linked glycosylation protein 1 homolog; GDP-Man:GlcNAc2-PP-dolichol mannosyltransferase; GDP-mannose-dolichol diphosphochitobiose mannosyltransferase", "tax_name": "Homo sapiens", "gene": "ALG1; PRO1870; HMT1; PSEC0061; HMAT1; CDG1K; hMat-1; HMAT1; HMT-1; HMT1; Mat-1; MT-1", "tax_id": 9606 }, { "uniprot_canonical_ac": "Q9H553-1", "gene_link": "https://www.uniprot.org/uniprot/Q9H553", "protein_name": "Alpha-1,3/1,6-mannosyltransferase ALG2; 2.4.1.132; 2.4.1.257; GDP-Man:Man(2)GlcNAc(2)-PP-Dol alpha-1,6-mannosyltransferase; GDP-Man:Man(1)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase; Asparagine-linked glycosylation protein 2 homolog; GDP-Man:Man(1)GlcNAc(2)-PP-dolichol mannosyltransferase", "tax_name": "Homo sapiens", "gene": "ALG2; PRO1298; CDG1I; CDGIi; CMS14; CMSTA3; hALPG2; NET38", "tax_id": 9606 }, { "uniprot_canonical_ac": "O60512-1", "gene_link": "https://www.uniprot.org/uniprot/O60512", "protein_name": "Beta-1,4-galactosyltransferase 3; Beta-1,4-GalTase 3; 2.4.1.-; Beta4Gal-T3; b4Gal-T3; UDP-galactose:beta-N-acetylglucosamine beta-1,4-galactosyltransferase 3; Nal synthase; UDP-Gal:beta-GlcNAc beta-1,4-galactosyltransferase 3; Beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase; 2.4.1.38; N-acetyllactosamine synthase; 2.4.1.90; Beta-N-acetylglucosaminyl-glycolipid beta-1,4-galactosyltransferase", "tax_name": "Homo sapiens", "gene": "B4GALT3; beta4Gal-T3", "tax_id": 9606 }, { "uniprot_canonical_ac": "P15291-1", "gene_link": "https://www.uniprot.org/uniprot/P15291", "protein_name": "Beta-1,4-galactosyltransferase 1; Beta-1,4-GalTase 1; 2.4.1.-; Beta4Gal-T1; b4Gal-T1; UDP-Gal:beta-GlcNAc beta-1,4-galactosyltransferase 1; UDP-galactose:beta-N-acetylglucosamine beta-1,4-galactosyltransferase 1; Nal synthase; Beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase; 2.4.1.38; Lactose synthase A protein; 2.4.1.22; N-acetyllactosamine synthase; 2.4.1.90; Beta-N-acetylglucosaminyl-glycolipid beta-1,4-galactosyltransferase", "tax_name": "Homo sapiens", "gene": "B4GALT1; GGTB2; B4GAL-T1; beta4Gal-T1; CDG2D; GGTB2; GT1; GTB", "tax_id": 9606 }, { "uniprot_canonical_ac": "Q9D8C3-1", "gene_link": "https://www.uniprot.org/uniprot/Q9D8C3", "protein_name": "Putative bifunctional UDP-N-acetylglucosamine transferase and deubiquitinase ALG13; 2.4.1.141; 3.4.19.12; Asparagine-linked glycosylation 13 homolog; Glycosyltransferase 28 domain-containing protein 1; UDP-N-acetylglucosamine transferase subunit ALG13 homolog", "tax_name": "Mus musculus", "gene": "Alg13; 2810046O15Rik; 4833435D08Rik; Glt28d1; MDS031; Glt28d1", "tax_id": 10090 }, { "uniprot_canonical_ac": "Q91YY2-1", "gene_link": "https://www.uniprot.org/uniprot/Q91YY2", "protein_name": "Beta-1,4-galactosyltransferase 3; Beta-1,4-GalTase 3; 2.4.1.-; Beta4Gal-T3; b4Gal-T3; UDP-galactose:beta-N-acetylglucosamine beta-1,4-galactosyltransferase 3; Nal synthase; UDP-Gal:beta-GlcNAc beta-1,4-galactosyltransferase 3; Beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase; 2.4.1.38; N-acetyllactosamine synthase; 2.4.1.90; Beta-N-acetylglucosaminyl-glycolipid beta-1,4-galactosyltransferase", "tax_name": "Mus musculus", "gene": "B4galt3; 9530061M23Rik; AA104562; AW125175; ESTM26; ESTM6; R74981", "tax_id": 10090 }, { "uniprot_canonical_ac": "O60909-1", "gene_link": "https://www.uniprot.org/uniprot/O60909", "protein_name": "Beta-1,4-galactosyltransferase 2; Beta-1,4-GalTase 2; 2.4.1.-; Beta4Gal-T2; b4Gal-T2; Nal synthase; UDP-Gal:beta-GlcNAc beta-1,4-galactosyltransferase 2; UDP-galactose:beta-N-acetylglucosamine beta-1,4-galactosyltransferase 2; Beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase; 2.4.1.38; Lactose synthase A protein; 2.4.1.22; N-acetyllactosamine synthase; 2.4.1.90; Beta-N-acetylglucosaminyl-glycolipid beta-1,4-galactosyltransferase", "tax_name": "Homo sapiens", "gene": "B4Gal-T2; B4Gal-T3; beta4Gal-T2; B4GALT2", "tax_id": 9606 } ], "crossref": [ { "url": "https://pubchem.ncbi.nlm.nih.gov/compound/CID25098607", "id": "CID25098607", "database": "PubChem Compound" }, { "url": "http://www.unicarbkb.org/structure/1189", "id": "1189", "database": "UniCarbKB" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+35217", "id": "35217", "database": "CarbBank" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?gl:G10716", "id": "G10716", "database": "KEGG Glycan" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+5470", "id": "5470", "database": "CarbBank" }, { "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=2688", "id": "2688", "database": "Glycosciences.de" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+20870", "id": "20870", "database": "CarbBank" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+1975", "id": "1975", "database": "CarbBank" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+1976", "id": "1976", "database": "CarbBank" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+27306", "id": "27306", "database": "CarbBank" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+25738", "id": "25738", "database": "CarbBank" }, { "url": "https://glyconnect.expasy.org/browser/structures/1077", "id": "1077", "database": "GlyConnect" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+1974", "id": "1974", "database": "CarbBank" }, { "url": "https://www.ebi.ac.uk/chebi/searchId.do?chebiId=87782", "id": "87782", "database": "ChEBI" }, { "url": "http://www.glycosciences.de/database/start.php?action=explore_linucsid&linucsid=23242", "id": "23242", "database": "Glycosciences.de" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+27281", "id": "27281", "database": "CarbBank" }, { "url": "https://pubchem.ncbi.nlm.nih.gov/substance/SID252290596", "id": "SID252290596", "database": "PubChem Substance" }, { "url": "https://www.genome.jp/dbget-bin/www_bget?carbbank+5493", "id": "5493", "database": "CarbBank" } ], "mass_pme": 2943.48, "inchi_key": { "url": "https://pubchem.ncbi.nlm.nih.gov/compound/YWJPMIROECFZJW-YBQNOACISA-N", "key": "YWJPMIROECFZJW-YBQNOACISA-N" }, "publication": [ { "title": "Structural determination of two N-linked glycans isolated from recombinant human lactoferrin expressed in BHK cells.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/7774715", "journal": "FEBS letters", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7774715", "id": "7774715", "database": "PubMed" } ], "authors": "Legrand D, Salmon V, Coddeville B, Benaissa M, Plancke Y, Spik G", "date": "1995", "pmid": "7774715" }, { "title": "Analysis of site-specific N-glycosylation of recombinant Desmodus rotundus salivary plasminogen activator rDSPA alpha 1 expressed in Chinese hamster ovary cells.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/9061366", "journal": "Glycobiology", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/9061366", "id": "9061366", "database": "PubMed" } ], "authors": "Gohlke M, Nuck R, Kannicht C, Grunow D, Baude G, Donner P, Reutter W", "date": "1997", "pmid": "9061366" }, { "title": "Structure and location of the O-glycosidic carbohydrate units of human chorionic gonadotropin.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/468798", "journal": "The Journal of biological chemistry", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/468798", "id": "468798", "database": "PubMed" } ], "authors": "Kessler MJ, Mise T, Ghai RD, Bahl OP", "date": "1979", "pmid": "468798" }, { "title": "Site-specific glycan-peptide analysis for determination of N-glycoproteome heterogeneity.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/24090084", "journal": "Journal of proteome research", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/24090084", "id": "24090084", "database": "PubMed" } ], "authors": "Parker BL, Thaysen-Andersen M, Solis N, Scott NE, Larsen MR, Graham ME, Packer NH, Cordwell SJ", "date": "2013", "pmid": "24090084" }, { "title": "Structural study of the N-linked oligosaccharides of hepatocyte growth factor by two-dimensional sugar mapping.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/8407880", "journal": "Journal of biochemistry", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/8407880", "id": "8407880", "database": "PubMed" } ], "authors": "Hara H, Nakae Y, Sogabe T, Ihara I, Ueno S, Sakai H, Inoue H, Shimizu S, Nakamura T, Shimizu N", "date": "1993", "pmid": "8407880" }, { "title": "N-glycan structures of a recombinant mouse soluble Fcgamma receptor II.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/10052594", "journal": "Glycoconjugate journal", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/10052594", "id": "10052594", "database": "PubMed" } ], "authors": "Takahashi N, Yamada W, Masuda K, Araki H, Tsukamoto Y, Galinha A, Sautes C, Kato K, Shimada I", "date": "1998", "pmid": "10052594" }, { "title": "N-glycan structures of matrix metalloproteinase-1 derived from human fibroblasts and from HT-1080 fibrosarcoma cells.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/10092871", "journal": "European journal of biochemistry", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/10092871", "id": "10092871", "database": "PubMed" } ], "authors": "Saarinen J, Welgus HG, Flizar CA, Kalkkinen N, Helin J", "date": "1999", "pmid": "10092871" }, { "title": "Elucidation of N-linked oligosaccharide structures of recombinant human factor VIII using fluorophore-assisted carbohydrate electrophoresis.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/8969451", "journal": "Biotechnology and applied biochemistry", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/8969451", "id": "8969451", "database": "PubMed" } ], "authors": "Kumar HP, Hague C, Haley T, Starr CM, Besman MJ, Lundblad RL, Baker D", "date": "1996", "pmid": "8969451" }, { "title": "The glycosylation of Bowes melanoma tissue plasminogen activator: lectin mapping, reaction with anti-L2/HNK-1 antibodies and the presence of sulphated/glucuronic acid containing glycans.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/8687384", "journal": "The Biochemical journal", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/8687384", "id": "8687384", "database": "PubMed" } ], "authors": "Jaques AJ, Opdenakker G, Rademacher TW, Dwek RA, Zamze SE", "date": "1996", "pmid": "8687384" }, { "title": "Peptide, disulfide, and glycosylation mapping of recombinant human thrombopoietin from ser1 to Arg246.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/8942648", "journal": "Biochemistry", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/8942648", "id": "8942648", "database": "PubMed" } ], "authors": "Hoffman RC, Andersen H, Walker K, Krakover JD, Patel S, Stamm MR, Osborn SG", "date": "1996", "pmid": "8942648" }, { "title": "Unusual N-glycosylation of a recombinant human erythropoietin expressed in a human lymphoblastoid cell line does not alter its biological properties.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/10764840", "journal": "Glycobiology", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/10764840", "id": "10764840", "database": "PubMed" } ], "authors": "Cointe D, Beliard R, Jorieux S, Leroy Y, Glacet A, Verbert A, Bourel D, Chirat F", "date": "2000", "pmid": "10764840" }, { "title": "Structures of sialylated oligosaccharides of human erythropoietin expressed in recombinant BHK-21 cells.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/8477709", "journal": "European journal of biochemistry", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/8477709", "id": "8477709", "database": "PubMed" } ], "authors": "Nimtz M, Martin W, Wray V, Kloppel KD, Augustin J, Conradt HS", "date": "1993", "pmid": "8477709" }, { "title": "Primary structure of glycans isolated from human leucocyte lactotransferrin. Absence of fucose residues questions the proposed mechanism of hyposideraemia.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/2390069", "journal": "The Biochemical journal", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2390069", "id": "2390069", "database": "PubMed" } ], "authors": "Derisbourg P, Wieruszeski JM, Montreuil J, Spik G", "date": "1990", "pmid": "2390069" }, { "title": "Site-specific N-glycosylation of human chorionic gonadotrophin--structural analysis of glycopeptides by one- and two-dimensional 1H NMR spectroscopy.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/1820200", "journal": "Glycobiology", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/1820200", "id": "1820200", "database": "PubMed" } ], "authors": "Weisshaar G, Hiyama J, Renwick AG", "date": "1991", "pmid": "1820200" }, { "title": "Carbohydrate structure of recombinant human uterine tissue plasminogen activator expressed in mouse epithelial cells.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/2513186", "journal": "European journal of biochemistry", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2513186", "id": "2513186", "database": "PubMed" } ], "authors": "Pfeiffer G, Schmidt M, Strube KH, Geyer R", "date": "1989", "pmid": "2513186" }, { "title": "Hepatocyte growth factor is linked by O-glycosylated oligosaccharide on the alpha chain.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/1482348", "journal": "Biochemical and biophysical research communications", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/1482348", "id": "1482348", "database": "PubMed" } ], "authors": "Shimizu N, Hara H, Sogabe T, Sakai H, Ihara I, Inoue H, Nakamura T, Shimizu S", "date": "1992", "pmid": "1482348" }, { "title": "Human alpha-N-acetylgalactosaminidase: site occupancy and structure of N-linked oligosaccharides.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/10704524", "journal": "Glycobiology", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/10704524", "id": "10704524", "database": "PubMed" } ], "authors": "Ohta M, Ohnishi T, Ioannou YA, Hodgson ME, Matsuura F, Desnick RJ", "date": "2000", "pmid": "10704524" }, { "title": "Oligosaccharides at individual glycosylation sites in glycoprotein 71 of Friend murine leukemia virus.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/2298213", "journal": "European journal of biochemistry", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2298213", "id": "2298213", "database": "PubMed" } ], "authors": "Geyer R, Dabrowski J, Dabrowski U, Linder D, Schluter M, Schott HH, Stirm S", "date": "1990", "pmid": "2298213" }, { "title": "Structure of the carbohydrate moiety of human interferon-beta secreted by a recombinant Chinese hamster ovary cell line.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/3667593", "journal": "The Journal of biological chemistry", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/3667593", "id": "3667593", "database": "PubMed" } ], "authors": "Conradt HS, Egge H, Peter-Katalinic J, Reiser W, Siklosi T, Schaper K", "date": "1987", "pmid": "3667593" }, { "title": "The carbohydrate chains of the beta subunit of human chorionic gonadotropin produced by the choriocarcinoma cell line BeWo. Novel O-linked and novel bisecting-GlcNAc-containing N-linked carbohydrates.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/1374031", "journal": "European journal of biochemistry", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/1374031", "id": "1374031", "database": "PubMed" } ], "authors": "Hard K, Damm JB, Spruijt MP, Bergwerff AA, Kamerling JP, Van Dedem GW, Vliegenthart JF", "date": "1992", "pmid": "1374031" }, { "title": "Comparative structural study of N-linked oligosaccharides of urinary and recombinant erythropoietins.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/3179269", "journal": "Biochemistry", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/3179269", "id": "3179269", "database": "PubMed" } ], "authors": "Tsuda E, Goto M, Murakami A, Akai K, Ueda M, Kawanishi G, Takahashi N, Sasaki R, Chiba H, Ishihara H, et al.", "date": "1988", "pmid": "3179269" }, { "title": "N-glycosylation potential of maize: the human lactoferrin used as a model.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/12151713", "journal": "Glycoconjugate journal", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/12151713", "id": "12151713", "database": "PubMed" } ], "authors": "Samyn-Petit B, Gruber V, Flahaut C, Wajda-Dubos JP, Farrer S, Pons A, Desmaizieres G, Slomianny MC, Theisen M, Delannoy P", "date": "2001", "pmid": "12151713" }, { "title": "Structural analysis of sulfated N-linked oligosaccharides in erythropoietin.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/11805077", "journal": "Glycobiology", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/11805077", "id": "11805077", "database": "PubMed" } ], "authors": "Kawasaki N, Haishima Y, Ohta M, Itoh S, Hyuga M, Hyuga S, Hayakawa T", "date": "2001", "pmid": "11805077" }, { "title": "Carbohydrate structures of soluble human L-selectin recombinantly expressed in baby-hamster kidney cells.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/10918037", "journal": "Biotechnology and applied biochemistry", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/10918037", "id": "10918037", "database": "PubMed" } ], "authors": "Gohlke M, Mach U, Nuck R, Zimmermann-Kordmann M, Grunow D, Fieger C, Volz B, Tauber R, Petri T, Debus N, Reutter W", "date": "2000", "pmid": "10918037" }, { "title": "Protein and carbohydrate structural analysis of a recombinant soluble CD4 receptor by mass spectrometry.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/2592374", "journal": "The Journal of biological chemistry", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2592374", "id": "2592374", "database": "PubMed" } ], "authors": "Carr SA, Hemling ME, Folena-Wasserman G, Sweet RW, Anumula K, Barr JR, Huddleston MJ, Taylor P", "date": "1989", "pmid": "2592374" }, { "title": "Structures of mucin-type sugar chains on human erythropoietins purified from urine and the culture medium of recombinant Chinese hamster ovary cells.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/8460945", "journal": "Archives of biochemistry and biophysics", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/8460945", "id": "8460945", "database": "PubMed" } ], "authors": "Inoue N, Takeuchi M, Asano K, Shimizu R, Takasaki S, Kobata A", "date": "1993", "pmid": "8460945" }, { "title": "Recombinant human erythropoietin produced by Namalwa cells.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/2550193", "journal": "DNA (Mary Ann Liebert, Inc.)", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2550193", "id": "2550193", "database": "PubMed" } ], "authors": "Yanagi H, Yoshima T, Ogawa I, Okamoto M", "date": "1989", "pmid": "2550193" }, { "title": "Relationship between sugar chain structure and biological activity of recombinant human erythropoietin produced in Chinese hamster ovary cells.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/2813359", "journal": "Proceedings of the National Academy of Sciences of the United States of America", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2813359", "id": "2813359", "database": "PubMed" } ], "authors": "Takeuchi M, Inoue N, Strickland TW, Kubota M, Wada M, Shimizu R, Hoshi S, Kozutsumi H, Takasaki S, Kobata A", "date": "1989", "pmid": "2813359" }, { "title": "Pregnancy-associated changes in oligomannose oligosaccharides of human and bovine uromodulin (Tamm-Horsfall glycoprotein).", "url": "https://www.ncbi.nlm.nih.gov/pubmed/2136357", "journal": "Glycoconjugate journal", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2136357", "id": "2136357", "database": "PubMed" } ], "authors": "Smagula RM, Van Halbeek H, Decker JM, Muchmore AV, Moody CE, Sherblom AP", "date": "1990", "pmid": "2136357" }, { "title": "Glycosylation sites and site-specific glycosylation in human Tamm-Horsfall glycoprotein.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/9884403", "journal": "Glycobiology", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/9884403", "id": "9884403", "database": "PubMed" } ], "authors": "van Rooijen JJ, Voskamp AF, Kamerling JP, Vliegenthart JF", "date": "1999", "pmid": "9884403" }, { "title": "Carbohydrate structures of a human tissue plasminogen activator variant expressed in recombinant Chinese hamster ovary cells.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/2226797", "journal": "FEBS letters", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/2226797", "id": "2226797", "database": "PubMed" } ], "authors": "Nimtz M, Noll G, Paques EP, Conradt HS", "date": "1990", "pmid": "2226797" }, { "title": "Carbohydrate and peptide structure of the alpha- and beta-subunits of human chorionic gonadotropin from normal and aberrant pregnancy and choriocarcinoma.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/9449027", "journal": "Endocrine", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/9449027", "id": "9449027", "database": "PubMed" } ], "authors": "Elliott MM, Kardana A, Lustbader JW, Cole LA", "date": "1997", "pmid": "9449027" }, { "title": "Characterization of the carbohydrate chains of the secreted form of the human epidermal growth factor receptor.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/10988252", "journal": "Glycobiology", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/10988252", "id": "10988252", "database": "PubMed" } ], "authors": "Stroop CJ, Weber W, Gerwig GJ, Nimtz M, Kamerling JP, Vliegenthart JF", "date": "2000", "pmid": "10988252" }, { "title": "Characterization of the glycosylation profiles of Alzheimer's beta -secretase protein Asp-2 expressed in a variety of cell lines.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/11278492", "journal": "The Journal of biological chemistry", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/11278492", "id": "11278492", "database": "PubMed" } ], "authors": "Charlwood J, Dingwall C, Matico R, Hussain I, Johanson K, Moore S, Powell DJ, Skehel JM, Ratcliffe S, Clarke B, Trill J, Sweitzer S, Camilleri P", "date": "2001", "pmid": "11278492" }, { "title": "Structural study of the sugar chains of human lactoferrin: finding of four novel complex-type asparagine-linked sugar chains.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/7068558", "journal": "Journal of biochemistry", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/7068558", "id": "7068558", "database": "PubMed" } ], "authors": "Matsumoto A, Yoshima H, Takasaki S, Kobata A", "date": "1982", "pmid": "7068558" }, { "title": "Structural analysis of the N-linked oligosaccharides from murine glycophorin.", "url": "https://www.ncbi.nlm.nih.gov/pubmed/1929437", "journal": "Archives of biochemistry and biophysics", "evidence": [ { "url": "https://www.ncbi.nlm.nih.gov/pubmed/1929437", "id": "1929437", "database": "PubMed" } ], "authors": "Angel AS, Gronberg G, Krotkiewski H, Lisowska E, Nilsson B", "date": "1991", "pmid": "1929437" } ], "motifs": [ { "id": "G00055MO", "name": "Lactosamine motif" }, { "id": "G00026MO", "name": "N-Glycan core basic" }, { "id": "G00065MO", "name": "VIM" }, { "id": "G00030MO", "name": "N-Glycan complex" } ], "composition": [ { "residue": "hexnac", "count": 4, "url": "https://pubchem.ncbi.nlm.nih.gov/compound/899", "name": "N-Acetylhexosamine", "cid": "899" }, { "residue": "dhex", "count": 1, "url": "https://pubchem.ncbi.nlm.nih.gov/compound/840", "name": "6-Deoxy-Hexose", "cid": "840" }, { "residue": "neuac", "count": 2, "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439197", "name": "N-Acetyl-Neuraminic Acid", "cid": "439197" }, { "residue": "hex", "count": 5, "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206", "name": "Hexose", "cid": "206" } ], "residues": [ { "attachedby": "rxn.Q9WTS2-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.P42867-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.Q9D081-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.Q9D8C3-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.Q921Q3-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.Q91YY2-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.Q9Z2Y2-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.P15535-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.Q9DBE8-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.Q921Q3-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" }, { "attachedby": "rxn.Q11203-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.Q9H553-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.Q9BT22-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.P26572-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.Q10469-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.Q11203-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.Q9H3H5-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.P15291-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.O60909-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.Q9BT22-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.Q9NP73-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.Q91Y74-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.Q8VIB3-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.Q921V5-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.P97325-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.Q8BML3-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.P27808-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.Q96F25-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.Q9H553-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.Q11206-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.P26572-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.Q10469-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.Q9Y274-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.Q921Q3-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.Q9DBE8-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.P15535-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.P15291-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.Q9D8C3-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.Q9WTS2-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.Q8BML3-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.P15535-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.Q9Z2Y2-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.Q91YY2-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.P42867-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.Q921Q3-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.Q9D8C3-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.Q9D081-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.Q9DBE8-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.Q9Y274-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.Q11206-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.Q11203-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.Q10469-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.P26572-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.Q9BYC5-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.Q9H3H5-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.O60512-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.O60909-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.P15291-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.Q9H553-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" }, { "attachedby": "rxn.Q9NP73-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" }, { "attachedby": "rxn.Q91Y74-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" }, { "attachedby": "rxn.Q8VIB3-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" }, { "attachedby": "rxn.Q9Y274-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.Q9D081-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.Q9Z2Y2-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.P97325-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.P15291-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.Q9H553-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.Q9H3H5-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.Q9BYC5-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.Q11203-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.P26572-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.Q10469-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.Q921V5-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.Q8VIB3-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.Q9DBE8-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.P15535-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.Q9Z2Y2-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.Q9D081-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.P42867-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.Q91YY2-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.P97325-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.Q9H3H5-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.O60512-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.Q8VIB3-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.Q9BT22-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.Q8VIB3-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.Q96F25-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.Q9NP73-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.Q921V5-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.P27808-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.Q91YY2-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.Q9Z2Y2-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.P26572-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.Q10469-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.Q921V5-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.P97325-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.Q91Y74-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.Q8VIB3-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.Q9BT22-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.Q9NP73-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.Q96F25-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.Q9H553-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.P15291-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.O60909-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.Q91YY2-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.Q9Y274-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" }, { "attachedby": "rxn.P26572-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.Q9BYC5-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.Q11203-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.P15535-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.Q9DBE8-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.Q9D8C3-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.Q9WTS2-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.P42867-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.Q91YY2-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.P27808-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.Q8BML3-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.Q8BML3-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.Q9WTS2-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.P42867-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.Q91Y74-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.Q921V5-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.P27808-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.Q9BT22-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.Q8VIB3-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.Q9Y274-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.Q11206-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.Q9NP73-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.Q9BT22-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" }, { "attachedby": "rxn.P27808-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.Q921V5-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.Q9WTS2-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.Q8BML3-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.Q91YY2-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.P42867-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.P15535-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.Q9Z2Y2-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.Q9D081-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.Q9DBE8-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.Q10469-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.Q11206-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.Q921Q3-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.Q9D8C3-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.Q9D081-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.Q9DBE8-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.P15535-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.Q91YY2-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.P97325-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" }, { "attachedby": "rxn.Q8VIB3-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.Q9H553-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.Q96F25-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.Q9D8C3-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.Q921Q3-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.Q9H3H5-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.O60512-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.P26572-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.Q9BYC5-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.Q11203-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.Q10469-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.Q9Y274-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.Q11206-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.Q91Y74-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.Q9BT22-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.Q8BML3-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.Q921V5-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.Q96F25-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.Q11203-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.Q9D8C3-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" }, { "attachedby": "rxn.Q9D081-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" }, { "attachedby": "rxn.Q9H3H5-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.Q9BYC5-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.Q11206-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.Q91YY2-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.P42867-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.Q921Q3-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.Q9D8C3-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.Q11206-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.Q9Y274-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.P15535-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.Q9Z2Y2-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.Q9D081-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.Q9DBE8-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.Q11203-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.Q9Y274-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.Q9Z2Y2-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.Q9BT22-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.Q8VIB3-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.Q96F25-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.Q9NP73-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.O60512-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.O60909-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.Q91Y74-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.Q9DBE8-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.Q9D081-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.Q9D8C3-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.Q921Q3-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.P42867-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.Q91YY2-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.Q9Z2Y2-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.P15535-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.Q8BML3-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.Q9WTS2-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.Q9BYC5-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.Q9H3H5-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.O60512-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.O60909-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.P15291-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.Q9H553-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.Q96F25-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.P26572-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.Q10469-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.Q11203-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.Q9Y274-1", "id": "N1", "name": "N-glycan_a-D-Manp_1", "parentid": "NC" }, { "attachedby": "rxn.Q9BYC5-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.O60512-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.P27808-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.Q921V5-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.P97325-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.Q91Y74-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.Q8VIB3-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.Q9BT22-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.Q9NP73-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.Q96F25-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.Q9H553-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.P15291-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.Q921V5-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.P97325-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.Q91Y74-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.Q8VIB3-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.P42867-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.Q9WTS2-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.Q9D8C3-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.Q9WTS2-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" }, { "attachedby": "rxn.P42867-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" }, { "attachedby": "rxn.Q8BML3-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" }, { "attachedby": "rxn.Q9WTS2-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.Q8BML3-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.P27808-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.P15535-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.Q9Z2Y2-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.P42867-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.Q9D081-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.P15291-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.Q9H553-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.Q96F25-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.Q9NP73-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.Q9NP73-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.Q8BML3-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.P27808-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.Q10469-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.P26572-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.Q11206-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.Q11203-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.O60512-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.O60909-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.Q9BYC5-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.Q9H3H5-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.Q9Y274-1", "id": "N15", "name": "N-glycan_a-L-Fucp_15", "parentid": "NA" }, { "attachedby": "rxn.Q11203-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.Q10469-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.Q91Y74-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.P97325-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.P15291-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.Q9H553-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.P15535-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" }, { "attachedby": "rxn.P27808-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" }, { "attachedby": "rxn.Q11206-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.Q921Q3-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.Q9Y274-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.Q9D081-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.Q9D8C3-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.P15535-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.Q9DBE8-1", "id": "N5", "name": "N-glycan_b-D-GlcpNAc_5", "parentid": "N4" }, { "attachedby": "rxn.Q11206-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.O60909-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.Q9H3H5-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.Q9BYC5-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.Q921Q3-1", "id": "NC", "name": "N-glycan_core_b-D-Manp", "parentid": "NB" }, { "attachedby": "rxn.O60909-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.O60512-1", "id": "NB", "name": "N-glycan_core_b-D-GlcpNAc_B", "parentid": "NA" }, { "attachedby": "rxn.Q9DBE8-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.Q9D081-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.Q96F25-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.Q9H553-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.P15291-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.O60909-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.Q9H3H5-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.O60512-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.P27808-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.Q8BML3-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.P97325-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.Q91Y74-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.Q9NP73-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.Q9BT22-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.P97325-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.Q91Y74-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.O60909-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.Q9BT22-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.Q9BT22-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.O60512-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.Q11206-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.Q9Y274-1", "id": "N16", "name": "N-glycan_a-D-Neup5Ac_16", "parentid": "N6" }, { "attachedby": "rxn.P97325-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.Q8VIB3-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.Q9WTS2-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.Q9DBE8-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" }, { "attachedby": "rxn.Q91YY2-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" }, { "attachedby": "rxn.Q9Z2Y2-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" }, { "attachedby": "rxn.Q921V5-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" }, { "attachedby": "rxn.Q921V5-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.Q9H3H5-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.Q9BYC5-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.O60909-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.Q9NP73-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.Q921Q3-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.Q9WTS2-1", "id": "NA", "name": "N-glycan_core_b-D-GlcpNAc_A", "parentid": "no_id" }, { "attachedby": "rxn.Q9WTS2-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.P42867-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.Q91YY2-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.Q9Z2Y2-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.P97325-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.Q921V5-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.P27808-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.Q8BML3-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.Q91Y74-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.P27808-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.Q9NP73-1", "id": "N6", "name": "N-glycan_b-D-Galp_6", "parentid": "N5" }, { "attachedby": "rxn.P15291-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" }, { "attachedby": "rxn.O60909-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" }, { "attachedby": "rxn.Q96F25-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" }, { "attachedby": "rxn.O60512-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" }, { "attachedby": "rxn.Q9H3H5-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" }, { "attachedby": "rxn.Q9BYC5-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.P26572-1", "id": "N17", "name": "N-glycan_a-D-Neup5Ac_17", "parentid": "N3" }, { "attachedby": "rxn.P26572-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.Q10469-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.O60512-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.Q9H553-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.P15291-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.Q96F25-1", "id": "N4", "name": "N-glycan_a-D-Manp_4", "parentid": "NC" }, { "attachedby": "rxn.Q9D8C3-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.Q921Q3-1", "id": "N3", "name": "N-glycan_b-D-Galp_3", "parentid": "N2" }, { "attachedby": "rxn.Q11206-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" }, { "attachedby": "rxn.Q11203-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" }, { "attachedby": "rxn.Q10469-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" }, { "attachedby": "rxn.P26572-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" }, { "attachedby": "rxn.Q9BYC5-1", "id": "N2", "name": "N-glycan_b-D-GlcpNAc_2", "parentid": "N1" } ], "glycam": "DNeup5Aca2-3DGalpb1-4DGlcpNAcb1-2DManpa1-3[DNeup5Aca2-3DGalpb1-4DGlcpNAcb1-2DManpa1-6]DManpb1-4DGlcpNAcb1-4[LFucpa1-6]DGlcpNAcb1-", "inchi": "InChI=1S/C90H148N6O66/c1-21-47(116)59(128)62(131)81(142-21)140-20-40-69(55(124)43(77(135)143-40)93-24(4)108)152-78-44(94-25(5)109)56(125)66(36(16-103)148-78)153-82-63(132)72(156-86-76(61(130)51(120)33(13-100)147-86)158-80-46(96-27(7)111)58(127)68(38(18-105)150-80)155-84-65(134)74(53(122)35(15-102)145-84)162-90(88(138)139)9-29(113)42(92-23(3)107)71(160-90)49(118)31(115)11-98)54(123)39(151-82)19-141-85-75(60(129)50(119)32(12-99)146-85)157-79-45(95-26(6)110)57(126)67(37(17-104)149-79)154-83-64(133)73(52(121)34(14-101)144-83)161-89(87(136)137)8-28(112)41(91-22(2)106)70(159-89)48(117)30(114)10-97/h21,28-86,97-105,112-135H,8-20H2,1-7H3,(H,91,106)(H,92,107)(H,93,108)(H,94,109)(H,95,110)(H,96,111)(H,136,137)(H,138,139)/t21-,28-,29-,30+,31+,32+,33+,34+,35+,36+,37+,38+,39+,40+,41+,42+,43+,44+,45+,46+,47+,48+,49+,50+,51+,52-,53-,54+,55+,56+,57+,58+,59+,60-,61-,62-,63-,64+,65+,66+,67+,68+,69+,70+,71+,72-,73-,74-,75-,76-,77+,78-,79-,80-,81+,82-,83-,84-,85-,86+,89-,90-/m0/s1", "smiles_isomeric": "C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)O)NC(=O)C)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O[C@H]4[C@H]([C@H]([C@@H]([C@H](O4)CO[C@@H]5[C@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O[C@H]7[C@@H]([C@H]([C@H]([C@H](O7)CO)O)O[C@@]8(C[C@@H]([C@H]([C@@H](O8)[C@@H]([C@@H](CO)O)O)NC(=O)C)O)C(=O)O)O)O)NC(=O)C)O)O[C@@H]9[C@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)CO)O)O[C@@]1(C[C@@H]([C@H]([C@@H](O1)[C@@H]([C@@H](CO)O)O)NC(=O)C)O)C(=O)O)O)O)NC(=O)C)O)O)NC(=O)C)O)O)O" }